| 1 |
IS 302 : Part 2 : Sec 30 (2007) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 30 room heaters (First Revision) |
Electric Room heater |
25000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl.6 (Classification) |
- |
0 |
|
- |
| Cl.6 (Classification) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
500 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.3(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.3(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.3(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.4(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.5(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.6 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.8 of IS :302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.9 of IS :302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.10 of IS :302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.11 of IS :302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2009(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.13 of IS 302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.14 of IS302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.14(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.14(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.101(Marking and Instructions) |
- |
0 |
|
- |
| Cl.8 & IS:302-1:2008(Protection Against Access to Live Parts) |
- |
1000 |
|
- |
| Cl.10 & IS:302-1:2008(Power Input and Current) |
- |
2000 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
1500 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
1500 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11.8(Heating) |
- |
0 |
|
- |
| Cl.11.8(Heating) |
- |
0 |
|
- |
| Cl.11.8(Heating) |
- |
0 |
|
- |
| Cl.13 & IS:302-1:2008(Leakage Current & Electric Strength at operating temp. ) |
- |
1000 |
|
- |
| Cl.13 & IS:302-1:2008(Leakage Current & Electric Strength at operating temp. ) |
- |
0 |
|
- |
| Cl.14 & IS:302-1:2008(Transient Over Voltages) |
- |
1000 |
|
- |
| Cl.15 & IS: 302-1:2008(Moisture Resistance
) |
- |
1500 |
|
- |
| Cl.15.3 of IS 302-1:200(Moisture Resistance
) |
- |
0 |
|
- |
| Cl.16 & IS:302-1:2008(Leakage Current & Electric Strength ) |
- |
1000 |
|
- |
| Cl.16 & IS:302-1:2008(Leakage Current & Electric Strength ) |
- |
0 |
|
- |
| Cl.17 & IS:302-1:2008(Over load Protection of Transformers and Associated Circuits ) |
- |
1000 |
|
- |
| Cl.19 & IS:302-1:2008(Abnormal Operation.) |
- |
1000 |
|
- |
| Cl.19 & IS:302-1:2008(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19 & IS:302-1:2008(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19 & IS:302-1:2008(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.101(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.102(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.103(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.104(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.105(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.106(Abnormal Operation.) |
- |
0 |
|
- |
| Table 8 of IS 302-1:2008(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.107(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.108(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.109(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.110(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.111(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.112(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.113(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.114(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.20 & IS:302-1:2008(Stability & Mechanical Hazards) |
- |
1000 |
|
- |
| Cl.21 & IS:302-1:2008)(Mechanical Strength.) |
- |
1000 |
|
- |
| Cl.21.2 of IS 302-1:2008(Mechanical Strength.) |
- |
0 |
|
- |
| Cl.21.101 (Mechanical Strength.) |
- |
0 |
|
- |
| Cl.21.102(Mechanical Strength.) |
- |
0 |
|
- |
| Cl.21.103(Mechanical Strength.) |
- |
0 |
|
- |
| Cl.22.1 of IS 302-1:2008(Construction) |
- |
1000 |
|
- |
| Cl.22.5 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.6 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.7 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.8 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.9 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.11(Construction) |
- |
0 |
|
- |
| Cl.22.12 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.13 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.14 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.15 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.18 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.20 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.21 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.23 & IS:302-1:2008(Internal Wiring
) |
- |
0 |
|
- |
| Cl.23.4 & Cl.29 of 302-1:2008(Internal Wiring
) |
- |
1000 |
|
- |
| Cl.23.5 of 302-1:2008(Internal Wiring
) |
- |
0 |
|
- |
| Cl.23.7 of 302-1:2008(Internal Wiring
) |
- |
0 |
|
- |
| C.23.7 of 302-1:2008(Internal Wiring
) |
- |
0 |
|
- |
| Cl.24.1 of 302-1:2008(Component) |
- |
500 |
|
- |
| Cl.24.1 of 302-1:2008(Component) |
- |
0 |
|
- |
| Cl.24.1.3 (Component) |
- |
0 |
|
- |
| Cl.24.1.3 (Component) |
- |
0 |
|
- |
| Cl.24.1.3 (Component) |
- |
0 |
|
- |
| Cl.24.1.3 (Component) |
- |
0 |
|
- |
| C.24.1.4(Component) |
- |
0 |
|
- |
| C.24.2 of 302-1:2008(Component) |
- |
0 |
|
- |
| Cl.24.10(Component) |
- |
0 |
|
- |
| Cl.25.1 of 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl. 25.2 of IS 3021:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl. 25.3 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
1000 |
|
- |
| Cl. 25.4 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.5 of 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.6 of 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.7.(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.8(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl. 25.9(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.10 of 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl. 25.11(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl. 25.12(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl. 25.13(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.14 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.15 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.15 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.17 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.18(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.20(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.26.1 of IS 302-1:2008(Terminal for External Conductors
) |
- |
0 |
|
- |
| Cl.26.10 of IS 302-1:2008(Terminal for External Conductors
) |
- |
1000 |
|
- |
| Cl.26.11 of IS 302-1:2008(Terminal for External Conductors
) |
- |
0 |
|
- |
| Cl.27.1 of 302-1:2008(Provision for Earthing.) |
- |
0 |
|
- |
| Cl.27.5 of 302-1:2008(Provision for Earthing.) |
- |
0 |
|
- |
| Cl.28 of 302-1:2008(Screws and Connections.) |
- |
1000 |
|
- |
| Cl.29 & IS:302-1:2008(Clearances, Creepage Distances and Solid Insulation) |
- |
1000 |
|
- |
| Cl.29 & IS:302-1:2008(Clearances, Creepage Distances and Solid Insulation) |
- |
0 |
|
- |
| Cl.30 & IS:302-1:2008(Resistance to Heat and Fire) |
- |
1000 |
|
- |
| Cl.30.2.2 of 302-1:2008(Resistance to Heat and Fire) |
- |
0 |
|
- |
| Cl.31 & IS:302-1:2008(Resistance to Rusting.) |
- |
1000 |
|
- |
| Cl.31 of IS:302-1:2008(Resistance to Rusting.) |
- |
0 |
|
- |
| Cl.30.2 of 302-1:2008(Resistance to Heat and Fire : Resistance to fire) |
- |
0 |
|
- |
| Cl.30.1 of IS:302-1:2008(Resistance to Heat and Fire: Resistance to heat. ) |
- |
0 |
|
- |
| Cl.29.2 of IS:302-1:2008(Clearances, Creepage Distances and Solid Insulation : Creepage Distance) |
- |
0 |
|
- |
| Cl.29.1 of IS:302-1:2008(Clearances, Creepage Distances and Solid Insulation : Clearance ) |
- |
0 |
|
- |
| Cl.28 of 302-1:2008(Screws and Connections.) |
- |
0 |
|
- |
| Cl.27.5 of 302-1:2008(Provision for Earthing : ECR) |
- |
1000 |
|
- |
| Cl.27.1 of 302-1:2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.26 of IS 302-1:2008(Terminal for External Conductors
) |
- |
0 |
|
- |
| Cl.25.18 of 302-1:2008(Supply Connection and External Flexible Cords : Arrangement of cord anchorages ) |
- |
0 |
|
- |
| Cl.25.15 of IS 302-1:2008(Supply Connection and External Flexible Cords : Cord grip test - displacement) |
- |
0 |
|
- |
| Cl.25.15 of IS 302-1:2008(Supply Connection and External Flexible Cords : Cord grip test - strain at terminals ) |
- |
0 |
|
- |
| Cl. 25.13 of 302-1:2008(Supply Connection and External Flexible Cords : Inlet opening of supply cords ) |
- |
0 |
|
- |
| Cl. 25.12 of 302-1:2008(Supply Connection and External Flexible Cords : Moulding of cords ) |
- |
0 |
|
- |
| Cl.25.10 of 302-1:2008(Supply Connection and External Flexible Cords : Colour of earthing wire ) |
- |
0 |
|
- |
| Cl. 25.9 of 302-1:2008(Supply Connection and External Flexible Cords : Contact with sharp edge ) |
- |
0 |
|
- |
| Cl.25.8 of 302-1:2008(Supply Connection and External Flexible Cords : Resistance of supply wires ) |
- |
0 |
|
- |
| Cl.25.7 of IS:302-2-30:2007(Supply Connection and External Flexible Cords : Supply cords material ) |
- |
0 |
|
- |
| Cl.25.5 of 302-1:2008(Supply Connection and External Flexible Cords : Type of attachments ) |
- |
0 |
|
- |
| Cl.25.1 of 302-1:2008(Supply Connection and External Flexible Cords : Means of connection ) |
- |
0 |
|
- |
| Cl.24 of IS:302-2-30:2007(Component) |
- |
0 |
|
- |
| Cl.23.7 of 302-1:2008(Internal Wiring : Colour of earting conductor
) |
- |
0 |
|
- |
| Cl.23 of IS:302-1:2008(Internal Wiring
) |
- |
0 |
|
- |
| Cl.22.106 of IS:302-2-30:2007(Construction : Checking of thermostats, timers or similar means for visibl glowing radiant heaters) |
- |
0 |
|
- |
| Cl.22.106 of IS:302-2-30:2007(Construction : Checking of openings on the underside) |
- |
0 |
|
- |
| Cl.22.102 & Cl 22.103 of IS:302-2-30:2007(Construction : Fireguard ) |
- |
0 |
|
- |
| Cl.22.101 of IS:302-2-30:2007(Construction : Prevention to contact with heating element) |
- |
0 |
|
- |
| Cl.22.24 of IS:302-2-30:2007(Construction : test of bare heating element) |
- |
0 |
|
- |
| Cl.22.18 of IS 302-1:2008(Construction : Resistance to corrosion ) |
- |
0 |
|
- |
| Cl.22.15 of IS 302-1:2008(Construction : Storage hooks for flexible cords) |
- |
0 |
|
- |
| Cl.22.14 of IS 302-1:2008(Construction : ragged and sharp edges) |
- |
0 |
|
- |
| Cl.22.13 of IS 302-1:2008(Construction : Position of handles ) |
- |
0 |
|
- |
| Cl.22.12 of IS 302-1:2008(Construction : Fixing of Handle, knobs,grips,lever and similer parts ) |
- |
0 |
|
- |
| Cl.22.11 of IS 302-1:2008(Construction : Fixing of non detachable parts ) |
- |
0 |
|
- |
| Cl.22.7 of IS:302-2-30:2007(Construction : Pressure test of oil heater ) |
- |
0 |
|
- |
| Cl.21.101 of IS:302-2-30:2007(Mechanical Strength : fire gaurd deformation test ) |
- |
0 |
|
- |
| Cl.21.2 of IS 302-1:2008(Mechanical Strength : Pentration by sharp implementation ) |
- |
0 |
|
- |
| Cl.21.1 of IS:302-1:2008)(Mechanical Strength : Rough handling ) |
- |
0 |
|
- |
| Cl.20 of IS:302-2-30:2007(Stability of Mechanical Hazards) |
- |
0 |
|
- |
| Cl.19.114 of IS:302-2-30:2007(Abnormal Operation : the temp. of the surface of the container for oil heaters ) |
- |
0 |
|
- |
| Cl.19.112 of IS:302-2-30:2007(Abnormal Operation : Ignition of bleached cotton gauge) |
- |
0 |
|
- |
| Cl.19.111 of IS:302-2-30:2007(Abnormal Operation : Ignition of flannelette for Visibly glowing heaters) |
- |
0 |
|
- |
| Cl.19.110 of IS:302-2-30:2007(Abnormal Operation : operation against wall for visibly glowing radiant heaters ) |
- |
0 |
|
- |
| Cl.19.109 of IS:302-2-30:2007(Abnormal Operation : operation against wall for fan heater ) |
- |
0 |
|
- |
| Cl.19.106 of IS:302-2-30:2007(Abnormal Operation : Locked rotor of fan hetear ) |
- |
0 |
|
- |
| Cl.19.103 , Cl 19.104 of IS:302-2-30:2007(Abnormal Operation : Operation after Covering by cotton) |
- |
0 |
|
- |
| Cl.19 of IS:302-2-30:2007(Abnormal Operation : High Voltage ) |
- |
0 |
|
- |
| Cl.19 of IS:302-2-30:2007(Abnormal Operation : temp rise of supply cord ) |
- |
0 |
|
- |
| Cl.19 of IS:302-2-30:2007(Abnormal Operation : Temp rise of test corner ) |
- |
0 |
|
- |
| Cl.19 of IS:302-1:2008(Abnormal Operation : Emission of molten or poisonous or ignitable gas) |
- |
0 |
|
- |
| Cl.16 of IS:302-1:2008(Leakage current and Electric strength (After humidity): Electric Strentgh ) |
- |
0 |
|
- |
| Cl.16 of IS:302-1:2008(Leakage current and Electric strength (After humidity): Leakage current ) |
- |
0 |
|
- |
| Cl.15 of IS 302-1:2008(Moisture Resistance
) |
- |
0 |
|
- |
| Cl.14 of IS:302-1:2008(Transient Over Voltages) |
- |
0 |
|
- |
| Cl.13 of IS:302-1:2008(Leakage Current of Electric Strength at operating temp. ) |
- |
0 |
|
- |
| Cl.13 of IS:302-1:2008(Leakage Current of Electric Strength at operating temp. ) |
- |
0 |
|
- |
| Cl.11 of IS:302-2:30: 2007(Heating : Room temperature) |
- |
0 |
|
- |
| Cl.11.8 of IS:302-2:30: 2007(Heating : For liquid filled radiators the temp. rise of the outer surface of the liquid container) |
- |
0 |
|
- |
| Cl.11 of IS:302-2:30: 2007(Heating : Temperature rise in winding) |
- |
0 |
|
- |
| Cl.11 of IS:302-2:30: 2007(Heating : Air-outlet grills) |
- |
0 |
|
- |
| Cl.11 of IS:302-2:30: 2007(Heating : Surfaces of handles, knobs, grips and similar parts) |
- |
0 |
|
- |
| Cl.11 of IS:302-2:30: 2007(Heating : Wooden supports, walls, ceiling and floor of the test corner) |
- |
0 |
|
- |
| Cl.11 of IS:302-2:30: 2007(Heating : PVC Insulation ) |
- |
0 |
|
- |
| Cl.10 of IS:302-1:2008(Power Input and Current) |
- |
0 |
|
- |
| Cl.8 of IS:302-1:2008(Protection Against Access to Live Parts) |
- |
0 |
|
- |
| Cl.7.101 of IS:302-2:30: 2007(Marking and Instructions : standard mark. ) |
- |
0 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions : Visibility of marking concerning covering) |
- |
0 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions : discernibility from the out side ) |
- |
0 |
|
- |
| Cl.7.14 of IS:302-2:30: 2007(Marking and Instructions : Height of “Do not cover”) |
- |
0 |
|
- |
| Cl.7.14 of IS:302-2:30: 2007(Marking and Instructions : height of symbol) |
- |
0 |
|
- |
| Cl.7.14 of IS302-1:2008(Marking and Instructions : Legibility and durability ) |
- |
0 |
|
- |
| Cl.7.13 of IS 302-1:2008(Marking and Instructions : Languge of instruction and texts ) |
- |
0 |
|
- |
| Cl.7.11 of IS :302-1:2008(Marking and Instructions : Controls ) |
- |
0 |
|
- |
| Cl.7.9 of IS :302-1:2008(Marking and Instructions : switches ) |
- |
0 |
|
- |
| Cl.7.8 of IS :302-1:2008(Marking and Instructions : terminals ) |
- |
0 |
|
- |
| Cl.7.6 of IS:302-1:2008(Marking and Instructions : Symbols ) |
- |
0 |
|
- |
| Cl.7.5 of IS:302-1:2008(Marking and Instructions : upper of lower limit of the rated power input ) |
- |
0 |
|
- |
| Cl 7.1 & Cl.7.6 of IS:302-2:30: 2007(Marking and Instructions : Do not cover ) |
- |
0 |
|
- |
| Cl.7.1 of IS:302-1:2008(Marking and Instructions : Country of manufacture ) |
- |
0 |
|
- |
| Cl.7.1 of IS:302-1:2008(Marking and Instructions : Symbol for Class-II ) |
- |
0 |
|
- |
| Cl.7.1 of IS:302-1:2008(Marking and Instructions : Model or type ) |
- |
0 |
|
- |
| Cl.7.1 of IS:302-1:2008(Marking and Instructions : Name , trade-mark or identification mark of the manufacturer ) |
- |
0 |
|
- |
| Cl.7.1 of IS:302-1:2008(Marking and Instructions : rated power input ) |
- |
0 |
|
- |
| Cl.7.1 of IS:302-1:2008(Marking and Instructions : Nature of supply ) |
- |
0 |
|
- |
| Cl.7.1 of IS:302-1:2008(Marking and Instructions : Rated Voltage ) |
- |
0 |
|
- |
| Cl.25.20 of 302-1:2008(Supply Connection and External Flexible Cords : Additional insulation ) |
- |
0 |
|
- |
|
29 Apr, 2027 |
- - |
| 2 |
IS 4250 (1980) |
Specification for domestic electric food - Mixers (Liquidizers And Grinders) (First Revision) |
Domestic Electric Food-Mixers, Juicer, Grinder (Liquidizes and Grinders) |
25000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 6(Classification- IS 302-1 ) |
- |
0 |
|
- |
| 6(Classification- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
1000 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.2(Marking) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.4(Marking) |
- |
0 |
|
- |
| 7.5(Marking) |
- |
0 |
|
- |
| 7.6(Marking) |
- |
0 |
|
- |
| 8( Protection Against Electric Shock, IS 302-1) |
- |
1000 |
|
- |
| 10(Power Input and Current, IS 302-1) |
- |
2000 |
|
- |
| 11(Heating, IS 302-1) |
- |
2000 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 13(Electrical Insulation and Leakage Current at Operating Temperature: Leakage current, IS 302-1) |
- |
1000 |
|
- |
| 13(Electrical Insulation and Leakage Current at Operating Temperature: High Voltage, IS 302-1) |
- |
0 |
|
- |
| 14(Transient Over Voltages, IS 302-1) |
- |
1000 |
|
- |
| 15.1(Moisture Resistance, IS 302-1) |
- |
1000 |
|
- |
| 15.2(Moisture Resistance-Spillage test) |
- |
0 |
|
- |
| 15(Moisture Resistance, IS 302-1) |
- |
0 |
|
- |
| 16(Electrical Insulation and Leakage Current at Operating Temperature: Leakage current, IS 302-1) |
- |
1000 |
|
- |
| 16(Electrical Insulation and Leakage Current at Operating Temperature: High Voltage, IS 302-1) |
- |
0 |
|
- |
| 19(Abnormal Operation, IS 302-1) |
- |
1000 |
|
- |
| 19(Abnormal Operation, IS 302-1) |
- |
0 |
|
- |
| 19(Abnormal Operation, IS 302-1) |
- |
0 |
|
- |
| 19(Abnormal Operation, IS 302-1) |
- |
0 |
|
- |
| 20(Stability & Mechanical Hazards, IS 302-1) |
- |
500 |
|
- |
| 20(Stability & Mechanical Hazards, IS 302-1) |
- |
0 |
|
- |
| 21(Mechanical Strength, IS 302-1) |
- |
500 |
|
- |
| 21(Mechanical Strength, IS 302-1) |
- |
0 |
|
- |
| 22.1(Construction, IS 302-1) |
- |
0 |
|
- |
| 22.2(Construction) |
- |
0 |
|
- |
| 22.3(Construction) |
- |
0 |
|
- |
| 22.4(Construction) |
- |
0 |
|
- |
| 22.5(Construction) |
- |
0 |
|
- |
| 22.6(Construction) |
- |
0 |
|
- |
| 22.8(Construction) |
- |
0 |
|
- |
| 22.9(Construction) |
- |
0 |
|
- |
| 22.1(Construction) |
- |
0 |
|
- |
| 23(Internal Wiring, IS 302-1) |
- |
1000 |
|
- |
| 23(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 24.1(Components, IS 302-1) |
- |
0 |
|
- |
| 24.1(Components, IS 302-1) |
- |
0 |
|
- |
| 24.1(Components, IS 302-1) |
- |
0 |
|
- |
| 24.1(Components, IS 302-1) |
- |
0 |
|
- |
| 24.2(Components) |
- |
0 |
|
- |
| 24.4(Components) |
- |
0 |
|
- |
| 24.5(Components) |
- |
0 |
|
- |
| 24.6(Components) |
- |
0 |
|
- |
| 24.7(Components) |
- |
0 |
|
- |
| 24.8(Components) |
- |
0 |
|
- |
| 24.9(Components) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
1000 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 26(Terminals for External Conductors, IS 302-1) |
- |
1000 |
|
- |
| 27(Provision for Earthing, IS 302-1) |
- |
1000 |
|
- |
| 27(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 28(Screws & Connections, IS 302-1) |
- |
1000 |
|
- |
| 29(Clearances and Distances through Insulation, IS 302-1) |
- |
1000 |
|
- |
| 29(Clearances and Distances through Insulation, IS 302-1) |
- |
0 |
|
- |
| 30(Resistance to Heat, Fire, Tracking, IS 302-1) |
- |
1000 |
|
- |
| 30(Resistance to Heat, Fire, Tracking, IS 302-1) |
- |
0 |
|
- |
| 31(Resistance of Rusting, IS 302-1) |
- |
1000 |
|
- |
| 34.2(Operational tests- Grinding coffee (for machines which have a dry grinding arrangement)) |
- |
0 |
|
- |
| 34.2(Operational tests- Grinding coffee (for machines which have a dry grinding arrangement)) |
- |
0 |
|
- |
| 34.2(Operational tests- Grinding coffee (for machines which have a dry grinding arrangement)) |
- |
0 |
|
- |
| 34.3(Whisking egg whites ) |
- |
0 |
|
- |
| 34.4(IDLI batter-Grinding of black gram) |
- |
0 |
|
- |
| 34.4(IDLI batter-Grinding of rice) |
- |
0 |
|
- |
| 34.4(IDLI batter-Grinding of rice) |
- |
0 |
|
- |
| 34.4(IDLI batter-Grinding of rice) |
- |
0 |
|
- |
| 34.5.1 (a)(Operational test for juicers ) |
- |
0 |
|
- |
| 34.5.1 (b)(Operational test for juicers ) |
- |
0 |
|
- |
| 34.5.2(Operational test for juicers ) |
- |
0 |
|
- |
| 35(Temperature withstand test for bowl) |
- |
0 |
|
- |
| 36(Test for controls ) |
- |
1000 |
|
- |
| 37(Strength of Assembly ) |
- |
500 |
|
- |
| 37(Strength of Assembly ) |
- |
0 |
|
- |
| Cl 37(Strength of assembly) |
- |
0 |
|
- |
| Cl 36(Test for controls) |
- |
500 |
|
- |
| Cl 35(Temperature withstand test for bowl) |
- |
500 |
|
- |
| Cl 34(Operational Tests) |
- |
0 |
|
- |
| Cl.31(Resistance to rusting) |
- |
0 |
|
- |
| Cl.30(Resistance to heat and fire) |
- |
0 |
|
- |
| CL.29(Clearances, Creepage distances and Solid Insulation) |
- |
0 |
|
- |
| Cl.28(Screws and connections) |
- |
0 |
|
- |
| Cl.27(Provision for Earthing) |
- |
0 |
|
- |
| Cl.26(Terminals for external conductors) |
- |
0 |
|
- |
| Cl.25(Supply connection and external flexible cords) |
- |
0 |
|
- |
| Cl.24(Components) |
- |
500 |
|
- |
| Cl.23(Internal wiring) |
- |
0 |
|
- |
| Cl.22(Construction) |
- |
0 |
|
- |
| Cl.21(Mechanical Strength) |
- |
0 |
|
- |
| Cl.20(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| Cl.19(Abnormal operation) |
- |
0 |
|
- |
| Cl.18(Endurance) |
- |
1000 |
|
- |
| Cl. 16(Leakage current and Electric strength) |
- |
0 |
|
- |
| Cl.15(Moisture Resistance) |
- |
0 |
|
- |
| Cl.14(Transient Over voltage) |
- |
0 |
|
- |
| Cl.13(Leakage current and Electric strength at operating temperature) |
- |
0 |
|
- |
| Cl.11(Temperature rise/ Heating) |
- |
0 |
|
- |
| Cl.10(Power Input and Current) |
- |
0 |
|
- |
| Cl.8(Protection against access to live parts/ Protection against electric shock) |
- |
0 |
|
- |
| Cl. 7(Marking and instructions) |
- |
0 |
|
- |
| Cl. 6(Classification) |
- |
0 |
|
- |
| 3(GENERAL REQUIREMENTS) |
- |
0 |
|
- |
| 4(GENERAL NOTES ON TESTS) |
- |
0 |
|
- |
| 5(RATING) |
- |
0 |
|
- |
| 9(Starting, IS 302-1) |
- |
0 |
|
- |
| 6(Classification- IS 302-1 ) |
- |
0 |
|
- |
| 6(Classification- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.2(Marking) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.4(Marking) |
- |
0 |
|
- |
| 7.5(Marking) |
- |
0 |
|
- |
| 7.6(Marking) |
- |
0 |
|
- |
| 8( Protection Against Electric Shock, IS 302-1) |
- |
0 |
|
- |
| 10(Power Input and Current, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 13(Electrical Insulation and Leakage Current at Operating Temperature: Leakage current, IS 302-1) |
- |
0 |
|
- |
| 13(Electrical Insulation and Leakage Current at Operating Temperature: High Voltage, IS 302-1) |
- |
0 |
|
- |
| 14(Transient Over Voltages, IS 302-1) |
- |
0 |
|
- |
| 15.1(Moisture Resistance, IS 302-1) |
- |
0 |
|
- |
| 15.2(Moisture Resistance-Spillage test) |
- |
0 |
|
- |
| 15(Moisture Resistance, IS 302-1) |
- |
0 |
|
- |
| 16(Electrical Insulation and Leakage Current at Operating Temperature: Leakage current, IS 302-1) |
- |
0 |
|
- |
| 16(Electrical Insulation and Leakage Current at Operating Temperature: High Voltage, IS 302-1) |
- |
0 |
|
- |
| 19(Abnormal Operation, IS 302-1) |
- |
0 |
|
- |
| 19(Abnormal Operation, IS 302-1) |
- |
0 |
|
- |
| 19(Abnormal Operation, IS 302-1) |
- |
0 |
|
- |
| 19(Abnormal Operation, IS 302-1) |
- |
0 |
|
- |
| 20(Stability & Mechanical Hazards, IS 302-1) |
- |
0 |
|
- |
| 20(Stability & Mechanical Hazards, IS 302-1) |
- |
0 |
|
- |
| 21(Mechanical Strength, IS 302-1) |
- |
0 |
|
- |
| 21(Mechanical Strength, IS 302-1) |
- |
0 |
|
- |
| 22.1(Construction, IS 302-1) |
- |
0 |
|
- |
| 22.2(Construction) |
- |
0 |
|
- |
| 22.3(Construction) |
- |
0 |
|
- |
| 22.4(Construction) |
- |
0 |
|
- |
| 22.5(Construction) |
- |
0 |
|
- |
| 22.6(Construction) |
- |
0 |
|
- |
| 22.8(Construction) |
- |
0 |
|
- |
| 22.9(Construction) |
- |
0 |
|
- |
| 22.1(Construction) |
- |
0 |
|
- |
| 23(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 24.1(Components, IS 302-1) |
- |
0 |
|
- |
| 24.1(Components, IS 302-1) |
- |
0 |
|
- |
| 24.1(Components, IS 302-1) |
- |
0 |
|
- |
| 24.1(Components, IS 302-1) |
- |
0 |
|
- |
| 24.2(Components) |
- |
0 |
|
- |
| 24.4(Components) |
- |
0 |
|
- |
| 24.5(Components) |
- |
0 |
|
- |
| 24.6(Components) |
- |
0 |
|
- |
| 24.7(Components) |
- |
0 |
|
- |
| 24.8(Components) |
- |
0 |
|
- |
| 24.9(Components) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 26(Terminals for External Conductors, IS 302-1) |
- |
0 |
|
- |
| 27(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 28(Screws & Connections, IS 302-1) |
- |
0 |
|
- |
| 29(Clearances and Distances through Insulation, IS 302-1) |
- |
0 |
|
- |
| 29(Clearances and Distances through Insulation, IS 302-1) |
- |
0 |
|
- |
| 30(Resistance to Heat, Fire, Tracking, IS 302-1) |
- |
0 |
|
- |
| 30(Resistance to Heat, Fire, Tracking, IS 302-1) |
- |
0 |
|
- |
| 31(Resistance of Rusting, IS 302-1) |
- |
0 |
|
- |
| 34.2(Operational tests- Grinding coffee (for machines which have a dry grinding arrangement)) |
- |
0 |
|
- |
| 34.2(Operational tests- Grinding coffee (for machines which have a dry grinding arrangement)) |
- |
0 |
|
- |
| 34.2(Operational tests- Grinding coffee (for machines which have a dry grinding arrangement)) |
- |
0 |
|
- |
| 34.3(Whisking egg whites ) |
- |
0 |
|
- |
| 34.4(IDLI batter-Grinding of black gram) |
- |
0 |
|
- |
| 34.4(IDLI batter-Grinding of rice) |
- |
0 |
|
- |
| 34.4(IDLI batter-Grinding of rice) |
- |
0 |
|
- |
| 34.4(IDLI batter-Grinding of rice) |
- |
0 |
|
- |
| 34.5.1 (a)(Operational test for juicers ) |
- |
0 |
|
- |
| 34.5.1 (b)(Operational test for juicers ) |
- |
0 |
|
- |
| 34.5.2(Operational test for juicers ) |
- |
0 |
|
- |
| 35(Temperature withstand test for bowl) |
- |
0 |
|
- |
| 36(Test for controls ) |
- |
0 |
|
- |
| 37(Strength of Assembly ) |
- |
0 |
|
- |
| 37(Strength of Assembly ) |
- |
0 |
|
- |
| Cl 37(Strength of assembly) |
- |
0 |
|
- |
| Cl 36(Test for controls) |
- |
0 |
|
- |
| Cl 35(Temperature withstand test for bowl) |
- |
0 |
|
- |
| Cl 34(Operational Tests) |
- |
0 |
|
- |
| Cl.31(Resistance to rusting) |
- |
0 |
|
- |
| Cl.30(Resistance to heat and fire) |
- |
0 |
|
- |
| CL.29(Clearances, Creepage distances and Solid Insulation) |
- |
0 |
|
- |
| Cl.28(Screws and connections) |
- |
0 |
|
- |
| Cl.27(Provision for Earthing) |
- |
0 |
|
- |
| Cl.26(Terminals for external conductors) |
- |
0 |
|
- |
| Cl.25(Supply connection and external flexible cords) |
- |
0 |
|
- |
| Cl.24(Components) |
- |
0 |
|
- |
| Cl.23(Internal wiring) |
- |
0 |
|
- |
| Cl.22(Construction) |
- |
0 |
|
- |
| Cl.21(Mechanical Strength) |
- |
0 |
|
- |
| Cl.20(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| Cl.19(Abnormal operation) |
- |
0 |
|
- |
| Cl.18(Endurance) |
- |
0 |
|
- |
| Cl. 16(Leakage current and Electric strength) |
- |
0 |
|
- |
| Cl.15(Moisture Resistance) |
- |
0 |
|
- |
| Cl.14(Transient Over voltage) |
- |
0 |
|
- |
| Cl.13(Leakage current and Electric strength at operating temperature) |
- |
0 |
|
- |
| Cl.11(Temperature rise/ Heating) |
- |
0 |
|
- |
| Cl.10(Power Input and Current) |
- |
0 |
|
- |
| Cl.8(Protection against access to live parts/ Protection against electric shock) |
- |
0 |
|
- |
| Cl. 7(Marking and instructions) |
- |
0 |
|
- |
| Cl. 6(Classification) |
- |
0 |
|
- |
| 3(GENERAL REQUIREMENTS) |
- |
0 |
|
- |
| 4(GENERAL NOTES ON TESTS) |
- |
0 |
|
- |
| 5(RATING) |
- |
0 |
|
- |
| 9(Starting, IS 302-1) |
- |
0 |
|
- |
|
29 Apr, 2027 |
- - |
| 3 |
IS 368 (2014) |
Electric immersion water heaters - Specification (Fifth Revision) |
Electric Immersion Water heater |
25000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl.6 of IS 302-‐2-‐201:2008(Classification) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
1000 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.8 of IS 302‐2-201: 2008(Protection Against Access to Live Parts) |
- |
1000 |
|
- |
| Cl.10 of IS 302‐2‐201:2008(Power Input and Current ) |
- |
2000 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
1500 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl. 12 of IS 368:2014(Operation under overload conditions of appliances with heating elements) |
- |
1000 |
|
- |
| Cl.13 of IS 302-2-201: 2008(Leakage Current & Electric Strength at Operating Temperature) |
- |
1000 |
|
- |
| Cl.13 of IS 302-2-201: 2009(Leakage Current & Electric Strength at Operating Temperature) |
- |
0 |
|
- |
| Cl.14 of IS 302‐2-201:2008(Transient Over Voltages ) |
- |
1000 |
|
- |
| Cl.15 of IS 302-2-201:2008(Moisture Resistance ) |
- |
1000 |
|
- |
| Cl.15 of IS 302-2-201:2008(Moisture Resistance ) |
- |
0 |
|
- |
| Cl.16 of IS 302-2-201:2008(Leakage Current & Electric Strength) |
- |
1000 |
|
- |
| Cl.16 of IS 302-2-201:2008(Leakage Current & Electric Strength) |
- |
0 |
|
- |
| Cl.17 of IS 302‐2-201: 2008(Overload Protection of Transformers & Associated Circuits) |
- |
500 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
1000 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
0 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
0 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
0 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
0 |
|
- |
| Cl.20 of IS 302-2-201: 2008(Stability & Mechanical Hazards) |
- |
1000 |
|
- |
| Cl.21 of IS 302-2-201: 2008(Mechanical Strength ) |
- |
1000 |
|
- |
| Cl.21 of IS 302-2-201: 2008(Mechanical Strength ) |
- |
0 |
|
- |
| Cl.21 of IS 302-2-201: 2008(Mechanical Strength ) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-201: 2008(Construction) |
- |
1000 |
|
- |
| Cl.22 of IS 302-2-201: 2008(Construction) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-201: 2008(Construction) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-201: 2008(Construction) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
500 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
500 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
500 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
500 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.28 of IS 302-2-201: 2008(Screws & Connections ) |
- |
500 |
|
- |
| Cl.29 of IS 302-2‐201:2008(Clearances, Creepage Distances and Solid Insulation ) |
- |
1000 |
|
- |
| Cl.29 of IS 302-2‐201:2008(Clearances, Creepage Distances and Solid Insulation ) |
- |
0 |
|
- |
| Cl.30 of IS 302-2‐201:2008(Resistance to Heat and Fire ) |
- |
1000 |
|
- |
| Cl.30 of IS 302-2‐201:2008(Resistance to Heat and Fire ) |
- |
0 |
|
- |
| Cl.31 of IS 302-2-201:2008(Resistance of Rusting ) |
- |
1000 |
|
- |
| 4(GENERAL REQUIREMENT) |
- |
0 |
|
- |
| 5(GENERAL CONDITIONS FOR THE TESTS) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-201: 2008(Terminals for External Conductors) |
- |
1500 |
|
- |
| Cl.18 of IS 368:2014(Endurance) |
- |
3000 |
|
- |
| Cl.6 of IS 302-‐2-‐201:2008(Classification) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.8 of IS 302‐2-201: 2008(Protection Against Access to Live Parts) |
- |
0 |
|
- |
| Cl.10 of IS 302‐2‐201:2008(Power Input and Current ) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl. 12 of IS 368:2014(Operation under overload conditions of appliances with heating elements) |
- |
0 |
|
- |
| Cl.13 of IS 302-2-201: 2008(Leakage Current & Electric Strength at Operating Temperature) |
- |
0 |
|
- |
| Cl.13 of IS 302-2-201: 2009(Leakage Current & Electric Strength at Operating Temperature) |
- |
0 |
|
- |
| Cl.14 of IS 302‐2-201:2008(Transient Over Voltages ) |
- |
0 |
|
- |
| Cl.15 of IS 302-2-201:2008(Moisture Resistance ) |
- |
0 |
|
- |
| Cl.15 of IS 302-2-201:2008(Moisture Resistance ) |
- |
0 |
|
- |
| Cl.16 of IS 302-2-201:2008(Leakage Current & Electric Strength) |
- |
0 |
|
- |
| Cl.16 of IS 302-2-201:2008(Leakage Current & Electric Strength) |
- |
0 |
|
- |
| Cl.17 of IS 302‐2-201: 2008(Overload Protection of Transformers & Associated Circuits) |
- |
0 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
0 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
0 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
0 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
0 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
0 |
|
- |
| Cl.20 of IS 302-2-201: 2008(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| Cl.21 of IS 302-2-201: 2008(Mechanical Strength ) |
- |
0 |
|
- |
| Cl.21 of IS 302-2-201: 2008(Mechanical Strength ) |
- |
0 |
|
- |
| Cl.21 of IS 302-2-201: 2008(Mechanical Strength ) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-201: 2008(Construction) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-201: 2008(Construction) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-201: 2008(Construction) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-201: 2008(Construction) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.28 of IS 302-2-201: 2008(Screws & Connections ) |
- |
0 |
|
- |
| Cl.29 of IS 302-2‐201:2008(Clearances, Creepage Distances and Solid Insulation ) |
- |
0 |
|
- |
| Cl.29 of IS 302-2‐201:2008(Clearances, Creepage Distances and Solid Insulation ) |
- |
0 |
|
- |
| Cl.30 of IS 302-2‐201:2008(Resistance to Heat and Fire ) |
- |
0 |
|
- |
| Cl.30 of IS 302-2‐201:2008(Resistance to Heat and Fire ) |
- |
0 |
|
- |
| Cl.31 of IS 302-2-201:2008(Resistance of Rusting ) |
- |
0 |
|
- |
| 4(GENERAL REQUIREMENT) |
- |
0 |
|
- |
| 5(GENERAL CONDITIONS FOR THE TESTS) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-201: 2008(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.18 of IS 368:2014(Endurance) |
- |
0 |
|
- |
| Cl.6 of IS 302-‐2-‐201:2008(Classification) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
0 |
|
- |
| Cl.8 of IS 302‐2-201: 2008(Protection Against Access to Live Parts) |
- |
0 |
|
- |
| Cl.10 of IS 302‐2‐201:2008(Power Input and Current ) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
0 |
|
- |
| Cl. 12 of IS 368:2014(Operation under overload conditions of appliances with heating elements) |
- |
0 |
|
- |
| Cl.13 of IS 302-2-201: 2008(Leakage Current & Electric Strength at Operating Temperature) |
- |
0 |
|
- |
| Cl.13 of IS 302-2-201: 2009(Leakage Current & Electric Strength at Operating Temperature) |
- |
0 |
|
- |
| Cl.14 of IS 302‐2-201:2008(Transient Over Voltages ) |
- |
0 |
|
- |
| Cl.15 of IS 302-2-201:2008(Moisture Resistance ) |
- |
0 |
|
- |
| Cl.15 of IS 302-2-201:2008(Moisture Resistance ) |
- |
0 |
|
- |
| Cl.16 of IS 302-2-201:2008(Leakage Current & Electric Strength) |
- |
0 |
|
- |
| Cl.16 of IS 302-2-201:2008(Leakage Current & Electric Strength) |
- |
0 |
|
- |
| Cl.17 of IS 302‐2-201: 2008(Overload Protection of Transformers & Associated Circuits) |
- |
0 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
0 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
0 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
0 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
0 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
0 |
|
- |
| Cl.20 of IS 302-2-201: 2008(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| Cl.21 of IS 302-2-201: 2008(Mechanical Strength ) |
- |
0 |
|
- |
| Cl.21 of IS 302-2-201: 2008(Mechanical Strength ) |
- |
0 |
|
- |
| Cl.21 of IS 302-2-201: 2008(Mechanical Strength ) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-201: 2008(Construction) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-201: 2008(Construction) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-201: 2008(Construction) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-201: 2008(Construction) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
0 |
|
- |
| Cl.28 of IS 302-2-201: 2008(Screws & Connections ) |
- |
0 |
|
- |
| Cl.29 of IS 302-2‐201:2008(Clearances, Creepage Distances and Solid Insulation ) |
- |
0 |
|
- |
| Cl.29 of IS 302-2‐201:2008(Clearances, Creepage Distances and Solid Insulation ) |
- |
0 |
|
- |
| Cl.30 of IS 302-2‐201:2008(Resistance to Heat and Fire ) |
- |
0 |
|
- |
| Cl.30 of IS 302-2‐201:2008(Resistance to Heat and Fire ) |
- |
0 |
|
- |
| Cl.31 of IS 302-2-201:2008(Resistance of Rusting ) |
- |
0 |
|
- |
| 4(GENERAL REQUIREMENT) |
- |
0 |
|
- |
| 5(GENERAL CONDITIONS FOR THE TESTS) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-201: 2008(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.18 of IS 368:2014(Endurance) |
- |
0 |
|
- |
|
29 Apr, 2027 |
- - |
| 4 |
IS 302 : Part 2 : Sec 6 (2009) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 6 cooking ranges, hobs, ovens and similar appliances (First Revision) |
Induction Oven, cooking ranges, hobs, ovens and similar appliances |
25000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 6.0(Classification) |
- |
1000 |
|
- |
| 7.0(Marking and instructions) |
- |
1000 |
|
- |
| 8.0(Protection against access to live part test) |
- |
1000 |
|
- |
| 10.0(Power Input and current test) |
- |
3000 |
|
- |
| 11.0(Heating test) |
- |
2000 |
|
- |
| 13.0(Leakage current and electric strength test) |
- |
1000 |
|
- |
| 14.0(Transient voltages) |
- |
1000 |
|
- |
| 15.0(Moisture Resistance) |
- |
2000 |
|
- |
| 16.0(Leakage current and electric strength test) |
- |
1000 |
|
- |
| 17.0(Overload protection of transformers test) |
- |
1000 |
|
- |
| 19.0(Abnormal Operations) |
- |
1000 |
|
- |
| 20.0(Stability and Mechanical Hazards) |
- |
500 |
|
- |
| 21.0(Mechanical Strength) |
- |
1000 |
|
- |
| 22.0(Construction verification related tests) |
- |
1000 |
|
- |
| 23.0(Internal wiring) |
- |
1000 |
|
- |
| 24.0(Components) |
- |
500 |
|
- |
| 25.0(Supply connections and External Flexible Cords) |
- |
1000 |
|
- |
| 26.0(Terminal for External Conductors) |
- |
1000 |
|
- |
| 27.0(Provision for Earthing) |
- |
500 |
|
- |
| 28.0(Screws and connections) |
- |
500 |
|
- |
| 29.0(Clearances and Creepage distances and solid insulation) |
- |
1000 |
|
- |
| 30.0(Resistance to heat and fire) |
- |
1000 |
|
- |
| 31.0(Resistance to rusting) |
- |
1000 |
|
- |
| 4(General Requirements) |
- |
0 |
|
- |
| 5(General condition for the tests) |
- |
0 |
|
- |
| 6.0(Classification) |
- |
0 |
|
- |
| 7.0(Marking and instructions) |
- |
0 |
|
- |
| 8.0(Protection against access to live part test) |
- |
0 |
|
- |
| 10.0(Power Input and current test) |
- |
0 |
|
- |
| 11.0(Heating test) |
- |
0 |
|
- |
| 13.0(Leakage current and electric strength test) |
- |
0 |
|
- |
| 14.0(Transient voltages) |
- |
0 |
|
- |
| 15.0(Moisture Resistance) |
- |
0 |
|
- |
| 16.0(Leakage current and electric strength test) |
- |
0 |
|
- |
| 17.0(Overload protection of transformers test) |
- |
0 |
|
- |
| 19.0(Abnormal Operations) |
- |
0 |
|
- |
| 20.0(Stability and Mechanical Hazards) |
- |
0 |
|
- |
| 21.0(Mechanical Strength) |
- |
0 |
|
- |
| 22.0(Construction verification related tests) |
- |
0 |
|
- |
| 23.0(Internal wiring) |
- |
0 |
|
- |
| 24.0(Components) |
- |
0 |
|
- |
| 25.0(Supply connections and External Flexible Cords) |
- |
0 |
|
- |
| 26.0(Terminal for External Conductors) |
- |
0 |
|
- |
| 27.0(Provision for Earthing) |
- |
0 |
|
- |
| 28.0(Screws and connections) |
- |
0 |
|
- |
| 29.0(Clearances and Creepage distances and solid insulation) |
- |
0 |
|
- |
| 30.0(Resistance to heat and fire) |
- |
0 |
|
- |
| 31.0(Resistance to rusting) |
- |
0 |
|
- |
| 4(General Requirements) |
- |
0 |
|
- |
| 5(General condition for the tests) |
- |
0 |
|
- |
|
29 Apr, 2027 |
- - |
| 5 |
IS 302 : Part 2 : Sec 14 (2009) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 14 electric kitchen machines (First Revision) |
Hand blenders, food mixers; grain grinders not exceeding 3 l hopper capacity; mixer grinders |
25000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 6(Classification- IS 302-1 ) |
- |
500 |
|
- |
| 6(Classification- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.3(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.4(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.6(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.7(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.8(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.11(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.12(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.13(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.14(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.15(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.101(Marking) |
- |
0 |
|
- |
| 8( Protection Against Electric Shock, IS 302-1) |
- |
1000 |
|
- |
| 10(Power Input and Current, IS 302-1) |
- |
2000 |
|
- |
| 11(Heating, IS 302-1) |
- |
2000 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 13(Electrical Insulation and Leakage Current at Operating Temperature: Leakage current, IS 302-1) |
- |
1000 |
|
- |
| 13(Electrical Insulation and Leakage Current at Operating Temperature: High Voltage, IS 302-1) |
- |
0 |
|
- |
| 14(Transient Over Voltages, IS 302-1) |
- |
1000 |
|
- |
| 15.1(Moisture Resistance, IS 302-1) |
- |
1500 |
|
- |
| 15.2(Moisture Resistance, IS 302-1) |
- |
0 |
|
- |
| 15(Moisture Resistance, IS 302-1) |
- |
0 |
|
- |
| 16(Electrical Insulation and Leakage Current at Operating Temperature: Leakage current, IS 302-1) |
- |
1000 |
|
- |
| 16(Electrical Insulation and Leakage Current at Operating Temperature: High Voltage, IS 302-1) |
- |
0 |
|
- |
| 17(Overload protection of Transformers and Associated Circuits, IS 302-1) |
- |
1000 |
|
- |
| 17(Overload protection of Transformers and Associated Circuits, IS 302-1) |
- |
0 |
|
- |
| 19.7(Abnormal Operation, IS 302-1) |
- |
0 |
|
- |
| 19.8(Abnormal Operation, IS 302-1) |
- |
0 |
|
- |
| 19.9(Abnormal Operation, IS 302-1) |
- |
0 |
|
- |
| 19.1(Abnormal Operation, IS 302-1) |
- |
0 |
|
- |
| 19.101(Abnormal Operation) |
- |
0 |
|
- |
| 19.102(Abnormal Operation) |
- |
0 |
|
- |
| 20.1(Stability & Mechanical Hazards, IS 302-1) |
- |
0 |
|
- |
| 20.2(Stability & Mechanical Hazards, IS 302-1) |
- |
0 |
|
- |
| 20.101(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| 20.102(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| 20.103(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| 20.104(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| 20.105(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| 20.106(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| 20.107(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| 20.108(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| 20.109(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| 20.110(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| 20.111(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| 20.112(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| 20.113(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| 20.114(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| 20.115(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| 20.116(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| 21.1(Mechanical Strength, IS 302-1) |
- |
0 |
|
- |
| 21.2(Mechanical Strength, IS 302-1) |
- |
0 |
|
- |
| 22(Construction, IS 302-1) |
- |
0 |
|
- |
| 22.101(Construction) |
- |
0 |
|
- |
| 22.102(Construction) |
- |
0 |
|
- |
| 23.1(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.2(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.3(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.4(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.5(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.6(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.7(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.8(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.9(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.10(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 24.1(Components, IS 302-1) |
- |
0 |
|
- |
| 24.2(Components, IS 302-1) |
- |
0 |
|
- |
| 24.5(Components, IS 302-1) |
- |
0 |
|
- |
| 24.6(Components, IS 302-1) |
- |
0 |
|
- |
| 25.1(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.5(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.6(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.7(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.8(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 26.9(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.1(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.11(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.12(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.13(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.14(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.14(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.15(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.16(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.17(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.18(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.19(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.2(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.21(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.22(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 26(Terminals for External Conductors, IS 302-1) |
- |
1000 |
|
- |
| 27(Provision for Earthing, IS 302-1) |
- |
1000 |
|
- |
| 27.2(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27.3(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27.4(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27.5(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 28(Screws & Connections, IS 302-1) |
- |
1000 |
|
- |
| 29.1(Clearances, Creepage distances and Solid Insulation, IS 302-1) |
- |
0 |
|
- |
| 29.2(Clearances, Creepage distances and Solid Insulation, IS 302-1) |
- |
0 |
|
- |
| 30.1(Resistance to Heat and Fire, IS 302-1) |
- |
1000 |
|
- |
| 30.2(Resistance to Heat and Fire, IS 302-1) |
- |
1000 |
|
- |
| 31(Resistance of Rusting, IS 302-1) |
- |
1000 |
|
- |
| 4(GENERAL REQUIREMENTS) |
- |
0 |
|
- |
| 5(GENERAL CONDITIONS FOR THE TESTS) |
- |
0 |
|
- |
| 27(Provision for Earthing) |
- |
1000 |
|
- |
| 29(Clearances, Creepage distances and Solid Insulation) |
- |
1000 |
|
- |
|
29 Apr, 2027 |
- - |
| 6 |
IS 8978 (1992) |
Specification for electric instantaneous water heaters (Second Revision) |
Electric instantaneous water heater |
25000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.6 of IS 302-2-35:2017(Classification) |
- |
0 |
|
- |
| Cl.6 of IS 302-2-35:2017(Classification) |
- |
0 |
|
- |
| Cl.8 of IS 302-2-35:2017(Protection Against Access To Live Parts) |
- |
0 |
|
- |
| Cl.10 of IS 302-2- 35:2011(Power Input & Current ) |
- |
0 |
|
- |
| Cl.11 of 302-2-35:2017(Heating) |
- |
0 |
|
- |
| Cl.11 of 302-2-35:2017(Heating) |
- |
0 |
|
- |
| Cl.11 of 302-2-35:2017(Heating) |
- |
0 |
|
- |
| Cl.11 of 302-2-35:2017(Heating) |
- |
0 |
|
- |
| Cl.13 of IS 302-2-35:2017(Leakage Current & Electrical Strength at Operating Temperature ) |
- |
0 |
|
- |
| Cl.13 of IS 302-2-35:2017(Leakage Current & Electrical Strength at Operating Temperature ) |
- |
0 |
|
- |
| Cl.14 of IS 302-2-35:2017(Transient Over Voltages ) |
- |
0 |
|
- |
| Cl.15 of IS 302-2-35-2011(Moisture Resistance ) |
- |
0 |
|
- |
| Cl.15 of IS 302-2-35-2011(Moisture Resistance ) |
- |
0 |
|
- |
| Cl.16 of IS 302-2-35:2011(Leakage Current and Electric Strength) |
- |
0 |
|
- |
| Cl.16 of IS 302-2-35:2011(Leakage Current and Electric Strength) |
- |
0 |
|
- |
| Cl.17 IS 302-2-35:2017(Overload Protection of Transformers & Associated circuits ) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-35:2017(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-35:2017(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-35:2017(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-35:2017(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-35:2017(Abnormal Operation) |
- |
0 |
|
- |
| Cl.20 of IS 302-2-35-2011(Stability & Mechanical Hazards
) |
- |
0 |
|
- |
| Cl.21.1 of IS 302-2-35-2011(Mechanical strength) |
- |
0 |
|
- |
| Cl. 21.2 of IS 302-1:2008(Mechanical strength) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-35:2017(Component
) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-35:2017(Component
) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-35:2017(Component
) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-35:2017(Component
) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-35:2017(Component
) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-35:2017(Provision for Earthing) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-35:2017(Provision for Earthing) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-35:2017(Provision for Earthing) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-35:2017(Provision for Earthing) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-35:2017(Provision for Earthing) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-35:2017(Provision for Earthing) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-35:2017(Provision for Earthing) |
- |
0 |
|
- |
| Cl.28 of IS 302-2-35:2017(Screws and Connections
) |
- |
0 |
|
- |
| Cl.29 of IS 302-2-35:2017(Clearances, Creepage Distances and Solid Insulation) |
- |
0 |
|
- |
| Cl.29 of IS 302-2-35:2017(Clearances, Creepage Distances and Solid Insulation) |
- |
0 |
|
- |
| Cl.29 of IS 302-2-35:2017(Clearances, Creepage Distances and Solid Insulation) |
- |
0 |
|
- |
| Cl.30 of IS 302-2-35: 2011(Resistance to Heat and Fire) |
- |
0 |
|
- |
| Cl.30 of IS 302-2-35: 2011(Resistance to Heat and Fire) |
- |
0 |
|
- |
| Cl.31 of IS 302-2-35: 2011(Resistance to Rusting
) |
- |
0 |
|
- |
| Cl.10 of IS 8978 : 1992(Finish) |
- |
0 |
|
- |
| Cl.11 of IS 8978 : 1992(Operation of flow switch) |
- |
0 |
|
- |
| Cl.12 of IS 8978 : 1992(Endurance) |
- |
0 |
|
- |
| Cl.12 of IS 8978 : 1992(Endurance) |
- |
0 |
|
- |
| Cl.10 of IS 8978 : 1992(Finish) |
- |
0 |
|
- |
| Cl.31 of IS 302-2-35: 2017(Resistance to Rusting
) |
- |
0 |
|
- |
| Cl.30.2 of IS 302-1:2008(Resistance to Heat and Fire) |
- |
0 |
|
- |
| Cl.30.1 of IS 302-1:2008(Resistance to Heat and Fire) |
- |
0 |
|
- |
| Cl.29.2 of IS 302-2-35:2017(Clearances, Creepage Distances and Solid Insulation : Creepage distance ) |
- |
0 |
|
- |
| Cl.29.1 of IS 302-2-35:2017(Clearances, Creepage Distances and Solid Insulation : Clearance distance ) |
- |
0 |
|
- |
| Cl.28 of IS 302-2-35:2017(Screws and Connections
) |
- |
0 |
|
- |
| Cl.27.5 of IS 302-2-35:2017(Provision for Earthing : ECR ) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-35:2017(Provision for Earthing) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.25.18 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25.15 of IS 302-2-35:2017(Supply Connection & External Flexible Cords : Cord grip test - displacement ) |
- |
0 |
|
- |
| Cl.25.15 of IS 302-2-35:2017(Supply Connection & External Flexible Cords : Cord grip test ) |
- |
0 |
|
- |
| Cl.25.12 of IS 302-2-35:2017(Supply Connection & External Flexible Cords : Moulding of supply cord ) |
- |
0 |
|
- |
| Cl.25.10 of IS 302-2-35:2017(Supply Connection & External Flexible Cords : Colour of Earthing conductor ) |
- |
0 |
|
- |
| Cl.25.8 of IS 302-2-35:2017(Supply Connection & External Flexible Cords : Resistance of supply cord ) |
- |
0 |
|
- |
| Cl.25.5 of IS 302-2-35:2017(Supply Connection & External Flexible Cords : Type of attachment ) |
- |
0 |
|
- |
| Cl.25.1 of IS 302-2-35:2017(Supply Connection & External Flexible Cords : connection to the supply mains) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-35:2017(Component
) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35:2017(Internal Wiring ; Colour of earthing conductor) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35:2017(Internal Wiring) |
- |
0 |
|
- |
| Cl.22.110 of IS 302-2-35:2017(Construction : Provision for fixing to wall
) |
- |
0 |
|
- |
| Cl.22.109 of IS 302-2-35:2017(Construction : Operation of presure switch of open outlet water heater
) |
- |
0 |
|
- |
| Cl.22.108 of IS 302-2-35:2017(Construction : Temperature of outlet water intended to supply for showring
) |
- |
0 |
|
- |
| Cl.22.107 of IS 302-2-35:2017(Construction : Temperature of outlet
) |
- |
0 |
|
- |
| Cl.22.106 of IS 302-2-35:2017(Construction : Operation of thermal cut out for closed water heater
) |
- |
0 |
|
- |
| Cl.22.104 of IS 302-2-35:2017(Construction : Pressure in open outlet water heaters
) |
- |
0 |
|
- |
| Cl.22.103 of IS 302-2-35:2017(Construction : Pressure relief device operation for closed water heater
) |
- |
0 |
|
- |
| Cl.22.102 of IS 302-2-35:2017(Construction : excessive temperature of outlet
) |
- |
0 |
|
- |
| Cl.22.101 of IS 302-2-35:2017(Construction : Rated pressure of closed water heater
) |
- |
0 |
|
- |
| Cl.22.47 of IS 302-2-35:2017(Construction : Water pressure test
) |
- |
0 |
|
- |
| Cl.22.44 of IS 302-1:2008(Construction : Shape and decoration
) |
- |
0 |
|
- |
| Cl.22.34, Cl 22.35 of
IS 302-1:2008(Construction : Shaft of operating Knobs ) |
- |
0 |
|
- |
| Cl.22.33 of
IS 302-1:2008(Construction : Direct contact of liquids ) |
- |
0 |
|
- |
| Cl 22.26 ,Cl.22.28, Cl 22.29, Cl 22.30 , Cl 22.31, Cl 22.32 of
IS 302-1:2008(Construction : Supplymentry/ double / reinforced insulation for Class II/ Class III appliance ) |
- |
0 |
|
- |
| Cl.22.18 of IS 302-1:2008(Construction : Resistance to corrosion
) |
- |
0 |
|
- |
| Cl.22.17 of IS 302-1:2008(Construction : Spacers
) |
- |
0 |
|
- |
| Cl.22.14 of IS 302-1:2008(Construction : Ragged or sharp edges
) |
- |
0 |
|
- |
| Cl.22.12 of IS 302-1:2008(Construction : Fixing of Handle, knob, grips, levers and similar parts
) |
- |
0 |
|
- |
| Cl.22.11 of IS 302-1:2008(Construction : Fixing of non detachable parts
) |
- |
0 |
|
- |
| Cl.22.7 of IS 302-1:2008(Construction : safeguards against the risk of excessive pressure.
) |
- |
0 |
|
- |
| Cl.22.6 of IS 302-2-35:2017(Construction : size of drain hole
) |
- |
0 |
|
- |
| Cl.22.6 of IS 302-1:2008(Construction : effect of water on 3 insulation
) |
- |
0 |
|
- |
| Cl.22.2 of IS 302-1:2008(Construction : connection to supply mains
) |
- |
0 |
|
- |
| Cl.22.1 of IS 302-1:2008(Construction : IP test
) |
- |
0 |
|
- |
| Cl. 21.2 of IS 302-1:2008(Mechanical strength : prevent penetration by sharp implements. ) |
- |
0 |
|
- |
| Cl.21.1 of IS 302-1:2008(Mechanical strength : Rough handling in normal use) |
- |
0 |
|
- |
| Cl.20 of IS 302-2-35:2017(Stability & Mechanical Hazards
) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-35:2017(Abnormal Operation : effect on container) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-35:2017(Abnormal Operation : High voltage) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-35:2017(Abnormal Operation : Temperature rise of insulation of supply cord) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-35:2017(Abnormal Operation : Temperature rise of test corner) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-35:2017(Abnormal Operation : Emission of flames, molten metal ,or poisonous or ignitable gas) |
- |
0 |
|
- |
| Cl.16 of IS 302-2-35:2017(Leakage Current and Electric Strength (After Humidity)) |
- |
0 |
|
- |
| Cl.16 of IS 302-2-35:2017(Leakage Current and Electric Strength (After Humidity)) |
- |
0 |
|
- |
| Cl.15 of IS 302-2-35:2017(Moisture Resistance ) |
- |
0 |
|
- |
| Cl.14 of IS 302-2-35:2017(Transient Over Voltages ) |
- |
0 |
|
- |
| Cl.13 of IS 302-2-35:2017(Leakage Current & 3 Strength at Operating Temperature : High voltage ) |
- |
0 |
|
- |
| Cl.13 of IS 302-2-35:2017(Leakage Current & 3 Strength at Operating Temperature ) |
- |
0 |
|
- |
| Cl.11 of 302-2-35:2017(Heating : room temperature) |
- |
0 |
|
- |
| Cl.11 of 302-2-35:2017(Heating : Insulation of supply cord) |
- |
0 |
|
- |
| Cl.11 of 302-2-35:2017(Heating : Temperature rise of test corner) |
- |
0 |
|
- |
| Cl.10 of IS 302-2- 35:2017(Power Input & Current ) |
- |
0 |
|
- |
| Cl.8 of IS 302-2-35:2017(Protection Against Access To Live Parts) |
- |
0 |
|
- |
| Cl.7.102 of IS 302-2-35:2017(Marking : Standard mark) |
- |
0 |
|
- |
| Cl.7.101 of IS 302-2-35:2017(Marking : Woter inlet and outlet idetification) |
- |
0 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking : Position of marking) |
- |
0 |
|
- |
| Cl.7.14 of IS 302-1:2008(Marking ; Legibility and durability) |
- |
0 |
|
- |
| Cl.7.13 of IS 302-1:2008(Marking : Language) |
- |
0 |
|
- |
| Cl.7.10 & 7.11 of IS 302-1:2008(Marking : Indication for direction of control) |
- |
0 |
|
- |
| Cl.7.8 of IS 302-1:2008(Marking : Terminal for connection ) |
- |
0 |
|
- |
| Cl.7.6 of IS 302-1:2008(Marking : Symbols) |
- |
0 |
|
- |
| Cl.7.1 of IS 302-2-35:2017(Marking : rated pressure) |
- |
0 |
|
- |
| Cl.7.1 of IS 302-1:2008(Marking : Country of manufacture) |
- |
0 |
|
- |
| Cl.7.1 of IS 302-1:2008(Marking : IP number ) |
- |
0 |
|
- |
| Cl.7.1 of IS 302-1:2008(Marking : Symbol for class II) |
- |
0 |
|
- |
| Cl.7.1 of IS 302-1:2008(Marking : Molel or type) |
- |
0 |
|
- |
| Cl.7.1 of IS 302-1:2008(Marking : Manufacture identification) |
- |
0 |
|
- |
| Cl.7.1 of IS 302-1:2008(Marking : Rated power input) |
- |
0 |
|
- |
| Cl.7.1 of IS 302-1:2008(Marking : Nature of supply) |
- |
0 |
|
- |
| Cl.7.1 of IS 302-1:2008(Marking : Rated Voltage) |
- |
0 |
|
- |
| 4(GENERAL REQUIREMENTS) |
- |
0 |
|
- |
| 5(GENERAL NOTE ON TEST) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| (Cl.7.1 of IS 302-2-35:2017)(Marking) |
- |
0 |
|
- |
| (Cl.7.101 of IS 302-2-35:2017)(Marking) |
- |
0 |
|
- |
| (Cl.8.1.1 of IS 8978:1992)(Marking) |
- |
0 |
|
- |
| (Cl.19.13 of IS 302-2-35:2017)(Abnormal operation) |
- |
0 |
|
- |
| (Cl.19.13 of IS 302-2-35:2017)(Abnormal operation) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-35:2017)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-35:2017)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-35:2017)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-35:2017)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-35:2017)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-35:2017)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-35:2017)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-35:2017)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-35:2017)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-35:2017)(Construction) |
- |
0 |
|
- |
| (Cl.23 of IS 302-2-35:2017)(Internal wiring) |
- |
0 |
|
- |
| (Cl.23 of IS 302-2-35:2017)(Internal wiring) |
- |
0 |
|
- |
| (Cl.23 of IS 302-2-35:2017)(Internal wiring) |
- |
0 |
|
- |
| (Cl.23 of IS 302-2-35:2017)(Internal wiring) |
- |
0 |
|
- |
| (Cl.24 of IS 302-2-35:2017)(Components) |
- |
0 |
|
- |
| (Cl.24 of IS 302-2-35:2017)(Components) |
- |
0 |
|
- |
| (Cl.24 of IS 302-2-35:2017)(Components) |
- |
0 |
|
- |
| (Cl.24 of IS 302-2-35:2017)(Components) |
- |
0 |
|
- |
| (Cl.24 of IS 302-2-35:2017)(Components) |
- |
0 |
|
- |
| (Cl.25.8 of IS 302-2-35:2017)(Supply Connection and External Flexible cords) |
- |
0 |
|
- |
| (CL.27.5 of IS 302-2-35:2017)(Provision for Earthing) |
- |
0 |
|
- |
|
29 Apr, 2027 |
- - |
| 7 |
IS 366 (1991) |
Electric iron - Specification (Fourth Revision) |
Electric iron |
25000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 7.0(Classification (as per Cl.6 of IS 302-2-3 and Cl.6.1 of IS 302-1)) |
- |
500 |
|
- |
| 7.0(Classification (as per Cl.6 of IS 302-2-3 and Cl.6.2 of IS 302-1)) |
- |
0 |
|
- |
| 9.0(Protection against access to live parts (as per Cl. 8 of IS 302-2-3 and IS 302-1)) |
- |
1000 |
|
- |
| 9.0(Power input and current (as per Cl. 10 of IS 302-2-3 and IS 302-1)) |
- |
2000 |
|
- |
| 9.0(Temperature Rise (as per Cl. 11 of IS 302-2-3 and IS 302-1)) |
- |
1000 |
|
- |
| 9.0(Temperature Rise (as per Cl. 11 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Temperature Rise (as per Cl. 11 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Temperature Rise (as per Cl. 11 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Leakage current and Electric Strength at Operating Temperature (as per Cl. 13 of IS 302-2-3 and IS 302-1)) |
- |
1000 |
|
- |
| 9.0(Leakage current and Electric Strength at Operating Temperature (as per Cl. 13 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Transient Overvoltage (as per of Cl. 14 of IS 302-2-3 and Table 6 of IS 302-1)) |
- |
1000 |
|
- |
| 9.0(Moisture Resistance (as per of Cl.15 of IS 302-2-3 and IS 302-1)) |
- |
1500 |
|
- |
| 9.0(Moisture Resistance (as per of Cl.15 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Abnormal Operation (as per of Cl.19 of IS 302-2-3 and IS 302-1) ) |
- |
1000 |
|
- |
| 9.0(Abnormal Operation (as per of Cl.19 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Abnormal Operation (as per of Cl.19 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Abnormal Operation (as per of Cl.19 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Abnormal Operation (as per of Cl.19 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Staibilty and mechanical hazards (as per of Cl.20 of IS 302-2-3 and IS 302-1) ) |
- |
1000 |
|
- |
| 9.0(Mechanical strength (as per of Cl.21 of IS 302-2-3 and IS 302-1) ) |
- |
1000 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
1000 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Internal wiring (as per of Cl.23 of IS 302-2-3 and IS 302-1) ) |
- |
1000 |
|
- |
| 9.0(Internal wiring (as per of Cl.23 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Internal wiring (as per of Cl.23 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Internal wiring (as per of Cl.23 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Components (as per of Cl.24 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Supply connection and external flexible cord (as per of Cl.25 of IS 302-2-3 and IS 302-1) ) |
- |
1000 |
|
- |
| 9.0(Supply connection and external flexible cord (as per of Cl.25 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Supply connection and external flexible cord (as per of Cl.25 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Supply connection and external flexible cord (as per of Cl.25 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Supply connection and external flexible cord (as per of Cl.25 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Terminals for external conductors (as per of Cl.26 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Provision for earthing (as per of Cl.27 of IS 302-2-3 and IS 302-1) ) |
- |
1000 |
|
- |
| 9.0(Provision for earthing (as per of Cl.27 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Provision for earthing (as per of Cl.27 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Provision for earthing (as per of Cl.27 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Screw and connections (as per of Cl.28 of IS 302-2-3 and IS 302-1)) |
- |
1000 |
|
- |
| 9.0(Screw and connections (as per of Cl.28 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Clearances, creepage distances and solid insulation (as per of Cl.29 of IS 302-2-3 and IS 302-1)) |
- |
1000 |
|
- |
| 9.0(Clearances, creepage distances and solid insulation (as per of Cl.29 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Resistance to Heat and Fire (as per of Cl.30 of IS 302-2-3 and IS 302-1)) |
- |
1000 |
|
- |
| 9.0(Resistance to Rusting (as per of Cl.31 of IS 302-2-3 and IS 302-1)) |
- |
1000 |
|
- |
| 10.0(Measurement of Heating up time) |
- |
1000 |
|
- |
| 10.0(Measurement of Heating up time) |
- |
0 |
|
- |
| 11.0(Measurement of sole plate temperature) |
- |
1000 |
|
- |
| 11.0(Measurement of sole plate temperature) |
- |
0 |
|
- |
| 11.0(Measurement of sole plate temperature) |
- |
0 |
|
- |
| 11.0(Measurement of sole plate temperature) |
- |
0 |
|
- |
| 12.0(Measurement of Tempearture Distribution) |
- |
1000 |
|
- |
| 13.0(Measurement of Initial overswing temperature and Heating up excess temperature) |
- |
1000 |
|
- |
| 13.0(Measurement of Initial overswing temperature and Heating up excess temperature) |
- |
0 |
|
- |
| 14.0(Measurement of Cyclic fluctuation of temperature of hottest point ) |
- |
1000 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
500 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 7.0(Classification (as per Cl.6 of IS 302-2-3 and Cl.6.1 of IS 302-1)) |
- |
0 |
|
- |
| 7.0(Classification (as per Cl.6 of IS 302-2-3 and Cl.6.2 of IS 302-1)) |
- |
0 |
|
- |
| 9.0(Protection against access to live parts (as per Cl. 8 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Power input and current (as per Cl. 10 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Temperature Rise (as per Cl. 11 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Temperature Rise (as per Cl. 11 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Temperature Rise (as per Cl. 11 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Temperature Rise (as per Cl. 11 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Leakage current and Electric Strength at Operating Temperature (as per Cl. 13 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Leakage current and Electric Strength at Operating Temperature (as per Cl. 13 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Transient Overvoltage (as per of Cl. 14 of IS 302-2-3 and Table 6 of IS 302-1)) |
- |
0 |
|
- |
| 9.0(Moisture Resistance (as per of Cl.15 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Moisture Resistance (as per of Cl.15 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Abnormal Operation (as per of Cl.19 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Abnormal Operation (as per of Cl.19 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Abnormal Operation (as per of Cl.19 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Abnormal Operation (as per of Cl.19 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Abnormal Operation (as per of Cl.19 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Staibilty and mechanical hazards (as per of Cl.20 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Mechanical strength (as per of Cl.21 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Internal wiring (as per of Cl.23 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Internal wiring (as per of Cl.23 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Internal wiring (as per of Cl.23 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Internal wiring (as per of Cl.23 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Components (as per of Cl.24 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Supply connection and external flexible cord (as per of Cl.25 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Supply connection and external flexible cord (as per of Cl.25 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Supply connection and external flexible cord (as per of Cl.25 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Supply connection and external flexible cord (as per of Cl.25 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Supply connection and external flexible cord (as per of Cl.25 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Terminals for external conductors (as per of Cl.26 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Provision for earthing (as per of Cl.27 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Provision for earthing (as per of Cl.27 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Provision for earthing (as per of Cl.27 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Provision for earthing (as per of Cl.27 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Screw and connections (as per of Cl.28 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Screw and connections (as per of Cl.28 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Clearances, creepage distances and solid insulation (as per of Cl.29 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Clearances, creepage distances and solid insulation (as per of Cl.29 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Resistance to Heat and Fire (as per of Cl.30 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Resistance to Rusting (as per of Cl.31 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 10.0(Measurement of Heating up time) |
- |
0 |
|
- |
| 10.0(Measurement of Heating up time) |
- |
0 |
|
- |
| 11.0(Measurement of sole plate temperature) |
- |
0 |
|
- |
| 11.0(Measurement of sole plate temperature) |
- |
0 |
|
- |
| 11.0(Measurement of sole plate temperature) |
- |
0 |
|
- |
| 11.0(Measurement of sole plate temperature) |
- |
0 |
|
- |
| 12.0(Measurement of Tempearture Distribution) |
- |
0 |
|
- |
| 13.0(Measurement of Initial overswing temperature and Heating up excess temperature) |
- |
0 |
|
- |
| 13.0(Measurement of Initial overswing temperature and Heating up excess temperature) |
- |
0 |
|
- |
| 14.0(Measurement of Cyclic fluctuation of temperature of hottest point ) |
- |
0 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 6(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 15(MEASUREMENT OF TEMPERATURE DROP UNDER LOAD) |
- |
0 |
|
- |
| 17(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16 of IS 302-2-3(Leakage current electric strength) |
- |
0 |
|
- |
| 4(GENERAL REQUIREMENTS) |
- |
0 |
|
- |
| 5(GENERAL NOTES ON TESTS) |
- |
0 |
|
- |
| 8(Marking) |
- |
0 |
|
- |
| (Cl.8 of IS 366:1991 )(Marking and Instructions) |
- |
0 |
|
- |
| (Cl.8 of IS 366:1991 )(Marking and Instructions) |
- |
0 |
|
- |
| (Cl.8 of IS 366:1991 )(Marking and Instructions) |
- |
0 |
|
- |
| (Cl.8 of IS 366:1991 )(Marking and Instructions) |
- |
500 |
|
- |
| (Cl.11 of IS 302-2-3 :2007)(Heating) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-3 :2007)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-3 :2007)(Construction) |
- |
0 |
|
- |
|
29 Apr, 2027 |
- - |
| 8 |
IS 302 : Part 2 : Sec 35 (2017) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 35 electric instantaneous water heaters (Second Revision) |
Electric Instantaneous Water Heaters |
25000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl.31(Verification) |
- |
0 |
|
- |
| Cl.30(Verification) |
- |
0 |
|
- |
| CL.29(Verification) |
- |
0 |
|
- |
| Cl.28(Verification) |
- |
0 |
|
- |
| Cl.27(Verification) |
- |
0 |
|
- |
| Cl.26(Verification) |
- |
0 |
|
- |
| Cl.25(Verification) |
- |
0 |
|
- |
| Cl.24(Verification) |
- |
0 |
|
- |
| Cl.23(Verification) |
- |
0 |
|
- |
| Cl.22(Verification) |
- |
0 |
|
- |
| Cl.21(Verification) |
- |
0 |
|
- |
| Cl.20(Verification) |
- |
0 |
|
- |
| Cl.19(Verification) |
- |
0 |
|
- |
| Cl.17(Verification) |
- |
0 |
|
- |
| Cl. 16(Verification) |
- |
0 |
|
- |
| Cl.15(Verification) |
- |
0 |
|
- |
| Cl.14(Verification) |
- |
0 |
|
- |
| Cl.13(Verification) |
- |
0 |
|
- |
| Cl.11(Verification) |
- |
0 |
|
- |
| Cl.10(Verification) |
- |
0 |
|
- |
| Cl.8(Verification) |
- |
0 |
|
- |
| Cl. 7(Verification) |
- |
0 |
|
- |
| Cl. 7(Verification) |
- |
0 |
|
- |
| Cl. 31
IS 302-2-35(Resistance to Rusting) |
- |
1000 |
|
- |
| Cl. 30
IS 302-2-35(Resistance to Heat Fire & Tracking ) |
- |
1000 |
|
- |
| Cl. 29
IS 302-2-35(Clearances, Creepage Distances & Solid insulation ) |
- |
2000 |
|
- |
| Cl. 28
IS 302-2-35(Screws & Connections) |
- |
1000 |
|
- |
| Cl. 27
IS 302-2-35(Provision for Earthing ) |
- |
1000 |
|
- |
| Cl. 26
IS 302-2-35(Terminals for External conductors ) |
- |
1000 |
|
- |
| Cl. 25
IS 302-2-35(Supply Connection & External Flexible Cords) |
- |
1000 |
|
- |
| Cl. 24
IS 302-2-35(Components) |
- |
1000 |
|
- |
| Cl. 23
IS 302-2-35(Internal Wiring) |
- |
1000 |
|
- |
| Cl. 22
IS 302-2-35(Construction ) |
- |
1000 |
|
- |
| 5(GENERAL CONDITIONS FOR THE TESTS) |
- |
0 |
|
- |
| 4(GENERAL REQUIREMENT) |
- |
0 |
|
- |
| Cl. 6
IS 302-2-35(Classification) |
- |
1000 |
|
- |
| Cl. 21
IS 302-2-35(Mechanical strength) |
- |
1000 |
|
- |
| Cl. 20
IS 302-2-35(Stability & Mechanical Hazards) |
- |
500 |
|
- |
| Cl. 19
IS 302-2-35(Abnormal Operation ) |
- |
1000 |
|
- |
| Cl. 17
IS 302-2-35(Overload Protection of Transformers and Associated Circuit) |
- |
1000 |
|
- |
| Cl. 16
IS 302-2-35(Leakage Current & Electric Strength at Operating Temperature (After Humidity Treatment)) |
- |
1000 |
|
- |
| Cl. 15
IS 302-2-35(Moisture Resistance Test ) |
- |
1000 |
|
- |
| Cl. 14
IS 302-2-35(Radio and television interference suppression / Transient over voltages) |
- |
1000 |
|
- |
| Cl. 13
IS 302-2-35(Leakage Current & Electric Strength at Operating Temperature) |
- |
1000 |
|
- |
| Cl. 11
IS 302-2-35(Heating) |
- |
2000 |
|
- |
| Cl. 10
IS 302-2-35(Power Input and Current ) |
- |
2000 |
|
- |
| Cl. 8
IS 302-2-35(Protection against access to live parts) |
- |
1000 |
|
- |
| Cl. 7
IS 302-2-35(Marking and Instruction) |
- |
500 |
|
- |
|
29 Apr, 2027 |
- - |
| 9 |
IS 302 : Part 2 : Sec 26 (2014) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 26 clocks (First Revision) |
Safety of household and similar Electrical Appliances (CLOCKS) |
25000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 6.0(Classification) |
- |
500 |
|
- |
| 7(Marking and instructions) |
- |
500 |
|
- |
| 8(Protection against live parts) |
- |
1000 |
|
- |
| 9(STARTING OF MOTOR-OPERATED APPLIANCES) |
- |
0 |
|
- |
| 10(POWER INPUT AND CURRENT) |
- |
2500 |
|
- |
| 11(HEATING) |
- |
2500 |
|
- |
| 13(LEAKAGE CURRENT AND ELECTRIC STRENGTH AT OPERATING TEMPERATURE) |
- |
1000 |
|
- |
| 14(TRANSIENT OVERVOLTAGES) |
- |
1000 |
|
- |
| 16(LEAKAGE CURRENT AND ELECTRIC STRENGTH) |
- |
1000 |
|
- |
| 17(OVERLOAD PROTECTION OF TRANSFORMERS AND ASSOCIATED CIRCUITS) |
- |
1000 |
|
- |
| 19(ABNORMAL OPERATION) |
- |
1000 |
|
- |
| 20(STABILITY AND MECHANICAL HAZARDS) |
- |
1000 |
|
- |
| 21(MECHANICAL STRENGTH) |
- |
1000 |
|
- |
| 22(CONSTRUCTION) |
- |
1000 |
|
- |
| 23(INTERNAL WIRING) |
- |
1000 |
|
- |
| 24(COMPONENTS) |
- |
500 |
|
- |
| 25(SUPPLY CONNECTION AND EXTERNAL FLEXIBLE CORDS) |
- |
1000 |
|
- |
| 26(TERMINALS FOR EXTERNAL CONDUCTORS) |
- |
1000 |
|
- |
| 27(PROVISION FOR EARTHING) |
- |
1000 |
|
- |
| 28(SCREWS AND CONNECTIONS) |
- |
500 |
|
- |
| 29(CLEARANCES, CREEPAGE DISTANCES AND SOLID INSULATION) |
- |
1000 |
|
- |
| 30(RESISTANCE TO HEAT AND FIRE) |
- |
2000 |
|
- |
| 31(RESISTANCE TO RUSTING) |
- |
1000 |
|
- |
| 22.16(Automatic cord reel) |
- |
0 |
|
- |
| 22.47(Water pressure inlet) |
- |
0 |
|
- |
| 22.3(Flexing test) |
- |
0 |
|
- |
| 24(Components) |
- |
0 |
|
- |
| 5(General conditions for the tests) |
- |
0 |
|
- |
| 4(General Requirements) |
- |
0 |
|
- |
| 15(MOISTURE RESISTANCE) |
- |
1000 |
|
- |
|
29 Apr, 2027 |
- - |
| 10 |
IS 2082 (2018) |
Stationary storage type electric water heaters - Specification (Fifth Revision) |
Stationary Storage type Electric Water Heaters |
25000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 7(Marking) |
- |
500 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 6(Classification ) |
- |
500 |
|
- |
| 6(Classification ) |
- |
0 |
|
- |
| (Cl.8 of IS 302-2-21:2011)(Protection Against Access to Live Parts) |
- |
500 |
|
- |
| (Cl.10 of IS 302-2-21: 2011)(Power Input & Current) |
- |
1000 |
|
- |
| (Cl.11 of 302-2-21:2011)(Heating) |
- |
1000 |
|
- |
| (Cl.11 of 302-2-21:2011)(Heating) |
- |
0 |
|
- |
| (Cl.11 of 302-2-21:2011)(Heating) |
- |
0 |
|
- |
| (Cl.13 of IS 302-2-21:2011)(Leakage Current ) |
- |
1000 |
|
- |
| (Cl.13 of IS 302-2-21:2011)(Electrical Strength at Operating Temperature) |
- |
0 |
|
- |
| (Cl.14ofIS302-2-21:2011)(Transient Over Voltages) |
- |
1000 |
|
- |
| (Cl.15 of IS 302-2-21-2011)(Moisture Resistance) |
- |
1000 |
|
- |
| (Cl.15 of IS 302-2-21-2011)(Moisture Resistance) |
- |
0 |
|
- |
| (Cl.15 of IS 302-2-21-2011)(Moisture Resistance) |
- |
0 |
|
- |
| (Cl.17 of IS 302-2-21:2011)(Overload protection of transformers & associated circuits) |
- |
500 |
|
- |
| (Cl.19 of IS 302-2-21:2011)(Abnormal Operation) |
- |
500 |
|
- |
| (Cl.19 of IS 302-2-21:2011)(Abnormal Operation) |
- |
0 |
|
- |
| (Cl.19 of IS 302-2-21:2011)(Abnormal Operation) |
- |
0 |
|
- |
| (Cl.19 of IS 302-2-21:2011)(Abnormal Operation) |
- |
0 |
|
- |
| (Cl.20 of IS 302-2-21:2011)(Stability & Mechanical Hazards) |
- |
500 |
|
- |
| (Cl.21ofIS302-2-21:2011)(Mechanical strength) |
- |
500 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl.22 Of
IS 302-2-21:2011)(Construction) |
- |
0 |
|
- |
| (Cl. 23 of IS 302-2-21: 2011)(Internal Wiring
) |
- |
500 |
|
- |
| (Cl. 23 of IS 302-2-21: 2011)(Internal Wiring
) |
- |
0 |
|
- |
| (Cl. 23 of IS 302-2-21: 2011)(Internal Wiring
) |
- |
0 |
|
- |
| (Cl. 23 of IS 302-2-21: 2011)(Internal Wiring
) |
- |
0 |
|
- |
| (Cl. 23 of IS 302-2-21: 2011)(Internal Wiring
) |
- |
0 |
|
- |
| (Cl. 23 of IS 302-2-21: 2011)(Internal Wiring
) |
- |
0 |
|
- |
| (Cl. 23 of IS 302-2-21: 2011)(Internal Wiring
) |
- |
0 |
|
- |
| (Cl. 23 of IS 302-2-21: 2011)(Internal Wiring
) |
- |
0 |
|
- |
| (Cl. 23 of IS 302-2-21: 2011)(Internal Wiring
) |
- |
0 |
|
- |
| (Cl. 23 of IS 302-2-21: 2011)(Internal Wiring
) |
- |
0 |
|
- |
| (Cl. 23 of IS 302-2-21: 2011)(Internal Wiring
) |
- |
0 |
|
- |
| (Cl. 23 of IS 302-2-21: 2011)(Internal Wiring
) |
- |
0 |
|
- |
| (Cl. 23 of IS 302-2-21: 2011)(Internal Wiring
) |
- |
0 |
|
- |
| (Cl.24ofIS302-221:2011)(Component) |
- |
500 |
|
- |
| (Cl.24ofIS302-221:2011)(Component) |
- |
0 |
|
- |
| (Cl.24ofIS302-221:2011)(Component) |
- |
0 |
|
- |
| (Cl.24ofIS302-221:2011)(Component) |
- |
0 |
|
- |
| (Cl.24ofIS302-221:2011)(Component) |
- |
0 |
|
- |
| (Cl.24ofIS302-221:2011)(Component) |
- |
0 |
|
- |
| (Cl.25 of IS 302-2-21:2011)(Supply Connection & External Flexible Cords) |
- |
500 |
|
- |
| (Cl.25 of IS 302-2-21:2011)(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| (Cl.25 of IS 302-2-21:2011)(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| (Cl.25 of IS 302-2-21:2011)(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| (Cl.25 of IS 302-2-21:2011)(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| (Cl.25 of IS 302-2-21:2011)(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| (Cl.25 of IS 302-2-21:2011)(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| (Cl.25 of IS 302-2-21:2011)(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| (Cl.25 of IS 302-2-21:2011)(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| (Cl.25 of IS 302-2-21:2011)(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| (Cl.25 of IS 302-2-21:2011)(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| (Cl.25 of IS 302-2-21:2011)(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| (Cl.25 of IS 302-2-21:2011)(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| (Cl.25 of IS 302-2-21:2011)(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| (Cl.25 of IS 302-2-21:2011)(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| (Cl.25 of IS 302-2-21:2011)(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| (Cl.25 of IS 302-2-21:2011)(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| (Cl.25 of IS 302-2-21:2011)(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| (Cl.25 of IS 302-2-21:2011)(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| (Cl.25 of IS 302-2-21:2011)(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| (Cl.25 of IS 302-2-21:2011)(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| (Cl.25 of IS 302-2-21:2011)(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| (Cl.26 of IS 302-2-21: 2011)(Terminals for External Conductors) |
- |
500 |
|
- |
| (Cl.26 of IS 302-2-21: 2011)(Terminals for External Conductors) |
- |
0 |
|
- |
| (Cl.26 of IS 302-2-21: 2011)(Terminals for External Conductors) |
- |
0 |
|
- |
| (Cl.26 of IS 302-2-21: 2011)(Terminals for External Conductors) |
- |
0 |
|
- |
| (Cl.26 of IS 302-2-21: 2011)(Terminals for External Conductors) |
- |
0 |
|
- |
| (Cl.26 of IS 302-2-21: 2011)(Terminals for External Conductors) |
- |
0 |
|
- |
| (Cl.26 of IS 302-2-21: 2011)(Terminals for External Conductors) |
- |
0 |
|
- |
| (Cl.26 of IS 302-2-21: 2011)(Terminals for External Conductors) |
- |
0 |
|
- |
| (Cl.26 of IS 302-2-21: 2011)(Terminals for External Conductors) |
- |
0 |
|
- |
| (Cl.26 of IS 302-2-21: 2011)(Terminals for External Conductors) |
- |
0 |
|
- |
| (Cl.26 of IS 302-2-21: 2011)(Terminals for External Conductors) |
- |
0 |
|
- |
| (Cl.27 of IS 302-2-21:2011)(Provision for Earthing) |
- |
1000 |
|
- |
| (Cl.27 of IS 302-2-21:2011)(Provision for Earthing) |
- |
0 |
|
- |
| (Cl.27 of IS 302-2-21:2011)(Provision for Earthing) |
- |
0 |
|
- |
| (Cl.27 of IS 302-2-21:2011)(Provision for Earthing) |
- |
0 |
|
- |
| (Cl.27 of IS 302-2-21:2011)(Provision for Earthing) |
- |
0 |
|
- |
| (Cl.27 of IS 302-2-21:2011)(Provision for Earthing) |
- |
0 |
|
- |
| (Cl.28 of IS 302-2-21:2011)(Screws & Connections) |
- |
500 |
|
- |
| (Cl.29ofIS302-2-21:2011)(Clearances, Creepage Distances and Solid Insulation) |
- |
1000 |
|
- |
| (Cl.30 of IS 302-2-21:2011)(Resistance to Heat & Fire) |
- |
1000 |
|
- |
| (Cl.30 of IS 302-2-21:2011)(Resistance to Heat & Fire) |
- |
0 |
|
- |
| (Cl.31 of IS 302-2-21:2011)(Resistance to Rusting) |
- |
0 |
|
- |
| (Cl.16 of IS 2082:2018)(Standing Loss per 24 Hours) |
- |
5000 |
|
- |
| (Cl.15 of IS 2082:2018)(Verification of the Rated Capacity) |
- |
1000 |
|
- |
| (Cl.17 of IS 2082:2018)(Hot Water Output) |
- |
1000 |
|
- |
| (Cl.18 of IS 2082:2018)( Reheating Time) |
- |
2000 |
|
- |
| (Cl.19 of IS 2082:2018)(Mixing Factor) |
- |
1000 |
|
- |
| (Cl.20 of IS 2082:2018)(Deviation of Dial Calibration) |
- |
1000 |
|
- |
| (Cl.21 of IS 2082:2018)(Cyclic Temperature Variation) |
- |
1000 |
|
- |
| (Cl.22 of IS 2082:2018)(Finish) |
- |
1000 |
|
- |
| Cl.22 of IS 2082:2018(Finish) |
- |
0 |
|
- |
| Cl.21 of IS 2082:2018(Cyclic Temperature Variation) |
- |
0 |
|
- |
| Cl.20 of IS 2082:2018(Deviation of Dial Calibration) |
- |
0 |
|
- |
| Cl.19 of IS 2082:2018(Mixing Factor) |
- |
0 |
|
- |
| Cl.18 of IS 2082:2018( Reheating Time) |
- |
0 |
|
- |
| Cl.17 of IS 2082:2018(Hot Water Output) |
- |
0 |
|
- |
| Cl.16 of IS 2082:2018(Standing Loss per 24 Hours) |
- |
0 |
|
- |
| Cl.15 of IS 2082:2018(Verification of the Rated Capacity) |
- |
500 |
|
- |
| Cl.31 of IS 302-2-21:2018(Resistance to Rusting) |
- |
1000 |
|
- |
| Cl.30.2 of IS 302-1:2008(Resistance to Heat & Fire : Glow wire test ) |
- |
0 |
|
- |
| Cl.30.1 of IS 302-1:2008(Resistance to Heat & Fire : Ball pressure test ) |
- |
0 |
|
- |
| Cl.29.2 of IS 302-1:2008(Clearances, Creepage Distances and Solid Insulation : Creepage distance ) |
- |
0 |
|
- |
| Cl.29.1 of IS 302-1:2008(Clearances, Creepage Distances and Solid Insulation : Clearance distance ) |
- |
0 |
|
- |
| Cl.28 of IS 302-2-21:2018(Screws & Connections) |
- |
0 |
|
- |
| Cl.27.5 of IS 302-1:2008(Provision for Earthing : ECR ) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-21:2018(Provision for Earthing) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-21: 2018(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.25.18 of IS 302-1:2008(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25.15 of IS 302-1:2008(Supply Connection & External Flexible Cords : Cord grip test - displacement ) |
- |
0 |
|
- |
| Cl.25.15 of IS 302-1:2008(Supply Connection & External Flexible Cords : Cord grip test ) |
- |
0 |
|
- |
| Cl.25.12 of IS 302-1:2008(Supply Connection & External Flexible Cords : Moulding of supply cord ) |
- |
0 |
|
- |
| Cl.25.10 of IS 302-1:2008(Supply Connection & External Flexible Cords : Colour of Earthing conductor ) |
- |
0 |
|
- |
| Cl.25.8 of IS 302-2-21:2018(Supply Connection & External Flexible Cords : Resistance of supply cord ) |
- |
0 |
|
- |
| Cl.25.5 of IS 302-1:2008(Supply Connection & External Flexible Cords : Type of attachment ) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-21:2018(Supply Connection & External Flexible Cords : connection to the supply mains) |
- |
0 |
|
- |
| Cl.24.102 of IS 302-221:2018(Component : Operation of thermal cut-out ) |
- |
0 |
|
- |
| Cl.24.101 of IS302-221:2018(Component : Location of non self reseting thermal cut out ) |
- |
0 |
|
- |
| Cl.24of IS 302-221:2018(Component : Relevent Indian standards ) |
- |
0 |
|
- |
| Cl. 23 of IS 302-1:2008(Internal Wiring : color identification for earthing conductor
) |
- |
0 |
|
- |
| Cl. 23 of IS 302-1:2008(Internal Wiring
) |
- |
0 |
|
- |
| Cl.22.111 of
IS 302-2-21:2018(Construction : Resistance to vacuum ) |
- |
0 |
|
- |
| Cl.22.110 of
IS 302-2-21:2018(Construction : meterial of connections ) |
- |
0 |
|
- |
| Cl.22.110 of
IS 302-2-21:2018(Construction : Material of Inner conatiner ) |
- |
0 |
|
- |
| Cl.22.109 of
IS 302-2-21:2018(Construction : Drain for appliance having a capacity of more than 15 liter) |
- |
0 |
|
- |
| Cl.22.108 of
IS 302-2-21:2018(Construction : fixing to wall ) |
- |
0 |
|
- |
| Cl.22.107 of
IS 302-2-21:2018(Construction : Position of Heating elements and thermal control sensor) |
- |
0 |
|
- |
| Cl.22.106 of
IS 302-2-21:2018(Construction : Operation of thermal cut- out ) |
- |
0 |
|
- |
| Cl.22.104 of
IS 302-2-21:2018(Construction : Outlet of open outlet heater ) |
- |
0 |
|
- |
| Cl.22.103 of
IS 302-2-21:2018(Construction : Operation of Pressure relieve devices ) |
- |
0 |
|
- |
| Cl.22.102 of
IS 302-2-21:2018(Construction : repeated drawing of water temp ) |
- |
0 |
|
- |
| Cl.22.101 of
IS 302-2-21:2018(Construction : rated pressure of closed water heater ) |
- |
0 |
|
- |
| Cl.22.47 of
IS 302-2-21:2018 (Construction : Water pressure test ) |
- |
0 |
|
- |
| Cl.22.44 of
IS 302-1:2008(Construction : Shape and decoration of enclosure) |
- |
0 |
|
- |
| Cl.22.34, Cl 22.35 of
IS 302-1:2008(Construction : Shaft of operating Knobs ) |
- |
0 |
|
- |
| Cl.22.33 of
IS 302-1:2008(Construction : Direct contact of liquids ) |
- |
0 |
|
- |
| Cl 22.26 ,Cl.22.28, Cl 22.29, Cl 22.30 , Cl 22.31, Cl 22.32 of
IS 302-1:2008(Construction : Supplymentry/ double / reinforced insulation for Class II/ Class III appliance ) |
- |
0 |
|
- |
| Cl.22.18 Of
IS 302-1:2008(Construction : Resistance to corrosion ) |
- |
0 |
|
- |
| Cl.22.17 of
IS 302-1:2008(Construction : Spacers ) |
- |
0 |
|
- |
| Cl.22.14 of
IS 302-1:2008(Construction : ragged or sharp edges) |
- |
0 |
|
- |
| Cl.22.12 of
IS 302-1:2008(Construction : Fixing of Handle, knob, grips, levers and similar parts) |
- |
0 |
|
- |
| Cl.22.11 of
IS 302-1:2008(Construction : Fixing of non detachable part ) |
- |
0 |
|
- |
| Cl.22.7 of
IS 302-1:2008(Construction: adequate safeguards against the risk of excessive pressure) |
- |
0 |
|
- |
| Cl.22.6 of
IS 302-2-21:2018(Construction : Size of drain hole ) |
- |
0 |
|
- |
| Cl.22.6 of
IS 302-1:2008(Construction : Effect of water on 3 insulation ) |
- |
0 |
|
- |
| Cl.22.2 of
IS 302-1:2008(Construction : Provision to ensure all pole disconnection ) |
- |
0 |
|
- |
| Cl.22.1 of
IS 302-1:2008(Construction : IP test ) |
- |
0 |
|
- |
| Cl.21.2 of IS 302-1:2008(Mechanical strength : prevent penetration by sharp implements. ) |
- |
0 |
|
- |
| Cl.21.1 of IS 302-1:2008(Mechanical strength : Rough handling in normal use) |
- |
0 |
|
- |
| Cl.20 of IS 302-1:2008(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-21:2018(Abnormal Operation : leakage from container during test) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-21:2018(Abnormal Operation : High Voltage ) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-21:2018(Abnormal Operation : Insulation of the supply cable or cord) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-21:2018(Abnormal Operation : Wall ceiling temp. of test corner ) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-21:2018(Abnormal Operation : emission of flame or molten metal or poisonous or ignitable gas ) |
- |
0 |
|
- |
| Cl.16 of IS 302-2-21-2018(Leakage current and Electric strength (After humidity): Electric Strentgh ) |
- |
0 |
|
- |
| Cl.16 of IS 302-2-21-2018(Leakage current and Electric strength (After humidity): Leakage current ) |
- |
0 |
|
- |
| Cl.15 of IS 302-2-21-2018(Moisture Resistance) |
- |
0 |
|
- |
| Cl.14 of IS 302-2-21:2018(Transient Over Voltages) |
- |
0 |
|
- |
| Cl.13 of IS 302-2-21:2018(3 Strength at Operating Temperature) |
- |
1000 |
|
- |
| Cl.13 of IS 302-2-21:2018(Leakage Current ) |
- |
0 |
|
- |
| Cl.11 of 302-2-21:2018(Heating : Room Temp.) |
- |
0 |
|
- |
| Cl.11 of 302-2-21:2018(Heating : Temp of Rubber or PVC insulation of internal and external wiring) |
- |
0 |
|
- |
| Cl.11 of 302-2-21:2018(Heating : Temp of Walls, ceilings and floor of the test corner ) |
- |
0 |
|
- |
| Cl.10 of IS 302-2-21: 2018(Power Input & Current) |
- |
0 |
|
- |
| Cl.8 of IS 302-2-21:2018(Protection Against Access to Live Parts) |
- |
0 |
|
- |
| 7.101(Marking : Indifiction of water inlet and water outlet ) |
- |
0 |
|
- |
| 7.14(Marking : Legibility and durability) |
- |
0 |
|
- |
| 7.13(Marking : Official language of Instruction ) |
- |
0 |
|
- |
| 7.11(Marking : Indication of controls ) |
- |
0 |
|
- |
| 7.8(Marking : Terminals ) |
- |
0 |
|
- |
| 7.6(Marking : Symbol used ) |
- |
0 |
|
- |
| 7.1(Marking : Warning for Open- outlet ) |
- |
0 |
|
- |
| 7.1(Marking : Statement for pressure reducing valve ( For rated pressure less than 0.6 MPa)) |
- |
0 |
|
- |
| 7.1(Marking : Statement for a pressure-relief device) |
- |
0 |
|
- |
| 7.1(Marking : Rated capacity) |
- |
0 |
|
- |
| 7.1(Marking : Rated pressure) |
- |
0 |
|
- |
| 7.1(Marking : Country of manufacture) |
- |
0 |
|
- |
| 7.1(Marking: IP Number) |
- |
0 |
|
- |
| 7.1(Marking: Symbol for Class II) |
- |
0 |
|
- |
| 7.1(Marking: Model or type reference) |
- |
0 |
|
- |
| 7.1(Marking: Name, trademark or identification mark of manufacturer ) |
- |
0 |
|
- |
| 7.1(Marking : Rated power input) |
- |
0 |
|
- |
| 7.1(Marking : Symbol for nature of supply ) |
- |
0 |
|
- |
| 7.1(Marking : Rated Voltage ) |
- |
0 |
|
- |
| 4(GENERAL REQUIREMENT) |
- |
0 |
|
- |
| 5(GENERAL CONDITIONS FOR THE TESTS) |
- |
0 |
|
- |
| 12(THERMOSTAT SETTING) |
- |
0 |
|
- |
| Cl-10(Mounting of the water heater) |
- |
500 |
|
- |
| Cl-11(Measurements of stored water temperature) |
- |
500 |
|
- |
| Cl-12(Thermostat setting) |
- |
0 |
|
- |
| Cl-13(Measurement of energy consumption) |
- |
0 |
|
- |
| Cl-14(Verification of the rated capacity) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-21:2018)(Constructions) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-21:2018)(Constructions) |
- |
0 |
|
- |
| (Cl.22.108 of IS 302-2-21:2018)(Constructions) |
- |
0 |
|
- |
| (Cl.22.6 of IS 302-2-21:2018)(Constructions) |
- |
0 |
|
- |
| (Cl.22.47 of IS 302-2-21:2018)(Constructions) |
- |
0 |
|
- |
| (Cl.22.47 of IS 302-2-21:2018)(Constructions) |
- |
0 |
|
- |
| (Cl.22.47 of IS 302-2-21:2018)(Constructions) |
- |
0 |
|
- |
| (Cl.22.47 of IS 302-2-21:2018)(Constructions) |
- |
0 |
|
- |
| (Cl.22.47 of IS 302-2-21:2018)(Constructions) |
- |
0 |
|
- |
| (Cl.22.101 of IS 302-2-21:2018)(Constructions) |
- |
0 |
|
- |
| (Cl.22.105 of IS 302-2-21:2018)(Constructions) |
- |
0 |
|
- |
| (Cl.22.101 of IS 302-2-21:2018)(Constructions) |
- |
0 |
|
- |
| (Cl.22.103 of IS 302-2-21:2018)(Constructions) |
- |
0 |
|
- |
| (Cl.22.104 of IS 302-2-21:2018)(Constructions) |
- |
0 |
|
- |
| (Cl.22.104 of IS 302-2-21:2018)(Constructions) |
- |
0 |
|
- |
| (Cl.22.105 of IS 302-2-21:2018)(Constructions) |
- |
0 |
|
- |
| (Cl.22.109 of IS 302-2-21:2018)(Constructions) |
- |
0 |
|
- |
| (Cl.24.101 of IS 302-2-21:2018)(Components) |
- |
0 |
|
- |
| (Cl.25 of IS 302-2-21:2018)(Supply Connection and External Flexible cords) |
- |
0 |
|
- |
|
29 Apr, 2027 |
- - |
| 11 |
IS 302 : Part 2 : Sec 21 (2018) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 21 stationary storage type electric water heaters (Second Revision) |
Stationary Storage Type Electric Water Heaters |
25000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 31.0(Resistance To Rusting) |
- |
2000 |
|
- |
| 30.0(Resistance To Heat and Fire) |
- |
1000 |
|
- |
| 29.0(Creepage Distances and Clearances) |
- |
1000 |
|
- |
| 28.0(Screws and Connections) |
- |
500 |
|
- |
| 27.0(Provision For Earthing) |
- |
1000 |
|
- |
| 26.0(Terminals for external conductors) |
- |
500 |
|
- |
| 25.0(Supply Connection and External Flexible Cords) |
- |
1000 |
|
- |
| 23.0(Internal Wiring) |
- |
1000 |
|
- |
| 22.0(Construction) |
- |
2000 |
|
- |
| 21.0(Mechanical Strength) |
- |
1000 |
|
- |
| 20.0(Stability and mechanical hazards) |
- |
1000 |
|
- |
| 19.0(Abnormal Operation) |
- |
1000 |
|
- |
| 17.0(Overload Protection of transformer and associated circuit) |
- |
1000 |
|
- |
| 16.0(Leakage current and Electric strength (After Humidity (Environmental) Treatment)) |
- |
1000 |
|
- |
| 15.0(Moisture resistance) |
- |
2000 |
|
- |
| 14.0(Transient Overvoltage) |
- |
1000 |
|
- |
| 13.0(Leakage Current and electric strength at operating temperature) |
- |
1000 |
|
- |
| 11.0(Heating) |
- |
2000 |
|
- |
| 10.0(Input and Current) |
- |
2000 |
|
- |
| 8.0(Protection against access to live parts) |
- |
500 |
|
- |
| 6.0(Classification) |
- |
500 |
|
- |
| 7.0(Marking and Instructions) |
- |
500 |
|
- |
| 24(Components) |
- |
500 |
|
- |
| 4(GENERAL REQUIREMENTS) |
- |
0 |
|
- |
| 5(GENERAL CONDITIONS FOR THE TESTS) |
- |
0 |
|
- |
| 24(Components) |
- |
0 |
|
- |
| 4(GENERAL REQUIREMENTS) |
- |
0 |
|
- |
| 5(GENERAL CONDITIONS FOR THE TESTS) |
- |
0 |
|
- |
|
29 Apr, 2027 |
- - |
| 12 |
IS 302 : Part 1 (2024) |
Household and Similar Electrical Appliances â Safety Part 1 General Requirements (Seventh Revision) |
Home appliances |
32000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 6(Classification- IS 302-1) |
- |
500 |
|
- |
| 5(General conditions for the tests) |
- |
0 |
|
- |
| 11.8(Temperature rise) |
- |
0 |
|
- |
| 11.7(Duration corresponding) |
- |
0 |
|
- |
| 11.6(Combined appliances) |
- |
0 |
|
- |
| 11.5(Motor-operated appliances) |
- |
0 |
|
- |
| 11.4(Heating appliances) |
- |
0 |
|
- |
| 8.1.5(Live parts of built-in appliances) |
- |
0 |
|
- |
| 17(Overload protection of transformers and associated circuits) |
- |
1000 |
|
- |
| 16(Leakage current and electric strength) |
- |
1000 |
|
- |
| 4(General requirement) |
- |
0 |
|
- |
| 31(Resistance to Rusting) |
- |
3000 |
|
- |
| 30.2(Needle Flame Test) |
- |
0 |
|
- |
| 30.2(Glow Wire Test) |
- |
0 |
|
- |
| 30.1(Ball pressure test) |
- |
0 |
|
- |
| 29(clearance, creepage distances and solid insulation) |
- |
1500 |
|
- |
| 28(Screw test and connections) |
- |
1000 |
|
- |
| 27.1(Provision for Earthing, IS 302-1) |
- |
1000 |
|
- |
| 26(Terminals for external conductors) |
- |
1500 |
|
- |
| 25.8(Supply Connection and External Flexible Cords, IS 302-1) |
- |
1000 |
|
- |
| 24(Components) |
- |
500 |
|
- |
| 23.1(Internal Wiring, IS 302-1) |
- |
1000 |
|
- |
| 22.1(Construction, IS 302-1) |
- |
2000 |
|
- |
| 21.1(Mechanical Strength, IS 302-1) |
- |
1000 |
|
- |
| 20.1(Stability & Mechanical Hazards, IS 302-1) |
- |
500 |
|
- |
| 19(Abnormal Operation) |
- |
1000 |
|
- |
| 17(Over Load Protection of Transformers and associated circuits) |
- |
1500 |
|
- |
| 16.3(Electric Strength (after clause 15 and 16.2)) |
- |
0 |
|
- |
| 16.2(Leakage Current (after Clause 15)) |
- |
0 |
|
- |
| 16.1(General) |
- |
0 |
|
- |
| 16.0(General) |
- |
1000 |
|
- |
| 15.3(Humidity Test) |
- |
0 |
|
- |
| 15.2(Spillage Test) |
- |
0 |
|
- |
| 15.1(Ingress Protection test other than IPX0 (IP test)) |
- |
0 |
|
- |
| 15.0(Moisture resistance) |
- |
3000 |
|
- |
| 14(Transient Over Voltages) |
- |
1000 |
|
- |
| 13.3(Electric Strength at operating temperature) |
- |
0 |
|
- |
| 13.2(Leakage current at operating temperature) |
- |
0 |
|
- |
| 13(Leakage current and electric strength at operating temperature) |
- |
1500 |
|
- |
| 11.3(Heating) |
- |
0 |
|
- |
| 11.2(General) |
- |
0 |
|
- |
| 11.1(General) |
- |
0 |
|
- |
| 10.2(Current input) |
- |
1500 |
|
- |
| 10.1(Power input) |
- |
1500 |
|
- |
| 8.1.4(Protection against live parts against protective impedance) |
- |
0 |
|
- |
| 8.1.3(Protection against live parts in visible glowing heating elements) |
- |
0 |
|
- |
| 8.1.2(Protection against live parts in openings) |
- |
0 |
|
- |
| 8.1.1(Protection against live parts in all positions) |
- |
0 |
|
- |
| 7(Marking and instructions) |
- |
500 |
|
- |
| A.2(Earth continuity test) |
- |
0 |
|
- |
| 15.2(Moisture resistance) |
- |
0 |
|
- |
| 19.17(Abnormal Operation, IS 302-1) |
- |
0 |
|
- |
| 20.2(Stability & Mechanical Hazards, IS 302-1) |
- |
0 |
|
- |
| 21.2(Mechanical Strength, IS 302-1) |
- |
0 |
|
- |
| 21.3(Mechanical Strength, IS 302-1) |
- |
0 |
|
- |
| 22.5(Construction) |
- |
0 |
|
- |
| 22.6(Construction, IS 302-1) |
- |
0 |
|
- |
| 22.11(Construction, IS 302-1) |
- |
0 |
|
- |
| 22.16(Construction) |
- |
0 |
|
- |
| 22.42(Construction) |
- |
0 |
|
- |
| 23.3(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 25.6(Supply connection and external flexible cords, IS 302-1) |
- |
1500 |
|
- |
| 25.7(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.14(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.15(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 26.5(Terminals for external conductors) |
- |
0 |
|
- |
| 27.5(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 28.1(Screws and connections) |
- |
0 |
|
- |
| 22.2(Construction, IS 302-1) |
- |
0 |
|
- |
| 22.3(Construction, IS 302-1) |
- |
0 |
|
- |
| B.22.4(Construction, IS 302-1) |
- |
0 |
|
- |
| B.22.5(Construction, IS 302-1) |
- |
0 |
|
- |
| 18(Endurance) |
- |
0 |
|
- |
| 18(Endurance) |
- |
0 |
|
- |
| 12(Charging of metal-ion batteries) |
- |
1500 |
|
- |
| 9(Starting of motor operation test requirements and tests) |
- |
0 |
|
- |
| Annex C(Ageing test on motors) |
- |
0 |
|
- |
| Annex D(Thermal motor protectors) |
- |
0 |
|
- |
|
29 Apr, 2027 |
- - |
| 13 |
IS 302 : Part 2 : Sec 15 (2009) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 15 appliances for heating liquids (First Revision) |
DOMESTIC APPLIANCES |
25000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 6.0(Classification) |
- |
500 |
|
- |
| 7(Marking and instructions) |
- |
500 |
|
- |
| 8(Protection against live parts) |
- |
1000 |
|
- |
| 10(POWER INPUT AND CURRENT) |
- |
2500 |
|
- |
| 11(HEATING) |
- |
1500 |
|
- |
| 13(LEAKAGE CURRENT AND ELECTRIC STRENGTH AT OPERATING TEMPERATURE) |
- |
1500 |
|
- |
| 14(TRANSIENT OVERVOLTAGES) |
- |
1000 |
|
- |
| 15(MOISTURE RESISTANCE) |
- |
2000 |
|
- |
| 16(LEAKAGE CURRENT AND ELECTRIC STRENGTH) |
- |
1500 |
|
- |
| 17(OVERLOAD PROTECTION OF TRANSFORMERS AND ASSOCIATED CIRCUITS) |
- |
1000 |
|
- |
| 19(ABNORMAL OPERATION) |
- |
1000 |
|
- |
| 20(STABILITY AND MECHANICAL HAZARDS) |
- |
500 |
|
- |
| 21(MECHANICAL STRENGTH) |
- |
500 |
|
- |
| 22(CONSTRUCTION) |
- |
1000 |
|
- |
| 23(INTERNAL WIRING) |
- |
500 |
|
- |
| 24(COMPONENTS) |
- |
500 |
|
- |
| 25(SUPPLY CONNECTION AND EXTERNAL FLEXIBLE CORDS) |
- |
500 |
|
- |
| 26(TERMINALS FOR EXTERNAL CONDUCTORS) |
- |
500 |
|
- |
| 27(PROVISION FOR EARTHING) |
- |
1000 |
|
- |
| 28(SCREWS AND CONNECTIONS) |
- |
500 |
|
- |
| 29(CLEARANCES, CREEPAGE DISTANCES AND SOLID INSULATION) |
- |
1500 |
|
- |
| 30(RESISTANCE TO HEAT AND FIRE) |
- |
1500 |
|
- |
| 31(RESISTANCE TO RUSTING) |
- |
2000 |
|
- |
| 22.106(Interlocks) |
- |
500 |
|
- |
| 22.3(Flexing test) |
- |
0 |
|
- |
| 24(Components) |
- |
0 |
|
- |
| 4(General requirements) |
- |
0 |
|
- |
| 5(General Conditions of tests) |
- |
0 |
|
- |
| 6(Classification- IS 302-1) |
- |
0 |
|
- |
| 6(Classification- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-2-15) |
- |
0 |
|
- |
| 7.3(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.4(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.5(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.6(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.7(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.8(Marking- IS 302-1) |
- |
0 |
|
- |
| 6(Classification- IS 302-1) |
- |
0 |
|
- |
| 6(Classification- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| Marking- IS 302-1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-2-15) |
- |
0 |
|
- |
| 7.3(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.4(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.5(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.6(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.7(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.8(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.9(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1O(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.11(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.12(Marking- IS 302-2-15) |
- |
0 |
|
- |
| 7.12(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.12.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.12.3(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.12.5(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.12.6(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.13(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.14(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.15(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.101(Marking- IS 302-2-15) |
- |
0 |
|
- |
| 8(Protection Against Electric Shock, IS 302-1) |
- |
0 |
|
- |
| 10(Power Input and Current, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 13(Electrical Insulation and Leakage Current at Operating Temperature: Leakage current, IS 302-1) |
- |
0 |
|
- |
| 13(Electrical Insulation and Leakage Current at Operating Temperature: High Voltage, IS 302-1) |
- |
0 |
|
- |
| 15.1(Moisture Resistance, IS 302-1) |
- |
0 |
|
- |
| 15.2(Spillage test as 15.2, IS 3.02-1 & 302-2-15) |
- |
0 |
|
- |
| 16(Leakage current as per Cl 16, IS 302-1) |
- |
0 |
|
- |
| 16(electric strength as per Cl 16, IS 302-1) |
- |
0 |
|
- |
| 17(Overload protection of Transformers and Associated Circuits, IS 302-1) |
- |
0 |
|
- |
| 19.13(Abnormal Operation as per Cl 19, IS 302-2-15) |
- |
0 |
|
- |
| 19.13(Abnormal Operation as per Cl 19, IS 302-1) |
- |
0 |
|
- |
| 19.13(Abnormal Operation as per Cl 19, IS 302-1) |
- |
0 |
|
- |
| 19.13(Abnormal Operation as per Cl 19, IS 302-1) |
- |
0 |
|
- |
| 20.1(Stability & Mechanical Hazards, IS 302-1) |
- |
0 |
|
- |
| 21.1(Mechanical Strength, IS 302-1) |
- |
0 |
|
- |
| 21.2(Mechanical Strength, IS 302-1) |
- |
0 |
|
- |
| 22.1(Construction, IS 302-1) |
- |
0 |
|
- |
| 22.7(Construction as per Cl 22.7, IS 3.02-2-15) |
- |
0 |
|
- |
| 22.107(Construction as per Cl 22.7, IS 3.02-2-15) |
- |
0 |
|
- |
| 22.108(Construction as per Cl 22.8, IS 3.02-2-15) |
- |
0 |
|
- |
| 23.1(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.2(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.4(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.5(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.6(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.7(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.8(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.9(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.1O(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 25.1(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.2(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.5(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.6(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.8(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.9(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.1(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.11(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.12(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.13(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.14(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.15(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.16(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.17(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.18(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.19(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.2(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.21(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.22(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 26(Terminals for External Conductors, IS 302-1) |
- |
0 |
|
- |
| 27.1(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27.2(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27.3(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27.4(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27.5(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 28(Screws & Connections, IS 302-1) |
- |
0 |
|
- |
| 29.1(Clearances, Creepage distances and Solid Insulation, IS 302-1) |
- |
0 |
|
- |
| 29.2(Clearances, Creepage distances and Solid Insulation, IS 302-1) |
- |
0 |
|
- |
| 30.1(Resistance to Heat and Fire, IS 302-1) |
- |
0 |
|
- |
| 30.2(Resistance to Heat and Fire, IS 302-1) |
- |
0 |
|
- |
| 31(Resistance of Rusting, IS 302-1) |
- |
0 |
|
- |
| 9(STARTING OF MOTOR-OPERATED APPLIANCES) |
- |
0 |
|
- |
| 18(ENDURANCE) |
- |
0 |
|
- |
| 25.14(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 6.0(Classification) |
- |
0 |
|
- |
| 7(Marking and instructions) |
- |
0 |
|
- |
| 8(Protection against live parts) |
- |
0 |
|
- |
| 10(POWER INPUT AND CURRENT) |
- |
0 |
|
- |
| 11(HEATING) |
- |
0 |
|
- |
| 13(LEAKAGE CURRENT AND ELECTRIC STRENGTH AT OPERATING TEMPERATURE) |
- |
0 |
|
- |
| 14(TRANSIENT OVERVOLTAGES) |
- |
0 |
|
- |
| 15(MOISTURE RESISTANCE) |
- |
0 |
|
- |
| 16(LEAKAGE CURRENT AND ELECTRIC STRENGTH) |
- |
0 |
|
- |
| 17(OVERLOAD PROTECTION OF TRANSFORMERS AND ASSOCIATED CIRCUITS) |
- |
0 |
|
- |
| 19(ABNORMAL OPERATION) |
- |
0 |
|
- |
| 20(STABILITY AND MECHANICAL HAZARDS) |
- |
0 |
|
- |
| 21(MECHANICAL STRENGTH) |
- |
0 |
|
- |
| 22(CONSTRUCTION) |
- |
0 |
|
- |
| 23(INTERNAL WIRING) |
- |
0 |
|
- |
| 24(COMPONENTS) |
- |
0 |
|
- |
| 25(SUPPLY CONNECTION AND EXTERNAL FLEXIBLE CORDS) |
- |
0 |
|
- |
| 26(TERMINALS FOR EXTERNAL CONDUCTORS) |
- |
0 |
|
- |
| 27(PROVISION FOR EARTHING) |
- |
0 |
|
- |
| 28(SCREWS AND CONNECTIONS) |
- |
0 |
|
- |
| 29(CLEARANCES, CREEPAGE DISTANCES AND SOLID INSULATION) |
- |
0 |
|
- |
| 30(RESISTANCE TO HEAT AND FIRE) |
- |
0 |
|
- |
| 31(RESISTANCE TO RUSTING) |
- |
0 |
|
- |
| 22.106(Interlocks) |
- |
0 |
|
- |
| 22.3(Flexing test) |
- |
0 |
|
- |
| 24(Components) |
- |
0 |
|
- |
| 4(General requirements) |
- |
0 |
|
- |
| 5(General Conditions of tests) |
- |
0 |
|
- |
| 6(Classification- IS 302-1) |
- |
0 |
|
- |
| 6(Classification- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-2-15) |
- |
0 |
|
- |
| 7.3(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.4(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.5(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.6(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.7(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.8(Marking- IS 302-1) |
- |
0 |
|
- |
| 6(Classification- IS 302-1) |
- |
0 |
|
- |
| 6(Classification- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| Marking- IS 302-1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-2-15) |
- |
0 |
|
- |
| 7.3(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.4(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.5(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.6(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.7(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.8(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.9(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1O(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.11(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.12(Marking- IS 302-2-15) |
- |
0 |
|
- |
| 7.12(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.12.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.12.3(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.12.5(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.12.6(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.13(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.14(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.15(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.101(Marking- IS 302-2-15) |
- |
0 |
|
- |
| 8(Protection Against Electric Shock, IS 302-1) |
- |
0 |
|
- |
| 10(Power Input and Current, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 13(Electrical Insulation and Leakage Current at Operating Temperature: Leakage current, IS 302-1) |
- |
0 |
|
- |
| 13(Electrical Insulation and Leakage Current at Operating Temperature: High Voltage, IS 302-1) |
- |
0 |
|
- |
| 15.1(Moisture Resistance, IS 302-1) |
- |
0 |
|
- |
| 15.2(Spillage test as 15.2, IS 3.02-1 & 302-2-15) |
- |
0 |
|
- |
| 16(Leakage current as per Cl 16, IS 302-1) |
- |
0 |
|
- |
| 16(electric strength as per Cl 16, IS 302-1) |
- |
0 |
|
- |
| 17(Overload protection of Transformers and Associated Circuits, IS 302-1) |
- |
0 |
|
- |
| 19.13(Abnormal Operation as per Cl 19, IS 302-2-15) |
- |
0 |
|
- |
| 19.13(Abnormal Operation as per Cl 19, IS 302-1) |
- |
0 |
|
- |
| 19.13(Abnormal Operation as per Cl 19, IS 302-1) |
- |
0 |
|
- |
| 19.13(Abnormal Operation as per Cl 19, IS 302-1) |
- |
0 |
|
- |
| 20.1(Stability & Mechanical Hazards, IS 302-1) |
- |
0 |
|
- |
| 21.1(Mechanical Strength, IS 302-1) |
- |
0 |
|
- |
| 21.2(Mechanical Strength, IS 302-1) |
- |
0 |
|
- |
| 22.1(Construction, IS 302-1) |
- |
0 |
|
- |
| 22.7(Construction as per Cl 22.7, IS 3.02-2-15) |
- |
0 |
|
- |
| 22.107(Construction as per Cl 22.7, IS 3.02-2-15) |
- |
0 |
|
- |
| 22.108(Construction as per Cl 22.8, IS 3.02-2-15) |
- |
0 |
|
- |
| 23.1(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.2(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.4(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.5(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.6(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.7(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.8(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.9(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.1O(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 25.1(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.2(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.5(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.6(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.8(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.9(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.1(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.11(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.12(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.13(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.14(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.15(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.16(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.17(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.18(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.19(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.2(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.21(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.22(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 26(Terminals for External Conductors, IS 302-1) |
- |
0 |
|
- |
| 27.1(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27.2(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27.3(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27.4(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27.5(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 28(Screws & Connections, IS 302-1) |
- |
0 |
|
- |
| 29.1(Clearances, Creepage distances and Solid Insulation, IS 302-1) |
- |
0 |
|
- |
| 29.2(Clearances, Creepage distances and Solid Insulation, IS 302-1) |
- |
0 |
|
- |
| 30.1(Resistance to Heat and Fire, IS 302-1) |
- |
0 |
|
- |
| 30.2(Resistance to Heat and Fire, IS 302-1) |
- |
0 |
|
- |
| 31(Resistance of Rusting, IS 302-1) |
- |
0 |
|
- |
| 9(STARTING OF MOTOR-OPERATED APPLIANCES) |
- |
0 |
|
- |
| 18(ENDURANCE) |
- |
0 |
|
- |
| 25.14(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 22.16(Automatic cord reel) |
- |
0 |
|
- |
|
29 Apr, 2027 |
- - |
| 14 |
IS 16242 : Part 1 (2014) |
Uninterruptible power systems (UPS): Part 1 general and safety requirements for UPS |
- |
40000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 4.6(Power interface) |
- |
3000 |
|
- |
| 4.7(Marking & instructions) |
- |
1000 |
|
- |
| 5.1(Protection against shock and energy hazards) |
- |
1000 |
|
- |
| 5.2(Requirement of auxiliary circuits) |
- |
1000 |
|
- |
| 5.3(Protective earthing and bonding) |
- |
1000 |
|
- |
| 5.5(Over current and earth fault condition) |
- |
1000 |
|
- |
| 5.6(Safety interlocks) |
- |
3000 |
|
- |
| 5.7(CLEARANCES, CREEPAGE DISTANCES AND SOLID INSULATION) |
- |
2000 |
|
- |
| 6.2(Connection to power) |
- |
1000 |
|
- |
| 7.2(STABILITY) |
- |
1000 |
|
- |
| 7.4(Construction details) |
- |
1000 |
|
- |
| 7.5(Resistance to fire) |
- |
2000 |
|
- |
| 7.7(Temperature rise) |
- |
3000 |
|
- |
| 8.1(General procision for earth leakage) |
- |
1000 |
|
- |
| 8.2(Electric Strength) |
- |
1000 |
|
- |
| 8.3(Abnormal operating and fault conditions) |
- |
2000 |
|
- |
| 5.4(AC and DC power isolation) |
- |
2000 |
|
- |
| 7.1(Enclosure) |
- |
1000 |
|
- |
| 7.3(MECHANICAL STRENGTH) |
- |
1000 |
|
- |
| 6.1(Wiring, connections and supply) |
- |
1000 |
|
- |
| 6.3(Wiring terminals for external power conductors) |
- |
1000 |
|
- |
| 7.6(Battery location) |
- |
1000 |
|
- |
| 9.0(Connection to telecommunication networks) |
- |
2000 |
|
- |
| 2.10.5.13(Winding wires) |
- |
1000 |
|
- |
| 5.6.1/ RD 2.8.7(Switches & Relays) |
- |
1000 |
|
- |
| 6.1.1/ RD 3.1.4(Insulating Conductors) |
- |
1000 |
|
- |
| Annex I.5(Solid-state backfeed protection) |
- |
1000 |
|
- |
| I.5(transient overvoltages) |
- |
2000 |
|
- |
|
29 Apr, 2027 |
- Exclusion: Cl. 1.5 (Components), Cl. 2.10.6 (PCB Material), Cl. 3.2.5 (Non-rewirable plug with PVC sheathed cable), Cl. 3.2.4 (Appliances inlets/connectors), Cl. 2.10.5.4 (Semiconductor devices), Cl. 2.10.11 of RD (Tests for semiconductor devices and for cemented joints), Cl. 2.10.9 of RD (Thermal cycling), Cl. 2.10.10 of RD (Test for Pollution Degree 1 environment and for insulating compound), Cl. 4.3.8 (Batteries), CL. I.5 (electromagnetic susceptibility), Cl. I.5 (electrostatic discharge), Cl. 2.10.5.11 (SMPS/Main transformer), Cl. 4.5 (Components), Cl. 2.10.8 of RD (Tests on coated printed boards and coated components), Cl. 2.10.5.6 (Thin sheet material), Cl. Annex M (Ventilation of battery compartments), Cl. I.5 (voltage variations), Cl. Annex I.5 (Solid-state backfeed protection), Cl. I.5 (transient overvoltages), Cl. 2.10.5.13 (Winding wires) |
| 15 |
IS 13252 : Part 1 (2010) |
Information technology equipment - Safety: Part 1 general requirements (Second Revision) |
- |
65000 View breakup
Class I & II Product : (AUTOMATIC DATA PROCESSING MACHINE, VISUAL DISPLAY UNITS, VIDEOS MONITORS OF SCREEN SIZE 32" AND ABOVE, COPYING MACHINES/DUPLICATORS, AUTOMATIC TELLER CASH DISPENSING MACHINES, PRINTERS, PLOTTERS, SCANNERS, SET TOP BOX, POWER ADAPTORS FOR IT EQUIPMENTS, VIS JAL DISPLAY UNITS, VIDEO MONITORS OF SCREEN SIZE UPTO 32, STANDALONE SWITCH MODE POWER SUPPLIES (SMPS) WITH OUTPUT VOLTAGE 48V (MAX), DIGITAL CAMERA, TELEPHONE ANSWERING MACHINES, CASH REGISTERS).- Rs. 65000/-
Class III Product : (LAPTOP/NOTEBOOK/TABLET, PASSPORT READER, POINT OF SALE TERMINALS, MAIL PROCESSING MACHINES/POSTAGE MACHINES/FRANKING MACHINES, POWER BANKS FOR USE IN PORTABLE APPLICATIONS, SMART CARD READER, MOBILE PHONES, CCTV CAMERAS/CCTV RECORDERS, USB DRIVEN BARCODE READERS, BARCODE SCANNERS, IRIS SCANNERS, OPTICAL FINGERPRINT SCANNERS, SMART WATCHES, KEYBOARD, USB TYPE EXTERNAL HARD DISK DRIVE, USB TYPE EXTERNAL SOLID-STATE STORAGE DEVICES (ABOVE 256 GB CAPACITY), WIRELESS KEYBOARDS).- Rs. 40000/-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 1.6(Power interface .) |
- |
3000 |
|
- |
| 1.7(Markings and instructions) |
- |
1000 |
|
- |
| 2.1(Protection from electric shock and energy hazards) |
- |
2000 |
|
- |
| 2.2(SELV circuits) |
- |
1000 |
|
- |
| 2.3(TNV circuits) |
- |
1000 |
|
- |
| 2.4(Limited current circuits) |
- |
1000 |
|
- |
| 2.5(Limited power sources .) |
- |
1000 |
|
- |
| 2.6(Provisions for earthing and bonding) |
- |
1000 |
|
- |
| 2.7(Overcurrent and earth fault protection in primary circuits) |
- |
1000 |
|
- |
| 2.8(Safety interlocks) |
- |
3000 |
|
- |
| 2.9(Electrical insulation) |
- |
1000 |
|
- |
| 2.10(Clearances, creepage distances and distances through insulation) |
- |
2000 |
|
- |
| 3.1(General) |
- |
500 |
|
- |
| 3.2(Connection to a mains supply) |
- |
2000 |
|
- |
| 3.3(Wiring terminals for connection of external conductors) |
- |
1000 |
|
- |
| 3.5(Interconnection of equipment) |
- |
1000 |
|
- |
| 4.1(Stability) |
- |
1000 |
|
- |
| 4.2(Mechanical strength) |
- |
1000 |
|
- |
| 4.4(Protection against hazardous moving parts) |
- |
2000 |
|
- |
| 4.5(Thermal requirements) |
- |
5000 |
|
- |
| 4.7(Resistance to fire) |
- |
4000 |
|
- |
| 5.1(Touch current and protective conductor curren) |
- |
1000 |
|
- |
| 5.2(Electric strength) |
- |
1000 |
|
- |
| 5.3(Abnormal operating and fault conditions) |
- |
1000 |
|
- |
| 6.1(Protection of telecommunication network service persons, and users of other equipment connected to the network, from hazards in the equipment) |
- |
3000 |
|
- |
| 6.2(Protection of equipment users from overvoltages on networks telecommunication) |
- |
3000 |
|
- |
| 7.3(Protection of equipment users from overvoltages on the cable distribution system) |
- |
1000 |
|
- |
| Annex B(Motor tests under abnormal conditions) |
- |
1000 |
|
- |
| Annex C(Transformers) |
- |
1000 |
|
- |
| Annex DD(Requirements for the mounting means of a rack mounted equipment) |
- |
1000 |
|
- |
| Annex EE(Household and home/ office document/ media shredders) |
- |
1000 |
|
- |
| 3.4(Disconnection from the mains supply) |
- |
2000 |
|
- |
| 6.3(Protection of the telecommunication wiring system from overheating) |
- |
1000 |
|
- |
| 7.2(Protection of cable distribution system service persons, and users of other equipment connected to the system, from hazardous voltages in the equipment) |
- |
1000 |
|
- |
| 7.4(Insulation between primary circuits and cable distribution systems) |
- |
1000 |
|
- |
| 1.5(Components) |
- |
500 |
|
- |
| 4.6(Openings in enclosures) |
- |
500 |
|
- |
| 7.1(General) |
- |
500 |
|
- |
| 2.8.2/2.8.5(Interlock switches) |
- |
2000 |
|
- |
| 2.10.4.2(Material Group and Comparative Tracking Index) |
- |
1000 |
|
- |
| 2.10.6(PCB material) |
- |
1000 |
|
- |
| 4.6.2(Bottoms of fire enclosures) |
- |
500 |
|
- |
| 2.10.8.4(Abrasion resistance test) |
- |
1000 |
|
- |
| Annex A3(Hot flaming oil test) |
- |
1000 |
|
- |
| 4.3(Design and construction) |
- |
500 |
|
- |
| 2.10.8.2(Thermal conditioning (thermal ageing)) |
- |
1000 |
|
- |
| 2.10.9(Thermal Cycling) |
- |
1000 |
|
- |
|
29 Apr, 2027 |
- Exclusion: Cl. 4.3.13.2 (Ionizing radiation), Cl. 4.3.13.5 (LED, laser class), Cl. 2.10.5.3 (Insulating Compound as Solid Insulation), Cl. 2.10.5.4 (Opto-coupler), Cl. 2.10.5.6 (Thin sheet materials), Cl. 2.10.5.11 (SMPS Transformer and Inductor), Cl. 2.10.5.12 (Wires in wound components), Cl. 2.10.5.13 (Winding wire), Cl. 2.10.5.14 (Additional insulation in wound components), Cl. 2.10.12 (Enclosed and sealed parts), Cl. 3.2.4 (Appliance inlet /connector), Cl. 3.2.5 (Non re-wirable plug with PVC sheathed cable), Cl. 4.2.8 (Cathode Ray Tubes), Cl. 4.3.8 (Batteries), Cl. 4.3.12 (Flammable liquids), Cl. 4.3.13.3/ Annex Y (Effect of UV radiation on material/Ultraviolet conditioning test), Cl. 4.3.13.4 (Human exposure to ultraviolet (UV) radiation), Annex U (Insulating winding wires for use without interleaved insulation), Annex CC (Evaluation of integrated circuit (IC) current limiters), Cl. 4.3.10 (Dust, powders, liquids and gases), Cl. 4.3.11 (Containers for liquids or gases), Cl. 2.8.7 (Switches and Relay), Annex Q (Voltage Dependent Resistors), Annex K (Thermal Control), Cl. 2.10.10 (Test for Pollution Degree 1 environment and for insulating compound), Cl. 2.10.11 (Tests for semiconductor devices and for cemented joints), Cl. 3.2.4 (Appliance inlet /connector), Cl. 3.1.4 (Internal wire), Cl. 1.5 (Components) |
| 16 |
IS 616 (2017) |
Audio, video and similar electronic apparatus - Safety requirements (Fifth Revision) |
- |
37300 View breakup
Class I & II Product : (AMPLIFIERS WITH INPUT POWER 2000W AND ABOVE, ELECTRONIC GAMES (VIDEO), ELECTRONIC MUSICAL SYSTEMS WITH INPUT POWER 200W AND ABOVE, OPTICAL DISC PLAYERS WITH BUILT IN AMPLIFIERS OF INPUT POWER 200W AND ABOVE, PLASMA/LCD/LED TELEVISIONS OF SCREEN SIZE 32"; AND ABOVE, POWER ADAPTORS FOR AUDIO, VIDEO & SIMILAR ELECTRONIC APPARATUS, PLASMA/ LCD/LED TELEVISION OF SCREEN SIZE UP-TO 32, WIRELESS HEADPHONE AND EARPHONE, ELECTRONIC MUSICAL SYSTEM WITH INPUT POWER BELOW 200 WATTS, TELEVISION OTHER THAN PLASMA/ LCD/LED TVS, WIRELESS MICROPHONE, VIDEO CAMERA, WEBCAM (FINISHED PRODUCT), SMART SPEAKERS (WITH AND WITHOUT DISPLAY), BLUETOOTH SPEAKERS)- Rs. 45000/-
Class III Product : (WIRELESS HEADPHONE AND EARPHONE, WIRELESS MICROPHONE, VIDEO CAMERA, WEBCAM (FINISHED PRODUCT), SMART SPEAKERS (WITH AND WITHOUT DISPLAY), BLUETOOTH SPEAKERS)- Rs. 30000/-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 5(Marking and instructions) |
- |
1000 |
|
- |
| 7(Heating under normal operating conditions) |
- |
1000 |
|
- |
| 8(Constructional requirements with regard to the protection against electric shock) |
- |
500 |
|
- |
| 10(Insulation requirements) |
- |
500 |
|
- |
| 11(Fault conditions) |
- |
1000 |
|
- |
| 12(Mechanical strength) |
- |
1000 |
|
- |
| 13(CLEARANCES and CREEPAGE DISTANCES) |
- |
1000 |
|
- |
| 15(TERMINALS) |
- |
1000 |
|
- |
| 16(External flexible cords) |
- |
1000 |
|
- |
| 17(Electrical connections and mechanical fixings) |
- |
1000 |
|
- |
| 19(Stability and mechanical hazards) |
- |
1000 |
|
- |
| 4(General test conditions) |
- |
100 |
|
- |
| 14(Components) |
- |
100 |
|
- |
| 9(Electric shock hazard under normal operating conditions) |
- |
100 |
|
- |
| Cl.5.1 of Cl.5(General requirements) |
- |
100 |
|
- |
| Cl.5.1-i) of Cl.5(Comprehensible and easily discernible) |
- |
100 |
|
- |
| Cl.5.1-ii) of Cl.5(Permanent durability against water and petroleum spirit) |
- |
100 |
|
- |
| Cl.5.2 of Cl.5(Identification and supply ratings) |
- |
100 |
|
- |
| Cl.5.2 a) of Cl.5(Identification, maker) |
- |
100 |
|
- |
| Cl.5.2 b) of Cl.5(Model number or type reference) |
- |
100 |
|
- |
| Cl.5.2 d) of Cl.5(Nature of supply) |
- |
100 |
|
- |
| Cl.5.2 e) of Cl.5(Rated supply voltage) |
- |
100 |
|
- |
| Cl.5.2 f) of Cl.5(Mains frequency if safety dependant) |
- |
100 |
|
- |
| Cl.5.2 g) of Cl.5(Rated current or power consumption for apparatus supplied by supply apparatus for general use, on apparatus or in instruction manual: Measured current or power consumption: Deviation % (max 10%):) |
- |
100 |
|
- |
| Cl.5.2 h) of Cl.5(Rated current or power consumption for apparatus intended for connection to an a.c. mains supply:Measured current or power consumption for Television set: Deviation % (max 10%):) |
- |
100 |
|
- |
| Cl.5.2 h)-i) of Cl.5(appliance coupler for Class I is used for Class II equipment with functional earth connection, the requirements of Clause 15 and Clause 16 related to Class I construction shall be applied up to the connecting point of the protective(earthing) conductor to the functional earth.) |
- |
100 |
|
- |
| Cl.5.2 h)-ii) of Cl.5(Graphical symbols placed on the apparatus, whether required by this standard or not, shall be in accordance with IEC 60417 or ISO 3864-2 or ISO 7000, if available. In the absence of suitable symbols, the manufacturer may design specific graphical symbols.) |
- |
100 |
|
- |
| Cl.5.2 h)-iii) of Cl.5(Care shall be taken so that additional markings and instructions not required by this standard do not contradict the markings and instructions required by this standard . Symbols placed on the Equipment shall be explained in the user manual.) |
- |
100 |
|
- |
| Cl.5.3 of Cl.5(Terminals) |
- |
100 |
|
- |
| Cl.5.3a) of Cl.5(Earth terminal) |
- |
100 |
|
- |
| Cl.5.3b) of Cl.5(Hazardous live terminals) |
- |
100 |
|
- |
| Cl.5.3c) of Cl.5(Markings on supply output terminals) |
- |
100 |
|
- |
| Cl.5.4 of Cl.5(Caution marking) |
- |
100 |
|
- |
| Cl.5.4a) of Cl.5(Use of triangle with exclamation mark) |
- |
100 |
|
- |
| Cl.5.4b) of Cl.5(Marking on loudspeaker grille, IEC 60417-5036) |
- |
100 |
|
- |
| Cl.5.4c) of Cl.5(User-replaceable coin / button cell battery marking) |
- |
100 |
|
- |
| Cl.5.5 of Cl.5(Instructions) |
- |
100 |
|
- |
| Cl.5.5 of Cl.5(Instructions) |
- |
100 |
|
- |
| Cl.5.5 of Cl.5(Instructions) |
- |
100 |
|
- |
| Cl.5.5.1 of Cl.5.5(Safety relevant information) |
- |
100 |
|
- |
| Cl.5.5.2 b) of Cl.5.5(Hazardous live terminals, instructions for wiring) |
- |
100 |
|
- |
| Cl.5.5.2 c) of Cl.5.5(Instructions for replacing lithium battery) |
- |
100 |
|
- |
| Cl.5.5.2 d) of Cl.5.5(Class I earth connection warning) |
- |
100 |
|
- |
| Cl.5.5.2 e) of Cl.5.5(Instructions for multimedia system connection) |
- |
100 |
|
- |
| Cl.5.5.2 f) of Cl.5.5(Special stability warning for attachment of the apparatus to the floor/wall) |
- |
100 |
|
- |
| Cl.5.5.2 g) of Cl.5.5(Warning: battery exposure to heat) |
- |
100 |
|
- |
| Cl.5.5.2 h) of Cl.5.5(Warning: protective film on CRT face) |
- |
100 |
|
- |
| Cl.5.5.2 i) of Cl.5.5("Warning: Non-floor standing TV
>7kg") |
- |
100 |
|
- |
| Cl.5.5.2 j) of Cl.5.5("Warning: User replaceable coin
/ button cell battery") |
- |
100 |
|
- |
| Cl.5.5.3 (a-b) of Cl.5.5(Disconnect device: plug/coupler or all-pole mains switch location, accessibility and markings) |
- |
100 |
|
- |
| Cl.5.5.3 c) of Cl.5.5(Instructions for permanently connected equipment) |
- |
100 |
|
- |
| Cl.5.5.3 c) i) of Cl.5.5(Marking, signal lamps or similar for completely disconnection from the mains) |
- |
100 |
|
- |
| Cl.7.1 of Cl.7(General) |
- |
100 |
|
- |
| "Cl.7.1.1 of Cl.7.1 Table-3"(Requirements) |
- |
100 |
|
- |
| "Cl.7.1.2 of Cl.7.1 Table-3"(Accessible parts) |
- |
100 |
|
- |
| "Cl.7.1.3 of Cl.7.1 Table-3"(Parts, other than windings and printed boards, providing electrical insulation) |
- |
100 |
|
- |
| "Cl.7.1.4 of Cl.7.1 Table-3"(Parts acting as a support or a mechanical barrier) |
- |
100 |
|
- |
| "Cl.7.1.5 of Cl.7.1 Table-3"(Windings) |
- |
100 |
|
- |
| "Cl.7.1.6 of Cl.7.1 Table-3"(Parts not subject to a limit under7.1.1 to 7.1.4) |
- |
100 |
|
- |
| Cl.7.2 of Cl.7(Softening temperature of insulating material supporting parts conductively connected to the mains carrying a current> 0.2 A, shall be at least 150ºC) |
- |
100 |
|
- |
| Cl.8.1 of Cl.8(Conductive parts covered by lacquer, paper, untreated textile oxide films and beads etc. considered to be bare*) |
- |
100 |
|
- |
| Cl.8.2 of Cl.8(No shock hazard when changing voltage setting device, fuse-links or handling drawers etc.) |
- |
100 |
|
- |
| Cl.8.3 of Cl.8(Insulation of hazardous live parts not provided by hygroscopic material) |
- |
100 |
|
- |
| Cl.8.4 of Cl.8(No risk of electric shock from accessible parts or from parts rendered accessible following the removal of a cover which can be removed by hand) |
- |
100 |
|
- |
| Cl.8.5 of Cl.8(Class I apparatus*) |
- |
100 |
|
- |
| Cl.8.5 i) of Cl.8(Basic insulation between hazardous live parts and earthed accessible parts *) |
- |
100 |
|
- |
| Cl.8.5 iv) of Cl.8(Protective earthing terminal *) |
- |
100 |
|
- |
| Cl.8.6 of Cl.8(Class II apparatus) |
- |
100 |
|
- |
| Cl.8.6 a) of Cl.8(Basic and supplementary insulation between hazardous live parts and accessible parts *) |
- |
100 |
|
- |
| Cl.8.6 b) of Cl.8(Reinforced insulation between hazardous live parts and accessible parts *) |
- |
100 |
|
- |
| Cl.8.8 of Cl.8(Insulation thickness and thin sheet materials) |
- |
100 |
|
- |
| Cl.8.8 i) of Cl.8(Basic or supplementary insulation > 0,4 mm (mm)*) |
- |
100 |
|
- |
| Cl.8.8 ii) of Cl.8(Reinforced insulation > 0,4 mm (mm) *) |
- |
100 |
|
- |
| Cl.8.8 iii) of Cl.8(Thin sheet material used inside the equipment) |
- |
100 |
|
- |
| Cl.8.8 iv) of Cl.8(Basic or supplementary insulation, atleast two layers, each meeting10.4) |
- |
100 |
|
- |
| Cl.8.8 v) of Cl.8(Basic or supplementary insulation, three layers any two of which meet10.4) |
- |
100 |
|
- |
| Cl.8.8 vi) of Cl.8(Reinforced insulation, two layers each of which meet 10.4) |
- |
100 |
|
- |
| Cl.8.9 of Cl.8(Adequate insulation between internal hazardous live conductors and accessible parts, or between internal hazardous live parts and conductors connected to accessible parts) |
- |
100 |
|
- |
| Cl.8.10 of Cl.8(Double insulation between accessible parts and conductors connected to the mains) |
- |
100 |
|
- |
| Cl.8.11 of Cl.8(Detaching of wires) |
- |
100 |
|
- |
| Cl.8.12 of Cl.8(Adequate fastening of windows, lenses, lamp covers etc. (pull test 20 N for 10 s)) |
- |
100 |
|
- |
| Cl.8.13 of Cl.8(Adequate fastening of windows, lenses, lamp covers etc. (pull test 20 N for 10 s)) |
- |
100 |
|
- |
| Cl.8.14 of Cl.8(No risk of damage to the insulation of internal wiring due to hot parts or sharp edges) |
- |
100 |
|
- |
| Cl.8.15 of Cl.8(Only special supply equipment can be used*) |
- |
100 |
|
- |
| Cl.8.18 of Cl.8(Disconnection from the mains) |
- |
100 |
|
- |
| Cl.8.18 i) of Cl.8(Disconnect device used in apparatus) |
- |
100 |
|
- |
| Cl.8.18 ii) of Cl.8(All-pole switch or circuit breaker with >3mm contact separation.) |
- |
100 |
|
- |
| Cl.8.18 iii) of Cl.8(Mains switch ON indication *) |
- |
100 |
|
- |
| Cl.8.19 of Cl.8(Switch not fitted in the mains cord *) |
- |
100 |
|
- |
| Cl.8.21 of Cl.8(Non-separable thin sheet material) |
- |
100 |
|
- |
| Cl.9.1.1 of Cl.9.1(Requirements) |
- |
100 |
|
- |
| Cl.9.1.1 i) of Cl.9.1(Accessible parts shall not be hazardous live) |
- |
100 |
|
- |
| Cl.9.1.1 ii) of Cl.9.1(Inaccessible terminals are not accessible or comply with relevant requirements) |
- |
100 |
|
- |
| Cl.9.1.1 iii) of Cl.9.1(For voltages >1000 V ac or >1500 V dc complies with clause 13.3.1 for basic insulation) |
- |
100 |
|
- |
| Cl.9.1.1.2 of Cl.9.1.1(Determination of hazardous live parts) |
- |
100 |
|
- |
| Cl.9.1.1.2 a) of Cl.9.1.1(Open circuit voltages) |
- |
100 |
|
- |
| Touch current measured from terminal devices using the network in annex D(Touch current measured from terminal devices using the network in annex D) |
- |
100 |
|
- |
| Cl.9.1.1.2 c) of Cl.9.1.1(The charge exceeds 45 μC) |
- |
100 |
|
- |
| Cl.9.1.1.2 d) of Cl.9.1.1(Energy of discharge not exceeding 350 mJ) |
- |
100 |
|
- |
| Cl.9.1.1.3 of Cl.9.1.1(Test with test finger and test probe) |
- |
100 |
|
- |
| Cl.9.1.2 of Cl.9.1(Shafts of operating knobs, handles, levers and the like) |
- |
100 |
|
- |
| Cl.9.1.3 of Cl.9.1(Openings ofthe enclosure) |
- |
100 |
|
- |
| Cl.9.1.4 of Cl.9.1(Terminals) |
- |
100 |
|
- |
| Cl.9.1.4 i) of Cl.9.1(Terminals) |
- |
100 |
|
- |
| Cl.9.1.4 ii) of Cl.9.1(Terminals) |
- |
100 |
|
- |
| Cl.9.1.5 of Cl.9.1(Pre-set controls) |
- |
100 |
|
- |
| Cl.9.1.6 of Cl.9.1(Withdrawal of the mains plug:) |
- |
100 |
|
- |
| Cl.9.1.6 i) of Cl.9.1(Withdrawal of the mains plug:) |
- |
100 |
|
- |
| Cl.9.1.6 ii) of Cl.9.1(Withdrawal of the mains plug:) |
- |
100 |
|
- |
| Cl.9.1.6 iii) of Cl.9.1(Withdrawal of the mains plug:) |
- |
100 |
|
- |
| Cl.9.1.7 of Cl.9.1(Resistance to external forces) |
- |
100 |
|
- |
| Cl.9.1.7 a) of Cl.9.1(Resistance to external forces) |
- |
100 |
|
- |
| Cl.9.1.7 b) of Cl.9.1(Resistance to external forces) |
- |
100 |
|
- |
| Cl.9.1.7 c) of Cl.9.1(Resistance to external forces) |
- |
100 |
|
- |
| Cl.9.2 of Cl.9(Removal of protective covers) |
- |
100 |
|
- |
| Cl.10.2 of Cl.10(Surge Test) |
- |
100 |
|
- |
| Cl.10.2 a) of Cl.10(Surge Test) |
- |
100 |
|
- |
| Cl.10.2 b) of Cl.10(Surge Test) |
- |
100 |
|
- |
| Cl.10.2 b) (i) of Cl.10(Surge Test) |
- |
100 |
|
- |
| Cl.10.4.2 ii) of Cl.10.4(Between parts separated by REINFORCED insulation) |
- |
100 |
|
- |
| Cl.10.2 b) (ii) of Cl.10(Surge Test) |
- |
100 |
|
- |
| Cl.10.2 b) (iii) of Cl.10(Surge Test) |
- |
100 |
|
- |
| Cl.10.3 of Cl.10(Humidity treatment) |
- |
100 |
|
- |
| Cl.10.4 of Cl.10(Insulation resistance and dielectric strength) |
- |
100 |
|
- |
| Cl.10.4.1 of Cl.10.4(Insulation of the insulating materials) |
- |
100 |
|
- |
| Cl.10.4.2 of Cl.10.4(Between parts of different polarity directly connected to the mains
Between parts of different polarity directly connected to the mains) |
- |
100 |
|
- |
| Cl.10.4.2 i) of Cl.10.4(Between parts separated by BASIC or SUPPLEMENTARY insulation) |
- |
100 |
|
- |
| Cl.11.1 of Cl.11(Electric Shock Hazard) |
- |
100 |
|
- |
| Cl.11.1 a) of Cl.11(Electric Shock Hazard) |
- |
100 |
|
- |
| Cl.11.1 b) of Cl.11(Electric Shock Hazard) |
- |
100 |
|
- |
| Cl.11.2 of Cl.11(Heating) |
- |
100 |
|
- |
| Cl.11.2.1 of Cl.11.2(Requirements) |
- |
100 |
|
- |
| Cl.11.2.1 i) of Cl.11.2(No danger of fire to the surroundings) |
- |
100 |
|
- |
| Cl.11.2.1 ii) of Cl.11.2(Safety not impaired by abnormal heat) |
- |
100 |
|
- |
| Cl.11.2.1 of Cl.11.2(Flames extinguish within 10 seconds) |
- |
100 |
|
- |
| Cl.11.2.1 of Cl.11.2(No hazard from softening solder) |
- |
100 |
|
- |
| Cl.11.2.2 of Cl.11.2(Measurement of temperature rises) |
- |
100 |
|
- |
| Cl.11.2.3 of Cl.11.2(Accessible parts) |
- |
100 |
|
- |
| Cl.11.2.4 of Cl.11.2(Parts, other than windings and printed boards, providing electrical insulation) |
- |
100 |
|
- |
| Cl.11.2.5 of Cl.11.2(Parts acting as a support or a mechanical barrier) |
- |
100 |
|
- |
| Cl.11.2.6 of Cl.11.2(Windings ) |
- |
100 |
|
- |
| Cl.11.2.7 of Cl.11.2(Printed boards) |
- |
100 |
|
- |
| Cl.11.2.7 i) of Cl.11.2(Printed boards) |
- |
100 |
|
- |
| Cl.11.2.7 i) a) of Cl.11.2(Printed boards) |
- |
100 |
|
- |
| Cl.11.2.7 i) b) of Cl.11.2(Printed boards) |
- |
100 |
|
- |
| Cl.11.2.7 ii) of Cl.11.2(Printed boards) |
- |
100 |
|
- |
| Cl.11.2.7 iii) of Cl.11.2(Printed boards) |
- |
100 |
|
- |
| Cl.11.2.8 of Cl.11.2(Parts not subject to a limit under7.1.1 to 7.1.4) |
- |
100 |
|
- |
| Cl.12.1.1 of Cl.12.1(Requirements) |
- |
100 |
|
- |
| Cl.12.1.2 of Cl.12.1(Bump test ) |
- |
100 |
|
- |
| Cl.12.1.3 of Cl.12.1(Vibration test) |
- |
100 |
|
- |
| Cl.12.1.4 of Cl.12.1(Impact test) |
- |
100 |
|
- |
| Cl.12.1.4 i) of Cl.12.1(Impact test) |
- |
100 |
|
- |
| Cl.12.1.4 ii) of Cl.12.1(Impact test) |
- |
100 |
|
- |
| Cl.12.1.5 of Cl.12.1(Drop test) |
- |
100 |
|
- |
| Cl.12.1.6 of Cl.12.1(Stress relief test) |
- |
100 |
|
- |
| Cl.12.2 of Cl.12(Fixing of actuating elements) |
- |
100 |
|
- |
| Cl.12.3 of Cl.12(Remote control devices held in hand) |
- |
100 |
|
- |
| Cl.12.4 of Cl.12(Drawers ) |
- |
100 |
|
- |
| Cl.12.5 of Cl.12(Antenna coaxial sockets mounted on the apparatus) |
- |
100 |
|
- |
| Cl.12.6 of Cl.12(Telescoping or rod antennas) |
- |
100 |
|
- |
| Cl.12.6.1 of Cl.12.6(General requirements) |
- |
100 |
|
- |
| Cl.12.6.1 i) of Cl.12.6(General requirements) |
- |
100 |
|
- |
| Cl.12.6.2 of Cl.12.6(Physical securement) |
- |
100 |
|
- |
| Cl.12.7 of Cl.12(Apparatus containing coin / button cell batteries) |
- |
100 |
|
- |
| Cl.12.7.3 of Cl.12.7(Tests) |
- |
100 |
|
- |
| Cl.12.7.3.2 of Cl.12.7.3(Stress relief test) |
- |
100 |
|
- |
| Cl.12.7.3.3 of Cl.12.7.3(Battery replacement test) |
- |
100 |
|
- |
| Cl.12.7.3.4 of Cl.12.7.3(Drop test) |
- |
100 |
|
- |
| Cl.12.7.3.5 of Cl.12.7.3(Impact test) |
- |
100 |
|
- |
| Cl.12.7.3.6 of Cl.12.7.3(Crush test) |
- |
100 |
|
- |
| Cl.12.7.4 of Cl.12.7(Compliance) |
- |
100 |
|
- |
| Cl.13.1 of Cl.13(General) |
- |
100 |
|
- |
| Cl.13.2 of Cl.13(Determination of Working voltage) |
- |
100 |
|
- |
| Cl.13.3 of Cl.13(Clearances) |
- |
100 |
|
- |
| Cl.13.3.1 of Cl.13.3(General) |
- |
100 |
|
- |
| Cl.13.3.2 of Cl.13.3(Clearances in circuits conductively connected to the mains) |
- |
100 |
|
- |
| Cl.13.3.3 of Cl.13.3(Clearances in circuits not conductively connected to the mains) |
- |
100 |
|
- |
| Cl.13.3.4 of Cl.13(Measurement of transient voltages) |
- |
100 |
|
- |
| Cl.13.4 a) of Cl.13(Creepage distances ) |
- |
100 |
|
- |
| Cl.13.4 b) of Cl.13(Creepage distances ) |
- |
100 |
|
- |
| Cl.13.4 c) of Cl.13(Creepage distances ) |
- |
100 |
|
- |
| Cl.13.6 a) of Cl.13(Jointed insulation ) |
- |
100 |
|
- |
| Cl.13.6 b) of Cl.13(Jointed insulation ) |
- |
100 |
|
- |
| Cl.13.6 c) of Cl.13(Jointed insulation ) |
- |
100 |
|
- |
| Cl.13.6 d) of Cl.13(Jointed insulation ) |
- |
100 |
|
- |
| Cl.13.7 of Cl.13(Enclosed and sealed parts) |
- |
100 |
|
- |
| Cl.13.8 of Cl.13(Parts filled with insulating compound, meeting the requirements of 8.8) |
- |
100 |
|
- |
| Cl.15.1.2 of Cl.15.1(Design of connectors other than for mains power *) |
- |
100 |
|
- |
| Cl.15.2 of Cl.15(Provisions for protective earthing) |
- |
100 |
|
- |
| Cl.15.3 of Cl.15(Terminals for external flexible cords and for permanent connection to the mains supply*) |
- |
100 |
|
- |
| Cl.15.3.1 of Cl.15.3(Adequate terminals for connection of permanent wiring*) |
- |
100 |
|
- |
| Cl.15.3.2 of Cl.15.3(Reliable connection of non-detachable cords) |
- |
100 |
|
- |
| Cl.15.3.2 i) of Cl.15.3(Not soldered to conductors of a printed circuit board) |
- |
100 |
|
- |
| Cl.15.3.2 ii) of Cl.15.3(Adequate clearances and creepage distances between connections should a wire break away) |
- |
100 |
|
- |
| Cl.15.3.3 of Cl.15.3(Screws and nuts clamping conductors have adequate threads: ISO 261, ISO 262 or similar*) |
- |
100 |
|
- |
| Cl.15.3.4 of Cl.15.3(Conductors adequately fixed (two independent fixings) *) |
- |
100 |
|
- |
| Cl.15.3.5 of Cl.15.3(Terminals allow connection of conductors having appropriate cross-sectional area) |
- |
100 |
|
- |
| Cl.15.3.6 of Cl.15.3(Terminals to 15.3.3 have sizes required by table 16) |
- |
100 |
|
- |
| Cl.15.3.7 of Cl.15.3(Terminals clamp conductors between metal and have adequate pressure) |
- |
100 |
|
- |
| Cl.15.3.7 i) of Cl.15.3(Terminals designed to avoid conductor slipping out when tightened) |
- |
100 |
|
- |
| Cl.15.3.7 ii) of Cl.15.3(Terminals adequately fixed when tightened or loosened (no loosening, wiring not stressed, distances not reduced)) |
- |
100 |
|
- |
| Cl.15.3.8 of Cl.15.3(Terminals carrying a current more than) |
- |
100 |
|
- |
| Cl.15.3.8 i) of Cl.15.3(0.2 A, contact pressure not transmitted by insulating material except ceramic*) |
- |
100 |
|
- |
| Cl.15.3.9 of Cl.15.3(Termination of non-detachable cords: wires terminated near to each other) |
- |
100 |
|
- |
| Cl.15.3.9 i) of Cl.15.3(Terminals located and shielded: test with 8 mm strand) |
- |
100 |
|
- |
| Cl.15.4 of Cl.15(Devices forming a part of the mains plug*) |
- |
100 |
|
- |
| Cl.15.4.1 of Cl.15.4(No undue strain on mains socket-outlets.) |
- |
100 |
|
- |
| Cl.15.4.1 i) of Cl.15.4(Device shall be tested on the equipment as per Fig.11: Torque to be applied : 0.25 Nm (Max)) |
- |
100 |
|
- |
| Cl.15.4.2 of Cl.15.4(Device complies with standard for dimensions of mains plugs) |
- |
100 |
|
- |
| Cl.15.4.3 of Cl.15.4(Device has adequate mechanical strength (tests a,b,c)) |
- |
100 |
|
- |
| Cl.16.2 of Cl.16(Mains cords conductors shall have a nominal cross-sectional area not less than the values given in Table 18, for rated current consumption of the apparatus) |
- |
100 |
|
- |
| Cl.16.3 a) of Cl.16(Flexiblecordsnotcomplyingwith16.1, used for interconnections between separate units of equipment used in combination and carrying hazardous live voltages, have adequate dielectric strength as perCl.10.3) |
- |
100 |
|
- |
| Cl.16.4 of Cl.16(Flexible cords used for connection between equipment have adequate cross-sectional areas to avoid temperature rise under normal and fault conditions) |
- |
100 |
|
- |
| Cl.16.5 a) of Cl.16(Adequate strain relief on external flexible cords) |
- |
100 |
|
- |
| Cl.16.5 b) of Cl.16(Not possible to push cord back into equipment) |
- |
100 |
|
- |
| Cl.16.5 c) of Cl.16(Strain relief device unlikely to damage flexible cord) |
- |
100 |
|
- |
| Cl.16.5 d) of Cl.16(For mains cords of Class I equipment, hazardous live conductors become taut before earth conductor) |
- |
100 |
|
- |
| Cl.16.6 of Cl.16(Apertures for external flexible cord: no risk of damage to the cord during assembly or movement in use) |
- |
100 |
|
- |
| Cl.16.7 a) of Cl.16(Transportable apparatus fitted with detachable cord sets with appliance inlet as perIEC60320-1 or) |
- |
100 |
|
- |
| Cl.16.7 b) of Cl.16(Transportable apparatus shall have a means of stowage to protect the cord) |
- |
100 |
|
- |
| 17.1 a) of Cl.17(Screws are loosened and then tightened with a torque according to table20) |
- |
100 |
|
- |
| Cl.17.1 b) of Cl.17(5 times in the case of screws operating in a thread of metal) |
- |
100 |
|
- |
| Cl.17.1 c) of Cl.17(10 times in the case of screws operating in wood or in a thread in insulating material:) |
- |
100 |
|
- |
| Cl.17.2 of Cl.17(Correct introduction of screws into female threads in non-metallic material) |
- |
100 |
|
- |
| Cl.17.3 a) of Cl.17(Screws or other fixing devices intended to fix Covers, legs, stands or the like, shall be captive in order to prevent replacement during servicing by screws or other fixing devices……) |
- |
100 |
|
- |
| Cl.17.3 b) of Cl.17(Non-captive fixing screws: no hazard when replaced by a screw whose length is 10 times its diameter) |
- |
100 |
|
- |
| Cl.17.4 of Cl.17(No loosening of conductive parts carrying a current > 0.2 A) |
- |
100 |
|
- |
| Cl.17.5 of Cl.17(Contact pressure not transmitted through plastic other than ceramic for connections carrying a current > 0.2 A*) |
- |
100 |
|
- |
| Cl.17.6 of Cl.17(Stranded conductors of flexible supply cords carrying a current > 0.2 A with screw terminals not consolidated by solder *) |
- |
100 |
|
- |
| Cl.17.7 of Cl.17(Cover fixing devices other than screws have adequate strength and their positioning is unambiguous) |
- |
100 |
|
- |
| Cl.17.8 of Cl.17(Detachable legs or stands supplied by the manufacturer of the apparatus shall be delivered with the relevant fixing means *) |
- |
100 |
|
- |
| Cl.17.9 a) of Cl.17(Internal pluggable connections, affecting safety, unlikely to become disconnected) |
- |
100 |
|
- |
| Cl.17.9 b) of Cl.17(By applying a 2N pull force in any direction to the connection, in case of doubt) |
- |
100 |
|
- |
| Cl.19.1 of Cl.19(Stability and mechanical hazards) |
- |
100 |
|
- |
| Cl.19.1 of Cl.19(Stability requirements) |
- |
100 |
|
- |
| Cl.19.2 of Cl.19(Test at 10° to the horizontal) |
- |
100 |
|
- |
| Cl.19.3 of Cl.19(Vertical force test ) |
- |
100 |
|
- |
| Cl.19.4 of Cl.19(Horizontal force test) |
- |
100 |
|
- |
| Cl.19.5 of Cl.19(Test of edges and corners) |
- |
100 |
|
- |
| Cl.19.7 of Cl.19(Wall or ceiling mounting means) |
- |
100 |
|
- |
| Cl.19.7.1 of Cl.19..7(Requirements) |
- |
100 |
|
- |
| Cl.19.7.3 of Cl.19.7(Compliance) |
- |
100 |
|
- |
| Cl.19.6.2 of Cl.19.6(Fragmentation test) |
- |
100 |
|
- |
| Cl.20.1 of Cl.20(Requirements) |
- |
100 |
|
- |
| Cl.19.6.1 of Cl.19.6(Requirements) |
- |
100 |
|
- |
| Cl.20.2.5 of Cl.20.2(Components and parts not covered by 20.2.2, 20.2.3 and 20.2.4) |
- |
100 |
|
- |
| Cl.20.2.5 i) of Cl.20.2(Components and parts not covered by 20.2.2, 20.2.3 and 20.2.4) |
- |
100 |
|
- |
| Cl.20.2.5 ii) of Cl.20.2(Components and parts not covered by 20.2.2, 20.2.3 and 20.2.4) |
- |
100 |
|
- |
| 20(Resistance to fire) |
- |
100 |
|
- |
| Cl.20.3 of Cl.20(Fire enclosure*) |
- |
100 |
|
- |
| Cl.20.3.1 of Cl.20.3(Fire enclosure*) |
- |
100 |
|
- |
| Cl.20.3.2 of Cl.20.3(Fire enclosure*) |
- |
100 |
|
- |
| Cl.20.3.3 of Cl.20.3(Fire enclosure*) |
- |
100 |
|
- |
| Annex-A(Additional requirements for apparatus with protection against splashing water) |
- |
100 |
|
- |
| 3(General requirements) |
- |
100 |
|
- |
| Annex-B(Apparatus to be connected to the TELECOMMUNICATION NETWORKS) |
- |
100 |
|
- |
| Cl.5.5.2 a) of Cl.5.5(Mains powered equipment not exposed to dripping or splashing. Warning concerning objects filled with liquid, etc.) |
- |
100 |
|
- |
| Cl.8.5 ii) of Cl.8(Resistors bridging basic insulation shall complying with 14.1 a) *) |
- |
100 |
|
- |
| Cl.8.11 i) of Cl.8(Noun due reduction of creepage or clearance distances if wires become detached) |
- |
100 |
|
- |
| Cl.8.11 ii) of Cl.8(Vibration test carried out) |
- |
100 |
|
- |
| Cl.9.1 of Cl.9(Testing on the outside) |
- |
100 |
|
- |
| Cl.12.5 a) of Cl.12(Endurance test,) |
- |
100 |
|
- |
| Cl.12.5 b) of Cl.12(Impact test,) |
- |
100 |
|
- |
| Cl.12.5 c) of Cl.12(Torque test) |
- |
100 |
|
- |
| Cl.8.7 v) of Cl.8(Double or reinforced insulation being bridged with a single capacitor or RC-unit complying with 14.3.2 b)) |
- |
100 |
|
- |
| Cl.8.10 of Cl.8(Double insulation between conductors connected to accessible parts and parts connected to the mains) |
- |
100 |
|
- |
| Cl.12.7.1 of Cl.12.7(Coin/button cell batteries with a diameter of 32 mm or less.) |
- |
100 |
|
- |
| Cl.12.7.2 of Cl.12.7(Construction requirementss) |
- |
100 |
|
- |
| Cl.15.1.1 i) of Cl.15.1(Plugs and Sockets*) |
- |
100 |
|
- |
| Cl.15.2 i) of Cl.15(Provisions for protective earthing) |
- |
100 |
|
- |
| Cl.15.2 ii) of Cl.15(Provisions for protective earthing) |
- |
100 |
|
- |
| Cl.15.2 iii) of Cl.15(Provisions for protective earthing) |
- |
100 |
|
- |
| Cl.15.2 iv) of Cl.15(Provisions for protective earthing) |
- |
100 |
|
- |
| Cl.15.2 v) of Cl.15(Provisions for protective earthing) |
- |
100 |
|
- |
| Cl.15.3.2 iii) of Cl.15.3(Wire secured by additional means to the conductor) |
- |
100 |
|
- |
| Cl.16.1 a) of Cl.16(Mains supply flexible cords shall be sheathed type, complying with IEC 60227 for PVC cords or as per IEC 60245 for synthetic rubber cords) |
- |
100 |
|
- |
| Cl.16.1 b) of Cl.16(Non-detachable cords for Class I have green/yellow core for protective earth) |
- |
100 |
|
- |
| Cl.19.1 i) of Cl.19(Stability requirements) |
- |
100 |
|
- |
| Cl.19.6 of Cl.19(Mechanical strength of glass) |
- |
100 |
|
- |
| Cl.8.7 iv) of Cl.8(Double or reinforced insulation being bridged with 2 capacitors or RC-units in series complying with 14.3.2 a)) |
- |
100 |
|
- |
| 16.3b(Cord Bending Test) |
- |
100 |
|
- |
| Cl.15.1.2 i) of Cl.15.1(Design of sockets with symbol of 5.3 b) design *) |
- |
100 |
|
- |
| Cl.11.2.1 of Cl.11.2(Soldered terminations not used as protective mechanism) |
- |
100 |
|
- |
|
29 Apr, 2027 |
- Exclusion: Cl.6 (Hazardous radiations), Cl. 6.2 (Laser Radiation), Cl. 6.1 (Ionizing radiation), Cl. 6.3 (Light Emitting diode(LEDs)), Cl. 14 (Components), Cl.20.2.2 of Cl.20.2 (Electrical components ), CL. 18 (Mechanical strength of picture tubes and protection against the effects of implosion), Cl.20.2.1 a) of Cl.20.2 (Exemption for components contained in an enclosure of material V-0 to IEC60695- 11-10 with openings not exceeding 1 mm in width), Cl.20.2.1 b) of Cl.20.2 (Exemption for small components), Cl.20.2.4 of Cl.20.2 (Printed boards), Cl.20.2 of Cl.20 (Electrical components and mechanical parts), Cl.20.3 of Cl.20 (Fire enclosure*), 8.16/ H 2.2/ H 2.3 (Requirements for insulated winding wires for use without additional interleaved insulation), Cl. 8.16 (Wound Component), Cl. 15 (Internal wires and power cords), Cl. 20.2.4 (Printed Boards), Cl.20.2.5 ii) of Cl.20.2 (Components and parts not covered by 20.2.2, 20.2.3 and 20.2.4), Cl.20.2.4 i) of Cl.20.2 (Printed boards), Cl.8.7 of Cl.8 (Components bridging insulation), Cl.8.7 ii) of Cl.8 (Components bridging basic, supplementary, double or reinforced insulation complying with 14.2 a) or 14.4), Cl.8.7 i) of Cl.8 (Basic insulation bridged by components complying with 14.4.5.3), Cl.8.7 iii) of Cl.8 (Basic and supplementary insulation each being bridged by a capacitor or RC-unit complying with 14.3.2 a)), Cl.8.16 of Cl.8 (Insulated winding wire without additional interleaved insulation), Cl.8.20 of Cl.8 (Bridging components comply with clause 14), Cl. Cl.15.1 of Cl.15 (Plugs and Sockets*), Cl.15.1.3 of Cl.15.1 (Design of terminals and connectors used in output circuits of supply apparatus*), Cl.20.2 of Cl.20 (Electrical components and mechanical parts), Cl.20.2.2 of Cl.20.2 (Electrical components ), Cl.20.2.3 of Cl.20.2 (Internal wiring), Cl.20.2.4 of Cl.20.2 (Printed boards), Cl.20.2.1 b) of Cl.20.2 (Exemption for small components), Cl.8.5 iii) of Cl.8 (Capacitors bridging basic insulation shall complying with 14.2.1 a) *), Annex-L (Additional requirements for electronic flash apparatus for photographic purposes) |
| 17 |
IS 16103 : Part 1 (2012) |
Led modules for general lighting: Part 1 safety requirements |
- |
25000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 7(Marking) |
- |
1000 |
|
- |
| 8(Terminals) |
- |
1000 |
|
- |
| 9(PROVISION FOR EARTHING) |
- |
1000 |
|
- |
| 10(Protection against accidental contact with live parts) |
- |
1000 |
|
- |
| 11(Mositure Resistance and Insulation) |
- |
3000 |
|
- |
| 12(Electric Strength) |
- |
1000 |
|
- |
| 13(Fault conditions) |
- |
1000 |
|
- |
| 15(Construction) |
- |
3000 |
|
- |
| 16(Creepage distance and clearances) |
- |
1000 |
|
- |
| 17(Screws, current carrying parts and connections) |
- |
3000 |
|
- |
| 18(Resistance to heat, fire and tracking) |
- |
6000 |
|
- |
| 19(Resistance to corrosion) |
- |
2000 |
|
- |
| 21(Heat management) |
- |
1000 |
|
- |
|
29 Apr, 2027 |
- - |
| 18 |
IS 15885 : Part 2 : Sec 13 (2012) |
Safety of lamp controlgear: Part 2 particular requirements: Sec 13 d.c. or a.c. supplied electronic controlgear for led modules |
- |
30000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 7(Marking) |
- |
1000 |
|
- |
| 8(Protection against accidental contact with live parts) |
- |
1000 |
|
- |
| 9(Terminals) |
- |
1000 |
|
- |
| 10(PROVISION FOR EARTHING) |
- |
1000 |
|
- |
| 11(MOISTURE RESISTANCE) |
- |
5000 |
|
- |
| 12(Electric Strength) |
- |
1000 |
|
- |
| 14(Fault conditions) |
- |
1000 |
|
- |
| 15(Transformer heating) |
- |
3000 |
|
- |
| 16(Construction) |
- |
3000 |
|
- |
| 17(Creepage distance and clearances) |
- |
2000 |
|
- |
| 18(Screws, current carrying parts and connections) |
- |
2000 |
|
- |
| 19(Resistance to heat, fire and tracking) |
- |
6000 |
|
- |
| 20(Resistance to corrosion) |
- |
3000 |
|
- |
| 13(Thermal endurance test for winding of ballasts) |
- |
0 |
|
- |
| 4(GENERAL REQUIREMENTS) |
- |
0 |
|
- |
| 5(GENERAL NOTES ON TESTS) |
- |
0 |
|
- |
| 6(CLASSIFICATION) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 8("PROTECTION AGAINST ACCIDENTAL
CONTACT WITH LIVE PARTS") |
- |
0 |
|
- |
| 9(TERMINALS) |
- |
0 |
|
- |
| 10(PROVISIONS FOR PROTECTIVE EARTHING) |
- |
0 |
|
- |
| 11(MOISTURE RESISTANCE AND INSULATION) |
- |
0 |
|
- |
| 12(ELECTRIC STRENGTH) |
- |
0 |
|
- |
| 14(FAULT CONDITIONS) |
- |
0 |
|
- |
| 15(TRANSFORMER HEATING) |
- |
0 |
|
- |
| 16(CONSTRUCTION) |
- |
0 |
|
- |
| 17(CREEPAGE DISTANCES AND CLEARANCES) |
- |
0 |
|
- |
| 18("SCREWS, CURRENT-CARRYING PARTS
AND CONNECTIONS") |
- |
0 |
|
- |
| 19(RESISTANCE TO HEAT, FIRE AND TRACKING) |
- |
0 |
|
- |
| 20(RESISTANCE TO CORROSION) |
- |
0 |
|
- |
|
29 Apr, 2027 |
- Exclusion: Cl.16 (Connector, MOV/VDR, Enclosures, Bridging resistor in primary circuit, (Inductor, Capacitor and RC units, Internal wire, SMPS/Mains Transformer, PCB material, Insulated tape, LED, Opto-coupler, Opto-coupler, EMI/EMC filter, Winding wire, Thin sheet materials, Heat shrinkage sleeve, Fuse, PCB material, RF suppression (X-Y capacitors), Cl. 19 (Metal base PCB for LED, Transparent cover, Bobbin, Terminals) |
| 19 |
IS 16102 : Part 1 (2012) |
Self - Ballasted led lamps for general lighting services: Part 1 safety requirements |
- |
25000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 5(Marking) |
- |
1000 |
|
- |
| 6(Interchangeability) |
- |
1000 |
|
- |
| 7(Protection against accidental contact with live parts) |
- |
3000 |
|
- |
| 8(Insulation Resistance and Electric Strength) |
- |
4000 |
|
- |
| 9(MECHANICAL STRENGTH) |
- |
3000 |
|
- |
| 10(cap temperature) |
- |
2500 |
|
- |
| 11(Resistance to Heat) |
- |
4000 |
|
- |
| 12(Resistance to Flame and Ignition) |
- |
2000 |
|
- |
| 13(Fault conditions) |
- |
1000 |
|
- |
| 14(Creepage distances and clearances) |
- |
1000 |
|
- |
| 14(Creepage distance and clearances) |
- |
0 |
|
- |
| 4(General requirement and General test requirements) |
- |
0 |
|
- |
| 5(Marking) |
- |
0 |
|
- |
| 6(Interchangeability) |
- |
0 |
|
- |
| 7(Protection against accidental contact with live parts) |
- |
0 |
|
- |
| 8(Strength after humidity treatment) |
- |
0 |
|
- |
| 9(Mechanical strength) |
- |
0 |
|
- |
| 10(Cap temperature rise) |
- |
0 |
|
- |
| 11(Resistance to heat) |
- |
0 |
|
- |
| 12(Resistance to flame and ignition) |
- |
0 |
|
- |
| 13(Fault conditions) |
- |
0 |
|
- |
| 4(GENERAL REQUIREMENT AND GENERAL TEST REQUIREMENTS) |
- |
0 |
|
- |
| 15(Selection of lamps for tests (Sampling)) |
- |
500 |
|
- |
| 16(Condition of compliance) |
- |
500 |
|
- |
| 17(Tests) |
- |
500 |
|
- |
| Annex A(Ovreview of systems composed of LED modules and control gear) |
- |
500 |
|
- |
| Annex B(Lamps with operating position limitations) |
- |
500 |
|
- |
|
29 Apr, 2027 |
- - |
| 20 |
IS 10322 : Part 5 : Sec 9 (2017) |
Luminaires: Part 5 particular requirements: Sec 9 rope lights |
- |
33000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 21.6(Marking) |
- |
1000 |
|
- |
| 21.7(Construction) |
- |
3000 |
|
- |
| 21.8(Creepage Distance and Clearances) |
- |
2000 |
|
- |
| 21.9(Provision for earthing) |
- |
1000 |
|
- |
| 21.10(Terminals) |
- |
1000 |
|
- |
| 21.11(External & Internal Wiring) |
- |
1000 |
|
- |
| 21.12(Protection against electric shock) |
- |
1000 |
|
- |
| 21.13(Endurance Tests and Thermal Tests) |
- |
8000 |
|
- |
| 21.14(Resistance to Dust & Moisture) |
- |
5000 |
|
- |
| 21.15(Insulation Resistance and Electric Strength) |
- |
4000 |
|
- |
| 21.16(Resistance to Heat , fire and tracking) |
- |
5000 |
|
- |
| 21.4(General Test Requireements) |
- |
100 |
|
- |
| 21.5(Classification of Luminaires') |
- |
100 |
|
- |
| 21.7.1(General) |
- |
200 |
|
- |
| 21.7.3(Terminals and supply connections) |
- |
200 |
|
- |
| 21.7.4(Control units) |
- |
200 |
|
- |
| 21.7.5(Mechanical strength) |
- |
200 |
|
- |
|
29 Apr, 2027 |
- - |
| 21 |
IS 10322 : Part 5 : Sec 8 (2013) |
Luminaires: Part 5 particular requirements: Sec 8 emergency lighting |
- |
33100 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 5(Classification of Luminaires') |
- |
1000 |
|
- |
| 6.0(Marking) |
- |
1000 |
|
- |
| 8.0(Creepage Distance and Clearances) |
- |
1000 |
|
- |
| 9.0(Provision for earthing) |
- |
1000 |
|
- |
| 10.0(Terminals) |
- |
1000 |
|
- |
| 11.0(External & Internal Wiring) |
- |
1000 |
|
- |
| 12.0(Protection against electric shock) |
- |
1000 |
|
- |
| 13.0(Endurance Tests and Thermal Tests) |
- |
6000 |
|
- |
| 14.0(Resistance to Dust & Moisture) |
- |
4000 |
|
- |
| 15.0(Insulation Resistance and Electric Strength) |
- |
2000 |
|
- |
| 16.0(Resistance to Heat , fire and tracking) |
- |
3000 |
|
- |
| 4(General Test Requireements) |
- |
500 |
|
- |
| 7.0(Construction) |
- |
1000 |
|
- |
| 20.0(BATTERY CHARGERS FOR SELFCONTAINED EMERGENCY LUMINAIRES) |
- |
500 |
|
- |
| 19.0(High Temperature Operation) |
- |
5000 |
|
- |
| 18.0(Changeover Operation) |
- |
1000 |
|
- |
| 22.0(REST MODE AND INIHIBITION MODE FACILITIES) |
- |
1000 |
|
- |
| 21.0(TEST DEVICES FOR EMERGENCY OPERATION) |
- |
100 |
|
- |
| 17.0(Functional Safety) |
- |
2000 |
|
- |
|
29 Apr, 2027 |
- - |
| 22 |
IS 10322 : Part 5 : Sec 7 (2017) |
Luminaires: Part 5 particular requirements: Sec 7 lighting chains (First Revision) |
- |
33000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 20.6(Marking) |
- |
1000 |
|
- |
| 20.7(Construction) |
- |
3000 |
|
- |
| 20.8(Creepage Distance and Clearances) |
- |
2000 |
|
- |
| 20.9(Provision for earthing) |
- |
1000 |
|
- |
| 20.10(Terminals) |
- |
1000 |
|
- |
| 20.11(External & Internal Wiring) |
- |
1000 |
|
- |
| 20.12(Protection against electric shock) |
- |
1000 |
|
- |
| 20.13(Endurance Tests and Thermal Tests) |
- |
8000 |
|
- |
| 20.14(Resistance to Dust & Moisture) |
- |
5000 |
|
- |
| 20.15(Insulation Resistance and Electric Strength) |
- |
4000 |
|
- |
| 20.16(Resistance to Heat , fire and tracking) |
- |
6000 |
|
- |
| 20.4(General Test Requireements) |
- |
1000 |
|
- |
| 20.5(Classification of Luminaires') |
- |
1000 |
|
- |
|
29 Apr, 2027 |
- - |
| 23 |
IS 10322 : Part 5 : Sec 6 (2013) |
Luminaires: Part 5 particular requirements: Sec 6 handlamps |
- |
33000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 6.0(Marking) |
- |
1000 |
|
- |
| 7.0(Construction) |
- |
3000 |
|
- |
| 8.0(Creepage Distance and Clearances) |
- |
2000 |
|
- |
| 9.0(Provision for earthing) |
- |
1000 |
|
- |
| 10.0(Terminals) |
- |
1000 |
|
- |
| 12.0(Protection against electric shock) |
- |
1000 |
|
- |
| 13.0(Endurance Tests and Thermal Tests) |
- |
8000 |
|
- |
| 14.0(Resistance to Dust & Moisture) |
- |
5000 |
|
- |
| 15.0(Insulation Resistance and Electric Strength) |
- |
4000 |
|
- |
| 16.0(Resistance to Heat , fire and tracking) |
- |
6000 |
|
- |
| 5(Classification of Luminaires') |
- |
0 |
|
- |
| 11.0(External & Internal Wiring) |
- |
0 |
|
- |
| 4(General Test Requireements) |
- |
0 |
|
- |
| 8.2(Packing -Each Package shall bear the following Particulars) |
- |
0 |
|
- |
|
29 Apr, 2027 |
- - |
| 24 |
IS 10322 : Part 5 : Sec 2 (2012) |
Luminaires: Part 5 particular requirements: Sec 2 recessed luminaires (First Revision) |
- |
40000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 6(Marking) |
- |
1000 |
|
- |
| 7(Construction) |
- |
3000 |
|
- |
| 8(Creepage Distance and Clearances) |
- |
2000 |
|
- |
| 9(Provision for earthing) |
- |
1000 |
|
- |
| 10(Terminals) |
- |
1000 |
|
- |
| 11(External & Internal Wiring) |
- |
1000 |
|
- |
| 12(Protection against electric shock) |
- |
1000 |
|
- |
| 13(Endurance Tests and Thermal Tests) |
- |
8000 |
|
- |
| 14(Resistance to Dust and Moisture) |
- |
5000 |
|
- |
| 15(Insulation Resistance and Electric Strength) |
- |
4000 |
|
- |
| 16(Resistance to Heat , fire and tracking) |
- |
6000 |
|
- |
| 17(Photometric Test) |
- |
7000 |
|
- |
| 4(General Test Requireements) |
- |
1000 |
|
- |
| 5(Classification of Luminaires') |
- |
1000 |
|
- |
|
29 Apr, 2027 |
- - |
| 25 |
IS 10322 : Part 5 : Sec 1 (2012) |
Luminaires: Part 5 particular requirements: Sec 1 fixed general purpose luminaires (First Revision) |
- |
40000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 6.0(Marking) |
- |
1000 |
|
- |
| 7.0(Construction) |
- |
3000 |
|
- |
| 8.0(Creepage Distance and Clearances) |
- |
2000 |
|
- |
| 9.0(Provision for earthing) |
- |
1000 |
|
- |
| 10.0(Terminals) |
- |
1000 |
|
- |
| 11.0(External & Internal Wiring) |
- |
1000 |
|
- |
| 12.0(Protection against electric shock) |
- |
1000 |
|
- |
| 13.0(Endurance Tests and Thermal Tests) |
- |
8000 |
|
- |
| 14.0(Resistance to Dust & Moisture) |
- |
5000 |
|
- |
| 15.0(Insulation Resistance and Electric Strength) |
- |
4000 |
|
- |
| 16.0(Resistance to Heat , fire and tracking) |
- |
6000 |
|
- |
| 17.0(Photometric Test) |
- |
7000 |
|
- |
| 4(General Test Requireements) |
- |
1000 |
|
- |
| 5(Classification of Luminaires') |
- |
1000 |
|
- |
|
29 Apr, 2027 |
- Exclusion: Cl.7.0 (Construction/ UV radiation) |
| 26 |
IS 10322 : Part 5 : Sec 5 (2013) |
Luminaires: Part 5 particular requirements: Sec 5 floodlights (First Revision) |
- |
40000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 7.0(Construction) |
- |
3000 |
|
- |
| 6.0(Marking) |
- |
1000 |
|
- |
| 8.0(Creepage Distance and Clearances) |
- |
2000 |
|
- |
| 9.0(Provision for earthing) |
- |
1000 |
|
- |
| 12.0(Protection against electric shock) |
- |
1000 |
|
- |
| 13.0(Endurance Tests and Thermal Tests) |
- |
8000 |
|
- |
| 14.0(Resistance to Dust & Moisture) |
- |
5000 |
|
- |
| 15.0(Insulation Resistance and Electric Strength) |
- |
4000 |
|
- |
| 16.0(Resistance to Heat , fire and tracking) |
- |
6000 |
|
- |
| 17.0(Photometric Test) |
- |
7000 |
|
- |
| 4(General Test Requireements) |
- |
1000 |
|
- |
| 5(Classification of Luminaires') |
- |
1000 |
|
- |
| 10.0(Terminals) |
- |
1000 |
|
- |
| 11.0(External & Internal Wiring) |
- |
1000 |
|
- |
|
29 Apr, 2027 |
- - |
| 27 |
IS 10322 : PART 5 : SEC 3 (2012) |
Luminaires: Part 5 particular requirements: Sec 3 luminaires for road and street lighting (First Revision) |
- |
40000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 7.0(Construction) |
- |
3000 |
|
- |
| 8.0(Creepage Distance and Clearances) |
- |
2000 |
|
- |
| 9.0(Provision for earthing) |
- |
1000 |
|
- |
| 10.0(Terminals) |
- |
1000 |
|
- |
| 11.0(External & Internal Wiring) |
- |
1000 |
|
- |
| 12.0(Protection against electric shock) |
- |
1000 |
|
- |
| 13.0(Endurance Tests and Thermal Tests) |
- |
8000 |
|
- |
| 14.0(Resistance to Dust & Moisture) |
- |
5000 |
|
- |
| 15.0(Insulation Resistance and Electric Strength) |
- |
4000 |
|
- |
| 16.0(Resistance to Heat , fire and tracking) |
- |
6000 |
|
- |
| 17.0(Photometric Test) |
- |
7000 |
|
- |
| 6.0(Marking) |
- |
1000 |
|
- |
| 5(Classification of Luminaires') |
- |
1000 |
|
- |
| 4(General Test Requireements) |
- |
1000 |
|
- |
|
29 Apr, 2027 |
- - |