| 1 |
IS 14333 (2022) |
Polyethylene Pipes for Sewerage and Industrial Chemicals and Effluent � Specification (First Revision) |
Testing facility available only for pipe of nominal dia from 63 mm upto and including 630 mm. |
14400 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 5.2.1,T2("Base Density
(At 27°C Temp.)-IS 7328:2020 ") |
- |
0 |
|
- |
| 5.2.1,T2(Melt Flow Rate (At 190°C /5kg)-IS 2530:1963) |
- |
0 |
|
- |
| 5.2.1,T2(Thermal Stability(Oxidation Induction Time)-IS 4984:2016(Annexure-B)) |
- |
0 |
|
- |
| 5.2.1,T2("Volatile Matter- IS 4984:2016
(Annexure-C)") |
- |
0 |
|
- |
| 5.2.1,T2("Water Content-IS 4984:2016
(Annexure-D)") |
- |
0 |
|
- |
| 5.2.1.1, T2(Compound Density-IS 7328:2020) |
- |
0 |
|
- |
| 5.2.1.1, T2("Compound carbon black -IS 2530:1963
content") |
- |
0 |
|
- |
| 5.2.1.1, T2(Compound Toluene extract - Any Method) |
- |
0 |
|
- |
| 5.2.1.1, T2(Compound carbon black particle size- Any Method) |
- |
0 |
|
- |
| 5.2.1.1, T2(Compound ash content - Any Method) |
- |
0 |
|
- |
| 5.2.1.1, T2("Compound carbon black -IS 2530:1963
dispersion") |
- |
0 |
|
- |
| 5.3(Density of Higher olefin - IS 7328:2020) |
- |
500 |
|
- |
| 5.3(Olefin Constituents- 14333-2022) |
- |
0 |
|
- |
| 5.3(Loading of Carbon Black - IS 2530:1963) |
- |
0 |
|
- |
| 5.3(Ash content- Any Method) |
- |
0 |
|
- |
| 5.3(Toluene extract - Any Method) |
- |
0 |
|
- |
| 5.3("Maximum volatile matter -IS 4984:2016
(Annexure-C)") |
- |
0 |
|
- |
| 5.3(Carbon black particle size - Any Method) |
- |
0 |
|
- |
| 5.4(Antioxidant - Any Method) |
- |
0 |
|
- |
| 6(Pipe Description - IS 14333-2022) |
- |
500 |
|
- |
| 6.2(Colour- IS 14333-2022) |
- |
100 |
|
- |
| 7.1(Visual Appearance- IS 14333-2022) |
- |
100 |
|
- |
| 7.2(Length- IS 14333-2022) |
- |
200 |
|
- |
| 7.3(Coiling- IS 14333-2022) |
- |
200 |
|
- |
| 7.4,T3 of IS 4984(Outside Diameter-IS 4984-2016) |
- |
200 |
|
- |
| 7.4,T4 of IS 4984(wall Thickness-IS 4984-2016) |
- |
200 |
|
- |
| 7.4,T3 of IS 4984(Ovality-IS 4984-2016) |
- |
200 |
|
- |
| 8.1.1, T4(Internal Pressure creep Rupture test, Temperature - 27 oC , Test Period - 100 hrs.-IS 4984-2016 (Annexure-E)) |
- |
1000 |
|
- |
| 8.1.1, T4(Internal Pressure creep Rupture test, Temperature - 80 oC , Test Period - 48 hrs.-IS 4984-2016 (Annexure-E)) |
- |
1000 |
|
- |
| 8.1.1, T4(Internal Pressure creep Rupture test, Temperature - 80 oC , Test Period - 165 hrs.-IS 4984-2016 (Annexure-E)) |
- |
1000 |
|
- |
| 8.1.1, T4(Internal Pressure creep Rupture test, Temperature - 80 oC , Test Period - 1000 hrs.-IS 4984-2016 (Annexure-E)) |
- |
1000 |
|
- |
| 8.1.2, T4(Internal Pressure creep Rupture test, Temperature - 80 oC , Test Period - 48 hrs.-IS 4984-2016 (Annexure-E)) |
- |
1000 |
|
- |
| 8.2("Longitudinal Reversion Test - IS 4984-2016
(Annexure-F)") |
- |
500 |
|
- |
| 8.3(Carbon black content- IS 2530-1963) |
- |
500 |
|
- |
| 8.3(Carbon black content Dispersion- IS 2530-1963) |
- |
300 |
|
- |
| 8.4(Melt Flow rate(Temperature - 190oC,Mass 5kg)-IS 2530-1963) |
- |
450 |
|
- |
| 8.5(Oxidation Induction Time -IS 4984:2016(Annexure-B)) |
- |
450 |
|
- |
| 8.6(Density-IS 7328:2020) |
- |
200 |
|
- |
| 8.7("Tensile Strength for Butt Fusion - IS 4984-2016
(Annexure-G)") |
- |
1000 |
|
- |
| 8.8,T5("Tensile - IS 4984-2016
(Annexure-H)") |
- |
1000 |
|
- |
| 8.8,T5("Elongation -IS 4984-2016
(Annexure-H)") |
- |
1000 |
|
- |
| 8.9(Slow Crack Growth Rate{Internal Pressure creep Rupture test, Temperature - 80±1 oC , Test Pressure – 0.80MPa, Test Period - 500 hrs.-IS 4984-2016 (Annexure-E &J)) |
- |
1300 |
|
- |
| 5.2.1.1, T2(Compound maximum volatile matter -IS 4984:2016 (Annexure-C)) |
- |
0 |
|
- |
| 5.3(Loading of Carbon Black - IS 2530:1963) |
- |
0 |
|
- |
| 5.2.1,T2(Melt Flow Rate (At 190°C /5kg)-IS 2530:1963) |
- |
0 |
|
- |
| 5.2.1,T2(Thermal Stability(Oxidation Induction Time)-IS 4984:2016(Annexure-B)) |
- |
0 |
|
- |
| 5.2.1,T2("Volatile Matter- IS 4984:2016
(Annexure-C)") |
- |
0 |
|
- |
| 5.2.1,T2("Water Content-IS 4984:2016
(Annexure-D)") |
- |
0 |
|
- |
| 5.2.1.1, T2(Compound Density-IS 7328:2020) |
- |
0 |
|
- |
| 5.2.1.1, T2("Compound carbon black -IS 2530:1963
content") |
- |
0 |
|
- |
| 5.2.1.1, T2(Compound Toluene extract - Any Method) |
- |
0 |
|
- |
| 5.2.1.1, T2(Compound carbon black particle size- Any Method) |
- |
0 |
|
- |
| 5.2.1.1, T2(Compound ash content - Any Method) |
- |
0 |
|
- |
| 5.2.1.1, T2("Compound carbon black -IS 2530:1963
dispersion") |
- |
0 |
|
- |
| 5.3(Density of Higher olefin - IS 7328:2020) |
- |
0 |
|
- |
| 5.3(Olefin Constituents- 14333-2022) |
- |
0 |
|
- |
| 5.3(Ash content- Any Method) |
- |
0 |
|
- |
| 5.3(Toluene extract - Any Method) |
- |
0 |
|
- |
| 5.3("Maximum volatile matter -IS 4984:2016
(Annexure-C)") |
- |
0 |
|
- |
| 5.3(Carbon black particle size - Any Method) |
- |
0 |
|
- |
| 5.4(Antioxidant - Any Method) |
- |
0 |
|
- |
| 6(Pipe Description - IS 14333-2022) |
- |
0 |
|
- |
| 6.2(Colour- IS 14333-2022) |
- |
0 |
|
- |
| 7.1(Visual Appearance- IS 14333-2022) |
- |
0 |
|
- |
| 7.2(Length- IS 14333-2022) |
- |
0 |
|
- |
| 7.3(Coiling- IS 14333-2022) |
- |
0 |
|
- |
| 7.4,T3 of IS 4984(Outside Diameter-IS 4984-2016) |
- |
0 |
|
- |
| 7.4,T4 of IS 4984(wall Thickness-IS 4984-2016) |
- |
0 |
|
- |
| 7.4,T3 of IS 4984(Ovality-IS 4984-2016) |
- |
0 |
|
- |
| 8.1.1, T4(Internal Pressure creep Rupture test, Temperature - 27 oC , Test Period - 100 hrs.-IS 4984-2016 (Annexure-E)) |
- |
0 |
|
- |
| 8.1.1, T4(Internal Pressure creep Rupture test, Temperature - 80 oC , Test Period - 48 hrs.-IS 4984-2016 (Annexure-E)) |
- |
0 |
|
- |
| 8.1.1, T4(Internal Pressure creep Rupture test, Temperature - 80 oC , Test Period - 165 hrs.-IS 4984-2016 (Annexure-E)) |
- |
0 |
|
- |
| 8.1.1, T4(Internal Pressure creep Rupture test, Temperature - 80 oC , Test Period - 1000 hrs.-IS 4984-2016 (Annexure-E)) |
- |
0 |
|
- |
| 8.1.2, T4(Internal Pressure creep Rupture test, Temperature - 80 oC , Test Period - 48 hrs.-IS 4984-2016 (Annexure-E)) |
- |
0 |
|
- |
| 8.2("Longitudinal Reversion Test - IS 4984-2016
(Annexure-F)") |
- |
0 |
|
- |
| 8.3(Carbon black content- IS 2530-1963) |
- |
0 |
|
- |
| 8.3(Carbon black content Dispersion- IS 2530-1963) |
- |
0 |
|
- |
| 8.4(Melt Flow rate(Temperature - 190oC,Mass 5kg)-IS 2530-1963) |
- |
0 |
|
- |
| 8.5(Oxidation Induction Time -IS 4984:2016(Annexure-B)) |
- |
0 |
|
- |
| 8.6(Density-IS 7328:2020) |
- |
0 |
|
- |
| 8.7("Tensile Strength for Butt Fusion - IS 4984-2016
(Annexure-G)") |
- |
0 |
|
- |
| 8.8,T5("Tensile - IS 4984-2016
(Annexure-H)") |
- |
0 |
|
- |
| 8.8,T5("Elongation -IS 4984-2016
(Annexure-H)") |
- |
0 |
|
- |
| 8.9(Slow Crack Growth Rate{Internal Pressure creep Rupture test, Temperature - 80±1 oC , Test Pressure – 0.80MPa, Test Period - 500 hrs.-IS 4984-2016 (Annexure-E &J)) |
- |
0 |
|
- |
| 5.2.1.1, T2(Compound maximum volatile matter -IS 4984:2016 (Annexure-C)) |
- |
0 |
|
- |
| 5.3(Loading of Carbon Black - IS 2530:1963) |
- |
0 |
|
- |
| 5.2.1,T2(Melt Flow Rate (At 190°C /5kg)-IS 2530:1963) |
- |
0 |
|
- |
| 5.2.1,T2(Thermal Stability(Oxidation Induction Time)-IS 4984:2016(Annexure-B)) |
- |
0 |
|
- |
| 5.2.1,T2("Volatile Matter- IS 4984:2016
(Annexure-C)") |
- |
0 |
|
- |
| 5.2.1,T2("Water Content-IS 4984:2016
(Annexure-D)") |
- |
0 |
|
- |
| 5.2.1.1, T2(Compound Density-IS 7328:2020) |
- |
0 |
|
- |
| 5.2.1.1, T2("Compound carbon black -IS 2530:1963
content") |
- |
0 |
|
- |
| 5.2.1.1, T2(Compound Toluene extract - Any Method) |
- |
0 |
|
- |
| 5.2.1.1, T2(Compound carbon black particle size- Any Method) |
- |
0 |
|
- |
| 5.2.1.1, T2(Compound ash content - Any Method) |
- |
0 |
|
- |
| 5.2.1.1, T2("Compound carbon black -IS 2530:1963
dispersion") |
- |
0 |
|
- |
| 5.3(Density of Higher olefin - IS 7328:2020) |
- |
0 |
|
- |
| 5.3(Olefin Constituents- 14333-2022) |
- |
0 |
|
- |
| 5.3(Ash content- Any Method) |
- |
0 |
|
- |
| 5.3(Toluene extract - Any Method) |
- |
0 |
|
- |
| 5.3("Maximum volatile matter -IS 4984:2016
(Annexure-C)") |
- |
0 |
|
- |
| 5.3(Carbon black particle size - Any Method) |
- |
0 |
|
- |
| 5.4(Antioxidant - Any Method) |
- |
0 |
|
- |
| 6(Pipe Description - IS 14333-2022) |
- |
0 |
|
- |
| 6.2(Colour- IS 14333-2022) |
- |
0 |
|
- |
| 7.1(Visual Appearance- IS 14333-2022) |
- |
0 |
|
- |
| 7.2(Length- IS 14333-2022) |
- |
0 |
|
- |
| 7.3(Coiling- IS 14333-2022) |
- |
0 |
|
- |
| 7.4,T3 of IS 4984(Outside Diameter-IS 4984-2016) |
- |
0 |
|
- |
| 7.4,T4 of IS 4984(wall Thickness-IS 4984-2016) |
- |
0 |
|
- |
| 7.4,T3 of IS 4984(Ovality-IS 4984-2016) |
- |
0 |
|
- |
| 8.1.1, T4(Internal Pressure creep Rupture test, Temperature - 27 oC , Test Period - 100 hrs.-IS 4984-2016 (Annexure-E)) |
- |
0 |
|
- |
| 8.1.1, T4(Internal Pressure creep Rupture test, Temperature - 80 oC , Test Period - 48 hrs.-IS 4984-2016 (Annexure-E)) |
- |
0 |
|
- |
| 8.1.1, T4(Internal Pressure creep Rupture test, Temperature - 80 oC , Test Period - 165 hrs.-IS 4984-2016 (Annexure-E)) |
- |
0 |
|
- |
| 8.1.1, T4(Internal Pressure creep Rupture test, Temperature - 80 oC , Test Period - 1000 hrs.-IS 4984-2016 (Annexure-E)) |
- |
0 |
|
- |
| 8.1.2, T4(Internal Pressure creep Rupture test, Temperature - 80 oC , Test Period - 48 hrs.-IS 4984-2016 (Annexure-E)) |
- |
0 |
|
- |
| 8.2("Longitudinal Reversion Test - IS 4984-2016
(Annexure-F)") |
- |
0 |
|
- |
| 8.3(Carbon black content- IS 2530-1963) |
- |
0 |
|
- |
| 8.3(Carbon black content Dispersion- IS 2530-1963) |
- |
0 |
|
- |
| 8.4(Melt Flow rate(Temperature - 190oC,Mass 5kg)-IS 2530-1963) |
- |
0 |
|
- |
| 8.5(Oxidation Induction Time -IS 4984:2016(Annexure-B)) |
- |
0 |
|
- |
| 8.6(Density-IS 7328:2020) |
- |
0 |
|
- |
| 8.7("Tensile Strength for Butt Fusion - IS 4984-2016
(Annexure-G)") |
- |
0 |
|
- |
| 8.8,T5("Tensile - IS 4984-2016
(Annexure-H)") |
- |
0 |
|
- |
| 8.8,T5("Elongation -IS 4984-2016
(Annexure-H)") |
- |
0 |
|
- |
| 8.9(Slow Crack Growth Rate{Internal Pressure creep Rupture test, Temperature - 80±1 oC , Test Pressure – 0.80MPa, Test Period - 500 hrs.-IS 4984-2016 (Annexure-E &J)) |
- |
0 |
|
- |
| 5.2.1.1, T2(Compound maximum volatile matter -IS 4984:2016 (Annexure-C)) |
- |
0 |
|
- |
|
09 Apr, 2028 |
-
- |
| 2 |
IS 302 : Part 2 : Sec 23 (2009) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 23 appliances for skin or hair care (First Revision) |
All Grade / Type / Size / Designation |
17900 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 32(Radiation ,Toxicity and similar hazards) |
- |
500 |
|
- |
| 31(Resistance to Rusting) |
- |
1000 |
|
- |
| 30(Resistance to Heat & Fire) |
- |
900 |
|
- |
| 29(Clearances, Creepage Distances & Solid Insulation) |
- |
500 |
|
- |
| 28(Screws & Connection) |
- |
500 |
|
- |
| 27(Provision For Earthing) |
- |
500 |
|
- |
| 26(Terminals For External Conductors) |
- |
1000 |
|
- |
| 25(Supply Connection & External Flexible Cables and Cords) |
- |
1000 |
|
- |
| 24(Component) |
- |
500 |
|
- |
| 23(Internal wiring) |
- |
1000 |
|
- |
| 22(Construction) |
- |
500 |
|
- |
| 21(Mechanical strength) |
- |
1000 |
|
- |
| 20(Stability & Mechanical Hazards) |
- |
1000 |
|
- |
| 19(Abnormal Operation) |
- |
1000 |
|
- |
| 18(Endurance) |
- |
0 |
|
- |
| 17(Overload Protection/ Overload Protection of Transformers & Associated Circuits) |
- |
500 |
|
- |
| 16(Leakage Current and Electric Strength) |
- |
500 |
|
- |
| 15(Moisture Resistance) |
- |
1000 |
|
- |
| 14(Transient Over Voltage) |
- |
500 |
|
- |
| 13(Leakage Current and Electric Strength at Operating Temperature) |
- |
500 |
|
- |
| 11(Temperature Rise/Heating) |
- |
1000 |
|
- |
| 10(Power Input
& Current) |
- |
1000 |
|
- |
| 9(Starting Of Motor Operated Appliances) |
- |
0 |
|
- |
| 8(Protection against Electric Shock/ Protection against Access to Live Parts) |
- |
500 |
|
- |
| 7(Marking/ Marking & Instructions) |
- |
500 |
|
- |
| 6(Classification) |
- |
500 |
|
- |
| 22.32(CONSTRUCTION) |
- |
500 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
|
09 Apr, 2028 |
-
- |
| 3 |
IS 302 : Part 2 : Sec 30 (2007) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 30 room heaters (First Revision) |
All Grade / Type / Size / Designation |
3200 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl.6 (Classification) |
- |
100 |
|
- |
| Cl.6 (Classification) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
100 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.3(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.3(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.3(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.4(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.5(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.6 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.8 of IS :302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.9 of IS :302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.10 of IS :302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.11 of IS :302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2009(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.13 of IS 302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.14 of IS302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.14(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.14(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.101(Marking and Instructions) |
- |
0 |
|
- |
| Cl.8 & IS:302-1:2008(Protection Against Access to Live Parts) |
- |
100 |
|
- |
| Cl.10 & IS:302-1:2008(Power Input and Current) |
- |
100 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
100 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11.8(Heating) |
- |
0 |
|
- |
| Cl.11.8(Heating) |
- |
0 |
|
- |
| Cl.11.8(Heating) |
- |
0 |
|
- |
| Cl.13 & IS:302-1:2008(Leakage Current & Electric Strength at operating temp. ) |
- |
100 |
|
- |
| Cl.13 & IS:302-1:2008(Leakage Current & Electric Strength at operating temp. ) |
- |
0 |
|
- |
| Cl.14 & IS:302-1:2008(Transient Over Voltages) |
- |
100 |
|
- |
| Cl.15 & IS: 302-1:2008(Moisture Resistance
) |
- |
300 |
|
- |
| Cl.15.3 of IS 302-1:200(Moisture Resistance
) |
- |
0 |
|
- |
| Cl.16 & IS:302-1:2008(Leakage Current & Electric Strength ) |
- |
100 |
|
- |
| Cl.16 & IS:302-1:2008(Leakage Current & Electric Strength ) |
- |
0 |
|
- |
| Cl.17 & IS:302-1:2008(Over load Protection of Transformers and Associated Circuits ) |
- |
100 |
|
- |
| Cl.18 (Endurance. ) |
- |
0 |
|
- |
| Cl.19 & IS:302-1:2008(Abnormal Operation.) |
- |
500 |
|
- |
| Cl.19 & IS:302-1:2008(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19 & IS:302-1:2008(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19 & IS:302-1:2008(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.101(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.102(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.103(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.104(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.105(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.106(Abnormal Operation.) |
- |
0 |
|
- |
| Table 8 of IS 302-1:2008(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.107(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.108(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.109(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.110(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.111(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.112(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.113(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.114(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.20 & IS:302-1:2008(Stability & Mechanical Hazards) |
- |
100 |
|
- |
| Cl.21 & IS:302-1:2008)(Mechanical Strength.) |
- |
100 |
|
- |
| Cl.21.2 of IS 302-1:2008(Mechanical Strength.) |
- |
0 |
|
- |
| Cl.21.101 (Mechanical Strength.) |
- |
0 |
|
- |
| Cl.21.102(Mechanical Strength.) |
- |
0 |
|
- |
| Cl.21.103(Mechanical Strength.) |
- |
0 |
|
- |
| Cl.22.1 of IS 302-1:2008(Construction) |
- |
200 |
|
- |
| Cl.22.5 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.6 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.7 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.8 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.9 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.11(Construction) |
- |
0 |
|
- |
| Cl.22.12 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.13 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.14 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.15 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.18 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.20 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.21 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.23 & IS:302-1:2008(Internal Wiring
) |
- |
100 |
|
- |
| Cl.23.4 & Cl.29 of 302-1:2008(Internal Wiring
) |
- |
0 |
|
- |
| Cl.23.5 of 302-1:2008(Internal Wiring
) |
- |
0 |
|
- |
| Cl.23.7 of 302-1:2008(Internal Wiring
) |
- |
0 |
|
- |
| C.23.7 of 302-1:2008(Internal Wiring
) |
- |
0 |
|
- |
| Cl.24.1 of 302-1:2008(Component) |
- |
100 |
|
- |
| Cl.24.1 of 302-1:2008(Component) |
- |
0 |
|
- |
| Cl.24.1.3 (Component) |
- |
0 |
|
- |
| Cl.24.1.3 (Component) |
- |
0 |
|
- |
| Cl.24.1.3 (Component) |
- |
0 |
|
- |
| Cl.24.1.3 (Component) |
- |
0 |
|
- |
| C.24.1.4(Component) |
- |
0 |
|
- |
| C.24.2 of 302-1:2008(Component) |
- |
0 |
|
- |
| Cl.24.10(Component) |
- |
0 |
|
- |
| Cl.25.1 of 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
100 |
|
- |
| Cl. 25.2 of IS 3021:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl. 25.3 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl. 25.4 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.5 of 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.6 of 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.7.(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.8(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl. 25.9(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.10 of 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl. 25.11(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl. 25.12(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl. 25.13(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.14 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.15 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.15 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.17 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.18(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.20(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.26.1 of IS 302-1:2008(Terminal for External Conductors
) |
- |
100 |
|
- |
| Cl.26.10 of IS 302-1:2008(Terminal for External Conductors
) |
- |
0 |
|
- |
| Cl.26.11 of IS 302-1:2008(Terminal for External Conductors
) |
- |
0 |
|
- |
| Cl.27.1 of 302-1:2008(Provision for Earthing.) |
- |
100 |
|
- |
| Cl.27.5 of 302-1:2008(Provision for Earthing.) |
- |
0 |
|
- |
| Cl.28 of 302-1:2008(Screws and Connections.) |
- |
100 |
|
- |
| Cl.29 & IS:302-1:2008(Clearances, Creepage Distances and Solid Insulation) |
- |
100 |
|
- |
| Cl.29 & IS:302-1:2008(Clearances, Creepage Distances and Solid Insulation) |
- |
0 |
|
- |
| Cl.30 & IS:302-1:2008(Resistance to Heat and Fire) |
- |
200 |
|
- |
| Cl.30.2.2 of 302-1:2008(Resistance to Heat and Fire) |
- |
0 |
|
- |
| Cl.31 & IS:302-1:2008(Resistance to Rusting.) |
- |
100 |
|
- |
| Cl.32 & IS:302-1:2008(Radition,Toxicity and similar Hazards.) |
- |
100 |
|
- |
| Cl.31 of IS:302-1:2008(Resistance to Rusting.) |
- |
0 |
|
- |
| Cl.30.2 of 302-1:2008(Resistance to Heat and Fire : Resistance to fire) |
- |
0 |
|
- |
| Cl.30.1 of IS:302-1:2008(Resistance to Heat and Fire: Resistance to heat. ) |
- |
0 |
|
- |
| Cl.29.2 of IS:302-1:2008(Clearances, Creepage Distances and Solid Insulation : Creepage Distance) |
- |
0 |
|
- |
| Cl.29.1 of IS:302-1:2008(Clearances, Creepage Distances and Solid Insulation : Clearance ) |
- |
0 |
|
- |
| Cl.28 of 302-1:2008(Screws and Connections.) |
- |
0 |
|
- |
| Cl.27.5 of 302-1:2008(Provision for Earthing : ECR) |
- |
0 |
|
- |
| Cl.27.1 of 302-1:2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.26 of IS 302-1:2008(Terminal for External Conductors
) |
- |
0 |
|
- |
| Cl.25.20 of 302-1:2008(Supply Connection and External Flexible Cords : Additional insulation ) |
- |
0 |
|
- |
| Cl.25.18 of 302-1:2008(Supply Connection and External Flexible Cords : Arrangement of cord anchorages ) |
- |
0 |
|
- |
| Cl.25.15 of IS 302-1:2008(Supply Connection and External Flexible Cords : Cord grip test - displacement) |
- |
0 |
|
- |
| Cl.25.15 of IS 302-1:2008(Supply Connection and External Flexible Cords : Cord grip test - strain at terminals ) |
- |
0 |
|
- |
| Cl. 25.13 of 302-1:2008(Supply Connection and External Flexible Cords : Inlet opening of supply cords ) |
- |
0 |
|
- |
| Cl. 25.12 of 302-1:2008(Supply Connection and External Flexible Cords : Moulding of cords ) |
- |
0 |
|
- |
| Cl.25.10 of 302-1:2008(Supply Connection and External Flexible Cords : Colour of earthing wire ) |
- |
0 |
|
- |
| Cl. 25.9 of 302-1:2008(Supply Connection and External Flexible Cords : Contact with sharp edge ) |
- |
0 |
|
- |
| Cl.25.8 of 302-1:2008(Supply Connection and External Flexible Cords : Resistance of supply wires ) |
- |
0 |
|
- |
| Cl.25.7 of IS:302-2-30:2007(Supply Connection and External Flexible Cords : Supply cords material ) |
- |
0 |
|
- |
| Cl.25.5 of 302-1:2008(Supply Connection and External Flexible Cords : Type of attachments ) |
- |
0 |
|
- |
| Cl.25.1 of 302-1:2008(Supply Connection and External Flexible Cords : Means of connection ) |
- |
0 |
|
- |
| Cl.24 of IS:302-2-30:2007(Component) |
- |
0 |
|
- |
| Cl.23.7 of 302-1:2008(Internal Wiring : Colour of earting conductor
) |
- |
0 |
|
- |
| Cl.23 of IS:302-1:2008(Internal Wiring
) |
- |
0 |
|
- |
| Cl.22.106 of IS:302-2-30:2007(Construction : Checking of thermostats, timers or similar means for visibl glowing radiant heaters) |
- |
0 |
|
- |
| Cl.22.106 of IS:302-2-30:2007(Construction : Checking of openings on the underside) |
- |
0 |
|
- |
| Cl.22.102 & Cl 22.103 of IS:302-2-30:2007(Construction : Fireguard ) |
- |
0 |
|
- |
| Cl.22.101 of IS:302-2-30:2007(Construction : Prevention to contact with heating element) |
- |
0 |
|
- |
| Cl.22.24 of IS:302-2-30:2007(Construction : test of bare heating element) |
- |
0 |
|
- |
| Cl.22.18 of IS 302-1:2008(Construction : Resistance to corrosion ) |
- |
0 |
|
- |
| Cl.22.15 of IS 302-1:2008(Construction : Storage hooks for flexible cords) |
- |
0 |
|
- |
| Cl.22.14 of IS 302-1:2008(Construction : ragged and sharp edges) |
- |
0 |
|
- |
| Cl.22.13 of IS 302-1:2008(Construction : Position of handles ) |
- |
0 |
|
- |
| Cl.22.12 of IS 302-1:2008(Construction : Fixing of Handle, knobs,grips,lever and similer parts ) |
- |
0 |
|
- |
| Cl.22.11 of IS 302-1:2008(Construction : Fixing of non detachable parts ) |
- |
0 |
|
- |
| Cl.22.7 of IS:302-2-30:2007(Construction : Pressure test of oil heater ) |
- |
0 |
|
- |
| Cl.21.101 of IS:302-2-30:2007(Mechanical Strength : fire gaurd deformation test ) |
- |
0 |
|
- |
| Cl.21.2 of IS 302-1:2008(Mechanical Strength : Pentration by sharp implementation ) |
- |
0 |
|
- |
| Cl.21.1 of IS:302-1:2008)(Mechanical Strength : Rough handling ) |
- |
0 |
|
- |
| Cl.20 of IS:302-2-30:2007(Stability of Mechanical Hazards) |
- |
0 |
|
- |
| Cl.19.114 of IS:302-2-30:2007(Abnormal Operation : the temp. of the surface of the container for oil heaters ) |
- |
0 |
|
- |
| Cl.19.112 of IS:302-2-30:2007(Abnormal Operation : Ignition of bleached cotton gauge) |
- |
0 |
|
- |
| Cl.19.111 of IS:302-2-30:2007(Abnormal Operation : Ignition of flannelette for Visibly glowing heaters) |
- |
0 |
|
- |
| Cl.19.110 of IS:302-2-30:2007(Abnormal Operation : operation against wall for visibly glowing radiant heaters ) |
- |
0 |
|
- |
| Cl.19.109 of IS:302-2-30:2007(Abnormal Operation : operation against wall for fan heater ) |
- |
0 |
|
- |
| Cl.19.106 of IS:302-2-30:2007(Abnormal Operation : Locked rotor of fan hetear ) |
- |
0 |
|
- |
| Cl.19.103 , Cl 19.104 of IS:302-2-30:2007(Abnormal Operation : Operation after Covering by cotton) |
- |
0 |
|
- |
| Cl.19 of IS:302-2-30:2007(Abnormal Operation : High Voltage ) |
- |
0 |
|
- |
| Cl.19 of IS:302-2-30:2007(Abnormal Operation : temp rise of supply cord ) |
- |
0 |
|
- |
| Cl.19 of IS:302-2-30:2007(Abnormal Operation : Temp rise of test corner ) |
- |
0 |
|
- |
| Cl.19 of IS:302-1:2008(Abnormal Operation : Emission of molten or poisonous or ignitable gas) |
- |
0 |
|
- |
| Cl.16 of IS:302-1:2008(Leakage current and Electric strength (After humidity): Electric Strentgh ) |
- |
0 |
|
- |
| Cl.16 of IS:302-1:2008(Leakage current and Electric strength (After humidity): Leakage current ) |
- |
0 |
|
- |
| Cl.15 of IS 302-1:2008(Moisture Resistance
) |
- |
0 |
|
- |
| Cl.14 of IS:302-1:2008(Transient Over Voltages) |
- |
0 |
|
- |
| Cl.13 of IS:302-1:2008(Leakage Current of Electric Strength at operating temp. ) |
- |
0 |
|
- |
| Cl.13 of IS:302-1:2008(Leakage Current of Electric Strength at operating temp. ) |
- |
0 |
|
- |
| Cl.11 of IS:302-2:30: 2007(Heating : Room temperature) |
- |
0 |
|
- |
| Cl.11.8 of IS:302-2:30: 2007(Heating : For liquid filled radiators the temp. rise of the outer surface of the liquid container) |
- |
0 |
|
- |
| Cl.11 of IS:302-2:30: 2007(Heating : Temperature rise in winding) |
- |
0 |
|
- |
| Cl.11 of IS:302-2:30: 2007(Heating : Air-outlet grills) |
- |
0 |
|
- |
| Cl.11 of IS:302-2:30: 2007(Heating : Surfaces of handles, knobs, grips and similar parts) |
- |
0 |
|
- |
| Cl.11 of IS:302-2:30: 2007(Heating : Wooden supports, walls, ceiling and floor of the test corner) |
- |
0 |
|
- |
| Cl.11 of IS:302-2:30: 2007(Heating : PVC Insulation ) |
- |
0 |
|
- |
| Cl.10 of IS:302-1:2008(Power Input and Current) |
- |
0 |
|
- |
| Cl.8 of IS:302-1:2008(Protection Against Access to Live Parts) |
- |
0 |
|
- |
| Cl.7.101 of IS:302-2:30: 2007(Marking and Instructions : standard mark. ) |
- |
0 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions : Visibility of marking concerning covering) |
- |
0 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions : discernibility from the out side ) |
- |
0 |
|
- |
| Cl.7.14 of IS:302-2:30: 2007(Marking and Instructions : Height of “Do not cover”) |
- |
0 |
|
- |
| Cl.7.14 of IS:302-2:30: 2007(Marking and Instructions : height of symbol) |
- |
0 |
|
- |
| Cl.7.14 of IS302-1:2008(Marking and Instructions : Legibility and durability ) |
- |
0 |
|
- |
| Cl.7.13 of IS 302-1:2008(Marking and Instructions : Languge of instruction and texts ) |
- |
0 |
|
- |
| Cl.7.11 of IS :302-1:2008(Marking and Instructions : Controls ) |
- |
0 |
|
- |
| Cl.7.9 of IS :302-1:2008(Marking and Instructions : switches ) |
- |
0 |
|
- |
| Cl.7.8 of IS :302-1:2008(Marking and Instructions : terminals ) |
- |
0 |
|
- |
| Cl.7.6 of IS:302-1:2008(Marking and Instructions : Symbols ) |
- |
0 |
|
- |
| Cl.7.5 of IS:302-1:2008(Marking and Instructions : upper of lower limit of the rated power input ) |
- |
0 |
|
- |
| Cl 7.1 & Cl.7.6 of IS:302-2:30: 2007(Marking and Instructions : Do not cover ) |
- |
0 |
|
- |
| Cl.7.1 of IS:302-1:2008(Marking and Instructions : Country of manufacture ) |
- |
0 |
|
- |
| Cl.7.1 of IS:302-1:2008(Marking and Instructions : Symbol for Class-II ) |
- |
0 |
|
- |
| Cl.7.1 of IS:302-1:2008(Marking and Instructions : Model or type ) |
- |
0 |
|
- |
| Cl.7.1 of IS:302-1:2008(Marking and Instructions : Name , trade-mark or identification mark of the manufacturer ) |
- |
0 |
|
- |
| Cl.7.1 of IS:302-1:2008(Marking and Instructions : rated power input ) |
- |
0 |
|
- |
| Cl.7.1 of IS:302-1:2008(Marking and Instructions : Nature of supply ) |
- |
0 |
|
- |
| Cl.7.1 of IS:302-1:2008(Marking and Instructions : Rated Voltage ) |
- |
0 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.5(Injected currents) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
|
09 Apr, 2028 |
-
- |
| 4 |
IS 302 : Part 2 : Sec 201 (2008) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 201 electric immersion water heaters (First Revision) |
All Grade / Type / Size / Designation |
6900 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl.6 of IS 302-‐2-‐201:2008(Classification) |
- |
200 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
300 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.8 of IS 302‐2-201: 2008(Protection Against Access to Live Parts) |
- |
200 |
|
- |
| Cl.10 of IS 302‐2‐201:2008(Power Input and Current ) |
- |
300 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
500 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.13 of IS 302-2-201: 2008(Leakage Current & Electric Strength at Operating Temperature) |
- |
300 |
|
- |
| Cl.14 of IS 302‐2-201:2008(Transient Over Voltages ) |
- |
200 |
|
- |
| Cl.15 of IS 302-2-201:2008(Moisture Resistance ) |
- |
500 |
|
- |
| Cl.15 of IS 302-2-201:2008(Moisture Resistance ) |
- |
0 |
|
- |
| Cl.16 of IS 302-2-201:2008(Leakage Current & Electric Strength) |
- |
300 |
|
- |
| Cl.16 of IS 302-2-201:2008(Leakage Current & Electric Strength) |
- |
0 |
|
- |
| Cl.17 of IS 302‐2-201: 2008(Overload Protection of Transformers & Associated Circuits) |
- |
200 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
500 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
0 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
0 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
0 |
|
- |
| Cl.20 of IS 302-2-201: 2008(Stability & Mechanical Hazards) |
- |
200 |
|
- |
| Cl.21 of IS 302-2-201: 2008(Mechanical Strength ) |
- |
200 |
|
- |
| Cl.21 of IS 302-2-201: 2008(Mechanical Strength ) |
- |
0 |
|
- |
| Cl.21 of IS 302-2-201: 2008(Mechanical Strength ) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-201: 2008(Construction) |
- |
300 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
300 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
200 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
200 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-201: 2008(Terminals for External Conductors) |
- |
200 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
200 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.28 of IS 302-2-201: 2008(Screws & Connections ) |
- |
200 |
|
- |
| Cl.29 of IS 302-2‐201:2008(Clearances, Creepage Distances and Solid Insulation ) |
- |
200 |
|
- |
| Cl.30 of IS 302-2‐201:2008(Resistance to Heat and Fire ) |
- |
400 |
|
- |
| Cl.31 of IS 302-2-201:2008(Resistance of Rusting ) |
- |
200 |
|
- |
| Cl.32 of IS 302-2-201:2008(Radiation, Toxicity and Similar Hazards) |
- |
200 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 4(GENERAL REQUIREMENTS) |
- |
200 |
|
- |
| 5(GENERAL CONDITIONS FOR THE TESTS) |
- |
200 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
|
09 Apr, 2028 |
-
- |
| 5 |
IS 302 : Part 2 : Sec 24 (1994) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 24 refrigerators, food - Freezers and ice - Makers |
All Grade / Type / Size / Designation |
49800 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 32(Radiation, toxicity and similar hazards) |
- |
300 |
|
- |
| 31(Resistance to rusting) |
- |
300 |
|
- |
| 30.3(Resistance to heat and fire) |
- |
300 |
|
- |
| 30.2(Resistance to heat and fire) |
- |
300 |
|
- |
| 30.1(Resistance to heat and fire) |
- |
300 |
|
- |
| 30.1(Resistance to heat and fire) |
- |
300 |
|
- |
| 29.2 & 29.3(Clearances, creepage distances ) |
- |
300 |
|
- |
| 29.1 and table 2(creepage and Clearances distances ) |
- |
300 |
|
- |
| 28.2 to 28.4(Screws and connections) |
- |
100 |
|
- |
| 28.1, Table No.-14(Screws and connections) |
- |
200 |
|
- |
| 27.5(Provision for earthing) |
- |
300 |
|
- |
| 27.1 to 27.4(Provision for earthing) |
- |
300 |
|
- |
| 26.10 & 26.13(Terminals for external conductors) |
- |
300 |
|
- |
| 26.9(Terminals for external conductors) |
- |
300 |
|
- |
| 26.1 to 26.8(Terminals for external conductors) |
- |
300 |
|
- |
| 25.7 to 25.13(Supply connection and external flexible cords) |
- |
300 |
|
- |
| 25.6(Supply connection and external flexible cords) |
- |
300 |
|
- |
| 25.4(Supply connection and external flexible cords) |
- |
300 |
|
- |
| 25.4(Supply connection and external flexible cords) |
- |
300 |
|
- |
| 25.3(Supply connection and external flexible cords) |
- |
300 |
|
- |
| 25.2(Supply connection and external flexible cords) |
- |
300 |
|
- |
| 25.1(Supply connection and external flexible cords) |
- |
300 |
|
- |
| 24.2 ,24.3,24.5 & 24.6(Components) |
- |
300 |
|
- |
| 24.1(Components) |
- |
300 |
|
- |
| 23.5 to 23.8(Internal wiring) |
- |
300 |
|
- |
| 23.4(Internal wiring) |
- |
300 |
|
- |
| 23.3(Internal wiring) |
- |
300 |
|
- |
| 23.1 & 23.2(Internal wiring) |
- |
300 |
|
- |
| 22.101 to 22.103(Constructions) |
- |
300 |
|
- |
| 22.13 to 22.33(Constructions) |
- |
300 |
|
- |
| 22.12(Constructions) |
- |
300 |
|
- |
| 22.11(Constructions) |
- |
300 |
|
- |
| 22.7 to 22.10(Constructions) |
- |
300 |
|
- |
| 22.6(Constructions) |
- |
300 |
|
- |
| 22.5(Constructions) |
- |
300 |
|
- |
| 22.4(Constructions) |
- |
300 |
|
- |
| 22.3(Constructions) |
- |
300 |
|
- |
| 22.2(Constructions) |
- |
300 |
|
- |
| 22.1(Constructions) |
- |
300 |
|
- |
| 21.2(MECHANICAL STRENGTH) |
- |
300 |
|
- |
| 21.1(MECHANICAL STRENGTH) |
- |
300 |
|
- |
| 20.2(Stability and mechanical hazards) |
- |
300 |
|
- |
| 20.1(Stability and mechanical hazards) |
- |
300 |
|
- |
| 19.103(ABNORMAL OPERATION) |
- |
300 |
|
- |
| 19.102(ABNORMAL OPERATION) |
- |
300 |
|
- |
| 19.101(ABNORMAL OPERATION) |
- |
300 |
|
- |
| 19.11(ABNORMAL OPERATION) |
- |
300 |
|
- |
| 19.9(ABNORMAL OPERATION) |
- |
300 |
|
- |
| 19.7(ABNORMAL OPERATION) |
- |
300 |
|
- |
| 19(ABNORMAL OPERATION) |
- |
300 |
|
- |
| 17(Over load Protection ) |
- |
300 |
|
- |
| 16.4(INSULATION RESISTANCE AND
ELECTRIC STRENGTH ( After the Humidity
Treatment )) |
- |
300 |
|
- |
| 16.3 & table(INSULATION RESISTANCE AND
ELECTRIC STRENGTH ( After the Humidity
Treatment )) |
- |
300 |
|
- |
| 16.2(INSULATION RESISTANCE AND
ELECTRIC STRENGTH ( After the Humidity
Treatment )) |
- |
300 |
|
- |
| 16 & 16.1(INSULATION RESISTANCE AND
ELECTRIC STRENGTH ( After the Humidity
Treatment )) |
- |
300 |
|
- |
| 15.103(Moisture resistance) |
- |
300 |
|
- |
| 15.102(Moisture resistance) |
- |
300 |
|
- |
| 15.101(Moisture resistance) |
- |
300 |
|
- |
| 15.4(Moisture resistance) |
- |
300 |
|
- |
| 15.3(Moisture resistance) |
- |
300 |
|
- |
| 15.2(Moisture resistance) |
- |
300 |
|
- |
| 15(Moisture resistance) |
- |
300 |
|
- |
| 14( RADIO AND TELEVISION
INTERFERENCE SUPPRESSION
) |
- |
300 |
|
- |
| 13(ELECTRICAL INSULATION AND
LEAKAGE CURRENT AT OPERATING
TEMPERATURE) |
- |
300 |
|
- |
| 12,12.1,12.2 & 12.3(Heating) |
- |
300 |
|
- |
| 11.103(TEMPERATURE RISE) |
- |
300 |
|
- |
| 11.102(TEMPERATURE RISE) |
- |
300 |
|
- |
| 11.101(TEMPERATURE RISE) |
- |
300 |
|
- |
| 11.1(TEMPERATURE RISE) |
- |
300 |
|
- |
| 11.8(TEMPERATURE RISE) |
- |
300 |
|
- |
| 11.7(TEMPERATURE RISE) |
- |
300 |
|
- |
| 11.6(TEMPERATURE RISE) |
- |
300 |
|
- |
| 11.5(TEMPERATURE RISE) |
- |
300 |
|
- |
| 11.4(TEMPERATURE RISE) |
- |
300 |
|
- |
| 11.2(TEMPERATURE RISE) |
- |
300 |
|
- |
| 11(TEMPERATURE RISE) |
- |
300 |
|
- |
| 10.1,10.2
10.101,10.102( Input and Current) |
- |
300 |
|
- |
| 9.2(Startability Test) |
- |
300 |
|
- |
| 9.1(Startability Test) |
- |
300 |
|
- |
| 9(Starting of motor operated Appliances) |
- |
300 |
|
- |
| 8.1.5(Protection against access to live parts) |
- |
300 |
|
- |
| 8.1.4(Protection against access to live parts) |
- |
300 |
|
- |
| 8.1.3(Protection against access to live parts) |
- |
300 |
|
- |
| 8.1.2(Protection against access to live parts) |
- |
300 |
|
- |
| 8.1, 8.1.1 & 8.2(Protection against access to live parts) |
- |
300 |
|
- |
| 7.1 , 7.12, 7.14,7.15(Marking) |
- |
300 |
|
- |
| 32(Radiation, toxicity and similar hazards) |
- |
300 |
|
- |
| 31(Resistance to rusting) |
- |
300 |
|
- |
| 30.3(Resistance to heat and fire) |
- |
300 |
|
- |
| 30.2(Resistance to heat and fire) |
- |
300 |
|
- |
| 30.1(Resistance to heat and fire) |
- |
300 |
|
- |
| 30.1(Resistance to heat and fire) |
- |
300 |
|
- |
| 29.2 & 29.3(Clearances, creepage distances ) |
- |
300 |
|
- |
| 29.1 and table 2(creepage and Clearances distances ) |
- |
300 |
|
- |
| 28.2 to 28.4(Screws and connections) |
- |
300 |
|
- |
| 28.1, Table No.-14(Screws and connections) |
- |
300 |
|
- |
| 27.5(Provision for earthing) |
- |
300 |
|
- |
| 27.1 to 27.4(Provision for earthing) |
- |
300 |
|
- |
| 26.10 & 26.13(Terminals for external conductors) |
- |
300 |
|
- |
| 26.9(Terminals for external conductors) |
- |
300 |
|
- |
| 26.1 to 26.8(Terminals for external conductors) |
- |
300 |
|
- |
| 25.7 to 25.13(Supply connection and external flexible cords) |
- |
300 |
|
- |
| 25.6(Supply connection and external flexible cords) |
- |
300 |
|
- |
| 25.4(Supply connection and external flexible cords) |
- |
300 |
|
- |
| 25.4(Supply connection and external flexible cords) |
- |
300 |
|
- |
| 25.3(Supply connection and external flexible cords) |
- |
300 |
|
- |
| 25.2(Supply connection and external flexible cords) |
- |
300 |
|
- |
| 25.1(Supply connection and external flexible cords) |
- |
300 |
|
- |
| 24.2 ,24.3,24.5 & 24.6(Components) |
- |
300 |
|
- |
| 24.1(Components) |
- |
300 |
|
- |
| 23.5 to 23.8(Internal wiring) |
- |
300 |
|
- |
| 23.4(Internal wiring) |
- |
300 |
|
- |
| 23.3(Internal wiring) |
- |
300 |
|
- |
| 23.1 & 23.2(Internal wiring) |
- |
300 |
|
- |
| 22.101 to 22.103(Constructions) |
- |
300 |
|
- |
| 22.13 to 22.33(Constructions) |
- |
300 |
|
- |
| 22.12(Constructions) |
- |
300 |
|
- |
| 22.11(Constructions) |
- |
300 |
|
- |
| 22.7 to 22.10(Constructions) |
- |
300 |
|
- |
| 22.6(Constructions) |
- |
300 |
|
- |
| 22.5(Constructions) |
- |
300 |
|
- |
| 22.4(Constructions) |
- |
300 |
|
- |
| 22.3(Constructions) |
- |
300 |
|
- |
| 22.2(Constructions) |
- |
300 |
|
- |
| 22.1(Constructions) |
- |
300 |
|
- |
| 21.2(MECHANICAL STRENGTH) |
- |
100 |
|
- |
| 21.1(MECHANICAL STRENGTH) |
- |
100 |
|
- |
| 20.2(Stability and mechanical hazards) |
- |
100 |
|
- |
| 20.1(Stability and mechanical hazards) |
- |
100 |
|
- |
| 19.103(ABNORMAL OPERATION) |
- |
300 |
|
- |
| 19.102(ABNORMAL OPERATION) |
- |
300 |
|
- |
| 19.101(ABNORMAL OPERATION) |
- |
300 |
|
- |
| 19.11(ABNORMAL OPERATION) |
- |
300 |
|
- |
| 19.9(ABNORMAL OPERATION) |
- |
300 |
|
- |
| 19.7(ABNORMAL OPERATION) |
- |
300 |
|
- |
| 19(ABNORMAL OPERATION) |
- |
300 |
|
- |
| 17(Over load Protection ) |
- |
300 |
|
- |
| 16.4(INSULATION RESISTANCE AND
ELECTRIC STRENGTH ( After the Humidity
Treatment )) |
- |
200 |
|
- |
| 16.3 & table(INSULATION RESISTANCE AND
ELECTRIC STRENGTH ( After the Humidity
Treatment )) |
- |
200 |
|
- |
| 16.2(INSULATION RESISTANCE AND
ELECTRIC STRENGTH ( After the Humidity
Treatment )) |
- |
200 |
|
- |
| 16 & 16.1(INSULATION RESISTANCE AND
ELECTRIC STRENGTH ( After the Humidity
Treatment )) |
- |
200 |
|
- |
| 15.103(Moisture resistance) |
- |
300 |
|
- |
| 15.102(Moisture resistance) |
- |
300 |
|
- |
| 15.101(Moisture resistance) |
- |
300 |
|
- |
| 15.4(Moisture resistance) |
- |
300 |
|
- |
| 15.3(Moisture resistance) |
- |
300 |
|
- |
| 15.2(Moisture resistance) |
- |
300 |
|
- |
| 15(Moisture resistance) |
- |
300 |
|
- |
| 14( RADIO AND TELEVISION
INTERFERENCE SUPPRESSION
) |
- |
100 |
|
- |
| 13(ELECTRICAL INSULATION AND
LEAKAGE CURRENT AT OPERATING
TEMPERATURE) |
- |
200 |
|
- |
| 12,12.1,12.2 & 12.3(Heating) |
- |
300 |
|
- |
| 11.103(TEMPERATURE RISE) |
- |
300 |
|
- |
| 11.102(TEMPERATURE RISE) |
- |
300 |
|
- |
| 11.101(TEMPERATURE RISE) |
- |
300 |
|
- |
| 11.1(TEMPERATURE RISE) |
- |
300 |
|
- |
| 11.8(TEMPERATURE RISE) |
- |
300 |
|
- |
| 11.7(TEMPERATURE RISE) |
- |
300 |
|
- |
| 11.6(TEMPERATURE RISE) |
- |
300 |
|
- |
| 11.5(TEMPERATURE RISE) |
- |
300 |
|
- |
| 11.4(TEMPERATURE RISE) |
- |
300 |
|
- |
| 11.2(TEMPERATURE RISE) |
- |
300 |
|
- |
| 11(TEMPERATURE RISE) |
- |
300 |
|
- |
| 10.1,10.2
10.101,10.102( Input and Current) |
- |
300 |
|
- |
| 9.2(Startability Test) |
- |
300 |
|
- |
| 9.1(Startability Test) |
- |
300 |
|
- |
| 9(Starting of motor operated Appliances) |
- |
300 |
|
- |
| 8.1.5(Protection against access to live parts) |
- |
300 |
|
- |
| 8.1.4(Protection against access to live parts) |
- |
300 |
|
- |
| 8.1.3(Protection against access to live parts) |
- |
300 |
|
- |
| 8.1.2(Protection against access to live parts) |
- |
300 |
|
- |
| 8.1, 8.1.1 & 8.2(Protection against access to live parts) |
- |
300 |
|
- |
| 7.1 , 7.12, 7.14,7.15(Marking) |
- |
100 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
| 6(Classifications) |
- |
100 |
|
- |
| 6(Classifications) |
- |
100 |
|
- |
|
09 Apr, 2028 |
-
Included w.e.f 31.12.2025
Exclusion: Cl 19.11.4.1-19.11.4.7(EMI/EMC) |
| 6 |
IS 302 : Part 2 : Sec 15 (2009) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 15 appliances for heating liquids (First Revision) |
All Grade / Type / Size / Designation |
9900 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 6.0(Classification) |
- |
300 |
|
- |
| 7(Marking and instructions) |
- |
300 |
|
- |
| 8(Protection against live parts) |
- |
250 |
|
- |
| 9(STARTING OF MOTOR-OPERATED APPLIANCES) |
- |
0 |
|
- |
| 10(POWER INPUT AND CURRENT) |
- |
400 |
|
- |
| 11(HEATING) |
- |
500 |
|
- |
| 13(LEAKAGE CURRENT AND ELECTRIC STRENGTH AT OPERATING TEMPERATURE) |
- |
500 |
|
- |
| 14(TRANSIENT OVERVOLTAGES) |
- |
400 |
|
- |
| 15(MOISTURE RESISTANCE) |
- |
500 |
|
- |
| 16(LEAKAGE CURRENT AND ELECTRIC STRENGTH) |
- |
200 |
|
- |
| 17(OVERLOAD PROTECTION OF TRANSFORMERS AND ASSOCIATED CIRCUITS) |
- |
300 |
|
- |
| 18(ENDURANCE) |
- |
0 |
|
- |
| 19(ABNORMAL OPERATION) |
- |
300 |
|
- |
| 20(STABILITY AND MECHANICAL HAZARDS) |
- |
300 |
|
- |
| 21(MECHANICAL STRENGTH) |
- |
500 |
|
- |
| 22(CONSTRUCTION) |
- |
300 |
|
- |
| 23(INTERNAL WIRING) |
- |
300 |
|
- |
| 24(COMPONENTS) |
- |
300 |
|
- |
| 25(SUPPLY CONNECTION AND EXTERNAL FLEXIBLE CORDS) |
- |
400 |
|
- |
| 26(TERMINALS FOR EXTERNAL CONDUCTORS) |
- |
450 |
|
- |
| 27(PROVISION FOR EARTHING) |
- |
300 |
|
- |
| 28(SCREWS AND CONNECTIONS) |
- |
500 |
|
- |
| 29(CLEARANCES, CREEPAGE DISTANCES AND SOLID INSULATION) |
- |
500 |
|
- |
| 30(RESISTANCE TO HEAT AND FIRE) |
- |
500 |
|
- |
| 31(RESISTANCE TO RUSTING) |
- |
500 |
|
- |
| 32(RADIATION, TOXICITY AND SIMILAR HAZARDS) |
- |
300 |
|
- |
| 22.16(Automatic cord reel) |
- |
0 |
|
- |
| 22.32(Oxygen bomb for rubber material) |
- |
0 |
|
- |
| 22.47(Water pressure inlet) |
- |
0 |
|
- |
| 22.106(Interlocks) |
- |
0 |
|
- |
| 22.3(Flexing test) |
- |
0 |
|
- |
| 24(Components) |
- |
0 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
| 4(General requirements) |
- |
400 |
|
- |
| 5(General Conditions of tests) |
- |
400 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 6(Classification- IS 302-1) |
- |
0 |
|
- |
| 6(Classification- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-2-15) |
- |
0 |
|
- |
| 7.3(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.4(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.5(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.6(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.7(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.8(Marking- IS 302-1) |
- |
0 |
|
- |
| 6(Classification- IS 302-1) |
- |
0 |
|
- |
| 6(Classification- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| Marking- IS 302-1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-2-15) |
- |
0 |
|
- |
| 7.3(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.4(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.5(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.6(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.7(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.8(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.9(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1O(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.11(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.12(Marking- IS 302-2-15) |
- |
0 |
|
- |
| 7.12(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.12.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.12.3(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.12.5(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.12.6(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.13(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.14(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.15(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.101(Marking- IS 302-2-15) |
- |
0 |
|
- |
| 8(Protection Against Electric Shock, IS 302-1) |
- |
0 |
|
- |
| 10(Power Input and Current, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 13(Electrical Insulation and Leakage Current at Operating Temperature: Leakage current, IS 302-1) |
- |
0 |
|
- |
| 13(Electrical Insulation and Leakage Current at Operating Temperature: High Voltage, IS 302-1) |
- |
0 |
|
- |
| 15.1(Moisture Resistance, IS 302-1) |
- |
0 |
|
- |
| 15.2(Spillage test as 15.2, IS 3.02-1 & 302-2-15) |
- |
0 |
|
- |
| 16(Leakage current as per Cl 16, IS 302-1) |
- |
0 |
|
- |
| 16(electric strength as per Cl 16, IS 302-1) |
- |
0 |
|
- |
| 17(Overload protection of Transformers and Associated Circuits, IS 302-1) |
- |
0 |
|
- |
| 19.13(Abnormal Operation as per Cl 19, IS 302-2-15) |
- |
0 |
|
- |
| 19.13(Abnormal Operation as per Cl 19, IS 302-1) |
- |
0 |
|
- |
| 19.13(Abnormal Operation as per Cl 19, IS 302-1) |
- |
0 |
|
- |
| 19.13(Abnormal Operation as per Cl 19, IS 302-1) |
- |
0 |
|
- |
| 20.1(Stability & Mechanical Hazards, IS 302-1) |
- |
0 |
|
- |
| 21.1(Mechanical Strength, IS 302-1) |
- |
0 |
|
- |
| 21.2(Mechanical Strength, IS 302-1) |
- |
0 |
|
- |
| 22.1(Construction, IS 302-1) |
- |
0 |
|
- |
| 22.7(Construction as per Cl 22.7, IS 3.02-2-15) |
- |
0 |
|
- |
| 22.107(Construction as per Cl 22.7, IS 3.02-2-15) |
- |
0 |
|
- |
| 22.108(Construction as per Cl 22.8, IS 3.02-2-15) |
- |
0 |
|
- |
| 23.1(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.2(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.4(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.5(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.6(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.7(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.8(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.9(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.1O(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 25.1(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.2(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.5(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.6(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.8(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.9(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.1(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.11(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.12(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.13(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.14(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.14(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.15(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.16(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.17(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.18(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.19(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.2(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.21(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.22(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 26(Terminals for External Conductors, IS 302-1) |
- |
0 |
|
- |
| 27.1(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27.2(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27.3(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27.4(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27.5(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 28(Screws & Connections, IS 302-1) |
- |
0 |
|
- |
| 29.1(Clearances, Creepage distances and Solid Insulation, IS 302-1) |
- |
0 |
|
- |
| 29.2(Clearances, Creepage distances and Solid Insulation, IS 302-1) |
- |
0 |
|
- |
| 30.1(Resistance to Heat and Fire, IS 302-1) |
- |
0 |
|
- |
| 30.2(Resistance to Heat and Fire, IS 302-1) |
- |
0 |
|
- |
| 31(Resistance of Rusting, IS 302-1) |
- |
0 |
|
- |
| Cl. 15.02(stands for cordless kettles) |
- |
0 |
|
- |
| Cl.22.103(appliance coupler of cordless kettles) |
- |
0 |
|
- |
| Cl-19.3(Abnormal operation test) |
- |
0 |
|
- |
| Cl-19.101("Abnormal operation test
") |
- |
0 |
|
- |
| Cl-19.102("Abnormal operation test
") |
- |
0 |
|
- |
| Cl-19.103("Abnormal operation test
") |
- |
0 |
|
- |
| Cl-22.103(Construction) |
- |
0 |
|
- |
| Cl-25.101(" Supply connection And external flexible ") |
- |
0 |
|
- |
|
09 Apr, 2028 |
-
Included w.e.f 31.12.2025
Exclusion: Cl 19.11.4.1-19.11.4.7(EMI/EMC) |
| 7 |
IS 302 : Part 2 : Sec 42 (2024) |
Household and Similar Electrical Appliances�Safety Part 2 Particular Requirements Section 42 Commercial electric forced convection ovens, steam cookers and steam-convection ovens |
All Grade / Type / Size / Designation |
31000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 7(Marking and instructions) |
- |
400 |
|
- |
| 8(Protection against access to live parts) |
- |
500 |
|
- |
| 10(Power input and current) |
- |
500 |
|
- |
| 11(Heating) |
- |
500 |
|
- |
| 13.1 &13.2(Leakage current test) |
- |
500 |
|
- |
| 13.1 &13.3(Electric strength test) |
- |
500 |
|
- |
| 14(Transient overvoltages) |
- |
1100 |
|
- |
| 15(Moisture resistance) |
- |
500 |
|
- |
| 15.3(Moisture resistance) |
- |
500 |
|
- |
| 15.101(Moisture resistance) |
- |
500 |
|
- |
| 16.1 &16.2(Leakage current test) |
- |
500 |
|
- |
| 16.1 & 16.3(Electric strength test) |
- |
500 |
|
- |
| 17(Overload protection of transformers and associated circuits) |
- |
500 |
|
- |
| 19.1 to 19.13, Table No. - 9(Abnormal operation) |
- |
500 |
|
- |
| 19.101(Abnormal operation) |
- |
500 |
|
- |
| 20.1(Stability and mechanical hazards) |
- |
250 |
|
- |
| 20.2(Stability and mechanical hazards) |
- |
250 |
|
- |
| 20.101(Stability and mechanical hazards) |
- |
250 |
|
- |
| 20.102(Stability and mechanical hazards) |
- |
250 |
|
- |
| 21(Mechanical strength) |
- |
500 |
|
- |
| 21.101(Mechanical strength) |
- |
500 |
|
- |
| 22(Construction) |
- |
300 |
|
- |
| 22.101(Construction) |
- |
300 |
|
- |
| 22.102(Construction) |
- |
300 |
|
- |
| 22.103(Construction) |
- |
300 |
|
- |
| 22.104(Construction) |
- |
300 |
|
- |
| 22.105(Construction) |
- |
300 |
|
- |
| 22.106(Construction) |
- |
300 |
|
- |
| 22.107(Construction) |
- |
300 |
|
- |
| 22.108(Construction) |
- |
300 |
|
- |
| 22.109(Construction) |
- |
300 |
|
- |
| 22.109(Construction) |
- |
300 |
|
- |
| 22.110(Construction) |
- |
300 |
|
- |
| 22.111(Construction) |
- |
300 |
|
- |
| 22.112(Construction) |
- |
300 |
|
- |
| 22.113(Construction) |
- |
300 |
|
- |
| 22.114(Construction) |
- |
300 |
|
- |
| 22.115(Construction) |
- |
300 |
|
- |
| 22.116(Construction) |
- |
300 |
|
- |
| 22.117(Construction) |
- |
300 |
|
- |
| 22.118(Construction) |
- |
300 |
|
- |
| 22.119(Construction) |
- |
300 |
|
- |
| 23(Internal wiring) |
- |
1000 |
|
- |
| 24(Components) |
- |
500 |
|
- |
| 25("Supply connection and
external flexible cords") |
- |
500 |
|
- |
| 26("Terminals for external
conductors") |
- |
700 |
|
- |
| 27(Provision for earthing) |
- |
1000 |
|
- |
| 28(Screws and connections) |
- |
1500 |
|
- |
| 29("Clearances, creepage
distances and solid insulation") |
- |
1500 |
|
- |
| 30(Resistance to heat and fire) |
- |
2500 |
|
- |
| 30.101(Resistance to heat and fire) |
- |
2500 |
|
- |
| 31(Resistance to rusting) |
- |
2000 |
|
- |
| 32("Radiation, toxicity and similar
hazards") |
- |
1000 |
|
- |
| 7(Marking and instructions) |
- |
0 |
|
- |
| 8(Protection against access to live parts) |
- |
0 |
|
- |
| 10(Power input and current) |
- |
0 |
|
- |
| 11(Heating) |
- |
0 |
|
- |
| 13.1 &13.2(Leakage current test) |
- |
0 |
|
- |
| 13.1 &13.3(Electric strength test) |
- |
0 |
|
- |
| 14(Transient overvoltages) |
- |
0 |
|
- |
| 15(Moisture resistance) |
- |
0 |
|
- |
| 15.3(Moisture resistance) |
- |
0 |
|
- |
| 15.101(Moisture resistance) |
- |
0 |
|
- |
| 16.1 &16.2(Leakage current test) |
- |
0 |
|
- |
| 16.1 & 16.3(Electric strength test) |
- |
0 |
|
- |
| 17(Overload protection of transformers and associated circuits) |
- |
0 |
|
- |
| 19.1 to 19.13, Table No. - 9(Abnormal operation) |
- |
0 |
|
- |
| 19.101(Abnormal operation) |
- |
0 |
|
- |
| 20.1(Stability and mechanical hazards) |
- |
0 |
|
- |
| 20.2(Stability and mechanical hazards) |
- |
0 |
|
- |
| 20.101(Stability and mechanical hazards) |
- |
0 |
|
- |
| 20.102(Stability and mechanical hazards) |
- |
0 |
|
- |
| 21(Mechanical strength) |
- |
0 |
|
- |
| 21.101(Mechanical strength) |
- |
0 |
|
- |
| 22(Construction) |
- |
0 |
|
- |
| 22.101(Construction) |
- |
0 |
|
- |
| 22.102(Construction) |
- |
0 |
|
- |
| 22.103(Construction) |
- |
0 |
|
- |
| 22.104(Construction) |
- |
0 |
|
- |
| 22.105(Construction) |
- |
0 |
|
- |
| 22.106(Construction) |
- |
0 |
|
- |
| 22.107(Construction) |
- |
0 |
|
- |
| 22.108(Construction) |
- |
0 |
|
- |
| 22.109(Construction) |
- |
0 |
|
- |
| 22.109(Construction) |
- |
0 |
|
- |
| 22.110(Construction) |
- |
0 |
|
- |
| 22.111(Construction) |
- |
0 |
|
- |
| 22.112(Construction) |
- |
0 |
|
- |
| 22.113(Construction) |
- |
0 |
|
- |
| 22.114(Construction) |
- |
0 |
|
- |
| 22.115(Construction) |
- |
0 |
|
- |
| 22.116(Construction) |
- |
0 |
|
- |
| 22.117(Construction) |
- |
0 |
|
- |
| 22.118(Construction) |
- |
0 |
|
- |
| 22.119(Construction) |
- |
0 |
|
- |
| 23(Internal wiring) |
- |
0 |
|
- |
| 24(Components) |
- |
0 |
|
- |
| 25("Supply connection and
external flexible cords") |
- |
0 |
|
- |
| 26("Terminals for external
conductors") |
- |
0 |
|
- |
| 27(Provision for earthing) |
- |
0 |
|
- |
| 28(Screws and connections) |
- |
0 |
|
- |
| 29("Clearances, creepage
distances and solid insulation") |
- |
0 |
|
- |
| 30(Resistance to heat and fire) |
- |
0 |
|
- |
| 30.101(Resistance to heat and fire) |
- |
0 |
|
- |
| 31(Resistance to rusting) |
- |
0 |
|
- |
| 32("Radiation, toxicity and similar
hazards") |
- |
0 |
|
- |
| 7(Marking and instructions) |
- |
0 |
|
- |
| 8(Protection against access to live parts) |
- |
0 |
|
- |
| 10(Power input and current) |
- |
0 |
|
- |
| 11(Heating) |
- |
0 |
|
- |
| 13.1 &13.2(Leakage current test) |
- |
0 |
|
- |
| 13.1 &13.3(Electric strength test) |
- |
0 |
|
- |
| 14(Transient overvoltages) |
- |
0 |
|
- |
| 15(Moisture resistance) |
- |
0 |
|
- |
| 15.3(Moisture resistance) |
- |
0 |
|
- |
| 15.101(Moisture resistance) |
- |
0 |
|
- |
| 16.1 &16.2(Leakage current test) |
- |
0 |
|
- |
| 16.1 & 16.3(Electric strength test) |
- |
0 |
|
- |
| 17(Overload protection of transformers and associated circuits) |
- |
0 |
|
- |
| 19.1 to 19.13, Table No. - 9(Abnormal operation) |
- |
0 |
|
- |
| 19.101(Abnormal operation) |
- |
0 |
|
- |
| 20.1(Stability and mechanical hazards) |
- |
0 |
|
- |
| 20.2(Stability and mechanical hazards) |
- |
0 |
|
- |
| 20.101(Stability and mechanical hazards) |
- |
0 |
|
- |
| 20.102(Stability and mechanical hazards) |
- |
0 |
|
- |
| 21(Mechanical strength) |
- |
0 |
|
- |
| 21.101(Mechanical strength) |
- |
0 |
|
- |
| 22(Construction) |
- |
0 |
|
- |
| 22.101(Construction) |
- |
0 |
|
- |
| 22.102(Construction) |
- |
0 |
|
- |
| 22.103(Construction) |
- |
0 |
|
- |
| 22.104(Construction) |
- |
0 |
|
- |
| 22.105(Construction) |
- |
0 |
|
- |
| 22.106(Construction) |
- |
0 |
|
- |
| 22.107(Construction) |
- |
0 |
|
- |
| 22.108(Construction) |
- |
0 |
|
- |
| 22.109(Construction) |
- |
0 |
|
- |
| 22.109(Construction) |
- |
0 |
|
- |
| 22.110(Construction) |
- |
0 |
|
- |
| 22.111(Construction) |
- |
0 |
|
- |
| 22.112(Construction) |
- |
0 |
|
- |
| 22.113(Construction) |
- |
0 |
|
- |
| 22.114(Construction) |
- |
0 |
|
- |
| 22.115(Construction) |
- |
0 |
|
- |
| 22.116(Construction) |
- |
0 |
|
- |
| 22.117(Construction) |
- |
0 |
|
- |
| 22.118(Construction) |
- |
0 |
|
- |
| 22.119(Construction) |
- |
0 |
|
- |
| 23(Internal wiring) |
- |
0 |
|
- |
| 24(Components) |
- |
0 |
|
- |
| 25("Supply connection and
external flexible cords") |
- |
0 |
|
- |
| 26("Terminals for external
conductors") |
- |
0 |
|
- |
| 27(Provision for earthing) |
- |
0 |
|
- |
| 28(Screws and connections) |
- |
0 |
|
- |
| 29("Clearances, creepage
distances and solid insulation") |
- |
0 |
|
- |
| 30(Resistance to heat and fire) |
- |
0 |
|
- |
| 30.101(Resistance to heat and fire) |
- |
0 |
|
- |
| 31(Resistance to rusting) |
- |
0 |
|
- |
| 32("Radiation, toxicity and similar
hazards") |
- |
0 |
|
- |
|
09 Apr, 2028 |
-
Included w.e.f. 19.12.2025
Exclusion: 19.1 to 19.13, Table No. - 9 (Abnormal operation) |
| 8 |
IS 302 : Part 2 : Sec 8 (2024) |
Household and Similar Electrical Appliances âSafety Part 2 Particular Requirements Section 8 Shavers, Hair Clippers and Similar Appliances (First Revision) |
All grade / Type / Size / Designation |
23400 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 7(Marking and instructions) |
- |
500 |
|
- |
| 8(Protection against access to live parts) |
- |
500 |
|
- |
| 10(Power input and current) |
- |
1000 |
|
- |
| 11(Heating) |
- |
1000 |
|
- |
| 12(Charging of metal-ion batteries) |
- |
1000 |
|
- |
| 13.1 &13.2(Leakage current test) |
- |
500 |
|
- |
| 13.1 &13.3(Electric strength test) |
- |
500 |
|
- |
| 14(Transient overvoltages) |
- |
500 |
|
- |
| 15(Moisture resistance) |
- |
1000 |
|
- |
| 15.3(Moisture resistance) |
- |
1000 |
|
- |
| 16.1 &16.2(Leakage current test) |
- |
400 |
|
- |
| 16.1 & 16.3(Electric strength test) |
- |
500 |
|
- |
| 17(Overload protection of transformers and associated circuits) |
- |
500 |
|
- |
| 19.1 to 19.13, Table No. - 9(Abnormal operation) |
- |
1000 |
|
- |
| 19.101(Abnormal operation) |
- |
500 |
|
- |
| 20.1(Stability and mechanical hazards) |
- |
500 |
|
- |
| 20.2(Stability and mechanical hazards) |
- |
500 |
|
- |
| 21(Mechanical strength) |
- |
1000 |
|
- |
| 21.101(Mechanical strength) |
- |
500 |
|
- |
| 21.102(Mechanical strength) |
- |
500 |
|
- |
| 21.103(Mechanical strength) |
- |
500 |
|
- |
| 22(Construction) |
- |
1000 |
|
- |
| 22.101(Construction) |
- |
500 |
|
- |
| 22.102(Construction) |
- |
500 |
|
- |
| 22.103(Construction) |
- |
500 |
|
- |
| 23(Internal wiring) |
- |
1000 |
|
- |
| 24(Components) |
- |
1000 |
|
- |
| 25("Supply connection and
external flexible cords") |
- |
500 |
|
- |
| 26("Terminals for external
conductors") |
- |
1000 |
|
- |
| 27(Provision for earthing) |
- |
500 |
|
- |
| 28(Screws and connections) |
- |
500 |
|
- |
| 29("Clearances, creepage
distances and solid insulation") |
- |
500 |
|
- |
| 30(Resistance to heat and fire) |
- |
1000 |
|
- |
| 31(Resistance to rusting) |
- |
500 |
|
- |
| 32("Radiation, toxicity and similar
hazards") |
- |
500 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
|
09 Apr, 2028 |
-
Included w.e.f. 19.12.2025
"19.11.4.1 (Electrostatic discharges)
19.11.4.2 (Radiated fields)
19.11.4.3 (Fast transient bursts)
19.11.4.4 (Surge immunity test)
19.11.4.5 (Immunity to conducted discharges)
19.11.4.6 (Class 3 Voltage dips and interruptions)
19.11.4.7 (Harmonics)
19.11.4.5 (Immunity to conducted discharges)
" |
| 9 |
IS 302 : Part 2 : Sec 59 (2024) |
Household and Similar Electrical Appliances â Safety Part 2 Particular Requirements Section 59 Insect Killers (First Revision) |
All grade / Type / Size / Designation etc. |
34900 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 4(General) |
- |
1000 |
|
- |
| 5(General conditions for the tests) |
- |
1000 |
|
- |
| 6(Classification) |
- |
1000 |
|
- |
| 7(Marking and instructions) |
- |
1000 |
|
- |
| 8("8 PROTECTION AGAINST ELECTRIC
SHOCK ") |
- |
1000 |
|
- |
| 10(Power input and current) |
- |
1000 |
|
- |
| 11(Heating) |
- |
1000 |
|
- |
| 11.3(Heating) |
- |
1000 |
|
- |
| 11.7(Heating) |
- |
1000 |
|
- |
| 11.8(Heating) |
- |
1000 |
|
- |
| 12(Charging of metal-ion batteries) |
- |
2000 |
|
- |
| 13(Leakage current and electric strength at operating temperature) |
- |
1000 |
|
- |
| 14(Transient overvoltages) |
- |
1000 |
|
- |
| 15(MOISTURE RESISTANCE) |
- |
3000 |
|
- |
| 16(Leakage current and electric strength) |
- |
1000 |
|
- |
| 17(Overload protection of transformers and associated circuits) |
- |
1000 |
|
- |
| 19(ABNORMAL OPERATION) |
- |
3000 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Voltage surges) |
- |
0 |
|
- |
| 19.11.4.5(Injected currents) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Mains signals) |
- |
0 |
|
- |
| 20("STABILITY AND MECHANICAL
HAZARDS") |
- |
1000 |
|
- |
| 21(MECHANICAL STRENGTH) |
- |
1000 |
|
- |
| 22(CONSTRUCTION) |
- |
1000 |
|
- |
| 23(INTERNAL WIRING) |
- |
1000 |
|
- |
| 24(COMPONENTS) |
- |
1000 |
|
- |
| 25("SUPPLY CONNECTION AND EXTERNAL
FLEXIBLE CABLES AND CORDS ") |
- |
1000 |
|
- |
| 26("TERMINALS FOR EXTERNAL
CONDUCTORS") |
- |
1000 |
|
- |
| 27(PROVISION FOR EARTHING) |
- |
1000 |
|
- |
| 28(SCREWS AND CONNECTIONS) |
- |
1000 |
|
- |
| 30("RESISTANCE TO HEAT, FIRE AND
TRACKING ") |
- |
1500 |
|
- |
| 31(RESISTANCE TO RUSTING) |
- |
1400 |
|
- |
| 32(Radiation, toxicity and similar hazards) |
- |
0 |
|
- |
| 29(Clearances, creepage distances and solid insulation) |
- |
1000 |
|
- |
| 4(General) |
- |
0 |
|
- |
| 5(General conditions for the tests) |
- |
0 |
|
- |
| 6(Classification) |
- |
0 |
|
- |
| 7(Marking and instructions) |
- |
0 |
|
- |
| 8("8 PROTECTION AGAINST ELECTRIC
SHOCK ") |
- |
0 |
|
- |
| 10(Power input and current) |
- |
0 |
|
- |
| 11(Heating) |
- |
0 |
|
- |
| 11.3(Heating) |
- |
0 |
|
- |
| 11.7(Heating) |
- |
0 |
|
- |
| 11.8(Heating) |
- |
0 |
|
- |
| 12(Charging of metal-ion batteries) |
- |
0 |
|
- |
| 13(Leakage current and electric strength at operating temperature) |
- |
0 |
|
- |
| 14(Transient overvoltages) |
- |
0 |
|
- |
| 15(MOISTURE RESISTANCE) |
- |
0 |
|
- |
| 16(Leakage current and electric strength) |
- |
0 |
|
- |
| 17(Overload protection of transformers and associated circuits) |
- |
0 |
|
- |
| 19(ABNORMAL OPERATION) |
- |
0 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Voltage surges) |
- |
0 |
|
- |
| 19.11.4.5(Injected currents) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Mains signals) |
- |
0 |
|
- |
| 20("STABILITY AND MECHANICAL
HAZARDS") |
- |
0 |
|
- |
| 21(MECHANICAL STRENGTH) |
- |
0 |
|
- |
| 22(CONSTRUCTION) |
- |
0 |
|
- |
| 23(INTERNAL WIRING) |
- |
0 |
|
- |
| 24(COMPONENTS) |
- |
0 |
|
- |
| 25("SUPPLY CONNECTION AND EXTERNAL
FLEXIBLE CABLES AND CORDS ") |
- |
0 |
|
- |
| 26("TERMINALS FOR EXTERNAL
CONDUCTORS") |
- |
0 |
|
- |
| 27(PROVISION FOR EARTHING) |
- |
0 |
|
- |
| 28(SCREWS AND CONNECTIONS) |
- |
0 |
|
- |
| 30("RESISTANCE TO HEAT, FIRE AND
TRACKING ") |
- |
0 |
|
- |
| 31(RESISTANCE TO RUSTING) |
- |
0 |
|
- |
| 32(Radiation, toxicity and similar hazards) |
- |
0 |
|
- |
| 29(Clearances, creepage distances and solid insulation) |
- |
0 |
|
- |
|
09 Apr, 2028 |
-
- |
| 10 |
IS 302 : Part 2 : Sec 13 (2024) |
Household and Similar Electrical Appliances âSafety Part 2 Particular Requirements Section 13 Deep Fat Fryers, Frying Pans and Similar Appliances (First Revision) |
All grade / Type / Size / Designation |
19900 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 7(Marking and instructions) |
- |
700 |
|
- |
| 8(Protection against access to live parts) |
- |
700 |
|
- |
| 10(Power input and current) |
- |
1000 |
|
- |
| 11(Heating) |
- |
1000 |
|
- |
| 13.1 &13.2(Leakage current test) |
- |
500 |
|
- |
| 13.1 &13.3(Electric strength test) |
- |
500 |
|
- |
| 14(Transient overvoltages) |
- |
500 |
|
- |
| 15(Moisture resistance) |
- |
500 |
|
- |
| 15.3(Moisture resistance) |
- |
500 |
|
- |
| 15.101(Moisture resistance) |
- |
500 |
|
- |
| 16.1 &16.2(Leakage current test) |
- |
500 |
|
- |
| 16.1 & 16.3(Electric strength test) |
- |
500 |
|
- |
| 17(Overload protection of transformers and associated circuits) |
- |
500 |
|
- |
| 19.1 to 19.13, Table No. - 9(Abnormal operation) |
- |
1000 |
|
- |
| 19.101 to to 19.102(Abnormal operation) |
- |
1000 |
|
- |
| 20(Stability and mechanical hazards) |
- |
500 |
|
- |
| 21(Mechanical strength) |
- |
500 |
|
- |
| 22(Construction) |
- |
500 |
|
- |
| 22.101(Construction) |
- |
1000 |
|
- |
| 23(Internal wiring) |
- |
1000 |
|
- |
| 24(Components) |
- |
1000 |
|
- |
| 25("Supply connection and
external flexible cords") |
- |
1000 |
|
- |
| 26("Terminals for external
conductors") |
- |
1000 |
|
- |
| 27(Provision for earthing) |
- |
500 |
|
- |
| 28(Screws and connections) |
- |
500 |
|
- |
| 29("Clearances, creepage
distances and solid insulation") |
- |
500 |
|
- |
| 30(Resistance to heat and fire) |
- |
1000 |
|
- |
| 31(Resistance to rusting) |
- |
500 |
|
- |
| 32("Radiation, toxicity and similar
hazards") |
- |
500 |
|
- |
| Cl.19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| Cl.19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| Cl.19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| Cl.19.11.4.4(Voltage surges) |
- |
0 |
|
- |
| Cl.19.11.4.5(Injected currents) |
- |
0 |
|
- |
| Cl.19.11.4.6(Class 3 voltage dips and interruptions) |
- |
0 |
|
- |
| Cl.19.11.4.7(mains signals) |
- |
0 |
|
- |
|
09 Apr, 2028 |
-
Included w.e.f 31.12.2025
Exclusion: Cl 19.11.4.1-19.11.4.7(EMI/EMC) |
| 11 |
IS 302 : Part 2 : Sec 25 (2014) |
Safety of household and similar electrical appliances: Part 2 Particular requirements: Section 25 Microwave ovens |
All grade / Type / Size / Designation |
29500 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 6.0(Classification) |
- |
1000 |
|
- |
| 7(Marking and instructions) |
- |
1000 |
|
- |
| 8(Protection against live parts) |
- |
1000 |
|
- |
| 9(STARTING OF MOTOR-OPERATED APPLIANCES) |
- |
0 |
|
- |
| 10(POWER INPUT AND CURRENT) |
- |
1000 |
|
- |
| 11(HEATING) |
- |
1500 |
|
- |
| 13(LEAKAGE CURRENT AND ELECTRIC STRENGTH AT OPERATING TEMPERATURE) |
- |
1000 |
|
- |
| 14(IMPULSE VOLTAGE TEST) |
- |
1000 |
|
- |
| 15(HUMIDITY TREATMENT TEST) |
- |
1000 |
|
- |
| 16(LEAKAGE CURRENT AND ELECTRIC STRENGTH) |
- |
1000 |
|
- |
| 17(OVERLOAD PROTECTION OF TRANSFORMERS AND ASSOCIATED CIRCUITS) |
- |
1000 |
|
- |
| 18(ENDURANCE) |
- |
2000 |
|
- |
| 19(ABNORMAL OPERATION) |
- |
1500 |
|
- |
| 20(STABILITY AND MECHANICAL HAZARDS) |
- |
1000 |
|
- |
| 21(MECHANICAL STRENGTH) |
- |
1000 |
|
- |
| 22(CONSTRUCTION) |
- |
1000 |
|
- |
| 23(INTERNAL WIRING) |
- |
1000 |
|
- |
| 24(COMPONENTS) |
- |
1000 |
|
- |
| 25(SUPPLY CONNECTION AND EXTERNAL FLEXIBLE CORDS) |
- |
1000 |
|
- |
| 26(TERMINALS FOR EXTERNAL CONDUCTORS) |
- |
1000 |
|
- |
| 27(PROVISION FOR EARTHING) |
- |
1000 |
|
- |
| 28(SCREWS AND CONNECTIONS) |
- |
1000 |
|
- |
| 29(CLEARANCES, CREEPAGE DISTANCES AND SOLID INSULATION) |
- |
1000 |
|
- |
| 30(RESISTANCE TO HEAT AND FIRE) |
- |
1500 |
|
- |
| 31(RESISTANCE TO RUSTING) |
- |
1000 |
|
- |
| 32(RADIATION, TOXICITY AND SIMILAR HAZARDS) |
- |
1000 |
|
- |
| 22.32(Oxygen bomb for rubber material) |
- |
2000 |
|
- |
| 22.46(Software) |
- |
0 |
|
- |
| Cl-19.11.4.1(Electrostatic discharge) |
- |
0 |
|
- |
| Cl-19.11.4.2(Radiated Fields) |
- |
0 |
|
- |
| Cl-19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| Cl-19.11.4.4(Surge Immunity test) |
- |
0 |
|
- |
| Cl-19.11.4.5(Immunity to conducted discharge) |
- |
0 |
|
- |
| Cl-19.11.4.6(Voltage dips and interruptions) |
- |
0 |
|
- |
| Cl-19.11.4.7(Harmonics) |
- |
0 |
|
- |
| 6.0(Classification) |
- |
0 |
|
- |
| 7(Marking and instructions) |
- |
0 |
|
- |
| 8(Protection against live parts) |
- |
0 |
|
- |
| 9(STARTING OF MOTOR-OPERATED APPLIANCES) |
- |
0 |
|
- |
| 10(POWER INPUT AND CURRENT) |
- |
0 |
|
- |
| 11(HEATING) |
- |
0 |
|
- |
| 13(LEAKAGE CURRENT AND ELECTRIC STRENGTH AT OPERATING TEMPERATURE) |
- |
0 |
|
- |
| 14(IMPULSE VOLTAGE TEST) |
- |
0 |
|
- |
| 15(HUMIDITY TREATMENT TEST) |
- |
0 |
|
- |
| 16(LEAKAGE CURRENT AND ELECTRIC STRENGTH) |
- |
0 |
|
- |
| 17(OVERLOAD PROTECTION OF TRANSFORMERS AND ASSOCIATED CIRCUITS) |
- |
0 |
|
- |
| 18(ENDURANCE) |
- |
0 |
|
- |
| 19(ABNORMAL OPERATION) |
- |
0 |
|
- |
| 20(STABILITY AND MECHANICAL HAZARDS) |
- |
0 |
|
- |
| 21(MECHANICAL STRENGTH) |
- |
0 |
|
- |
| 22(CONSTRUCTION) |
- |
0 |
|
- |
| 23(INTERNAL WIRING) |
- |
0 |
|
- |
| 24(COMPONENTS) |
- |
0 |
|
- |
| 25(SUPPLY CONNECTION AND EXTERNAL FLEXIBLE CORDS) |
- |
0 |
|
- |
| 26(TERMINALS FOR EXTERNAL CONDUCTORS) |
- |
0 |
|
- |
| 27(PROVISION FOR EARTHING) |
- |
0 |
|
- |
| 28(SCREWS AND CONNECTIONS) |
- |
0 |
|
- |
| 29(CLEARANCES, CREEPAGE DISTANCES AND SOLID INSULATION) |
- |
0 |
|
- |
| 30(RESISTANCE TO HEAT AND FIRE) |
- |
0 |
|
- |
| 31(RESISTANCE TO RUSTING) |
- |
0 |
|
- |
| 32(RADIATION, TOXICITY AND SIMILAR HAZARDS) |
- |
0 |
|
- |
| 22.32(Oxygen bomb for rubber material) |
- |
0 |
|
- |
| 22.46(Software) |
- |
0 |
|
- |
| Cl-19.11.4.1(Electrostatic discharge) |
- |
0 |
|
- |
| Cl-19.11.4.2(Radiated Fields) |
- |
0 |
|
- |
| Cl-19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| Cl-19.11.4.4(Surge Immunity test) |
- |
0 |
|
- |
| Cl-19.11.4.5(Immunity to conducted discharge) |
- |
0 |
|
- |
| Cl-19.11.4.6(Voltage dips and interruptions) |
- |
0 |
|
- |
| Cl-19.11.4.7(Harmonics) |
- |
0 |
|
- |
|
09 Apr, 2028 |
-
- |
| 12 |
IS 302 : Part 2 : Sec 14 (2009) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 14 electric kitchen machines (First Revision) |
All Grade / Type / Size / Designation |
8400 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 6(Classification- IS 302-1 ) |
- |
100 |
|
- |
| 6(Classification- IS 302-1) |
- |
100 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
100 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
100 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
100 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
100 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
100 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
100 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
100 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
100 |
|
- |
| 7.3(Marking- IS 302-1) |
- |
100 |
|
- |
| 7.4(Marking- IS 302-1) |
- |
100 |
|
- |
| 7.6(Marking- IS 302-1) |
- |
100 |
|
- |
| 7.7(Marking- IS 302-1) |
- |
100 |
|
- |
| 7.8(Marking- IS 302-1) |
- |
100 |
|
- |
| 7.11(Marking- IS 302-1) |
- |
100 |
|
- |
| 7.12(Marking- IS 302-1) |
- |
100 |
|
- |
| 7.13(Marking- IS 302-1) |
- |
100 |
|
- |
| 7.14(Marking- IS 302-1) |
- |
100 |
|
- |
| 7.15(Marking- IS 302-1) |
- |
100 |
|
- |
| 7.101(Marking) |
- |
100 |
|
- |
| 8( Protection Against Electric Shock, IS 302-1) |
- |
100 |
|
- |
| 10(Power Input and Current, IS 302-1) |
- |
100 |
|
- |
| 11(Heating, IS 302-1) |
- |
1000 |
|
- |
| 11(Heating, IS 302-1) |
- |
1000 |
|
- |
| 11(Heating, IS 302-1) |
- |
1000 |
|
- |
| 11(Heating, IS 302-1) |
- |
1000 |
|
- |
| 11(Heating, IS 302-1) |
- |
1000 |
|
- |
| 13(Electrical Insulation and Leakage Current at Operating Temperature: Leakage current, IS 302-1) |
- |
300 |
|
- |
| 13(Electrical Insulation and Leakage Current at Operating Temperature: High Voltage, IS 302-1) |
- |
300 |
|
- |
| 14(Transient Over Voltages, IS 302-1) |
- |
400 |
|
- |
| 15.1(Moisture Resistance, IS 302-1) |
- |
1000 |
|
- |
| 15.2(Moisture Resistance, IS 302-1) |
- |
1000 |
|
- |
| 15(Moisture Resistance, IS 302-1) |
- |
1000 |
|
- |
| 16(Electrical Insulation and Leakage Current at Operating Temperature: Leakage current, IS 302-1) |
- |
300 |
|
- |
| 16(Electrical Insulation and Leakage Current at Operating Temperature: High Voltage, IS 302-1) |
- |
300 |
|
- |
| 17(Overload protection of Transformers and Associated Circuits, IS 302-1) |
- |
300 |
|
- |
| 17(Overload protection of Transformers and Associated Circuits, IS 302-1) |
- |
300 |
|
- |
| 19.7(Abnormal Operation, IS 302-1) |
- |
500 |
|
- |
| 19.8(Abnormal Operation, IS 302-1) |
- |
500 |
|
- |
| 19.9(Abnormal Operation, IS 302-1) |
- |
500 |
|
- |
| 19.1(Abnormal Operation, IS 302-1) |
- |
500 |
|
- |
| 19.101(Abnormal Operation) |
- |
500 |
|
- |
| 19.102(Abnormal Operation) |
- |
500 |
|
- |
| 20.1(Stability & Mechanical Hazards, IS 302-1) |
- |
500 |
|
- |
| 20.2(Stability & Mechanical Hazards, IS 302-1) |
- |
500 |
|
- |
| 20.101(Stability & Mechanical Hazards) |
- |
500 |
|
- |
| 20.102(Stability & Mechanical Hazards) |
- |
500 |
|
- |
| 20.103(Stability & Mechanical Hazards) |
- |
500 |
|
- |
| 20.104(Stability & Mechanical Hazards) |
- |
500 |
|
- |
| 20.105(Stability & Mechanical Hazards) |
- |
500 |
|
- |
| 20.106(Stability & Mechanical Hazards) |
- |
500 |
|
- |
| 20.107(Stability & Mechanical Hazards) |
- |
500 |
|
- |
| 20.108(Stability & Mechanical Hazards) |
- |
500 |
|
- |
| 20.109(Stability & Mechanical Hazards) |
- |
500 |
|
- |
| 20.110(Stability & Mechanical Hazards) |
- |
500 |
|
- |
| 20.111(Stability & Mechanical Hazards) |
- |
500 |
|
- |
| 20.112(Stability & Mechanical Hazards) |
- |
500 |
|
- |
| 20.113(Stability & Mechanical Hazards) |
- |
500 |
|
- |
| 20.114(Stability & Mechanical Hazards) |
- |
500 |
|
- |
| 20.115(Stability & Mechanical Hazards) |
- |
500 |
|
- |
| 20.116(Stability & Mechanical Hazards) |
- |
500 |
|
- |
| 21.1(Mechanical Strength, IS 302-1) |
- |
200 |
|
- |
| 21.2(Mechanical Strength, IS 302-1) |
- |
200 |
|
- |
| 22(Construction, IS 302-1) |
- |
200 |
|
- |
| 22.101(Construction) |
- |
200 |
|
- |
| 22.102(Construction) |
- |
200 |
|
- |
| 23.1(Internal Wiring, IS 302-1) |
- |
500 |
|
- |
| 23.2(Internal Wiring, IS 302-1) |
- |
500 |
|
- |
| 23.3(Internal Wiring, IS 302-1) |
- |
500 |
|
- |
| 23.4(Internal Wiring, IS 302-1) |
- |
500 |
|
- |
| 23.5(Internal Wiring, IS 302-1) |
- |
500 |
|
- |
| 23.6(Internal Wiring, IS 302-1) |
- |
500 |
|
- |
| 23.7(Internal Wiring, IS 302-1) |
- |
500 |
|
- |
| 23.8(Internal Wiring, IS 302-1) |
- |
500 |
|
- |
| 23.9(Internal Wiring, IS 302-1) |
- |
500 |
|
- |
| 23.10(Internal Wiring, IS 302-1) |
- |
500 |
|
- |
| 24.1(Components, IS 302-1) |
- |
500 |
|
- |
| 24.2(Components, IS 302-1) |
- |
500 |
|
- |
| 24.5(Components, IS 302-1) |
- |
500 |
|
- |
| 24.6(Components, IS 302-1) |
- |
500 |
|
- |
| 25.1(Supply Connection and External Flexible Cords, IS 302-1) |
- |
300 |
|
- |
| 25.5(Supply Connection and External Flexible Cords, IS 302-1) |
- |
300 |
|
- |
| 25.6(Supply Connection and External Flexible Cords, IS 302-1) |
- |
300 |
|
- |
| 25.7(Supply Connection and External Flexible Cords, IS 302-1) |
- |
300 |
|
- |
| 25.8(Supply Connection and External Flexible Cords, IS 302-1) |
- |
300 |
|
- |
| 26.9(Supply Connection and External Flexible Cords, IS 302-1) |
- |
200 |
|
- |
| 25.1(Supply Connection and External Flexible Cords, IS 302-1) |
- |
300 |
|
- |
| 25.11(Supply Connection and External Flexible Cords, IS 302-1) |
- |
300 |
|
- |
| 25.12(Supply Connection and External Flexible Cords, IS 302-1) |
- |
300 |
|
- |
| 25.13(Supply Connection and External Flexible Cords, IS 302-1) |
- |
300 |
|
- |
| 25.14(Supply Connection and External Flexible Cords, IS 302-1) |
- |
300 |
|
- |
| 25.14(Supply Connection and External Flexible Cords, IS 302-1) |
- |
300 |
|
- |
| 25.15(Supply Connection and External Flexible Cords, IS 302-1) |
- |
300 |
|
- |
| 25.16(Supply Connection and External Flexible Cords, IS 302-1) |
- |
300 |
|
- |
| 25.17(Supply Connection and External Flexible Cords, IS 302-1) |
- |
300 |
|
- |
| 25.18(Supply Connection and External Flexible Cords, IS 302-1) |
- |
300 |
|
- |
| 25.19(Supply Connection and External Flexible Cords, IS 302-1) |
- |
300 |
|
- |
| 25.2(Supply Connection and External Flexible Cords, IS 302-1) |
- |
300 |
|
- |
| 25.21(Supply Connection and External Flexible Cords, IS 302-1) |
- |
300 |
|
- |
| 25.22(Supply Connection and External Flexible Cords, IS 302-1) |
- |
300 |
|
- |
| 26(Terminals for External Conductors, IS 302-1) |
- |
200 |
|
- |
| 27(Provision for Earthing, IS 302-1) |
- |
200 |
|
- |
| 27.2(Provision for Earthing, IS 302-1) |
- |
200 |
|
- |
| 27.3(Provision for Earthing, IS 302-1) |
- |
200 |
|
- |
| 27.4(Provision for Earthing, IS 302-1) |
- |
200 |
|
- |
| 27.5(Provision for Earthing, IS 302-1) |
- |
200 |
|
- |
| 28(Screws & Connections, IS 302-1) |
- |
100 |
|
- |
| 29.1(Clearances, Creepage distances and Solid Insulation, IS 302-1) |
- |
100 |
|
- |
| 29.2(Clearances, Creepage distances and Solid Insulation, IS 302-1) |
- |
100 |
|
- |
| 30.1(Resistance to Heat and Fire, IS 302-1) |
- |
1000 |
|
- |
| 30.2(Resistance to Heat and Fire, IS 302-1) |
- |
1000 |
|
- |
| 31(Resistance of Rusting, IS 302-1) |
- |
100 |
|
- |
| 32(Radiation, Toxicity and similar Hazard IS 302-1) |
- |
100 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 4(GENERAL REQUIREMENTS) |
- |
100 |
|
- |
| 5(GENERAL CONDITIONS FOR THE TESTS) |
- |
100 |
|
- |
| 27(Provision for Earthing) |
- |
200 |
|
- |
| 29(Clearances, Creepage distances and Solid Insulation) |
- |
100 |
|
- |
|
09 Apr, 2028 |
-
Included w.e.f. 19.12.2025
"19.11.4.1 (Electrostatic discharges)
19.11.4.2 (Radiated fields)
19.11.4.3 (Fast transient bursts)
19.11.4.4 (Surge immunity test)
19.11.4.5 (Immunity to conducted discharges)
19.11.4.6 (Class 3 Voltage dips and interruptions)
19.11.4.7 (Harmonics)
19.11.4.5 (Immunity to conducted discharges)
" |
| 13 |
IS 302 : Part 2 : Sec 80 (2017) |
Household and similar electrical appliances - Safety: Part 2 - 80 particular requirements for fans (First Revision) |
All Grade / Type / Size / Designation |
9500 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 32.0(Radiation, Toxicity and Similar Hazards) |
- |
0 |
|
- |
| 31.0(Resistance To Rusting) |
- |
200 |
|
- |
| 30.0(Resistance To Heat and Fire) |
- |
200 |
|
- |
| 29.0(Creepage Distances and Clearances) |
- |
200 |
|
- |
| 28.0(Screws and Connections) |
- |
300 |
|
- |
| 27.0(Provision For Earthing) |
- |
500 |
|
- |
| 26.0(Terminals for external conductors) |
- |
500 |
|
- |
| 25.0(Supply Connection and External Flexible Cords) |
- |
500 |
|
- |
| 24.0(Components) |
- |
500 |
|
- |
| 23.0(Internal Wiring) |
- |
500 |
|
- |
| 22.0(Construction) |
- |
500 |
|
- |
| 20.0(Stability and mechanical hazards) |
- |
500 |
|
- |
| 19.0(Abnormal Operation) |
- |
1000 |
|
- |
| 17.0(Overload Protection of transformer and associated circuit) |
- |
500 |
|
- |
| 16.0(Leakage current and Electric strength (After Humidity (Environmental) Treatment)) |
- |
500 |
|
- |
| 15.0(Moisture resistance) |
- |
500 |
|
- |
| 14.0(Transient Overvoltage) |
- |
500 |
|
- |
| 13.0(Leakage Current and electric strength at operating temperature) |
- |
500 |
|
- |
| 11.0(Heating) |
- |
700 |
|
- |
| 10.0(Input and Current) |
- |
200 |
|
- |
| 8.0(Protection against access to live parts) |
- |
200 |
|
- |
| 7.0(Classification) |
- |
0 |
|
- |
| 6.0(Marking and Instructions) |
- |
0 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
| 4(GENERAL REQUIREMENT) |
- |
0 |
|
- |
| 5(GENERAL CONDITIONS FOR THE TESTS) |
- |
0 |
|
- |
| 21.0(Mechanical Strength) |
- |
0 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
| 4(GENERAL REQUIREMENT) |
- |
0 |
|
- |
| 5(GENERAL CONDITIONS FOR THE TESTS) |
- |
0 |
|
- |
|
09 Apr, 2028 |
-
Included w.e.f. 19.12.2025
"19.11.4.1 (Electrostatic discharges)
19.11.4.2 (Radiated fields)
19.11.4.3 (Fast transient bursts)
19.11.4.4 (Surge immunity test)
19.11.4.5 (Immunity to conducted discharges)
19.11.4.6 (Class 3 Voltage dips and interruptions)
" |
| 14 |
IS 13592 (2013) |
Unplasticized Polyvinyl Chloride (PVC-U) Pipes for Soil and Waste Discharge System Inside and Outside Buiildings Including Ventilation and Rainwater System |
All Grade / Type / Size / Designation |
12800 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl.5(Surface colour of the pipes shall be dark shade of grey) |
- |
100 |
|
- |
| Cl6.3(The composition shall be based on PVC resin
having a K-value of 64 or greater when tested in
accordance with IS 4669) |
- |
1000 |
|
- |
| Cl.7.1(Mean out side Diameter (For less than or equal to 40 mm- Average of 8 , For higher diameters up to 110 mm average of 6)) |
- |
100 |
|
- |
| Cl.7.1(Outside Diameter at any point (Take 8 reading reported minimum, maximum)) |
- |
100 |
|
- |
| Cl.7.1(Wall thickness "minimum,maximum" (Take 8 reading)) |
- |
100 |
|
- |
| Cl.7.2(Pipes shall be supplied in nominal lengths of 2, 3, 4 or
6 metres either plain or with socket for solvent
cementing/grooved socket. Tolerances on specified
length shall be + 10 mm and – 0 mm.The nominal length of the pipe with socket for solvent
cementing/grooved socket shall be as given in Fig. 1.) |
- |
100 |
|
- |
| Cl.7.3.1(Minimum wall thickness of socket on pipes shall
be as given in Table 2 read with Fig. 2 and Fig. 3.) |
- |
100 |
|
- |
| Cl.7.3.2(Dimensions of sockets for solvent cementing and
grooved sockets of pipes shall be as given in Tables 3
and 4 respectively, read with Fig. 2 and 3.) |
- |
100 |
|
- |
| Cl.8.1(The internal and external surface of the pipes shall be
smooth and clean, and free from grooving and other
defects. The end shall be clearly cut and shall be square
with the axis of the pipe. The end may be chamfered
on the plain side.) |
- |
100 |
|
- |
| Cl.8.2(When tested by the method described in IS 12235
(Part 5), a length of pipe sample of 200 ± 20 mm shall
not alter in length by more than 5 percent. In the case
of socket ended pipes, this test shall be carried out on
the plain portion of pipe taken at least 100 mm away
from the root of the socket.) |
- |
1000 |
|
- |
| Cl.8.4(When determined in accordance with IS 12235 (Part 2),
the vicat softening temperature of the specimen shall
not be less than 79°C.) |
- |
1000 |
|
- |
| Cl.8.5(After the required
period of exposure, the tensile strengths of two samples when tested as per IS 12235 (Part 13) shall not show
difference of more than 20 percent of their initial tensile
strengths) |
- |
1000 |
|
- |
| Cl. 9, IS 12235 Part 7(Resistance to Sulphuric Acid) |
- |
1500 |
|
- |
| Cl.10.1(When tested by method prescribed in IS 12235 (Part 9),the pipe shall have a true impact rate of not more than
10 percent. Mass of striker and height of fall shall be
as per Annex A.) |
- |
700 |
|
- |
| Cl.10.2(When determined in accordance with the method
described in IS 12235 (Part 13), the tensile strength at
break shall not be less than 45 MPa.) |
- |
1000 |
|
- |
| Cl.10.3(The axial shrinkage shall not exceed 2 percent when
determined in accordance with Annex B.) |
- |
1000 |
|
- |
| Cl.11.(Jointing of solvent
cementing joints is to be carried out using solvent
conforming to IS 14182.
Apply a pressure of 0.05 MPa for a period of 15 min
and there should be no leakage at any joint.) |
- |
1000 |
|
- |
| Cl. 12, IS 12235 Part 11(Resistance to Di-Chloro-Methane) |
- |
1000 |
|
- |
| 8.6(Effect on Water Test) |
- |
1500 |
|
- |
| 14(Marking) |
- |
100 |
|
- |
| Cl 8.6(Effect on Water Lead (first extraction)) |
- |
1500 |
|
- |
| Cl 8.6(Effect on Water Lead (first extraction)) |
- |
1500 |
|
- |
| Cl 8.6(Effect on Water Lead (third extraction)) |
- |
1500 |
|
- |
| Cl 8.6(Effect on Water Dialkyl tin C4 and higher homologues(measuredas tin )(third extraction )) |
- |
1500 |
|
- |
| Cl 8.6(Effect on Water Cadmium (mean of first extraction, second extraction and third extraction)) |
- |
1500 |
|
- |
| Cl 8.6(Effect on Water Mercury (mean of first extraction, second extraction and third extraction)) |
- |
1500 |
|
- |
| CL 7.3(Socket length (Take 4 reading & minimum will be reported)) |
- |
100 |
|
- |
| CL 7.3.1(Socket wall Thickness For S2 and S3 (Take 4 reading and average will be reported)) |
- |
100 |
|
- |
| CL 7.3.2 grooved sockets(Inside diameter of Sockets, D1 (Take 4 reading & minimum, Maximum will be reported)) |
- |
100 |
|
- |
| CL 7.3.2 grooved sockets(Inside diameter of beading D2 (Take 4 reading & minimum, Maximum will be reported)) |
- |
100 |
|
- |
| CL 7.3.2 grooved sockets(Length of beading and Neck A (Take 4 reading & Maximum will be reported)) |
- |
100 |
|
- |
| CL 7.3.2 grooved sockets(Neck of Socket B (Take 4 reading & minimum, will be reported)) |
- |
100 |
|
- |
| CL 7.3.2 grooved sockets(Length beyond beading C (Take 4 reading & minimum will be reported)) |
- |
100 |
|
- |
| Cl8.3(This test shall be carried out for socket end pipes only.
When tested by the method described in IS 12235
(Part 6), the test specimens shall not show blisters,
excessive delamination or cracking or signs of weld
line splitting.) |
- |
1000 |
|
- |
| Cl.5(Surface colour of the pipes shall be dark shade of grey) |
- |
0 |
|
- |
| Cl6.3(The composition shall be based on PVC resin
having a K-value of 64 or greater when tested in
accordance with IS 4669) |
- |
0 |
|
- |
| Cl.7.1(Mean out side Diameter (For less than or equal to 40 mm- Average of 8 , For higher diameters up to 110 mm average of 6)) |
- |
0 |
|
- |
| Cl.7.1(Outside Diameter at any point (Take 8 reading reported minimum, maximum)) |
- |
0 |
|
- |
| Cl.7.1(Wall thickness "minimum,maximum" (Take 8 reading)) |
- |
0 |
|
- |
| Cl.7.2(Pipes shall be supplied in nominal lengths of 2, 3, 4 or
6 metres either plain or with socket for solvent
cementing/grooved socket. Tolerances on specified
length shall be + 10 mm and – 0 mm.The nominal length of the pipe with socket for solvent
cementing/grooved socket shall be as given in Fig. 1.) |
- |
0 |
|
- |
| Cl.7.3.1(Minimum wall thickness of socket on pipes shall
be as given in Table 2 read with Fig. 2 and Fig. 3.) |
- |
0 |
|
- |
| Cl.7.3.2(Dimensions of sockets for solvent cementing and
grooved sockets of pipes shall be as given in Tables 3
and 4 respectively, read with Fig. 2 and 3.) |
- |
0 |
|
- |
| Cl.8.1(The internal and external surface of the pipes shall be
smooth and clean, and free from grooving and other
defects. The end shall be clearly cut and shall be square
with the axis of the pipe. The end may be chamfered
on the plain side.) |
- |
0 |
|
- |
| Cl.8.2(When tested by the method described in IS 12235
(Part 5), a length of pipe sample of 200 ± 20 mm shall
not alter in length by more than 5 percent. In the case
of socket ended pipes, this test shall be carried out on
the plain portion of pipe taken at least 100 mm away
from the root of the socket.) |
- |
0 |
|
- |
| Cl.8.4(When determined in accordance with IS 12235 (Part 2),
the vicat softening temperature of the specimen shall
not be less than 79°C.) |
- |
0 |
|
- |
| Cl.8.5(After the required
period of exposure, the tensile strengths of two samples when tested as per IS 12235 (Part 13) shall not show
difference of more than 20 percent of their initial tensile
strengths) |
- |
0 |
|
- |
| Cl. 9, IS 12235 Part 7(Resistance to Sulphuric Acid) |
- |
0 |
|
- |
| Cl.10.1(When tested by method prescribed in IS 12235 (Part 9),the pipe shall have a true impact rate of not more than
10 percent. Mass of striker and height of fall shall be
as per Annex A.) |
- |
0 |
|
- |
| Cl.10.2(When determined in accordance with the method
described in IS 12235 (Part 13), the tensile strength at
break shall not be less than 45 MPa.) |
- |
0 |
|
- |
| Cl.10.3(The axial shrinkage shall not exceed 2 percent when
determined in accordance with Annex B.) |
- |
0 |
|
- |
| Cl.11.(Jointing of solvent
cementing joints is to be carried out using solvent
conforming to IS 14182.
Apply a pressure of 0.05 MPa for a period of 15 min
and there should be no leakage at any joint.) |
- |
0 |
|
- |
| Cl. 12, IS 12235 Part 11(Resistance to Di-Chloro-Methane) |
- |
0 |
|
- |
| 8.6(Effect on Water Test) |
- |
0 |
|
- |
| 14(Marking) |
- |
0 |
|
- |
| Cl 8.6(Effect on Water Lead (first extraction)) |
- |
0 |
|
- |
| Cl 8.6(Effect on Water Lead (first extraction)) |
- |
0 |
|
- |
| Cl 8.6(Effect on Water Lead (third extraction)) |
- |
0 |
|
- |
| Cl 8.6(Effect on Water Dialkyl tin C4 and higher homologues(measuredas tin )(third extraction )) |
- |
0 |
|
- |
| Cl 8.6(Effect on Water Cadmium (mean of first extraction, second extraction and third extraction)) |
- |
0 |
|
- |
| Cl 8.6(Effect on Water Mercury (mean of first extraction, second extraction and third extraction)) |
- |
0 |
|
- |
| CL 7.3(Socket length (Take 4 reading & minimum will be reported)) |
- |
0 |
|
- |
| CL 7.3.1(Socket wall Thickness For S2 and S3 (Take 4 reading and average will be reported)) |
- |
0 |
|
- |
| CL 7.3.2 grooved sockets(Inside diameter of Sockets, D1 (Take 4 reading & minimum, Maximum will be reported)) |
- |
0 |
|
- |
| CL 7.3.2 grooved sockets(Inside diameter of beading D2 (Take 4 reading & minimum, Maximum will be reported)) |
- |
0 |
|
- |
| CL 7.3.2 grooved sockets(Length of beading and Neck A (Take 4 reading & Maximum will be reported)) |
- |
0 |
|
- |
| CL 7.3.2 grooved sockets(Neck of Socket B (Take 4 reading & minimum, will be reported)) |
- |
0 |
|
- |
| CL 7.3.2 grooved sockets(Length beyond beading C (Take 4 reading & minimum will be reported)) |
- |
0 |
|
- |
| Cl8.3(This test shall be carried out for socket end pipes only.
When tested by the method described in IS 12235
(Part 6), the test specimens shall not show blisters,
excessive delamination or cracking or signs of weld
line splitting.) |
- |
0 |
|
- |
| Cl.5(Surface colour of the pipes shall be dark shade of grey) |
- |
0 |
|
- |
| Cl6.3(The composition shall be based on PVC resin
having a K-value of 64 or greater when tested in
accordance with IS 4669) |
- |
0 |
|
- |
| Cl.7.1(Mean out side Diameter (For less than or equal to 40 mm- Average of 8 , For higher diameters up to 110 mm average of 6)) |
- |
0 |
|
- |
| Cl.7.1(Outside Diameter at any point (Take 8 reading reported minimum, maximum)) |
- |
0 |
|
- |
| Cl.7.1(Wall thickness "minimum,maximum" (Take 8 reading)) |
- |
0 |
|
- |
| Cl.7.2(Pipes shall be supplied in nominal lengths of 2, 3, 4 or
6 metres either plain or with socket for solvent
cementing/grooved socket. Tolerances on specified
length shall be + 10 mm and – 0 mm.The nominal length of the pipe with socket for solvent
cementing/grooved socket shall be as given in Fig. 1.) |
- |
0 |
|
- |
| Cl.7.3.1(Minimum wall thickness of socket on pipes shall
be as given in Table 2 read with Fig. 2 and Fig. 3.) |
- |
0 |
|
- |
| Cl.7.3.2(Dimensions of sockets for solvent cementing and
grooved sockets of pipes shall be as given in Tables 3
and 4 respectively, read with Fig. 2 and 3.) |
- |
0 |
|
- |
| Cl.8.1(The internal and external surface of the pipes shall be
smooth and clean, and free from grooving and other
defects. The end shall be clearly cut and shall be square
with the axis of the pipe. The end may be chamfered
on the plain side.) |
- |
0 |
|
- |
| Cl.8.2(When tested by the method described in IS 12235
(Part 5), a length of pipe sample of 200 ± 20 mm shall
not alter in length by more than 5 percent. In the case
of socket ended pipes, this test shall be carried out on
the plain portion of pipe taken at least 100 mm away
from the root of the socket.) |
- |
0 |
|
- |
| Cl.8.4(When determined in accordance with IS 12235 (Part 2),
the vicat softening temperature of the specimen shall
not be less than 79°C.) |
- |
0 |
|
- |
| Cl.8.5(After the required
period of exposure, the tensile strengths of two samples when tested as per IS 12235 (Part 13) shall not show
difference of more than 20 percent of their initial tensile
strengths) |
- |
0 |
|
- |
| Cl. 9, IS 12235 Part 7(Resistance to Sulphuric Acid) |
- |
0 |
|
- |
| Cl.10.1(When tested by method prescribed in IS 12235 (Part 9),the pipe shall have a true impact rate of not more than
10 percent. Mass of striker and height of fall shall be
as per Annex A.) |
- |
0 |
|
- |
| Cl.10.2(When determined in accordance with the method
described in IS 12235 (Part 13), the tensile strength at
break shall not be less than 45 MPa.) |
- |
0 |
|
- |
| Cl.10.3(The axial shrinkage shall not exceed 2 percent when
determined in accordance with Annex B.) |
- |
0 |
|
- |
| Cl.11.(Jointing of solvent
cementing joints is to be carried out using solvent
conforming to IS 14182.
Apply a pressure of 0.05 MPa for a period of 15 min
and there should be no leakage at any joint.) |
- |
0 |
|
- |
| Cl. 12, IS 12235 Part 11(Resistance to Di-Chloro-Methane) |
- |
0 |
|
- |
| 8.6(Effect on Water Test) |
- |
0 |
|
- |
| 14(Marking) |
- |
0 |
|
- |
| Cl 8.6(Effect on Water Lead (first extraction)) |
- |
0 |
|
- |
| Cl 8.6(Effect on Water Lead (first extraction)) |
- |
0 |
|
- |
| Cl 8.6(Effect on Water Lead (third extraction)) |
- |
0 |
|
- |
| Cl 8.6(Effect on Water Dialkyl tin C4 and higher homologues(measuredas tin )(third extraction )) |
- |
0 |
|
- |
| Cl 8.6(Effect on Water Cadmium (mean of first extraction, second extraction and third extraction)) |
- |
0 |
|
- |
| Cl 8.6(Effect on Water Mercury (mean of first extraction, second extraction and third extraction)) |
- |
0 |
|
- |
| CL 7.3(Socket length (Take 4 reading & minimum will be reported)) |
- |
0 |
|
- |
| CL 7.3.1(Socket wall Thickness For S2 and S3 (Take 4 reading and average will be reported)) |
- |
0 |
|
- |
| CL 7.3.2 grooved sockets(Inside diameter of Sockets, D1 (Take 4 reading & minimum, Maximum will be reported)) |
- |
0 |
|
- |
| CL 7.3.2 grooved sockets(Inside diameter of beading D2 (Take 4 reading & minimum, Maximum will be reported)) |
- |
0 |
|
- |
| CL 7.3.2 grooved sockets(Length of beading and Neck A (Take 4 reading & Maximum will be reported)) |
- |
0 |
|
- |
| CL 7.3.2 grooved sockets(Neck of Socket B (Take 4 reading & minimum, will be reported)) |
- |
0 |
|
- |
| CL 7.3.2 grooved sockets(Length beyond beading C (Take 4 reading & minimum will be reported)) |
- |
0 |
|
- |
| Cl8.3(This test shall be carried out for socket end pipes only.
When tested by the method described in IS 12235
(Part 6), the test specimens shall not show blisters,
excessive delamination or cracking or signs of weld
line splitting.) |
- |
0 |
|
- |
|
09 Apr, 2028 |
-
Included w.e.f 31.12.2025 |
| 15 |
IS 302 : Part 1 (2008) |
Safety of household and similar electrical appliances: Part 1 general requirements (Sixth Revision) |
- |
50000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 7(Marking and instructions) |
- |
300 |
|
- |
| 8.1.1(Protection against live parts in all positions) |
- |
1000 |
|
- |
| 8.1.2(Protection against live parts in openings) |
- |
1000 |
|
- |
| 8.1.3(Protection against live parts in visible glowing heating elements) |
- |
1000 |
|
- |
| 8.1.4(Protection against live parts against protective impedance) |
- |
1000 |
|
- |
| 9(Starting of motor operation test requirements and tests) |
- |
1000 |
|
- |
| 10.1(Power input) |
- |
1000 |
|
- |
| 10.2(Current input) |
- |
1000 |
|
- |
| 11.1(General) |
- |
300 |
|
- |
| 11.2(General) |
- |
1000 |
|
- |
| 11.3(Heating) |
- |
300 |
|
- |
| 13.1(General) |
- |
300 |
|
- |
| 13.2(Leakage current at operating temperature) |
- |
1500 |
|
- |
| 13.3(Electric Strength at operating temperature) |
- |
1500 |
|
- |
| 14(Transient Over Voltages) |
- |
1500 |
|
- |
| 15.0(General) |
- |
300 |
|
- |
| 15.1(Ingress Protection test other than IPX0 (IP test)) |
- |
2500 |
|
- |
| 15.2(Spillage Test) |
- |
1000 |
|
- |
| 15.3(Humidity Test) |
- |
1500 |
|
- |
| 16.0(General) |
- |
500 |
|
- |
| 16.1(General) |
- |
500 |
|
- |
| 16.2(Leakage Current (after Clause 15)) |
- |
1000 |
|
- |
| 16.3(Electric Strength (after clause 15 and 16.2)) |
- |
1500 |
|
- |
| 17(Over Load Protection of Transformers and associated circuits) |
- |
2000 |
|
- |
| 18(Endurance Test requirements and tests) |
- |
1500 |
|
- |
| 19(Abnormal Operation) |
- |
1500 |
|
- |
| 20(Stability test) |
- |
1500 |
|
- |
| 21(Mechanical Strength Test) |
- |
1500 |
|
- |
| 22(Construction verification related test) |
- |
1500 |
|
- |
| 23(General) |
- |
300 |
|
- |
| 24(Components) |
- |
2000 |
|
- |
| 25(Supply connection and external flexible cords) |
- |
2000 |
|
- |
| 26(Terminals for external conductors) |
- |
2000 |
|
- |
| 27(Provision for earthing) |
- |
2500 |
|
- |
| 28(Screw test and connections) |
- |
2500 |
|
- |
| 29(clearance, creepage distances and solid insulation) |
- |
1000 |
|
- |
| 30.1(Ball pressure test) |
- |
1000 |
|
- |
| 30.2(Glow Wire Test) |
- |
1000 |
|
- |
| 30.2(Needle Flame Test) |
- |
1500 |
|
- |
| 31(Resistance to Rusting) |
- |
1000 |
|
- |
| 32(Radiation Toxicity and Similar Hazards) |
- |
1000 |
|
- |
| 4(General requirement) |
- |
300 |
|
- |
| 16(Leakage current and electric strength) |
- |
1000 |
|
- |
| 17(Overload protection of transformers and associated circuits) |
- |
2000 |
|
- |
| 18(Endurance) |
- |
0 |
|
- |
| 8.1.5(Live parts of built-in appliances) |
- |
1000 |
|
- |
| 11.4(Heating appliances) |
- |
300 |
|
- |
| 11.5(Motor-operated appliances) |
- |
300 |
|
- |
| 11.6(Combined appliances) |
- |
300 |
|
- |
| 11.7(Duration corresponding) |
- |
300 |
|
- |
| 11.8(Temperature rise) |
- |
300 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
| 4(General Requirement) |
- |
300 |
|
- |
| 5(General conditions for tests) |
- |
300 |
|
- |
| 6(Classification- IS 302-1) |
- |
300 |
|
- |
|
09 Apr, 2028 |
-
Included w.e.f. 30.10.2025
Exclusion: 19.11.4.1 (Electrostatic discharges)
19.11.4.2 (Radiated fields)
19.11.4.3 (Fast transient bursts)
19.11.4.4 (Surge immunity test)
19.11.4.5 (Immunity to conducted discharges)
19.11.4.6 (Class 3 Voltage dips and interruptions)
19.11.4.7 (Harmonics)
"(1)Cooking ranges, hobs, ovens and similar appliances, (2)Commercial Dispensing Appliances and Vending Machines, (3) spin extractors
(For testing charges please refer relevant part 2 standard in LIMS)" |
| 16 |
IS 302 : Part 2 : Sec 6 (2009) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 6 cooking ranges, hobs, ovens and similar appliances (First Revision) |
All Grade / Type / Size / Designation |
13900 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 6.0(Classification) |
- |
50 |
|
- |
| 7.0(Marking and instructions) |
- |
50 |
|
- |
| 8.0(Protection against access to live part test) |
- |
250 |
|
- |
| 9.0(Starting of motor-operated appliances test) |
- |
0 |
|
- |
| 10.0(Power Input and current test) |
- |
500 |
|
- |
| 11.0(Heating test) |
- |
500 |
|
- |
| 13.0(Leakage current and electric strength test) |
- |
500 |
|
- |
| 14.0(Transient voltages) |
- |
500 |
|
- |
| 15.0(Moisture Resistance) |
- |
500 |
|
- |
| 16.0(Leakage current and electric strength test) |
- |
500 |
|
- |
| 17.0(Overload protection of transformers test) |
- |
100 |
|
- |
| 18.0(Endurance test) |
- |
250 |
|
- |
| 19.0(Abnormal Operations) |
- |
500 |
|
- |
| 20.0(Stability and Mechanical Hazards) |
- |
300 |
|
- |
| 21.0(Mechanical Strength) |
- |
200 |
|
- |
| 22.0(Construction verification related tests) |
- |
450 |
|
- |
| 23.0(Internal wiring) |
- |
250 |
|
- |
| 24.0(Components) |
- |
100 |
|
- |
| 25.0(Supply connections and External Flexible Cords) |
- |
250 |
|
- |
| 26.0(Terminal for External Conductors) |
- |
150 |
|
- |
| 27.0(Provision for Earthing) |
- |
250 |
|
- |
| 28.0(Screws and connections) |
- |
250 |
|
- |
| 29.0(Clearances and Creepage distances and solid insulation) |
- |
350 |
|
- |
| 30.0(Resistance to heat and fire) |
- |
100 |
|
- |
| 31.0(Resistance to rusting) |
- |
100 |
|
- |
| 32.0(Radiation, Toxicity and Similar hazards) |
- |
250 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
| 4(General Requirements) |
- |
10 |
|
- |
| 5(General condition for the tests) |
- |
200 |
|
- |
| 22.111(Pyrolytic self-cleaning) |
- |
1000 |
|
- |
| 6.0(Classification) |
- |
0 |
|
- |
| 7.0(Marking and instructions) |
- |
0 |
|
- |
| 8.0(Protection against access to live part test) |
- |
0 |
|
- |
| 9.0(Starting of motor-operated appliances test) |
- |
0 |
|
- |
| 10.0(Power Input and current test) |
- |
0 |
|
- |
| 11.0(Heating test) |
- |
0 |
|
- |
| 13.0(Leakage current and electric strength test) |
- |
0 |
|
- |
| 14.0(Transient voltages) |
- |
0 |
|
- |
| 15.0(Moisture Resistance) |
- |
0 |
|
- |
| 16.0(Leakage current and electric strength test) |
- |
0 |
|
- |
| 17.0(Overload protection of transformers test) |
- |
0 |
|
- |
| 18.0(Endurance test) |
- |
0 |
|
- |
| 19.0(Abnormal Operations) |
- |
0 |
|
- |
| 20.0(Stability and Mechanical Hazards) |
- |
0 |
|
- |
| 21.0(Mechanical Strength) |
- |
0 |
|
- |
| 22.0(Construction verification related tests) |
- |
0 |
|
- |
| 23.0(Internal wiring) |
- |
0 |
|
- |
| 24.0(Components) |
- |
0 |
|
- |
| 25.0(Supply connections and External Flexible Cords) |
- |
0 |
|
- |
| 26.0(Terminal for External Conductors) |
- |
0 |
|
- |
| 27.0(Provision for Earthing) |
- |
0 |
|
- |
| 28.0(Screws and connections) |
- |
0 |
|
- |
| 29.0(Clearances and Creepage distances and solid insulation) |
- |
0 |
|
- |
| 30.0(Resistance to heat and fire) |
- |
0 |
|
- |
| 31.0(Resistance to rusting) |
- |
0 |
|
- |
| 32.0(Radiation, Toxicity and Similar hazards) |
- |
0 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
| 4(General Requirements) |
- |
0 |
|
- |
| 5(General condition for the tests) |
- |
0 |
|
- |
| 22.111(Pyrolytic self-cleaning) |
- |
0 |
|
- |
|
09 Apr, 2028 |
-
Included w.e.f. 31.10.2025
Exclusion: 19.11.4.1 (Electrostatic discharges)
19.11.4.2 (Radiated fields)
19.11.4.3 (Fast transient bursts)
19.11.4.4 (Surge immunity test)
19.11.4.5 (Immunity to conducted discharges)
19.11.4.6 (Class 3 Voltage dips and interruptions)
19.11.4.7 (Harmonics)
9.0 (Starting of motor-operated appliances test) |
| 17 |
IS 14625 (2015) |
Plastics Feeding Bottles ( First Revision ) |
All Grade / Type / Size / Designation etc. |
10400 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl 5.1(Physical Requirements) |
- |
200 |
|
- |
| Cl 5.1.3(Wall Thickness) |
- |
200 |
|
- |
| Cl 5.1.4(Capacity) |
- |
200 |
|
- |
| Cl 5.3.2(Transparecy) |
- |
200 |
|
- |
| Cl 5.3.3(Leakage Test) |
- |
200 |
|
- |
| Cl 5.3.4(Drop Test) |
- |
200 |
|
- |
| Cl 5.3.5(Ageing Resistance) |
- |
200 |
|
- |
| Cl 5.3.6(Compressive Deformation Resistance) |
- |
200 |
|
- |
| Cl 5.3.7(Product Resistance of Printed Containers) |
- |
200 |
|
- |
| Cl 5.1.3(Wall Thickness) |
- |
200 |
|
- |
| Cl 5.1.4(Capacity) |
- |
200 |
|
- |
| Cl 5.3.2(Transparecy) |
- |
200 |
|
- |
| Cl 5.3.3(Leakage Test) |
- |
200 |
|
- |
| Cl 5.3.4(Drop Test) |
- |
200 |
|
- |
| Cl 5.3.6(Compressive Deformation Resistance) |
- |
200 |
|
- |
| Cl 5.3.7(Product Resistance of Printed Containers) |
- |
200 |
|
- |
| Cl 5.1(Physical Requirements) |
- |
200 |
|
- |
| Cl 5.1.3(Wall Thickness) |
- |
200 |
|
- |
| Cl 5.1.4(Capacity) |
- |
200 |
|
- |
| Cl 5.3.2(Transparecy) |
- |
200 |
|
- |
| Cl 5.3.3(Leakage Test) |
- |
200 |
|
- |
| Cl 5.3.4(Drop Test) |
- |
200 |
|
- |
| Cl 5.3.5(Ageing Resistance) |
- |
200 |
|
- |
| Cl 5.3.6(Compressive Deformation Resistance) |
- |
200 |
|
- |
| Cl 5.3.7(Product Resistance of Printed Containers) |
- |
200 |
|
- |
| Sl. No. i), Table 1, Cl.5.2.1.7(Migration of certain elements - Antimony) |
- |
500 |
|
- |
| Sl. No. i), Table 1, Cl.5.2.1.7(Migration of certain elements - Arsenic) |
- |
500 |
|
- |
| Sl. No. i), Table 1, Cl.5.2.1.7(Migration of certain elements - Chromium) |
- |
500 |
|
- |
| Sl. No. i), Table 1, Cl.5.2.1.7(Migration of certain elements - Mercury) |
- |
500 |
|
- |
| Sl. No. i), Table 1, Cl.5.2.1.7(Migration of certain elements - Cadmium) |
- |
500 |
|
- |
| Sl. No. i), Table 1, Cl.5.2.1.7(Migration of certain elements - Lead) |
- |
500 |
|
- |
| Sl. No. i), Table 1, Cl.5.2.1.7(Migration of certain elements - Barium) |
- |
500 |
|
- |
| Sl. No. i), Table 1, Cl.5.2.1.7(Migration of certain elements - Selenium) |
- |
500 |
|
- |
| Cl 5.1.4.2 (a)(Test for permanency of Pigment) |
- |
500 |
|
- |
| 5.3.8 a)(Migration Test a) Distilled water at 40±2° hrs) |
- |
200 |
|
- |
| 5.3.8 b)(Migration Test b) n-Haptane at 38±1° C for 30 min) |
- |
200 |
|
- |
| 4.1(Material Identification, Bisphenol A,) |
- |
400 |
|
- |
| 4.2(Rubber Teats for Feeding bottle shall conform to IS 3565 (Workmanship and Finish, Acetone Extract, Free sulphur in Acetone Extract, Change in Physical property, Properties of Water Extract, pH of the Water Extract, Tension Set )) |
- |
0 |
|
- |
| 5.1.1(Description, Design, shape & dimensions) |
- |
400 |
|
- |
| 5.1.2(Manufacture, workmanship finish & appearance) |
- |
200 |
|
- |
| 5.3.1(Environmental Stress Crack Resistance,) |
- |
200 |
|
- |
| Clause 5.3.1(Environmental Stress crack resistance) |
- |
200 |
|
- |
| Clause 5.1.4.2(Capacity Scale) |
- |
200 |
|
- |
| Clause 5.1.2.2(Workmanship.Finish and Appearance) |
- |
200 |
|
- |
| Clause 5.1.1 (Description) |
- |
200 |
|
- |
| Clause 4.2 (Teats) |
- |
0 |
|
- |
| Cl 5.3.7(Product Resistance of Printed Containers) |
- |
200 |
|
- |
| Cl 5.3.6(Compressive Deformation Resistance) |
- |
200 |
|
- |
| Cl 5.3.5(Ageing Resistance) |
- |
200 |
|
- |
| Cl 5.3.4(Drop Test) |
- |
200 |
|
- |
| Cl 5.3.3(Leakage Test) |
- |
200 |
|
- |
| Cl 5.3.2(Transparecy) |
- |
200 |
|
- |
| Cl 5.1.4(Capacity) |
- |
200 |
|
- |
| Cl 5.1.3(Wall Thickness at Top, Middle & Bottom ( Take every position 4 measurment and average will be reported)) |
- |
200 |
|
- |
| Cl 5.1(Physical Requirements) |
- |
200 |
|
- |
| "IS 14625:2015 RA2020 Sub-clause 4.0 "(Material Identification) |
- |
200 |
|
- |
| Cl 5.1(Physical Requirements) |
- |
200 |
|
- |
| Cl 5.1.3(Wall Thickness) |
- |
200 |
|
- |
| Cl 5.1.4(Capacity) |
- |
200 |
|
- |
| Cl 5.3.2(Transparecy) |
- |
200 |
|
- |
| Cl 5.3.3(Leakage Test) |
- |
200 |
|
- |
| Cl 5.3.4(Drop Test) |
- |
200 |
|
- |
| Cl 5.3.5(Ageing Resistance) |
- |
200 |
|
- |
| Cl 5.3.6(Compressive Deformation Resistance) |
- |
200 |
|
- |
| Cl 5.3.7(Product Resistance of Printed Containers) |
- |
200 |
|
- |
| "IS 14625:2015 RA2020 Sub-clause 4.0 "(Material Identification) |
- |
200 |
|
- |
| Cl.5.2.1.7, Table-1(i)(Migration of certain elements, Reqiurement as per table 1, Arsenic) |
- |
500 |
|
- |
| Cl.5.2.1.7, Table-1(ii)(Migration of certain elements, Reqiurement as per table 1, Chromium) |
- |
500 |
|
- |
| Cl.5.2.1.7, Table-1(iii)(Migration of certain elements, Reqiurement as per table 1, Mercury) |
- |
500 |
|
- |
| Cl.5.2.1.7, Table-1(iv)(Migration of certain elements, Reqiurement as per table 1, Cadmium) |
- |
500 |
|
- |
| Cl.5.2.1.7, Table-1(v)(Migration of certain elements, Reqiurement as per table 1, Lead) |
- |
500 |
|
- |
| Cl.5.2.1.7, Table-1(vi)(Migration of certain elements, Reqiurement as per table 1, Barium) |
- |
500 |
|
- |
| Cl.5.2.1.7, Table-1(vii)(Migration of certain elements, Reqiurement as per table 1, Selenium) |
- |
500 |
|
- |
| Cl.5.3.8(Migration test a)Distilled water) |
- |
500 |
|
- |
| Cl.5.3.8(Migration test a)n-Heptane) |
- |
500 |
|
- |
| Cl.5.3.9.2, Table-3(i)(Specific migration , Barium) |
- |
500 |
|
- |
| Cl.5.3.9.2, Table-3(ii)(Specific migration , Cobalt) |
- |
500 |
|
- |
| Cl.5.3.9.2, Table-3(iii)(Specific migration , Copper) |
- |
500 |
|
- |
| Cl.5.3.9.2, Table-3(iv)(Specific migration , Iron) |
- |
500 |
|
- |
| Cl.5.3.9.2, Table-3(v)(Specific migration , Lithium) |
- |
500 |
|
- |
| Cl.5.3.9.2, Table-3(vi)(Specific migration , Manganese) |
- |
500 |
|
- |
| Cl.5.3.9.2, Table-3(vii)(Specific migration , Zinc) |
- |
500 |
|
- |
| Cl.5.3.9.2, Table-3(viii)(Specific migration , Antimony) |
- |
500 |
|
- |
| Clauses 5.3.9.2 and 5.3.9.3,Table 3, S.no.(ix)(Phthalic acid, bis(2-ethylhexyl)ester (DEHP)-ISO 18856) |
- |
500 |
|
- |
| Clause 5.2.1.7, S.No.(i)(Heavy metal,Antimony) |
- |
500 |
|
- |
| Clause 5.2.1.7, S.No.(ii)(Heavy metal,Arsenic) |
- |
500 |
|
- |
| Clause 5.2.1.7, S.No.(iii)(Heavy metal,Chromium) |
- |
500 |
|
- |
| Clause 5.2.1.7, S.No.(iv)(Heavy metal,Mercury) |
- |
500 |
|
- |
| Clause 5.2.1.7, S.No.(v)(Heavy metal,Cadmium) |
- |
500 |
|
- |
| Clause 5.2.1.7, S.No.(vi)(Heavy metal,Lead) |
- |
500 |
|
- |
| Clause 5.2.1.7, S.No.(vii)(Heavy metal,Barium) |
- |
500 |
|
- |
| Clause 5.2.1.7, S.No.(viii)(Heavy metal,Selenium) |
- |
500 |
|
- |
| Cl-5.2.1.2.2(pH meter) |
- |
200 |
|
- |
| Cl-5.2.1.2.3(Membrane filter) |
- |
200 |
|
- |
| Cl-5.2.1.2.4(Centrifuge) |
- |
200 |
|
- |
| Cl-5.2.1.3(Reagents) |
- |
200 |
|
- |
| Cl-5.2.1.3.1(Hydrochloric acid solution) |
- |
200 |
|
- |
| Cl-5.2.1.3.2(Hydrochloric acid solution) |
- |
200 |
|
- |
| Cl-7(Packing and Marking) |
- |
200 |
|
- |
| Cl 5.3.5(Ageing Resistance) |
- |
200 |
|
- |
|
09 Apr, 2028 |
-
Included w.e.f. 19.12.2025
Excluding Material Cl.4 |
| 18 |
IS 5168 (2018) |
Glass feeding bottles - Specification (First Revision) |
All Grade / Type / Size / Designation |
22400 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl 4(Types) |
- |
300 |
|
- |
| Cl 5.1(Materials) |
- |
5700 |
|
- |
| Cl 5.2(Description) |
- |
500 |
|
- |
| Cl 5.3(Capacity) |
- |
500 |
|
- |
| Cl 5.4(Types, Dimensions and Wall Thickness) |
- |
1500 |
|
- |
| Cl 5.5(Scale and Graduations) |
- |
1500 |
|
- |
| Cl 5.7(Thermal Shock Resistance) |
- |
2000 |
|
- |
| Cl 4(Types) |
- |
300 |
|
- |
| Cl 5.1(Materials) |
- |
5700 |
|
- |
| Cl 5.2(Description) |
- |
500 |
|
- |
| Cl 5.3(Capacity) |
- |
500 |
|
- |
| Cl 5.4(Types, Dimensions and Wall Thickness) |
- |
1500 |
|
- |
| Cl 5.5(Scale and Graduations) |
- |
1500 |
|
- |
| Cl 5.7(Thermal Shock Resistance) |
- |
2000 |
|
- |
| 5.6(Limit of Alkalinity) |
- |
1700 |
|
- |
| Cl 5.7(Thermal Shock Resistance) |
- |
2000 |
|
- |
| Cl 5.5(Scale and Graduations) |
- |
1500 |
|
- |
| Cl 5.4(Types, Dimensions and Wall Thickness) |
- |
1500 |
|
- |
| Cl 5.3(Capacity) |
- |
500 |
|
- |
| Cl 5.2(Description) |
- |
500 |
|
- |
| Cl 5.1(Materials) |
- |
5700 |
|
- |
| Cl 4(Types) |
- |
300 |
|
- |
| "Clause 5.2.1 Sub Clause.5.2.1.1 &5.2.1.2 "(Manufacture, workmanship, Finish and Appearance) |
- |
200 |
|
- |
| "Sub-clause 5.5 Annex A "(b)Permanency of pigments) |
- |
1500 |
|
- |
| Cl 4(Types) |
- |
300 |
|
- |
| Cl 5.1(Materials) |
- |
5700 |
|
- |
| Cl 5.2(Description) |
- |
500 |
|
- |
| Cl 5.3(Capacity) |
- |
500 |
|
- |
| Cl 5.4(Types, Dimensions and Wall Thickness) |
- |
1500 |
|
- |
| Cl 5.5(Scale and Graduations) |
- |
1500 |
|
- |
| Cl 5.7(Thermal Shock Resistance) |
- |
2000 |
|
- |
| "Clause 5.2.1 Sub.Cls.5.2.1.1 &5.2.1.2 "(Manufacture, workmanship, Finish and Appearance) |
- |
200 |
|
- |
| "Sub-clause 5.5 Annex A "(b)Permanency of pigments) |
- |
1500 |
|
- |
| 5.8(Migration of Heavy and toxic Elements) |
- |
7000 |
|
- |
| Cl 4(Types) |
- |
0 |
|
- |
| Cl 5.1(Materials) |
- |
0 |
|
- |
| Cl 5.2(Description) |
- |
0 |
|
- |
| Cl 5.3(Capacity) |
- |
0 |
|
- |
| Cl 5.4(Types, Dimensions and Wall Thickness) |
- |
0 |
|
- |
| Cl 5.5(Scale and Graduations) |
- |
0 |
|
- |
| Cl 5.7(Thermal Shock Resistance) |
- |
0 |
|
- |
| Cl 4(Types) |
- |
0 |
|
- |
| Cl 5.1(Materials) |
- |
0 |
|
- |
| Cl 5.2(Description) |
- |
0 |
|
- |
| Cl 5.3(Capacity) |
- |
0 |
|
- |
| Cl 5.4(Types, Dimensions and Wall Thickness) |
- |
0 |
|
- |
| Cl 5.5(Scale and Graduations) |
- |
0 |
|
- |
| Cl 5.7(Thermal Shock Resistance) |
- |
0 |
|
- |
| 5.6(Limit of Alkalinity) |
- |
0 |
|
- |
| Cl 5.7(Thermal Shock Resistance) |
- |
0 |
|
- |
| Cl 5.5(Scale and Graduations) |
- |
0 |
|
- |
| Cl 5.4(Types, Dimensions and Wall Thickness) |
- |
0 |
|
- |
| Cl 5.3(Capacity) |
- |
0 |
|
- |
| Cl 5.2(Description) |
- |
0 |
|
- |
| Cl 5.1(Materials) |
- |
0 |
|
- |
| Cl 4(Types) |
- |
0 |
|
- |
| "Clause 5.2.1 Sub Clause.5.2.1.1 &5.2.1.2 "(Manufacture, workmanship, Finish and Appearance) |
- |
0 |
|
- |
| "Sub-clause 5.5 Annex A "(b)Permanency of pigments) |
- |
0 |
|
- |
| Cl 4(Types) |
- |
0 |
|
- |
| Cl 5.1(Materials) |
- |
0 |
|
- |
| Cl 5.2(Description) |
- |
0 |
|
- |
| Cl 5.3(Capacity) |
- |
0 |
|
- |
| Cl 5.4(Types, Dimensions and Wall Thickness) |
- |
0 |
|
- |
| Cl 5.5(Scale and Graduations) |
- |
0 |
|
- |
| Cl 5.7(Thermal Shock Resistance) |
- |
0 |
|
- |
| "Clause 5.2.1 Sub.Cls.5.2.1.1 &5.2.1.2 "(Manufacture, workmanship, Finish and Appearance) |
- |
0 |
|
- |
| "Sub-clause 5.5 Annex A "(b)Permanency of pigments) |
- |
0 |
|
- |
| 5.8(Migration of Heavy and toxic Elements) |
- |
0 |
|
- |
|
09 Apr, 2028 |
-
Included w.e.f 16.12.2025 |
| 19 |
IS/ISO 22702 (2018) |
Utility lighters Safety specifications First Revision |
All Grade / Type / Size / Designation etc. |
19800 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 4.1(Flame generation) |
- |
1000 |
|
- |
| 4.2(Flame heights) |
- |
1000 |
|
- |
| 4.3(Flame- height adjustment) |
- |
500 |
|
- |
| 4.4("Resistance to Spitting or
Sputtering and flaring") |
- |
1000 |
|
- |
| 4.5(Flame extinction) |
- |
1500 |
|
- |
| 4.6(Volumetric Displacement) |
- |
1500 |
|
- |
| 5.2(Resistance to dropping) |
- |
1500 |
|
- |
| 5.3(Resistance to elevated temperature) |
- |
1000 |
|
- |
| 5.4(Burning behavior) |
- |
2000 |
|
- |
| 5.5(Resistance to continuous burn) |
- |
2000 |
|
- |
| 5.6(Resistance to cyclic burn) |
- |
1400 |
|
- |
| 5.7(External Finish) |
- |
1250 |
|
- |
| 5.8(Compatibility with fuel) |
- |
1500 |
|
- |
| 5.9(Resistance to internal pressure) |
- |
1750 |
|
- |
| 6(Refilling Test) |
- |
400 |
|
- |
|
09 Apr, 2028 |
-
Included w.e.f 31.12.2025 |
| 20 |
IS 5145 (1969) |
Specification for walking sticks |
All Grade / Type / Size / Designation etc. |
3900 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl-2.1(Wood) |
- |
1000 |
|
- |
| Cl.2.2(ALUMINIUM) |
- |
0 |
|
- |
| Cl.4(MANUFACTURE) |
- |
200 |
|
- |
| Cl.5(WORKMANSHIP AND FINISH) |
- |
200 |
|
- |
| Cl.6.1(STRENGTH TEST) |
- |
600 |
|
- |
| Cl.7(MARKING) |
- |
200 |
|
- |
| Cl.8(PACKING) |
- |
200 |
|
- |
| Cl-3(Shapes and Dimensions) |
- |
100 |
|
- |
| Cl-6.2.1(Strength of joint between handle and the stick) |
- |
600 |
|
- |
|
09 Apr, 2028 |
-
Included w.e.f 29.10.2025
Exclusion Cl.2.2 (ALUMINIUM) |
| 21 |
IS 9754 (2025) |
HIGH DENSITY POLYETHYLENE CONTAINERS FOR PACKING OF LIQUID PESTICIDES (UP TO 1 LITRE CAPACITY) - SPECIFICATION (first revision) |
-- |
32000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 4.1.1(Melt Flow Rate (MFR)) |
- |
1100 |
|
- |
| 4.1.1(Density) |
- |
1100 |
|
- |
| 4.1.2(Material Identification of Plug) |
- |
1000 |
|
- |
| 4.1.2(Material Identification of Caps/Closure) |
- |
3000 |
|
- |
| 4.2(Ullage & Nominal Capacity) |
- |
100 |
|
- |
| 4.2.2(Mass of Container) |
- |
500 |
|
- |
| 4.3(Wall thickness at any point of Container) |
- |
500 |
|
- |
| 4.4(Construction of Container) |
- |
500 |
|
- |
| 4.4.1(Container Height to Neck Face) |
- |
500 |
|
- |
| 4.4.2(Container Overall Height) |
- |
500 |
|
- |
| 4.4.3(Container Diameter) |
- |
500 |
|
- |
| 4.4.4(Neck Height) |
- |
500 |
|
- |
| 4.4.5(Neck Diameter) |
- |
600 |
|
- |
| 4.4.5(Neck Thread diameter) |
- |
500 |
|
- |
| 4.4.6(Neck Bore) |
- |
500 |
|
- |
| 4.4.7(Neck Ovality) |
- |
500 |
|
- |
| 4.5(Construction of Closure and Sealing) |
- |
500 |
|
- |
| 4.6(Workmanship and Finish) |
- |
500 |
|
- |
| 5.1.1(Leakage Test Vertically Downwards) |
- |
2000 |
|
- |
| 5.1.1(Leakage Test Vertically Upwards) |
- |
2700 |
|
- |
| 5.2(Stress Crack Resistance Test for 360 hours) |
- |
11000 |
|
- |
| 5.3(Drop Test @ Ambient Temperature) |
- |
1900 |
|
- |
| 5.3(Drop Test @ 0 Deg.C) |
- |
1900 |
|
- |
| 5.4(Ink Adhesion test) |
- |
1500 |
|
- |
| 7(Marking & BIS Cert. Marking) |
- |
500 |
|
- |
| 4.1.1(Melt Flow Rate (MFR)) |
- |
0 |
|
- |
| 4.1.1(Density) |
- |
0 |
|
- |
| 4.1.2(Material Identification of Plug) |
- |
0 |
|
- |
| 4.1.2(Material Identification of Caps/Closure) |
- |
0 |
|
- |
| 4.2(Ullage & Nominal Capacity) |
- |
0 |
|
- |
| 4.2.2(Mass of Container) |
- |
0 |
|
- |
| 4.3(Wall thickness at any point of Container) |
- |
0 |
|
- |
| 4.4(Construction of Container) |
- |
0 |
|
- |
| 4.4.1(Container Height to Neck Face) |
- |
0 |
|
- |
| 4.4.2(Container Overall Height) |
- |
0 |
|
- |
| 4.4.3(Container Diameter) |
- |
0 |
|
- |
| 4.4.4(Neck Height) |
- |
0 |
|
- |
| 4.4.5(Neck Diameter) |
- |
0 |
|
- |
| 4.4.5(Neck Thread diameter) |
- |
0 |
|
- |
| 4.4.6(Neck Bore) |
- |
0 |
|
- |
| 4.4.7(Neck Ovality) |
- |
0 |
|
- |
| 4.5(Construction of Closure and Sealing) |
- |
0 |
|
- |
| 4.6(Workmanship and Finish) |
- |
0 |
|
- |
| 5.1.1(Leakage Test Vertically Downwards) |
- |
0 |
|
- |
| 5.1.1(Leakage Test Vertically Upwards) |
- |
0 |
|
- |
| 5.2(Stress Crack Resistance Test for 360 hours) |
- |
0 |
|
- |
| 5.3(Drop Test @ Ambient Temperature) |
- |
0 |
|
- |
| 5.3(Drop Test @ 0 Deg.C) |
- |
0 |
|
- |
| 5.4(Ink Adhesion test) |
- |
0 |
|
- |
| 7(Marking & BIS Cert. Marking) |
- |
0 |
|
- |
|
09 Apr, 2028 |
-
Included w.e.f. 19.12.2025 |
| 22 |
IS 13488 (2008) |
Irrigation equipment - Emitting pipe systems - Specification (First Revision) |
All Grade / Type / Size / Designation etc. |
9400 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 5.1(Materials - shall be resistant to fertilizers and
chemicals commonly employed in irrigation, and shall
be suitable for use with water at temperatures up to
60°C and at pressures designed for the emitting pipe) |
- |
100 |
|
- |
| 5.1.2 (Ref. Cl 4.1.a of IS 12786 : 1989)(Potyethylene - higher olefins constituent ) |
- |
300 |
|
- |
| 5.1.2 (Ref. Cl 4.1.b of IS 12786 : 1989)(Potyethylene - anti-oxidant) |
- |
100 |
|
- |
| 5.1.2 (Ref. Cl 4.1.c.i of IS 12786 : 1989)(Density) |
- |
300 |
|
- |
| 5.1.2 (Ref. Cl 4.1.c.ii of IS 12786 : 1989)(Toluene extract - Annex A of IS 12786:1989) |
- |
300 |
|
- |
| 5.1.2 (Ref. Cl 4.1.c.iii of IS 12786 : 1989)(Volatile matter - Annex B of IS 12786:1989) |
- |
100 |
|
- |
| 5.1.2 (Ref. Cl 4.1.c & 4.2.a of IS 12786 : 1989)(Carbon Black content - IS 2530 : 1963) |
- |
100 |
|
- |
| 5.1.2 (Ref. Cl 4.2.b of IS 12786 : 1989)(The dispersion of Carbon Black content shall be satisfactory - IS 2530 : 1963) |
- |
100 |
|
- |
| 5.1.2 (Ref. Cl 4.3 of IS 12786 : 1989)(Addition of not more than 10 percent of the manufactures own rework material produced during the manufacture and works testing of pipe complying with this standard is permitted. No other rework material shall be used) |
- |
100 |
|
- |
| 6.2.2(Fittings) |
- |
100 |
|
- |
| 6.3(General) |
- |
100 |
|
- |
| 6.3(General) |
- |
100 |
|
- |
| 8.1.2(Uniformity of Emission Rate for Unregulated Emitting Pipes) |
- |
300 |
|
- |
| 8.1.3(Uniformity of Emission Rate for Regulated Emitting Pipes) |
- |
300 |
|
- |
| 8.2(Emission Rate of Emitting Unit as a Function of Inlet Pressure) |
- |
300 |
|
- |
| 8.2.1(Unregu/Qt~d Emining Pipe) |
- |
100 |
|
- |
| 8.2.2(Regulated Emitting Pipes) |
- |
200 |
|
- |
| 8.3.1(Wall Thickness ofEmitting Pipe) |
- |
100 |
|
- |
| 8.3.2(Inside Diameter ofEmitting Pipe) |
- |
100 |
|
- |
| 8.3.3(Flow Paths in Emitting Unit) |
- |
100 |
|
- |
| 8.4.1(Resistance to Hydrostatic Pressure at Ambient Temperature) |
- |
200 |
|
- |
| 8.4.2(Resistance to Hydrostatic Pressure at Elevated Temperature) |
- |
300 |
|
- |
| 8.5(Resistance to Tension at Elevated Temperature) |
- |
300 |
|
- |
| 8.5(Resistance to Tension at Elevated Temperature) |
- |
100 |
|
- |
| 8.5(Resistance to Tension at Elevated Temperature) |
- |
100 |
|
- |
| 8.6(Resistance to Pull Out of Joints Between Fitting and Emitting
IS 13479) |
- |
100 |
|
- |
| 8.7.1(Resistance of PE Emitting Pipe to
Environmental Stress Cracking -Acceptance Test
Annex D of IS 12786) |
- |
200 |
|
- |
| 8.7.2(Resistance of PE Emitting Pipe to
Environmental Stress Cracking - Type Test
Annex D of IS 12786) |
- |
200 |
|
- |
| 8.8(Determination of Emitting Unit Exponent) |
- |
200 |
|
- |
| 9.1(DESIGNATION - Non regulated Emitting Pipe) |
- |
100 |
|
- |
| 9.2(DESIGNATION - Regulated Emitting Pipe) |
- |
100 |
|
- |
| 4.1 a(Identification) |
- |
200 |
|
- |
| 4.1 a(Identification) |
- |
200 |
|
- |
| 4.1 c(Volatile matter Extract) |
- |
200 |
|
- |
| 4.1 d(Density) |
- |
100 |
|
- |
| 4.1 d(MFI @ 1900C/2.16 Kg) |
- |
100 |
|
- |
| 4.2(Carbon black dispersion) |
- |
300 |
|
- |
| 5.1(Materials) |
- |
100 |
|
- |
| 6.1.1, Table 1,(i)(Nominal Diameter) |
- |
100 |
|
- |
| 6.1.1, Table 1,(ii)(Inside Diameter) |
- |
100 |
|
- |
| 6.1.1, Table 1,(iii)(Tolerance on I.D) |
- |
100 |
|
- |
| 6.1.1, Table 1,(iv)(Wall Thickness) |
- |
100 |
|
- |
| 6.2(Fittings) |
- |
100 |
|
- |
| 6.3(General) |
- |
100 |
|
- |
| 7.1(Test Specimens) |
- |
100 |
|
- |
| 7.2(Order of Tests) |
- |
200 |
|
- |
| 7.3(Testing Conditions) |
- |
100 |
|
- |
| 7.4(Accuracy of Measuring Devices) |
- |
100 |
|
- |
| 8.1(Uniformity of Emission Rate) |
- |
100 |
|
- |
| 8.1.2(Unregulated Emitting Pipes) |
- |
100 |
|
- |
| 8.1.3(Regulated Emitting Pipes) |
- |
100 |
|
- |
| 8.2(Emission Rate of Emitting Unit as a Function
of Inlet Pressure) |
- |
100 |
|
- |
| 8.2.1(Unregulated Emitting Pipes) |
- |
100 |
|
- |
| 8.2.2(Regulated Emitting Pipes) |
- |
100 |
|
- |
| 8.3.1(Wall Thickness ofEmitting Pipe) |
- |
100 |
|
- |
| 8.3.3(Flow Paths in Emitting Unit) |
- |
100 |
|
- |
| 8.3.4(Spacing of Emitter Units) |
- |
100 |
|
- |
| 8.4(Resistance of Emitting Pipes to Hydrostatic
Pressure) |
- |
100 |
|
- |
| 8.5(Resistance to Tension at Elevated Temperature) |
- |
100 |
|
- |
| 8.6(Resistance to Pull Out ofJoints Between Fitting
and Emitting) |
- |
100 |
|
- |
| 8.7.1(Acceptance Test) |
- |
100 |
|
- |
| 8.7.2(Type Test) |
- |
100 |
|
- |
| 8.8(Determination of Emitting Unit Exponen) |
- |
100 |
|
- |
| 9.1(Non-regulated Emitting Pipe) |
- |
100 |
|
- |
| 9.2(Regulated Emitting Pipe) |
- |
100 |
|
- |
| 10.1(Marking) |
- |
100 |
|
- |
| 8.3.2(Inside Diameter ofEmitting Pipe) |
- |
100 |
|
- |
| 4.2(Carbon black content) |
- |
100 |
|
- |
| 8.3.4(Spacing ofEmitter Units) |
- |
100 |
|
- |
| 5.1(Materials - shall be resistant to fertilizers and
chemicals commonly employed in irrigation, and shall
be suitable for use with water at temperatures up to
60°C and at pressures designed for the emitting pipe) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.1.a of IS 12786 : 1989)(Potyethylene - higher olefins constituent ) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.1.b of IS 12786 : 1989)(Potyethylene - anti-oxidant) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.1.c.i of IS 12786 : 1989)(Density) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.1.c.ii of IS 12786 : 1989)(Toluene extract - Annex A of IS 12786:1989) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.1.c.iii of IS 12786 : 1989)(Volatile matter - Annex B of IS 12786:1989) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.1.c & 4.2.a of IS 12786 : 1989)(Carbon Black content - IS 2530 : 1963) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.2.b of IS 12786 : 1989)(The dispersion of Carbon Black content shall be satisfactory - IS 2530 : 1963) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.3 of IS 12786 : 1989)(Addition of not more than 10 percent of the manufactures own rework material produced during the manufacture and works testing of pipe complying with this standard is permitted. No other rework material shall be used) |
- |
0 |
|
- |
| 6.2.2(Fittings) |
- |
0 |
|
- |
| 6.3(General) |
- |
0 |
|
- |
| 6.3(General) |
- |
0 |
|
- |
| 8.1.2(Uniformity of Emission Rate for Unregulated Emitting Pipes) |
- |
0 |
|
- |
| 8.1.3(Uniformity of Emission Rate for Regulated Emitting Pipes) |
- |
0 |
|
- |
| 8.2(Emission Rate of Emitting Unit as a Function of Inlet Pressure) |
- |
0 |
|
- |
| 8.2.1(Unregu/Qt~d Emining Pipe) |
- |
0 |
|
- |
| 8.2.2(Regulated Emitting Pipes) |
- |
0 |
|
- |
| 8.3.1(Wall Thickness ofEmitting Pipe) |
- |
0 |
|
- |
| 8.3.2(Inside Diameter ofEmitting Pipe) |
- |
0 |
|
- |
| 8.3.3(Flow Paths in Emitting Unit) |
- |
0 |
|
- |
| 8.4.1(Resistance to Hydrostatic Pressure at Ambient Temperature) |
- |
0 |
|
- |
| 8.4.2(Resistance to Hydrostatic Pressure at Elevated Temperature) |
- |
0 |
|
- |
| 8.5(Resistance to Tension at Elevated Temperature) |
- |
0 |
|
- |
| 8.5(Resistance to Tension at Elevated Temperature) |
- |
0 |
|
- |
| 8.5(Resistance to Tension at Elevated Temperature) |
- |
0 |
|
- |
| 8.6(Resistance to Pull Out of Joints Between Fitting and Emitting
IS 13479) |
- |
0 |
|
- |
| 8.7.1(Resistance of PE Emitting Pipe to
Environmental Stress Cracking -Acceptance Test
Annex D of IS 12786) |
- |
0 |
|
- |
| 8.7.2(Resistance of PE Emitting Pipe to
Environmental Stress Cracking - Type Test
Annex D of IS 12786) |
- |
0 |
|
- |
| 8.8(Determination of Emitting Unit Exponent) |
- |
0 |
|
- |
| 9.1(DESIGNATION - Non regulated Emitting Pipe) |
- |
0 |
|
- |
| 9.2(DESIGNATION - Regulated Emitting Pipe) |
- |
0 |
|
- |
| 4.1 a(Identification) |
- |
0 |
|
- |
| 4.1 a(Identification) |
- |
0 |
|
- |
| 4.1 c(Volatile matter Extract) |
- |
0 |
|
- |
| 4.1 d(Density) |
- |
0 |
|
- |
| 4.1 d(MFI @ 1900C/2.16 Kg) |
- |
0 |
|
- |
| 4.2(Carbon black dispersion) |
- |
0 |
|
- |
| 5.1(Materials) |
- |
0 |
|
- |
| 6.1.1, Table 1,(i)(Nominal Diameter) |
- |
0 |
|
- |
| 6.1.1, Table 1,(ii)(Inside Diameter) |
- |
0 |
|
- |
| 6.1.1, Table 1,(iii)(Tolerance on I.D) |
- |
0 |
|
- |
| 6.1.1, Table 1,(iv)(Wall Thickness) |
- |
0 |
|
- |
| 6.2(Fittings) |
- |
0 |
|
- |
| 6.3(General) |
- |
0 |
|
- |
| 7.1(Test Specimens) |
- |
0 |
|
- |
| 7.2(Order of Tests) |
- |
0 |
|
- |
| 7.3(Testing Conditions) |
- |
0 |
|
- |
| 7.4(Accuracy of Measuring Devices) |
- |
0 |
|
- |
| 8.1(Uniformity of Emission Rate) |
- |
0 |
|
- |
| 8.1.2(Unregulated Emitting Pipes) |
- |
0 |
|
- |
| 8.1.3(Regulated Emitting Pipes) |
- |
0 |
|
- |
| 8.2(Emission Rate of Emitting Unit as a Function
of Inlet Pressure) |
- |
0 |
|
- |
| 8.2.1(Unregulated Emitting Pipes) |
- |
0 |
|
- |
| 8.2.2(Regulated Emitting Pipes) |
- |
0 |
|
- |
| 8.3.1(Wall Thickness ofEmitting Pipe) |
- |
0 |
|
- |
| 8.3.3(Flow Paths in Emitting Unit) |
- |
0 |
|
- |
| 8.3.4(Spacing of Emitter Units) |
- |
0 |
|
- |
| 8.4(Resistance of Emitting Pipes to Hydrostatic
Pressure) |
- |
0 |
|
- |
| 8.5(Resistance to Tension at Elevated Temperature) |
- |
0 |
|
- |
| 8.6(Resistance to Pull Out ofJoints Between Fitting
and Emitting) |
- |
0 |
|
- |
| 8.7.1(Acceptance Test) |
- |
0 |
|
- |
| 8.7.2(Type Test) |
- |
0 |
|
- |
| 8.8(Determination of Emitting Unit Exponen) |
- |
0 |
|
- |
| 9.1(Non-regulated Emitting Pipe) |
- |
0 |
|
- |
| 9.2(Regulated Emitting Pipe) |
- |
0 |
|
- |
| 10.1(Marking) |
- |
0 |
|
- |
| 8.3.2(Inside Diameter ofEmitting Pipe) |
- |
0 |
|
- |
| 4.2(Carbon black content) |
- |
0 |
|
- |
| 8.3.4(Spacing ofEmitter Units) |
- |
0 |
|
- |
|
09 Apr, 2028 |
-
Included w.e.f 12.11.2025 |
| 23 |
IS 302 : Part 1 (2024) |
Household and Similar Electrical Appliances â Safety Part 1 General Requirements (Seventh Revision) |
Household and Similar Electrical Appliances |
44500 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 12(Charging of metal-ion batteries) |
- |
1000 |
|
- |
| 6(Classification- IS 302-1) |
- |
500 |
|
- |
| 5(General conditions for the tests) |
- |
500 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
EMI/EMC test facility not available |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
EMI/EMC test facility not available |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
EMI/EMC test facility not available |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
EMI/EMC test facility not available |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
EMI/EMC test facility not available |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
EMI/EMC test facility not available |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
EMI/EMC test facility not available |
| 11.8(Temperature rise) |
- |
5000 |
|
- |
| 11.7(Duration corresponding) |
- |
2500 |
|
- |
| 11.6(Combined appliances) |
- |
2500 |
|
- |
| 11.5(Motor-operated appliances) |
- |
2500 |
|
- |
| 11.4(Heating appliances) |
- |
2500 |
|
- |
| 8.1.5(Live parts of built-in appliances) |
- |
2500 |
|
- |
| 18(Endurance) |
- |
1000 |
|
- |
| 17(Overload protection of transformers and associated circuits) |
- |
2000 |
|
- |
| 16(Leakage current and electric strength) |
- |
1000 |
|
- |
| 4(General requirement) |
- |
500 |
|
- |
| 32.1(Radiation Toxicity and Similar Hazards) |
- |
1000 |
|
- |
| 31(Resistance to Rusting) |
- |
1000 |
|
- |
| 30.2(Needle Flame Test) |
- |
1000 |
|
- |
| 30.2(Glow Wire Test) |
- |
1000 |
|
- |
| 30.1(Ball pressure test) |
- |
1000 |
|
- |
| 29(clearance, creepage distances and solid insulation) |
- |
2000 |
|
- |
| 28(Screw test and connections) |
- |
1000 |
|
- |
| 27.1(Provision for Earthing, IS 302-1) |
- |
2000 |
|
- |
| 26(Terminals for external conductors) |
- |
1000 |
|
- |
| 25.8(Supply Connection and External Flexible Cords, IS 302-1) |
- |
1000 |
|
- |
| 24(Components) |
- |
3000 |
|
- |
| 23.1(Internal Wiring, IS 302-1) |
- |
1000 |
|
- |
| 22.1(Construction, IS 302-1) |
- |
5000 |
|
- |
| 21.1(Mechanical Strength, IS 302-1) |
- |
2000 |
|
- |
| 20.1(Stability & Mechanical Hazards, IS 302-1) |
- |
1000 |
|
- |
| 19(Abnormal Operation) |
- |
2000 |
|
- |
| 18(Endurance) |
- |
0 |
|
- |
| 17(Over Load Protection of Transformers and associated circuits) |
- |
0 |
|
- |
| 16.3(Electric Strength (after clause 15 and 16.2)) |
- |
1000 |
|
- |
| 16.2(Leakage Current (after Clause 15)) |
- |
1000 |
|
- |
| 16.1(General) |
- |
1000 |
|
- |
| 16.0(General) |
- |
3000 |
|
- |
| 15.3(Humidity Test) |
- |
1000 |
|
- |
| 15.2(Spillage Test) |
- |
1000 |
|
- |
| 15.1(Ingress Protection test other than IPX0 (IP test)) |
- |
4900 |
|
- |
| 15.0(Moisture resistance) |
- |
5000 |
|
- |
| 14(Transient Over Voltages) |
- |
1000 |
|
- |
| 13.3(Electric Strength at operating temperature) |
- |
1000 |
|
- |
| 13.2(Leakage current at operating temperature) |
- |
1000 |
|
- |
| 13(Leakage current and electric strength at operating temperature) |
- |
1000 |
|
- |
| 11.3(Heating) |
- |
1000 |
|
- |
| 11.2(General) |
- |
500 |
|
- |
| 11.1(General) |
- |
500 |
|
- |
| 10.2(Current input) |
- |
1000 |
|
- |
| 10.1(Power input) |
- |
1000 |
|
- |
| 9(Starting of motor operation test requirements and tests) |
- |
1000 |
|
- |
| 8.1.4(Protection against live parts against protective impedance) |
- |
1000 |
|
- |
| 8.1.3(Protection against live parts in visible glowing heating elements) |
- |
1000 |
|
- |
| 8.1.2(Protection against live parts in openings) |
- |
1000 |
|
- |
| 8.1.1(Protection against live parts in all positions) |
- |
1000 |
|
- |
| 7(Marking and instructions) |
- |
500 |
|
- |
| A.2(Earth continuity test) |
- |
1000 |
|
- |
| Annex C(Ageing test on motors) |
- |
1000 |
|
- |
| Annex D(Thermal motor protectors) |
- |
1000 |
|
- |
| 15.2(Moisture resistance) |
- |
1000 |
|
- |
| 19.17(Abnormal Operation, IS 302-1) |
- |
1000 |
|
- |
| 20.2(Stability & Mechanical Hazards, IS 302-1) |
- |
1000 |
|
- |
| 21.2(Mechanical Strength, IS 302-1) |
- |
1000 |
|
- |
| 21.3(Mechanical Strength, IS 302-1) |
- |
1000 |
|
- |
| 22.5(Construction) |
- |
0 |
|
EMI/EMC test facility not available. |
| 22.6(Construction, IS 302-1) |
- |
1000 |
|
- |
| 22.11(Construction, IS 302-1) |
- |
1000 |
|
- |
| 22.16(Construction) |
- |
1000 |
|
- |
| 22.32(Construction, IS 302-1) |
- |
0 |
|
Oxygen Bomb with Pressure Gauge not available |
| 22.42(Construction) |
- |
1000 |
|
- |
| 23.3(Internal Wiring, IS 302-1) |
- |
1000 |
|
- |
| 25.6(Supply connection and external flexible cords, IS 302-1) |
- |
5000 |
|
- |
| 25.7(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.14(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.15(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 26.5(Terminals for external conductors) |
- |
1000 |
|
- |
| 27.5(Provision for Earthing, IS 302-1) |
- |
1000 |
|
- |
| 28.1(Screws and connections) |
- |
1000 |
|
- |
| 22.2(Construction, IS 302-1) |
- |
1000 |
|
- |
| 22.3(Construction, IS 302-1) |
- |
1000 |
|
- |
| B.22.4(Construction, IS 302-1) |
- |
1000 |
|
- |
| B.22.5(Construction, IS 302-1) |
- |
1000 |
|
- |
|
09 Apr, 2028 |
-
"Domestic Electric Clothes Washing Machines
(For testing charges please refer part 2 standard in LIMS)" |
| 24 |
IS 15652 (2006) |
Insulating mats for electrical purposes - Specification |
All Grade / Type / Size / Designation etc. |
49000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 9(Marking (As per Cl.9.1 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 9(Marking (As per Cl.9.1 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 9(Marking (As per Cl.9.1 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 9(Marking (As per Cl.9.1 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 9(Marking (As per Cl.9.2 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 10.a)(Packing) |
- |
900 |
|
- |
| 10.b)(Packing) |
- |
900 |
|
- |
| 4(Classification and Designation (As per Cl.4.1 and Table-1 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 4(Classification and Designation (As per Cl.4.1 and Table-1 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 4(Classification and Designation (As per Cl.4.1 and Table-1 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 4(Classification and Designation (As per Cl.4.2 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 4(Classification and Designation (As per Cl.4.2 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 4(Classification and Designation (As per Cl.4.2 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 4(Classification and Designation (As per Cl.4.2 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 5(Composition (As per Cl. 5.2 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 6(Shape Requirements and Dimension (As per Cl.6.1 & 6.2 of IS 15652 : 2006)) |
- |
1900 |
|
- |
| 6(Shape Requirements and Dimension (As per Cl.6.1 & 6.2 of IS 15652 : 2006)) |
- |
1900 |
|
- |
| 6(Thickness [mm] (As per Cl. 6.3 and Table-2 of IS 15652 : 2006)) |
- |
1900 |
|
- |
| 6(Thickness [mm] (As per Cl. 6.3 and Table-2 of IS 15652 : 2006)) |
- |
1900 |
|
- |
| 6(Thickness [mm] (As per Cl. 6.3 and Table-2 of IS 15652 : 2006)) |
- |
1900 |
|
- |
| 6(Colour (As per Cl. 6.4 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 7(Workmanship & Finish (As per Cl. 7.1 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 8(Physical properties (As per Cl.8.1 and Table - 3 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Physical properties (As per Cl.8.1 and Table - 3 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Physical properties (As per Cl.8.3 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Physical properties (As per Cl.8.5 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Physical properties (As per Cl.8.3 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Physical properties (As per Cl.8.5 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Physical properties (As per Cl.8.5 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Physical properties (As per Cl.8.5 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Physical properties (As per Cl.8.5 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Physical properties (As per Cl.8.5 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Physical properties (As per Cl.8.5 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Physical properties (As per Cl.8.5 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Di-electric Properties (As per Cl.8.2.1 and C-3.1 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Di-electric Properties (As per Cl.8.2.2 and C-3.2 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Di-electric Properties (As per Cl.8.2.3 and C-3.3 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Di-electric Properties (As per Cl.8.2.3 and Table-4 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Di-electric Properties (As per Cl.8.2.3 and Table-4 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(A.C. Proof Voltage (Cl.8.2.4), C-3.4 and Table-5 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Thermal Properties (Cl..8.4)) |
- |
4900 |
|
- |
| 8(Thermal Properties (Cl..8.4)) |
- |
4900 |
|
- |
| 8(Extreme Low Temperature (Cl.8.6)) |
- |
4900 |
|
- |
| 9(Marking (As per Cl.9.1 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 9(Marking (As per Cl.9.1 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 9(Marking (As per Cl.9.1 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 9(Marking (As per Cl.9.1 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 9(Marking (As per Cl.9.1 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 9(Marking (As per Cl.9.2 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 10(Packing) |
- |
900 |
|
- |
| 10(Packing) |
- |
900 |
|
- |
| 10(Packing) |
- |
900 |
|
- |
| 4(Classification and Designation (As per Cl.4.1 and Table-1 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 4(Classification and Designation (As per Cl.4.1 and Table-1 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 4(Classification and Designation (As per Cl.4.2 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 4(Classification and Designation (As per Cl.4.2 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 4(Classification and Designation (As per Cl.4.2 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 4(Classification and Designation (As per Cl.4.2 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 5(Composition (As per Cl. 5.1 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 5(Composition (As per Cl. 5.2 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 6(Shape Requirements and Dimension (As per Cl.6.1 & 6.2 of IS 15652 : 2006)) |
- |
1900 |
|
- |
| 6(Shape Requirements and Dimension (As per Cl.6.1 & 6.2 of IS 15652 : 2006)) |
- |
1900 |
|
- |
| 6(Thickness [mm] (As per Cl. 6.3 and Table-2 of IS 15652 : 2006)) |
- |
1900 |
|
- |
| 6(Thickness [mm] (As per Cl. 6.3 and Table-2 of IS 15652 : 2006)) |
- |
1900 |
|
- |
| 6(Thickness [mm] (As per Cl. 6.3 and Table-2 of IS 15652 : 2006)) |
- |
1900 |
|
- |
| 6(Colour (As per Cl. 6.4 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 7(Workmanship & Finish (As per Cl. 7.1 of IS 15652 : 2006)) |
- |
1900 |
|
- |
| 8(Physical properties (As per Cl.8.1 and Table - 3 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Physical properties (As per Cl.8.1 and Table - 3 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Physical properties (As per Cl.8.3 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Physical properties (As per Cl.8.3 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Physical properties (As per Cl.8.5 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Physical properties (As per Cl.8.5 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Physical properties (As per Cl.8.5 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Physical properties (As per Cl.8.5 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Physical properties (As per Cl.8.5 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Physical properties (As per Cl.8.5 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Physical properties (As per Cl.8.5 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Physical properties (As per Cl.8.5 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Di-electric Properties (As per Cl.8.2.1 and C-3.1 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Di-electric Properties (As per Cl.8.2.2 and C-3.2 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Di-electric Properties (As per Cl.8.2.3 and C-3.3 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Di-electric Properties (As per Cl.8.2.3 and Table-4 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Di-electric Properties (As per Cl.8.2.3 and Table-4 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Di-electric Properties (Cl.8.2), A.C. Proof Voltage (Cl.8.2.4), C-3.4 and Table-5 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(A.C. Proof Voltage (Cl.8.2.4), C-3.4 and Table-5 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(A.C. Proof Voltage (Cl.8.2.4), C-3.4 and Table-5 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(Thermal Properties (Cl..8.4)) |
- |
4900 |
|
- |
| 8(Thermal Properties (Cl..8.4)) |
- |
4900 |
|
- |
| 8(Extreme Low Temperature (Cl.8.6)) |
- |
4900 |
|
- |
| 9(Marking (As per Cl.9.1 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 10.c)(Packing) |
- |
900 |
|
- |
| 5(Composition (As per Cl. 5.1 of IS 15652 : 2006)) |
- |
900 |
|
- |
| 8(Di-electric Properties (Cl.8.2), A.C. Proof Voltage (Cl.8.2.4), C-3.4 and Table-5 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 8(A.C. Proof Voltage (Cl.8.2.4), C-3.4 and Table-5 of IS 15652 : 2006)) |
- |
4900 |
|
- |
| 4(Classification and Designation (As per Cl.4.1 and Table-1 of IS 15652 : 2006)) |
- |
900 |
|
- |
|
09 Apr, 2028 |
-
Included w.e.f 14.10.2025 |
| 25 |
IS 9873 : Part 3 (2020) |
Safety of Toys Part 3 Migration of Certain Elements ( Third Revision ) |
All Grade / Type / Size / Designation |
1900 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 4.1 - Table 1(Selenium (Se) - Cl 7,8,9 of IS 9873-3 : 2017 and ISO 8124-3 : 2010) |
- |
200 |
|
- |
| 4.1 - Table 1(Mercury (Hg) - Cl 7,8,9 of IS 9873-3 : 2017 and ISO 8124-3 : 2010) |
- |
200 |
|
- |
| 4.1 - Table 1(Lead (Pb) - Cl 7,8,9 of IS 9873-3 : 2017 and ISO 8124-3 : 2010) |
- |
200 |
|
- |
| 4.1 - Table 1(Chromium (Cr) - Cl 7,8,9 of IS 9873-3 : 2017 and ISO 8124-3 : 2010) |
- |
200 |
|
- |
| 4.1 - Table 1(Cadmium (Cd) - Cl 7,8,9 of IS 9873-3 : 2017 and ISO 8124-3 : 2010) |
- |
200 |
|
- |
| 4.1 - Table 1(Barium (Ba) - Cl 7,8,9 of IS 9873-3 : 2017 and ISO 8124-3 : 2010) |
- |
200 |
|
- |
| 4.1 - Table 1(Arsenic (As) - Cl 7,8,9 of IS 9873-3 : 2017 and ISO 8124-3 : 2010) |
- |
200 |
|
- |
| 4.1 - Table 1(Antimony (Sb) - Cl 7,8,9 of IS 9873-3 : 2017 and ISO 8124-3 : 2010) |
- |
200 |
|
- |
| 4.1 - Table 1(Antimony (Sb) - Cl 7,8,9 of IS 9873-3 : 2017 and ISO 8124-3 : 2010) |
- |
200 |
|
- |
| 4.1 - Table 1(Arsenic (As) - Cl 7,8,9 of IS 9873-3 : 2017 and ISO 8124-3 : 2010) |
- |
200 |
|
- |
| 4.1 - Table 1(Barium (Ba) - Cl 7,8,9 of IS 9873-3 : 2017 and ISO 8124-3 : 2010) |
- |
200 |
|
- |
| 4.1 - Table 1(Cadmium (Cd) - Cl 7,8,9 of IS 9873-3 : 2017 and ISO 8124-3 : 2010) |
- |
200 |
|
- |
| 4.1 - Table 1(Mercury (Hg) - Cl 7,8,9 of IS 9873-3 : 2017 and ISO 8124-3 : 2010) |
- |
200 |
|
- |
| 4.1 - Table 1(Selenium (Se) - Cl 7,8,9 of IS 9873-3 : 2017 and ISO 8124-3 : 2010) |
- |
200 |
|
- |
| 4.1 - Table 1(Chromium (Cr) - Cl 7,8,9 of IS 9873-3 : 2017 and ISO 8124-3 : 2010) |
- |
200 |
|
- |
| 4.1 - Table 1(Lead (Pb) - Cl 7,8,9 of IS 9873-3 : 2017 and ISO 8124-3 : 2010) |
- |
200 |
|
- |
| 4.1(Sample preparation as per clause 8 of IS 9873 Part 3:1999) |
- |
200 |
|
- |
| Cl-4.1 & 4.2,Table 1,sl.no-i(Sb) |
- |
200 |
|
- |
| Cl-4.1 & 4.2,Table 1,sl.no-ii(As) |
- |
200 |
|
- |
| Cl-4.1 & 4.2,Table 1,sl.no-iii(Ba) |
- |
200 |
|
- |
| Cl-4.1 & 4.2,Table 1,sl.no-iv(Cd) |
- |
200 |
|
- |
| Cl-4.1 & 4.2,Table 1,sl.no-v(Cr) |
- |
200 |
|
- |
| Cl-4.1 & 4.2,Table 1,sl.no-vi(Pb) |
- |
200 |
|
- |
| Cl-4.1 & 4.2,Table 1,sl.no-vii(Hg) |
- |
200 |
|
- |
| Cl-4.1 & 4.2,Table 1,sl.no-viii(Se) |
- |
200 |
|
- |
|
09 Apr, 2028 |
-
Included w.e.f 29.10.2025 |
| 26 |
IS 2619 (2018) |
Glass beakers - Specification (Third Revision) |
All Grade / Type / Size / Designation |
12800 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl.8.5 Thermal shock resistance(Beakers shall have a thermal shock resistance of 160 °C when tested in accordance with ISO 718.) |
- |
2800 |
|
- |
| Cl.5 Capacity
(b) Distance between the levels corresponding to the nominal and overflow capacities shall be at least
10 mm.) |
- |
1500 |
|
- |
| Cl.6 Material(Beakers shall be made of borosilicate glass 3.3 in accordance with ISO 3585. The glass shall be
reasonably free from residual strain and from visible glass defects which might impair the safety and
performance of the beaker.) |
- |
0 |
|
- |
| Cl.7.1 Dimensions(Low-form and tall-form beakers shall observe the dimensions specified in Table 1 and thick-walled
beakers the dimensions specifed in Table 2. The tolerances on the external diameter shall be ±5 % of
the value given in the tables.) |
- |
1000 |
|
- |
| Cl.7.2 Radius at base(Beakers having a nominal capacity of 250 ml or greater shall have an external radius at the junction
between the base and the side of 10 % to 20 % of the external diameter.) |
- |
1000 |
|
- |
| Cl.7.2 Radius at base(Beakers having a nominal capacity less than 250 ml shall have a minimum radius at the junction
between the base and the side of 5 % of the external diameter.) |
- |
1000 |
|
- |
| Cl.7.3 Wall thickness(Substantial local irregularities from the minimum values for wall thickness given in the tables shall
be avoided. That means, the minimum wall thickness shall fall at no place below the values given in
Table 1 and Table 2 and the beakers shall comply with the requirement for thermal shock endurance
specified in 8.5.) |
- |
1000 |
|
- |
| Cl.8.1 Base(The design of the base shall enable the beaker to stand vertically on a plane horizontal surface without
spinning or rocking) |
- |
1000 |
|
- |
| 8.2 Upper edge(The side of the beaker shall be slightly flared near the brim in a smooth and regular curve. The diameter
of the brim shall be of the order of 5 % to 15 % greater than the diameter of the body. The edge of the
brim shall be finished in a plane parallel with that of the horizontal base.) |
- |
500 |
|
- |
| Cl. 8.3 Spout(The spout shall be shaped so that, when the beaker is filled with water, the water may be poured in a
regular stream clear of the side of the beaker. When the beaker is placed on a horizontal surface and
filling is continued beyond its overflow capacity, the water shall first overflow from the spout and not
from any other part of the brim.) |
- |
500 |
|
- |
| Cl.8.4 Scale(Beakers may be provided with a scale, which should approximately indicate the volume contained
in the beaker.) |
- |
1000 |
|
- |
| Cl.8.5 Thermal shock resistance(Beakers shall have a thermal shock resistance of 160 °C when tested in accordance with ISO 718.) |
- |
2800 |
|
- |
| Cl.5 Capacity
(a)overflow of capacity of a beaker shall exceed the nominal capacity by at least 5 %;) |
- |
0 |
|
- |
| Cl.5 Capacity
(b) Distance between the levels corresponding to the nominal and overflow capacities shall be at least
10 mm.) |
- |
0 |
|
- |
| Cl.6 Material(Beakers shall be made of borosilicate glass 3.3 in accordance with ISO 3585. The glass shall be
reasonably free from residual strain and from visible glass defects which might impair the safety and
performance of the beaker.) |
- |
0 |
|
- |
| Cl.7.1 Dimensions(Low-form and tall-form beakers shall observe the dimensions specified in Table 1 and thick-walled
beakers the dimensions specifed in Table 2. The tolerances on the external diameter shall be ±5 % of
the value given in the tables.) |
- |
0 |
|
- |
| Cl.7.2 Radius at base(Beakers having a nominal capacity of 250 ml or greater shall have an external radius at the junction
between the base and the side of 10 % to 20 % of the external diameter.) |
- |
0 |
|
- |
| Cl.7.2 Radius at base(Beakers having a nominal capacity less than 250 ml shall have a minimum radius at the junction
between the base and the side of 5 % of the external diameter.) |
- |
0 |
|
- |
| Cl.7.3 Wall thickness(Substantial local irregularities from the minimum values for wall thickness given in the tables shall
be avoided. That means, the minimum wall thickness shall fall at no place below the values given in
Table 1 and Table 2 and the beakers shall comply with the requirement for thermal shock endurance
specified in 8.5.) |
- |
0 |
|
- |
| Cl.8.1 Base(The design of the base shall enable the beaker to stand vertically on a plane horizontal surface without
spinning or rocking) |
- |
0 |
|
- |
| 8.2 Upper edge(The side of the beaker shall be slightly flared near the brim in a smooth and regular curve. The diameter
of the brim shall be of the order of 5 % to 15 % greater than the diameter of the body. The edge of the
brim shall be finished in a plane parallel with that of the horizontal base.) |
- |
0 |
|
- |
| Cl. 8.3 Spout(The spout shall be shaped so that, when the beaker is filled with water, the water may be poured in a
regular stream clear of the side of the beaker. When the beaker is placed on a horizontal surface and
filling is continued beyond its overflow capacity, the water shall first overflow from the spout and not
from any other part of the brim.) |
- |
0 |
|
- |
| Cl.8.4 Scale(Beakers may be provided with a scale, which should approximately indicate the volume contained
in the beaker.) |
- |
0 |
|
- |
| Cl.8.5 Thermal shock resistance(Beakers shall have a thermal shock resistance of 160 °C when tested in accordance with ISO 718.) |
- |
0 |
|
- |
| Cl.5 Capacity
(a)overflow of capacity of a beaker shall exceed the nominal capacity by at least 5 %;) |
- |
0 |
|
- |
| Cl.5 Capacity
(b) Distance between the levels corresponding to the nominal and overflow capacities shall be at least
10 mm.) |
- |
0 |
|
- |
| Cl.6 Material(Beakers shall be made of borosilicate glass 3.3 in accordance with ISO 3585. The glass shall be
reasonably free from residual strain and from visible glass defects which might impair the safety and
performance of the beaker.) |
- |
0 |
|
- |
| Cl.7.1 Dimensions(Low-form and tall-form beakers shall observe the dimensions specified in Table 1 and thick-walled
beakers the dimensions specifed in Table 2. The tolerances on the external diameter shall be ±5 % of
the value given in the tables.) |
- |
0 |
|
- |
| Cl.7.2 Radius at base(Beakers having a nominal capacity of 250 ml or greater shall have an external radius at the junction
between the base and the side of 10 % to 20 % of the external diameter.) |
- |
0 |
|
- |
| Cl.7.2 Radius at base(Beakers having a nominal capacity less than 250 ml shall have a minimum radius at the junction
between the base and the side of 5 % of the external diameter.) |
- |
0 |
|
- |
| Cl.7.3 Wall thickness(Substantial local irregularities from the minimum values for wall thickness given in the tables shall
be avoided. That means, the minimum wall thickness shall fall at no place below the values given in
Table 1 and Table 2 and the beakers shall comply with the requirement for thermal shock endurance
specified in 8.5.) |
- |
0 |
|
- |
| Cl.8.1 Base(The design of the base shall enable the beaker to stand vertically on a plane horizontal surface without
spinning or rocking) |
- |
0 |
|
- |
| 8.2 Upper edge(The side of the beaker shall be slightly flared near the brim in a smooth and regular curve. The diameter
of the brim shall be of the order of 5 % to 15 % greater than the diameter of the body. The edge of the
brim shall be finished in a plane parallel with that of the horizontal base.) |
- |
0 |
|
- |
| Cl. 8.3 Spout(The spout shall be shaped so that, when the beaker is filled with water, the water may be poured in a
regular stream clear of the side of the beaker. When the beaker is placed on a horizontal surface and
filling is continued beyond its overflow capacity, the water shall first overflow from the spout and not
from any other part of the brim.) |
- |
0 |
|
- |
| Cl.8.4 Scale(Beakers may be provided with a scale, which should approximately indicate the volume contained
in the beaker.) |
- |
0 |
|
- |
| Cl.5 Capacity
(a)overflow of capacity of a beaker shall exceed the nominal capacity by at least 5 %;) |
- |
0 |
|
- |
| Cl.8.5 Thermal shock resistance(Beakers shall have a thermal shock resistance of 160 °C when tested in accordance with ISO 718.) |
- |
0 |
|
- |
| Cl.5 Capacity
(b) Distance between the levels corresponding to the nominal and overflow capacities shall be at least
10 mm.) |
- |
0 |
|
- |
| Cl.6 Material(Beakers shall be made of borosilicate glass 3.3 in accordance with ISO 3585. The glass shall be
reasonably free from residual strain and from visible glass defects which might impair the safety and
performance of the beaker.) |
- |
0 |
|
- |
| Cl.7.1 Dimensions(Low-form and tall-form beakers shall observe the dimensions specified in Table 1 and thick-walled
beakers the dimensions specifed in Table 2. The tolerances on the external diameter shall be ±5 % of
the value given in the tables.) |
- |
0 |
|
- |
| Cl.7.2 Radius at base(Beakers having a nominal capacity of 250 ml or greater shall have an external radius at the junction
between the base and the side of 10 % to 20 % of the external diameter.) |
- |
0 |
|
- |
| Cl.7.2 Radius at base(Beakers having a nominal capacity less than 250 ml shall have a minimum radius at the junction
between the base and the side of 5 % of the external diameter.) |
- |
0 |
|
- |
| Cl.7.3 Wall thickness(Substantial local irregularities from the minimum values for wall thickness given in the tables shall
be avoided. That means, the minimum wall thickness shall fall at no place below the values given in
Table 1 and Table 2 and the beakers shall comply with the requirement for thermal shock endurance
specified in 8.5.) |
- |
0 |
|
- |
| Cl.8.1 Base(The design of the base shall enable the beaker to stand vertically on a plane horizontal surface without
spinning or rocking) |
- |
0 |
|
- |
| 8.2 Upper edge(The side of the beaker shall be slightly flared near the brim in a smooth and regular curve. The diameter
of the brim shall be of the order of 5 % to 15 % greater than the diameter of the body. The edge of the
brim shall be finished in a plane parallel with that of the horizontal base.) |
- |
0 |
|
- |
| Cl. 8.3 Spout(The spout shall be shaped so that, when the beaker is filled with water, the water may be poured in a
regular stream clear of the side of the beaker. When the beaker is placed on a horizontal surface and
filling is continued beyond its overflow capacity, the water shall first overflow from the spout and not
from any other part of the brim.) |
- |
0 |
|
- |
| Cl.8.4 Scale(Beakers may be provided with a scale, which should approximately indicate the volume contained
in the beaker.) |
- |
0 |
|
- |
| Cl.8.5 Thermal shock resistance(Beakers shall have a thermal shock resistance of 160 °C when tested in accordance with ISO 718.) |
- |
0 |
|
- |
| Cl.5 Capacity
(a)overflow of capacity of a beaker shall exceed the nominal capacity by at least 5 %;) |
- |
0 |
|
- |
| Cl.5 Capacity
(b) Distance between the levels corresponding to the nominal and overflow capacities shall be at least
10 mm.) |
- |
0 |
|
- |
| Cl.6 Material(Beakers shall be made of borosilicate glass 3.3 in accordance with ISO 3585. The glass shall be
reasonably free from residual strain and from visible glass defects which might impair the safety and
performance of the beaker.) |
- |
0 |
|
- |
| Cl.7.1 Dimensions(Low-form and tall-form beakers shall observe the dimensions specified in Table 1 and thick-walled
beakers the dimensions specifed in Table 2. The tolerances on the external diameter shall be ±5 % of
the value given in the tables.) |
- |
0 |
|
- |
| Cl.7.2 Radius at base(Beakers having a nominal capacity of 250 ml or greater shall have an external radius at the junction
between the base and the side of 10 % to 20 % of the external diameter.) |
- |
0 |
|
- |
| Cl.7.2 Radius at base(Beakers having a nominal capacity less than 250 ml shall have a minimum radius at the junction
between the base and the side of 5 % of the external diameter.) |
- |
0 |
|
- |
| Cl.7.3 Wall thickness(Substantial local irregularities from the minimum values for wall thickness given in the tables shall
be avoided. That means, the minimum wall thickness shall fall at no place below the values given in
Table 1 and Table 2 and the beakers shall comply with the requirement for thermal shock endurance
specified in 8.5.) |
- |
0 |
|
- |
| Cl.8.1 Base(The design of the base shall enable the beaker to stand vertically on a plane horizontal surface without
spinning or rocking) |
- |
0 |
|
- |
| 8.2 Upper edge(The side of the beaker shall be slightly flared near the brim in a smooth and regular curve. The diameter
of the brim shall be of the order of 5 % to 15 % greater than the diameter of the body. The edge of the
brim shall be finished in a plane parallel with that of the horizontal base.) |
- |
0 |
|
- |
| Cl. 8.3 Spout(The spout shall be shaped so that, when the beaker is filled with water, the water may be poured in a
regular stream clear of the side of the beaker. When the beaker is placed on a horizontal surface and
filling is continued beyond its overflow capacity, the water shall first overflow from the spout and not
from any other part of the brim.) |
- |
0 |
|
- |
| Cl.8.4 Scale(Beakers may be provided with a scale, which should approximately indicate the volume contained
in the beaker.) |
- |
0 |
|
- |
| Cl.8.5 Thermal shock resistance(Beakers shall have a thermal shock resistance of 160 °C when tested in accordance with ISO 718.) |
- |
0 |
|
- |
| Cl.5 Capacity
(a)overflow of capacity of a beaker shall exceed the nominal capacity by at least 5 %;) |
- |
0 |
|
- |
| Cl.5 Capacity
(b) Distance between the levels corresponding to the nominal and overflow capacities shall be at least
10 mm.) |
- |
0 |
|
- |
| Cl.6 Material(Beakers shall be made of borosilicate glass 3.3 in accordance with ISO 3585. The glass shall be
reasonably free from residual strain and from visible glass defects which might impair the safety and
performance of the beaker.) |
- |
0 |
|
- |
| Cl.7.1 Dimensions(Low-form and tall-form beakers shall observe the dimensions specified in Table 1 and thick-walled
beakers the dimensions specifed in Table 2. The tolerances on the external diameter shall be ±5 % of
the value given in the tables.) |
- |
0 |
|
- |
| Cl.7.2 Radius at base(Beakers having a nominal capacity of 250 ml or greater shall have an external radius at the junction
between the base and the side of 10 % to 20 % of the external diameter.) |
- |
0 |
|
- |
| Cl.7.2 Radius at base(Beakers having a nominal capacity less than 250 ml shall have a minimum radius at the junction
between the base and the side of 5 % of the external diameter.) |
- |
0 |
|
- |
| Cl.7.3 Wall thickness(Substantial local irregularities from the minimum values for wall thickness given in the tables shall
be avoided. That means, the minimum wall thickness shall fall at no place below the values given in
Table 1 and Table 2 and the beakers shall comply with the requirement for thermal shock endurance
specified in 8.5.) |
- |
0 |
|
- |
| Cl.8.1 Base(The design of the base shall enable the beaker to stand vertically on a plane horizontal surface without
spinning or rocking) |
- |
0 |
|
- |
| 8.2 Upper edge(The side of the beaker shall be slightly flared near the brim in a smooth and regular curve. The diameter
of the brim shall be of the order of 5 % to 15 % greater than the diameter of the body. The edge of the
brim shall be finished in a plane parallel with that of the horizontal base.) |
- |
0 |
|
- |
| Cl. 8.3 Spout(The spout shall be shaped so that, when the beaker is filled with water, the water may be poured in a
regular stream clear of the side of the beaker. When the beaker is placed on a horizontal surface and
filling is continued beyond its overflow capacity, the water shall first overflow from the spout and not
from any other part of the brim.) |
- |
0 |
|
- |
| Cl.8.4 Scale(Beakers may be provided with a scale, which should approximately indicate the volume contained
in the beaker.) |
- |
0 |
|
- |
| Cl.5 Capacity
(a)overflow of capacity of a beaker shall exceed the nominal capacity by at least 5 %;) |
- |
0 |
|
- |
|
09 Apr, 2028 |
-
Included w.e.f 26.11.2025
Cl.6 Material (Beakers shall be made of borosilicate glass 3.3 in accordance with ISO 3585. The glass shall be reasonably free from residual strain and from visible glass defects which might impair the safety and performance of the beaker.) |
| 27 |
IS 17077 : Part 1 (2022) |
PLASTICS ACRYLONITRILE- BUTADIENESTYRENE ABS MOULDING AND EXTRUSION MATERIALS PART 1 DESIGNATION SYSTEM AND SPECIFICATIONS |
All Grade / Type / Size / Designation |
7800 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 4.2.5.1 and 6.1(Vicat Softening temperature,(°C),Clause 5 Table 3, IS 17077 (P-2)) |
- |
1100 |
|
- |
| 4.2.5.2 and 6.2(Charpy Notched Impact Strength,(kj/m²),Clause 5 Table 3, IS 17077 (P-2)) |
- |
1700 |
|
- |
| 4.2.5.3 and 6.3(Melt Mass Flow Rate,(g/10min),Clause 5 Table 3,IS 17077 (P-2)) |
- |
1000 |
|
- |
| 4.2.5.4 and 6.4(Tensile Modulus,(Mpa),Clause 5 Table 3,IS 17077 (P-2)) |
- |
1700 |
|
- |
| 6.5.1.1(Pigments and colourants, IS 9833) |
- |
0 |
|
- |
| 6.5.1.2(Overall migration,(mg/dm²), IS 9845) |
- |
2100 |
|
- |
| 4.2.5.1 and 6.1(Vicat Softening temperature,(°C),Clause 5 Table 3, IS 17077 (P-2)) |
- |
0 |
|
- |
| 4.2.5.2 and 6.2(Charpy Notched Impact Strength,(kj/m²),Clause 5 Table 3, IS 17077 (P-2)) |
- |
0 |
|
- |
| 4.2.5.3 and 6.3(Melt Mass Flow Rate,(g/10min),Clause 5 Table 3,IS 17077 (P-2)) |
- |
0 |
|
- |
| 4.2.5.4 and 6.4(Tensile Modulus,(Mpa),Clause 5 Table 3,IS 17077 (P-2)) |
- |
0 |
|
- |
| 6.5.1.1(Pigments and colourants, IS 9833) |
- |
0 |
|
- |
| 6.5.1.2(Overall migration,(mg/dm²), IS 9845) |
- |
0 |
|
- |
| 4.2.5.1 and 6.1(Vicat Softening temperature,(°C),Clause 5 Table 3, IS 17077 (P-2)) |
- |
0 |
|
- |
| 4.2.5.2 and 6.2(Charpy Notched Impact Strength,(kj/m²),Clause 5 Table 3, IS 17077 (P-2)) |
- |
0 |
|
- |
| 4.2.5.3 and 6.3(Melt Mass Flow Rate,(g/10min),Clause 5 Table 3,IS 17077 (P-2)) |
- |
0 |
|
- |
| 4.2.5.4 and 6.4(Tensile Modulus,(Mpa),Clause 5 Table 3,IS 17077 (P-2)) |
- |
0 |
|
- |
| 6.5.1.1(Pigments and colourants, IS 9833) |
- |
0 |
|
- |
| 6.5.1.2(Overall migration,(mg/dm²), IS 9845) |
- |
0 |
|
- |
|
09 Apr, 2028 |
-
Included w.e.f 12.11.2025
Exclusion: 6.5.1.1 (Pigments and colourants, IS 9833) Pigments and Colourants HPLC not Available |
| 28 |
IS 2267 : Part 1 (2024) |
Polystyrene (ps) moulding and extrusion materials : Part 1 designation system and basis for specification (Third Revision) |
- |
20000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl-4.3(Data block 2, Material) |
- |
1000 |
|
- |
| Cl-4.4(Data block 3) |
- |
1000 |
|
- |
| Cl-4.5.2(Vicat softening temperature) |
- |
10000 |
|
- |
| Cl-4.5.3(Melt mass-flow rate) |
- |
7000 |
|
- |
| Cl-4.2(Data block 1) |
- |
1000 |
|
- |
| Cl-4.3(Data block 2, Material) |
- |
0 |
|
- |
| Cl-4.4(Data block 3) |
- |
0 |
|
- |
| Cl-4.5.2(Vicat softening temperature) |
- |
0 |
|
- |
| Cl-4.5.3(Melt mass-flow rate) |
- |
0 |
|
- |
| Cl-4.2(Data block 1) |
- |
0 |
|
- |
|
09 Apr, 2028 |
-
Included w.e.f. 04.11.2025 |
| 29 |
IS 13960 (1994) |
Thermoplastic strappings - Specification |
All Grade / Type / Size / Designation |
20000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 4(Types) |
- |
14000 |
|
- |
| 5(Manufacture) |
- |
0 |
|
- |
| 6(Workmanship, Finish and Appearance) |
- |
500 |
|
- |
| 7(Requirements) |
- |
5000 |
|
- |
| 8(Packing and Marking) |
- |
500 |
|
- |
| 4(Types) |
- |
0 |
|
Repeated Test Parameter |
| 5(Manufacture) |
- |
0 |
|
Repeated Test Parameter |
| 6(Workmanship, Finish and Appearance) |
- |
0 |
|
Repeated Test Parameter |
| 7(Requirements) |
- |
0 |
|
Repeated Test Parameter |
| 8(Packing and Marking) |
- |
0 |
|
Repeated Test Parameter |
|
09 Apr, 2028 |
-
Included w.e.f.09.10.2025 |
| 30 |
IS 15559 (2004) |
Polyester strapping - Specification |
All Grade / Type / Size / Designation |
5300 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 4.1(Manufacture) |
- |
500 |
|
- |
| 4.1(Manufacture) |
- |
500 |
|
- |
| 4.2(Surface finish) |
- |
250 |
|
- |
| 4.3(Colour) |
- |
250 |
|
- |
| 4.4(Intrinsic Viscosity) |
- |
700 |
|
- |
| 4.5(Freedom from Defects) |
- |
200 |
|
- |
| 4.6, Table-1(Dimensions and Physical Properties) |
- |
300 |
|
- |
| 4.7(Tolerance on Width and Thickness) |
- |
300 |
|
- |
| 5.1, Table-2(Tensile Strength and Elongation) |
- |
300 |
|
- |
| 5.2(Split Resistance) |
- |
450 |
|
- |
| 5.3, Table-3(Camber) |
- |
250 |
|
- |
| Table-1 (2)(Nominal width of strapping) |
- |
200 |
|
- |
| Table-1 (3)(Nominal thickness of strapping) |
- |
200 |
|
- |
| Table-1 (4)(Type) |
- |
100 |
|
- |
| Table-1 (5)(Breaking strength, Min) |
- |
200 |
|
- |
| Table-2 (2)(Tensile strength, kg/mm2) |
- |
200 |
|
- |
| Table-2 (3)(Elongation, %) |
- |
300 |
|
- |
| Table-2 (4)(Type) |
- |
200 |
|
- |
| Table-3 (2)(Camber- Nominal width (mm)) |
- |
200 |
|
- |
| Table-3 (3)(Camber, Max (mm)) |
- |
200 |
|
- |
| 4.1(Manufacture) |
- |
0 |
|
- |
| 4.1(Manufacture) |
- |
0 |
|
- |
| 4.2(Surface finish) |
- |
0 |
|
- |
| 4.3(Colour) |
- |
0 |
|
- |
| 4.4(Intrinsic Viscosity) |
- |
0 |
|
- |
| 4.5(Freedom from Defects) |
- |
0 |
|
- |
| 4.6, Table-1(Dimensions and Physical Properties) |
- |
0 |
|
- |
| 4.7(Tolerance on Width and Thickness) |
- |
0 |
|
- |
| 5.1, Table-2(Tensile Strength and Elongation) |
- |
0 |
|
- |
| 5.2(Split Resistance) |
- |
0 |
|
- |
| 5.3, Table-3(Camber) |
- |
0 |
|
- |
| Table-1 (2)(Nominal width of strapping) |
- |
0 |
|
- |
| Table-1 (3)(Nominal thickness of strapping) |
- |
0 |
|
- |
| Table-1 (4)(Type) |
- |
0 |
|
- |
| Table-1 (5)(Breaking strength, Min) |
- |
0 |
|
- |
| Table-1 (5)(Breaking strength, Min) |
- |
0 |
|
- |
| Table-2 (2)(Tensile strength, kg/mm2) |
- |
0 |
|
- |
| Table-2 (2)(Tensile strength, kg/mm2) |
- |
0 |
|
- |
| Table-2 (3)(Elongation, %) |
- |
0 |
|
- |
| Table-2 (3)(Elongation, %) |
- |
0 |
|
- |
| Table-2 (4)(Type) |
- |
0 |
|
- |
| Table-2 (4)(Type) |
- |
0 |
|
- |
| Table-3 (2)(Camber- Nominal width (mm)) |
- |
0 |
|
- |
| Table-3 (2)(Camber- Nominal width (mm)) |
- |
0 |
|
- |
| Table-3 (3)(Camber, Max (mm)) |
- |
0 |
|
- |
|
09 Apr, 2028 |
-
Included w.e.f 14.10.2025 |
