| 1 |
IS 2508 (2024) |
Polyethylene Films and Sheets â Specification (Fourth Revision) |
All Grade / Type / Size / Designation |
9750 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 5.1.4 Sl No. (i) of Table 1, Table 2, Table 3 & Table 4.(Density - IS 13360 : Part 3 : Sec 10 : 2021) |
- |
750 |
|
- |
| 5.1.6(Black Film- Carbon black - IS 2508:2024) |
- |
750 |
|
- |
| 5.1.6(Ash content - IS 2508: 2024) |
- |
750 |
|
- |
| 5.1.6(carbon black dispersion - IS 2530: 1963) |
- |
750 |
|
- |
| 5.1.1(Appearance) |
- |
500 |
|
- |
| 5.1.2(Film Form) |
- |
0 |
|
- |
| 5.1.3(Odour) |
- |
500 |
|
- |
| 5.2.1.1/ Table-1,2,3 &4(Nominal Thickness, Annex C,) |
- |
250 |
|
- |
| 5.2.1.2(Nominal Width) |
- |
250 |
|
- |
| 6, Type 1 (LDPE/LLDPE) /Table-1("Tensile strength at break-Machine direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/ Sec 3)") |
- |
1000 |
|
- |
| 6/Table-1("Tensile strength at break-Transverse direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/ Sec 3)") |
- |
1000 |
|
- |
| 6/Table-1("Elongation % at break, -Machine direction,IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/ Sec 3)") |
- |
1000 |
|
- |
| 6/Table-1("Elongation % at break, -Transverse direction,IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/ Sec 3)") |
- |
1000 |
|
- |
| 6/Table-1("Ageing test at (70 ± 1) ºC for 7 days-Machine Direction, IS 7016 (Part 8)
followed by IS 13360 (Part 5/Sec 1) and IS 13360 (Part 5/Sec 3)") |
- |
1000 |
|
- |
| 6/Table-1("Ageing test at (70 ± 1) ºC for 7 days- Transverse Direction, IS 7016 (Part 8)
followed by IS 13360 (Part 5/Sec 1) and IS 13360 (Part 5/Sec 3)") |
- |
1000 |
|
- |
| 6/Table-1(Dart impact strength,Method B of IS 13360 (Part 5/Sec 6)) |
- |
1500 |
|
- |
| 6/Table-1(Tear resistance -Machine direction, IS 13360 (Part 5/Sec 23)) |
- |
1000 |
|
- |
| " 7, Type 2 (HDPE/PE) /Table-2"("Tensile strength at break-Machine direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/ Sec 3)") |
- |
1000 |
|
- |
| " 7/Table-2"("Tensile strength at break-Transverse direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/ Sec 3)") |
- |
1000 |
|
- |
| " 7/Table-2"("Elongation % at break, -Machine direction,IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/ Sec 3)") |
- |
1000 |
|
- |
| " 7/Table-2"("Elongation % at break, -Transverse direction,IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/ Sec 3)") |
- |
1000 |
|
- |
| " 7/Table-2"("Ageing test at (70 ± 1) ºC for 7 days-Machine Direction, IS 7016 (Part 8)
followed by IS 13360 (Part 5/Sec 1) and IS 13360 (Part 5/Sec 3)") |
- |
1000 |
|
- |
| " 7/Table-2"("Ageing test at (70 ± 1) ºC for 7 days- Transverse Direction, IS 7016 (Part 8)
followed by IS 13360 (Part 5/Sec 1) and IS 13360 (Part 5/Sec 3)") |
- |
1000 |
|
- |
| 6/Table-1(Tear resistance-Transverse direction, IS 13360 (Part 5/Sec 23)) |
- |
1000 |
|
- |
| 5.1.5(Melt Flow Index- IS 13360 : Part 4 : Sec 1 : subsec 1 or IS 13360 : Part 4 : Sec 1 : subsec 2) |
- |
750 |
|
- |
| " 7/Table-2"(Dart impact strength,Method B of IS 13360 (Part 5/Sec 6)) |
- |
1500 |
|
- |
| 8, Type 3 (LDPE/LLDPE, PE) /Table-3("Average Tensile Break strength- Machine Direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/Sec 3)") |
- |
1000 |
|
- |
| 8/Table-3("Average Tensile Break strength- Transverse Direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/Sec 3)") |
- |
1000 |
|
- |
| 8/Table-3("Average Tensile Break Elongation %-Machine Direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/Sec 3)") |
- |
1000 |
|
- |
| 8/Table-3("Average Tensile Break Elongation %-Transverse Direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/Sec 3)") |
- |
1000 |
|
- |
| 8/Table-3(Average Tear resistance, IS 2508: 2024 Annex-D) |
- |
1000 |
|
- |
| 8/Table-3(Average Puncture resistance, IS 2508: 2024 Annex-E) |
- |
1000 |
|
- |
| 9, Type 4 (HDPE/PE) /Table-4("Average Yield strength- Machine Direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/Sec 3)") |
- |
1000 |
|
- |
| 9/Table-4("Average Yield strength- Transverse Direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/Sec 3)") |
- |
1000 |
|
- |
| 9/Table-4("Average Tensile Break strength- Machine Direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/Sec 3)") |
- |
1000 |
|
- |
| 9/Table-4("Average Tensile Break strength- Transverse Direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/Sec 3)") |
- |
1000 |
|
- |
| 9/Table-4("Average Tensile yield Elongation %-Machine Direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/Sec 3)") |
- |
1000 |
|
- |
| 9/Table-4("Average Tensile yield Elongation %-Transverse Direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/Sec 3)") |
- |
1000 |
|
- |
| 9/Table-4(Average Tensile Break Elongation %-Machine Direction, IS 13360 (Part 5/Sec 1) and IS 13360 (Part 5/Sec 3)) |
- |
1000 |
|
- |
| 9/Table-4(Average Tensile Break Elongation -Transverse Direction, IS 13360 (Part 5/Sec 1) and S 13360 (Part 5/Sec 3)) |
- |
1000 |
|
- |
| 9/Table-4(Average Tear resistance, IS 2508: 2024 Annex-D) |
- |
1000 |
|
- |
| Cl-4.2.3.1.4 (b)(Toluene Extract) |
- |
750 |
|
- |
| Cl-4.2.3.1.4 (c)(Volatile Matter, Max) |
- |
750 |
|
- |
| Cl-4.2.3.1.4 (d)(Carbon Black Particle Size) |
- |
750 |
|
- |
| Cl-4.2.3.1.4 (e)(Tint Strength) |
- |
1000 |
|
- |
| Cl-4.2.3.1.4 (a)(Density) |
- |
750 |
|
- |
| 5.1.4 Sl No. (i) of Table 1, Table 2, Table 3 & Table 4.(Density - IS 13360 : Part 3 : Sec 10 : 2021) |
- |
- |
|
- |
| 5.1.6(Black Film- Carbon black - IS 2508:2024) |
- |
- |
|
- |
| 5.1.6(Ash content - IS 2508: 2024) |
- |
- |
|
- |
| 5.1.6(carbon black dispersion - IS 2530: 1963) |
- |
- |
|
- |
| 5.1.1(Appearance) |
- |
- |
|
- |
| 5.1.2(Film Form) |
- |
- |
|
- |
| 5.1.3(Odour) |
- |
- |
|
- |
| 5.2.1.1/ Table-1,2,3 &4(Nominal Thickness, Annex C,) |
- |
- |
|
- |
| 5.2.1.2(Nominal Width) |
- |
- |
|
- |
| 6, Type 1 (LDPE/LLDPE) /Table-1("Tensile strength at break-Machine direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/ Sec 3)") |
- |
- |
|
- |
| 6/Table-1("Tensile strength at break-Transverse direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/ Sec 3)") |
- |
- |
|
- |
| 6/Table-1("Elongation % at break, -Machine direction,IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/ Sec 3)") |
- |
- |
|
- |
| 6/Table-1("Elongation % at break, -Transverse direction,IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/ Sec 3)") |
- |
- |
|
- |
| 6/Table-1("Ageing test at (70 ± 1) ºC for 7 days-Machine Direction, IS 7016 (Part 8)
followed by IS 13360 (Part 5/Sec 1) and IS 13360 (Part 5/Sec 3)") |
- |
- |
|
- |
| 6/Table-1("Ageing test at (70 ± 1) ºC for 7 days- Transverse Direction, IS 7016 (Part 8)
followed by IS 13360 (Part 5/Sec 1) and IS 13360 (Part 5/Sec 3)") |
- |
- |
|
- |
| 6/Table-1(Dart impact strength,Method B of IS 13360 (Part 5/Sec 6)) |
- |
- |
|
- |
| 6/Table-1(Tear resistance -Machine direction, IS 13360 (Part 5/Sec 23)) |
- |
- |
|
- |
| " 7, Type 2 (HDPE/PE) /Table-2"("Tensile strength at break-Machine direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/ Sec 3)") |
- |
- |
|
- |
| " 7/Table-2"("Tensile strength at break-Transverse direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/ Sec 3)") |
- |
- |
|
- |
| " 7/Table-2"("Elongation % at break, -Machine direction,IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/ Sec 3)") |
- |
- |
|
- |
| " 7/Table-2"("Elongation % at break, -Transverse direction,IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/ Sec 3)") |
- |
- |
|
- |
| " 7/Table-2"("Ageing test at (70 ± 1) ºC for 7 days-Machine Direction, IS 7016 (Part 8)
followed by IS 13360 (Part 5/Sec 1) and IS 13360 (Part 5/Sec 3)") |
- |
- |
|
- |
| " 7/Table-2"("Ageing test at (70 ± 1) ºC for 7 days- Transverse Direction, IS 7016 (Part 8)
followed by IS 13360 (Part 5/Sec 1) and IS 13360 (Part 5/Sec 3)") |
- |
- |
|
- |
| 6/Table-1(Tear resistance-Transverse direction, IS 13360 (Part 5/Sec 23)) |
- |
- |
|
- |
| 5.1.5(Melt Flow Index- IS 13360 : Part 4 : Sec 1 : subsec 1 or IS 13360 : Part 4 : Sec 1 : subsec 2) |
- |
- |
|
- |
| " 7/Table-2"(Dart impact strength,Method B of IS 13360 (Part 5/Sec 6)) |
- |
- |
|
- |
| 8, Type 3 (LDPE/LLDPE, PE) /Table-3("Average Tensile Break strength- Machine Direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/Sec 3)") |
- |
- |
|
- |
| 8/Table-3("Average Tensile Break strength- Transverse Direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/Sec 3)") |
- |
- |
|
- |
| 8/Table-3("Average Tensile Break Elongation %-Machine Direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/Sec 3)") |
- |
- |
|
- |
| 8/Table-3("Average Tensile Break Elongation %-Transverse Direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/Sec 3)") |
- |
- |
|
- |
| 8/Table-3(Average Tear resistance, IS 2508: 2024 Annex-D) |
- |
- |
|
- |
| 8/Table-3(Average Puncture resistance, IS 2508: 2024 Annex-E) |
- |
- |
|
- |
| 9, Type 4 (HDPE/PE) /Table-4("Average Yield strength- Machine Direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/Sec 3)") |
- |
- |
|
- |
| 9/Table-4("Average Yield strength- Transverse Direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/Sec 3)") |
- |
- |
|
- |
| 9/Table-4("Average Tensile Break strength- Machine Direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/Sec 3)") |
- |
- |
|
- |
| 9/Table-4("Average Tensile Break strength- Transverse Direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/Sec 3)") |
- |
- |
|
- |
| 9/Table-4("Average Tensile yield Elongation %-Machine Direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/Sec 3)") |
- |
- |
|
- |
| 9/Table-4("Average Tensile yield Elongation %-Transverse Direction, IS 13360 (Part 5/Sec 1) and
IS 13360 (Part 5/Sec 3)") |
- |
- |
|
- |
| 9/Table-4(Average Tensile Break Elongation %-Machine Direction, IS 13360 (Part 5/Sec 1) and IS 13360 (Part 5/Sec 3)) |
- |
- |
|
- |
| 9/Table-4(Average Tensile Break Elongation -Transverse Direction, IS 13360 (Part 5/Sec 1) and S 13360 (Part 5/Sec 3)) |
- |
- |
|
- |
| 9/Table-4(Average Tear resistance, IS 2508: 2024 Annex-D) |
- |
- |
|
- |
| Cl-4.2.3.1.4 (b)(Toluene Extract) |
- |
- |
|
- |
| Cl-4.2.3.1.4 (c)(Volatile Matter, Max) |
- |
- |
|
- |
| Cl-4.2.3.1.4 (d)(Carbon Black Particle Size) |
- |
- |
|
- |
| Cl-4.2.3.1.4 (e)(Tint Strength) |
- |
- |
|
- |
| Cl-4.2.3.1.4 (a)(Density) |
- |
- |
|
- |
|
- |
-
Included w.e.f 01.04.2026 |
| 2 |
IS 13488 (2008) |
Irrigation equipment - Emitting pipe systems - Specification (First Revision) |
All |
12700 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 5.1(Materials - shall be resistant to fertilizers and
chemicals commonly employed in irrigation, and shall
be suitable for use with water at temperatures up to
60°C and at pressures designed for the emitting pipe) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.1.a of IS 12786 : 1989)(Potyethylene - higher olefins constituent ) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.1.b of IS 12786 : 1989)(Potyethylene - anti-oxidant) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.1.c.i of IS 12786 : 1989)(Density) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.1.c.ii of IS 12786 : 1989)(Toluene extract - Annex A of IS 12786:1989) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.1.c.iii of IS 12786 : 1989)(Volatile matter - Annex B of IS 12786:1989) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.1.c & 4.2.a of IS 12786 : 1989)(Carbon Black content - IS 2530 : 1963) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.2.b of IS 12786 : 1989)(The dispersion of Carbon Black content shall be satisfactory - IS 2530 : 1963) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.3 of IS 12786 : 1989)(Addition of not more than 10 percent of the manufactures own rework material produced during the manufacture and works testing of pipe complying with this standard is permitted. No other rework material shall be used) |
- |
0 |
|
- |
| 6.2.2(Fittings) |
- |
0 |
|
- |
| 6.3(General) |
- |
200 |
|
- |
| 6.3(General) |
- |
200 |
|
- |
| 8.1.2(Uniformity of Emission Rate for Unregulated Emitting Pipes) |
- |
500 |
|
- |
| 8.1.3(Uniformity of Emission Rate for Regulated Emitting Pipes) |
- |
500 |
|
- |
| 8.2(Emission Rate of Emitting Unit as a Function of Inlet Pressure) |
- |
1000 |
|
- |
| 8.2.1(Unregu/Qt~d Emining Pipe) |
- |
0 |
|
- |
| 8.2.2(Regulated Emitting Pipes) |
- |
0 |
|
- |
| 8.3.1(Wall Thickness ofEmitting Pipe) |
- |
200 |
|
- |
| 8.3.2(Inside Diameter ofEmitting Pipe) |
- |
200 |
|
- |
| 8.3.3(Flow Paths in Emitting Unit) |
- |
500 |
|
- |
| 8.3.4(Spacing ofEmitter Units) |
- |
200 |
|
- |
| 8.4.1(Resistance to Hydrostatic Pressure at Ambient Temperature) |
- |
750 |
|
- |
| 8.4.2(Resistance to Hydrostatic Pressure at Elevated Temperature) |
- |
750 |
|
- |
| 8.5(Resistance to Tension at Elevated Temperature) |
- |
1000 |
|
- |
| 8.5(Resistance to Tension at Elevated Temperature) |
- |
1000 |
|
- |
| 8.5(Resistance to Tension at Elevated Temperature) |
- |
1000 |
|
- |
| 8.6(Resistance to Pull Out of Joints Between Fitting and Emitting
IS 13479) |
- |
1500 |
|
- |
| 8.7.1(Resistance of PE Emitting Pipe to
Environmental Stress Cracking -Acceptance Test
Annex D of IS 12786) |
- |
1500 |
|
- |
| 8.7.2(Resistance of PE Emitting Pipe to
Environmental Stress Cracking - Type Test
Annex D of IS 12786) |
- |
1500 |
|
- |
| 8.8(Determination of Emitting Unit Exponent) |
- |
500 |
|
- |
| 9.1(DESIGNATION - Non regulated Emitting Pipe) |
- |
0 |
|
- |
| 9.2(DESIGNATION - Regulated Emitting Pipe) |
- |
0 |
|
- |
| 4.1 a(Identification) |
- |
500 |
|
- |
| 4.1 a(Identification) |
- |
0 |
|
- |
| 4.1 c(Volatile matter Extract) |
- |
0 |
|
- |
| 4.1 d(Density) |
- |
500 |
|
- |
| 4.1 d(MFI @ 1900C/2.16 Kg) |
- |
700 |
|
- |
| 4.2(Carbon black content) |
- |
700 |
|
- |
| 4.2(Carbon black dispersion) |
- |
700 |
|
- |
| 5.1(Materials) |
- |
0 |
|
- |
| 6.1.1, Table 1,(i)(Nominal Diameter) |
- |
0 |
|
- |
| 6.1.1, Table 1,(ii)(Inside Diameter) |
- |
0 |
|
- |
| 6.1.1, Table 1,(iii)(Tolerance on I.D) |
- |
0 |
|
- |
| 6.1.1, Table 1,(iv)(Wall Thickness) |
- |
0 |
|
- |
| 6.2(Fittings) |
- |
0 |
|
- |
| 6.3(General) |
- |
0 |
|
- |
| 7.1(Test Specimens) |
- |
0 |
|
- |
| 7.2(Order of Tests) |
- |
0 |
|
- |
| 7.3(Testing Conditions) |
- |
0 |
|
- |
| 7.4(Accuracy of Measuring Devices) |
- |
0 |
|
- |
| 8.1(Uniformity of Emission Rate) |
- |
0 |
|
- |
| 8.1.2(Unregulated Emitting Pipes) |
- |
0 |
|
- |
| 8.2(Emission Rate of Emitting Unit as a Function
of Inlet Pressure) |
- |
0 |
|
- |
| 8.2.1(Unregulated Emitting Pipes) |
- |
0 |
|
- |
| 8.2.2(Regulated Emitting Pipes) |
- |
0 |
|
- |
| 8.3.1(Wall Thickness ofEmitting Pipe) |
- |
0 |
|
- |
| 8.3.2(Inside Diameter ofEmitting Pipe) |
- |
0 |
|
- |
| 8.3.3(Flow Paths in Emitting Unit) |
- |
0 |
|
- |
| 8.3.4(Spacing of Emitter Units) |
- |
0 |
|
- |
| 8.4(Resistance of Emitting Pipes to Hydrostatic
Pressure) |
- |
0 |
|
- |
| 8.5(Resistance to Tension at Elevated Temperature) |
- |
0 |
|
- |
| 8.6(Resistance to Pull Out ofJoints Between Fitting
and Emitting) |
- |
0 |
|
- |
| 8.7.1(Acceptance Test) |
- |
0 |
|
- |
| 8.7.2(Type Test) |
- |
0 |
|
- |
| 8.8(Determination of Emitting Unit Exponen) |
- |
0 |
|
- |
| 9.1(Non-regulated Emitting Pipe) |
- |
0 |
|
- |
| 9.2(Regulated Emitting Pipe) |
- |
0 |
|
- |
| 10.1(Marking) |
- |
200 |
|
- |
| 8.1.3(Regulated Emitting Pipes) |
- |
0 |
|
- |
| 5.1(Materials - shall be resistant to fertilizers and
chemicals commonly employed in irrigation, and shall
be suitable for use with water at temperatures up to
60°C and at pressures designed for the emitting pipe) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.1.a of IS 12786 : 1989)(Potyethylene - higher olefins constituent ) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.1.b of IS 12786 : 1989)(Potyethylene - anti-oxidant) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.1.c.i of IS 12786 : 1989)(Density) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.1.c.ii of IS 12786 : 1989)(Toluene extract - Annex A of IS 12786:1989) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.1.c.iii of IS 12786 : 1989)(Volatile matter - Annex B of IS 12786:1989) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.1.c & 4.2.a of IS 12786 : 1989)(Carbon Black content - IS 2530 : 1963) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.2.b of IS 12786 : 1989)(The dispersion of Carbon Black content shall be satisfactory - IS 2530 : 1963) |
- |
0 |
|
- |
| 5.1.2 (Ref. Cl 4.3 of IS 12786 : 1989)(Addition of not more than 10 percent of the manufactures own rework material produced during the manufacture and works testing of pipe complying with this standard is permitted. No other rework material shall be used) |
- |
0 |
|
- |
| 6.2.2(Fittings) |
- |
0 |
|
- |
| 6.3(General) |
- |
0 |
|
- |
| 6.3(General) |
- |
0 |
|
- |
| 8.1.2(Uniformity of Emission Rate for Unregulated Emitting Pipes) |
- |
0 |
|
- |
| 8.1.3(Uniformity of Emission Rate for Regulated Emitting Pipes) |
- |
0 |
|
- |
| 8.2(Emission Rate of Emitting Unit as a Function of Inlet Pressure) |
- |
0 |
|
- |
| 8.2.1(Unregu/Qt~d Emining Pipe) |
- |
0 |
|
- |
| 8.2.2(Regulated Emitting Pipes) |
- |
0 |
|
- |
| 8.3.1(Wall Thickness ofEmitting Pipe) |
- |
0 |
|
- |
| 8.3.2(Inside Diameter ofEmitting Pipe) |
- |
0 |
|
- |
| 8.3.3(Flow Paths in Emitting Unit) |
- |
0 |
|
- |
| 8.3.4(Spacing ofEmitter Units) |
- |
0 |
|
- |
| 8.4.1(Resistance to Hydrostatic Pressure at Ambient Temperature) |
- |
0 |
|
- |
| 8.4.2(Resistance to Hydrostatic Pressure at Elevated Temperature) |
- |
0 |
|
- |
| 8.5(Resistance to Tension at Elevated Temperature) |
- |
0 |
|
- |
| 8.5(Resistance to Tension at Elevated Temperature) |
- |
0 |
|
- |
| 8.5(Resistance to Tension at Elevated Temperature) |
- |
0 |
|
- |
| 8.6(Resistance to Pull Out of Joints Between Fitting and Emitting
IS 13479) |
- |
0 |
|
- |
| 8.7.1(Resistance of PE Emitting Pipe to
Environmental Stress Cracking -Acceptance Test
Annex D of IS 12786) |
- |
0 |
|
- |
| 8.7.2(Resistance of PE Emitting Pipe to
Environmental Stress Cracking - Type Test
Annex D of IS 12786) |
- |
0 |
|
- |
| 8.8(Determination of Emitting Unit Exponent) |
- |
0 |
|
- |
| 9.1(DESIGNATION - Non regulated Emitting Pipe) |
- |
0 |
|
- |
| 9.2(DESIGNATION - Regulated Emitting Pipe) |
- |
0 |
|
- |
| 4.1 a(Identification) |
- |
0 |
|
- |
| 4.1 a(Identification) |
- |
0 |
|
- |
| 4.1 c(Volatile matter Extract) |
- |
0 |
|
- |
| 4.1 d(Density) |
- |
0 |
|
- |
| 4.1 d(MFI @ 1900C/2.16 Kg) |
- |
0 |
|
- |
| 4.2(Carbon black content) |
- |
0 |
|
- |
| 4.2(Carbon black dispersion) |
- |
0 |
|
- |
| 5.1(Materials) |
- |
0 |
|
- |
| 6.1.1, Table 1,(i)(Nominal Diameter) |
- |
0 |
|
- |
| 6.1.1, Table 1,(ii)(Inside Diameter) |
- |
0 |
|
- |
| 6.1.1, Table 1,(iii)(Tolerance on I.D) |
- |
0 |
|
- |
| 6.1.1, Table 1,(iv)(Wall Thickness) |
- |
0 |
|
- |
| 6.2(Fittings) |
- |
0 |
|
- |
| 6.3(General) |
- |
0 |
|
- |
| 7.1(Test Specimens) |
- |
0 |
|
- |
| 7.2(Order of Tests) |
- |
0 |
|
- |
| 7.3(Testing Conditions) |
- |
0 |
|
- |
| 7.4(Accuracy of Measuring Devices) |
- |
0 |
|
- |
| 8.1(Uniformity of Emission Rate) |
- |
0 |
|
- |
| 8.1.2(Unregulated Emitting Pipes) |
- |
0 |
|
- |
| 8.2(Emission Rate of Emitting Unit as a Function
of Inlet Pressure) |
- |
0 |
|
- |
| 8.2.1(Unregulated Emitting Pipes) |
- |
0 |
|
- |
| 8.2.2(Regulated Emitting Pipes) |
- |
0 |
|
- |
| 8.3.1(Wall Thickness ofEmitting Pipe) |
- |
0 |
|
- |
| 8.3.2(Inside Diameter ofEmitting Pipe) |
- |
0 |
|
- |
| 8.3.3(Flow Paths in Emitting Unit) |
- |
0 |
|
- |
| 8.3.4(Spacing of Emitter Units) |
- |
0 |
|
- |
| 8.4(Resistance of Emitting Pipes to Hydrostatic
Pressure) |
- |
0 |
|
- |
| 8.5(Resistance to Tension at Elevated Temperature) |
- |
0 |
|
- |
| 8.6(Resistance to Pull Out ofJoints Between Fitting
and Emitting) |
- |
0 |
|
- |
| 8.7.1(Acceptance Test) |
- |
0 |
|
- |
| 8.7.2(Type Test) |
- |
0 |
|
- |
| 8.8(Determination of Emitting Unit Exponen) |
- |
0 |
|
- |
| 9.1(Non-regulated Emitting Pipe) |
- |
0 |
|
- |
| 9.2(Regulated Emitting Pipe) |
- |
0 |
|
- |
| 10.1(Marking) |
- |
0 |
|
- |
| 8.1.3(Regulated Emitting Pipes) |
- |
0 |
|
- |
|
- |
-
Included w.e.f 01.04.2026 |
| 3 |
IS 13487 (2024) |
Irrigation Equipment — Emitters — Specification |
All |
5250 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl-5.1(Connections) |
- |
250 |
|
- |
| Cl-5.2(Emitter Ends) |
- |
250 |
|
- |
| Cl-5.3(Materials) |
- |
0 |
|
- |
| Cl-6.1(Test Specimens) |
- |
0 |
|
- |
| Cl-6.2.1(polyethylene pipe) |
- |
0 |
|
- |
| Cl-6.2.2("grease or chemicals
") |
- |
0 |
|
- |
| Cl-6.2.3(water temperature) |
- |
1000 |
|
- |
| Cl-6.3(Accuracy or Measuring Devices) |
- |
500 |
|
- |
| Cl-7.1(Construction and Workmanship) |
- |
500 |
|
- |
| Cl-7.2(Flow Paths in Emitter) |
- |
500 |
|
- |
| Cl-7.3(Resistance to Hydrostatic Pressure) |
- |
1500 |
|
- |
| Cl-7.4(Emitter Pull-Out) |
- |
1000 |
|
- |
| Cl-7.4.1(In-Line Emitters) |
- |
1000 |
|
- |
| Cl-7.4.2(On-Line Emitters) |
- |
1000 |
|
- |
| Cl-8.1.1(Uniformity of Emission Rate) |
- |
1000 |
|
- |
| Cl-8.1.2(Emission Rate as Function of Inlet Pressure) |
- |
1000 |
|
- |
| Cl-8.1.3(Determination of Emitter Exponent) |
- |
1000 |
|
- |
| Cl-9(Marking) |
- |
0 |
|
- |
|
- |
-
Included w.e.f 17.03.2026 |
| 4 |
IS 17425 (2020) |
Irrigation Equipment - Quick Coupled Polyethylene Pipes and Fittings for Sprinkler Irrigation Systems - Specification |
All |
24500 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 5(Dimensions of pipe - i) Outside diameter) |
- |
200 |
|
- |
| 5(Dimensions of pipe - ii) Wall thickness minimum) |
- |
200 |
|
- |
| 6(Visual Appearance) |
- |
200 |
|
- |
| 7.1(Hydraulic Characteristics - Quality test) |
- |
2000 |
|
- |
| 7.1(Hydraulic Characteristics - Acceptance test) |
- |
1000 |
|
- |
| 7.2(Reversion Test) |
- |
1000 |
|
- |
| 7.3(Tensile Test- i) Tensile Strength) |
- |
1000 |
|
- |
| 7.3(Tensile Test - ii)Elongation at Break) |
- |
1000 |
|
- |
| 7.4(Fusion Compatibility Test- a) Quality test) |
- |
2000 |
|
- |
| 7.4(Fusion Compatibility Test- b) Acceptance test) |
- |
1000 |
|
- |
| 7.5(Density) |
- |
700 |
|
- |
| 7.6(Melt Flow Rate) |
- |
1000 |
|
- |
| 7.6(Melt Flow Rate) |
- |
1000 |
|
- |
| 4.2(Carbon black- a)carbon content) |
- |
1000 |
|
- |
| 4.2(Carbon black- b) Dispersion of carbon black) |
- |
1000 |
|
- |
| 7.6(Melt now Rate (MFR)) |
- |
1000 |
|
- |
| 7.5(Density) |
- |
700 |
|
- |
| 7.4 Table-2(Fusion Compatibility Test) |
- |
2000 |
|
- |
| 7.3(Tensile Test) |
- |
1000 |
|
- |
| 7.2(Reversion Test) |
- |
1000 |
|
- |
| 7.1 Table -2(Hydraulic Characteristics) |
- |
2000 |
|
- |
| 6.1(VISUAL APPEARANCE) |
- |
200 |
|
- |
| 5.1.2(Ovality) |
- |
200 |
|
- |
| 4.3(Anti-oxidant) |
- |
2000 |
|
- |
| Cl. 4.2 , IS 2530-1963, Cl. 10(Cabon Black Content) |
- |
1000 |
|
- |
| 4.1.2(The MFR of the material shall be between 0.2 to 1.1 (both inclusive) when tested at 190 T at a nominal load of 50 N by the method prescribed in 7 of IS 2530. The MFR of the material shall also be within 20% of the value declared by the manufacturer.’) |
- |
1000 |
|
- |
| 4.1.1(density shall be between 940.4 kg/m’ and 958.4 kg/m3 (both inclusive) when determined at 27°C according to procedure prescribed in Annex A of IS 7328. The value of the density shall also not differ from the nominal value by more than 3 kg/m2 as per 5.2.1.1 of IS 7328.) |
- |
700 |
|
- |
| 4.1(melt flow rating (MFR) shall not exceed 1.10 g/10 min.) |
- |
100 |
|
- |
| 3(CLASSIFICATION OF PIPES) |
- |
0 |
|
- |
| 4.1(Quick Coupled Male and Female Couplers) |
- |
0 |
|
- |
| 4.1(Quick Coupled Male and Female Couplers) |
- |
0 |
|
- |
| 4.1.3(Workmanship and appearance) |
- |
200 |
|
- |
| 6.1.3(Weldability Test- b) Acceptance test) |
- |
200 |
|
- |
| 3(Quick Coupled pipes) |
- |
0 |
|
- |
| 3(QUICK COUPLED PIPES) |
- |
0 |
|
- |
| 4.1 (a)(Quick Coupled Male and Female Couplers) |
- |
500 |
|
- |
| 4.1 (b)(HDPE couplers —) |
- |
0 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31000(Aluminium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31000(Copper Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31000(Magnesium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31000(Silicon Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31000(Iron Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31000(Manganese Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31000(Zinc Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31000(Titanium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31000(Chromium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31000(Remarks) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31500(Aluminium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31500(Copper Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31500(Magnesium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31500(Silicon Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31500(Iron Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31500(Manganese Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31500(Zinc Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31500(Titanium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31500(Chromium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31500(Remarks) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 40800(Aluminium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 40800(Copper Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 40800(Magnesium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 40800(Silicon Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 40800(Iron Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 40800(Manganese Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 40800(Zinc Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 40800(Titanium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 40800(Chromium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 40800(Remarks) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 51300(Aluminium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 51300(Copper Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 51300(Magnesium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 51300(Silicon Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 51300(Iron Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 51300(Manganese Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 51300(Zinc Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 51300(Titanium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 51300(Chromium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 51300(Remarks) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 52000(Aluminium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 52000(Copper Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 52000(Magnesium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 52000(Silicon Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 52000(Iron Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 52000(Manganese Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 52000(Zinc Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 52000(Titanium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 52000(Chromium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 52000(Cr + Mn) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 53000(Aluminium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 53000(Copper Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 53000(Magnesium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 53000(Silicon Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 53000(Iron Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 53000(Manganese Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 53000(Zinc Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 53000(Titanium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 53000(Chromium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 53000(Cr + Mn) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 55000(Aluminium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 55000(Copper Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 55000(Magnesium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 55000(Silicon Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 55000(Iron Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 55000(Manganese Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 55000(Zinc Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 55000(Titanium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 55000(Chromium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 55000(Cr + Mn) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 617-1994, Cl. 5, Table-1 , Desig 4600(Copper Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 617-1994, Cl. 5, Table-1 , Desig 4600(Silicon Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 617-1994, Cl. 5, Table-1 , Desig 4600(Magnesium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 617-1994, Cl. 5, Table-1 , Desig 4600(Iron Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 617-1994, Cl. 5, Table-1 , Desig 4600(Manganese Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 617-1994, Cl. 5, Table-1 , Desig 4600(Nickel Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 617-1994, Cl. 5, Table-1 , Desig 4600(Zinc Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 617-1994, Cl. 5, Table-1 , Desig 4600(Lead Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 617-1994, Cl. 5, Table-1 , Desig 4600(Tin Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 617-1994, Cl. 5, Table-1 , Desig 4600(Titanium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.1, IS 617-1994, Cl. 5, Table-1 , Desig 4600(Aluminium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.2, IS 513 (P-1)-2016, Cl. 7.3, Table-3 , Grade O (CR1)(Carbon Content) |
- |
300 |
|
- |
| C. 4.1.1.1.2, IS 513 (P-1)-2016, Cl. 7.3, Table-3 , Grade O (CR1)(Manganese Content) |
- |
300 |
|
- |
| C. 4.1.1.1.2, IS 513 (P-1)-2016, Cl. 7.3, Table-3 , Grade O (CR1)(Sulphur Content) |
- |
300 |
|
- |
| C. 4.1.1.1.2, IS 513 (P-1)-2016, Cl. 7.3, Table-3 , Grade O (CR1)(Phosphorous Content) |
- |
300 |
|
- |
| C. 4.1.1.1.2, IS 513 (P-1)-2016, Cl. 7.3, Table-3 , Grade O (CR1) Al-Killed(Aluminium Content) |
- |
300 |
|
- |
| C. 4.1.1.1.2, IS 513 (P-1)-2016, Cl. 7.3, Table-3 , Grade O (CR1) Si-Killed(Silicon Content) |
- |
300 |
|
- |
| C. 4.1.1.1.2, IS 513 (P-1)-2016, Cl. 7.3, Table-3 , Grade O (CR1) Al-Si-Killed(Silicon Content) |
- |
300 |
|
- |
| C. 4.1.1.1.2, IS 513 (P-1)-2016, Cl. 7.3, Table-3 , Grade O (CR1) Al-Si-Killed(Aluminium Content) |
- |
300 |
|
- |
| Cl. 4.1.1.2.1, IS 14151 (P-1)-1999, Cl. 4, IS 2530-1963, Cl. 10(Cabon Black Content) |
- |
0 |
|
- |
| Cl. 4.1.1.2.1, IS 14151 (P-1)-1999, Cl. 4, IS 2530-1963, Cl. 16(Carbon Black Dispersion) |
- |
0 |
|
- |
| 5.1 table -1(DIMENSIONS OF PIPES) |
- |
600 |
|
- |
| 4.1.4(Holding attachments for coupler parts) |
- |
500 |
|
- |
| 6.1.3(Weldability Test- a) Quality test) |
- |
2000 |
|
- |
| 4(QUICK COUPLED FITTINGS) |
- |
0 |
|
- |
| 4.1 .1.2.1(HDPE couplers) |
- |
0 |
|
- |
| 4.1 .1.2.2(HDPE couplers) |
- |
0 |
|
- |
| 4.1.4(a)(Holding Attachments for Coupler Parts) |
- |
500 |
|
- |
| 4.1.4(b)(Holding Attachments for Coupler Parts) |
- |
500 |
|
- |
| 4.2.1(Quick Coupled ~pe HDPE Fittings) |
- |
0 |
|
- |
| 4.2.2(Quick Coupled ~pe HDPE Fittings) |
- |
0 |
|
- |
| 4.2.3(Quick Coupled ~pe HDPE Fittings) |
- |
0 |
|
- |
| 4.2.4(Quick Coupled ~pe HDPE Fittings) |
- |
0 |
|
- |
| 4.2.5(Quick Coupled ~pe HDPE Fittings) |
- |
0 |
|
- |
| 4.2.6(Quick Coupled ~pe HDPE Fittings) |
- |
0 |
|
- |
| 4.2.7(Quick Coupled ~pe HDPE Fittings) |
- |
0 |
|
- |
| 4.2.7(1 Dimensions of Quick Coupled Pipes and Fittings) |
- |
500 |
|
- |
| 4.2.7(Reducers Table 1 and 2 of IS 8008 (Part 4)) |
- |
0 |
|
- |
| 4.2.7(Ferrule reducers Table 1 of IS 8008 (Part 5)) |
- |
0 |
|
- |
| 4.2.7(Pipe ends Table 1 of IS 8008 (Part 6)) |
- |
0 |
|
- |
| 4.2.7(End caps Table 1 of IS 8008 (Part 9)) |
- |
0 |
|
- |
| 4.2.7(Insert vatve couplers Table 1 of IS 8008 (Part 3)) |
- |
0 |
|
- |
| 4.2.7(Valve openers Table 1 of IS 8008 (Part 2)) |
- |
0 |
|
- |
| 5.2(Dimensions of Quick Coupled Sprinkler Saddles Table 1.) |
- |
500 |
|
- |
| 6.1(Quick Coupled Pipes and Fittings) |
- |
0 |
|
- |
| 6.1.1, 6.1.1.1(Leakage Test) |
- |
1000 |
|
- |
| 6.1.1, 6.1.1.1(Leakage Test) |
- |
1000 |
|
- |
| 6.1.2, 6.1.2.1(Hydraulic Proof Test) |
- |
1000 |
|
- |
| 6.1.2.2(Hydraulic Proof Test) |
- |
1000 |
|
- |
| 6.1.2.2(Hydraulic Proof Test) |
- |
1000 |
|
- |
| 6.1.3, 6.1.3.1(Weldability Test) |
- |
2000 |
|
- |
| 6.1.3.1.1(Weldability Test) |
- |
1000 |
|
- |
| 6.1.3.2(Quick coupled fittings) |
- |
0 |
|
- |
| 6.2, 6.2.1(Quick Coupled Fittings) |
- |
0 |
|
- |
| 7.2.1(Visual and Workmanship Requirement) |
- |
500 |
|
- |
| 6.2 b(Material Identification - Male & Female Coupler) |
- |
500 |
|
- |
| 6.3.3(Material Identification - Insert Valve Coupler) |
- |
500 |
|
- |
| 6.3.3(Material Identification - Insert Valve Coupler) |
- |
500 |
|
- |
| 6.3.4() |
- |
0 |
|
- |
| 6.3.5(Material Identification - Saddle) |
- |
0 |
|
- |
| 6.3.5(Material Identification - Pipe Ends) |
- |
0 |
|
- |
| 6.3.6(Quick Coupled Pump Connectors - Visual) |
- |
0 |
|
- |
| 4.2(Metallic Couplers) |
- |
0 |
|
- |
| 4.2(Metallic Couplers) |
- |
0 |
|
- |
| 7.2.1(Leakage Test) |
- |
1000 |
|
- |
| Cl.4.1.3(Den sity Test) |
- |
700 |
|
- |
| Cl.4.1.3(MFR Test) |
- |
1000 |
|
- |
| Cl.4.1.3(MFR Test) |
- |
1000 |
|
- |
| Cl.4.1.3(MFR Test) |
- |
1000 |
|
- |
| Cl.4.1.3(MFR Test) |
- |
1000 |
|
- |
| Cl.4.1.3(Thermal Stabi lity) |
- |
1500 |
|
- |
| Cl.4.1.3(Thermal Stabi lity) |
- |
1500 |
|
- |
| Cl.4.1.3, T-1(Volatile Matter) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Volatile Matter) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Volatile Matter) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Volatile Matter) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Volatile Matter) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Volatile Matter) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Volatile Matter) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
500 |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
500 |
|
- |
| Cl.4.1.4(Carbon Black Content) |
- |
1000 |
|
- |
| Cl.4.1.4(Carbon Black Content) |
- |
1000 |
|
- |
| Cl.4.1.4(Carbon Black Content) |
- |
1000 |
|
- |
| Cl.4.1.4(Carbon Black Di spersion) |
- |
1000 |
|
- |
| Cl.4.1.4(Carbon Black Di spersion) |
- |
1000 |
|
- |
| Cl.4.1.4(Carbon Black Di spersion) |
- |
1000 |
|
- |
| Cl.5(Di men sion) |
- |
700 |
|
- |
| Cl.5.1.l(Outside Diameter) |
- |
200 |
|
- |
| Cl.5.1.l(Outside Diameter) |
- |
200 |
|
- |
| Cl.6.2.L(Wall Thickness) |
- |
200 |
|
- |
| Cl.6.2.4(Workmanship and Appearance) |
- |
500 |
|
- |
| Cl.6.2.6(Rubber Ring Hardness) |
- |
500 |
|
- |
| Cl.6.2.6(Ageing Test) |
- |
1000 |
|
- |
| Cl.7.1.l(Visual Anneara nce) |
- |
500 |
|
- |
| Cl.7.1.2(Hydraulic Characteristic) |
- |
2000 |
|
- |
| Cl.7.1.2(Hydraulic Characteristic) |
- |
2000 |
|
- |
| Cl.7.1.2(Hydraulic Characteristic) |
- |
2000 |
|
- |
| Cl.7.1.2(Hydraulic Characteristic) |
- |
2000 |
|
- |
| Cl.7.1.3(Reversion Test) |
- |
1000 |
|
- |
| Cl.7.1.3(Reversion Test) |
- |
1000 |
|
- |
| Cl.7.1.4(Tensile Test) |
- |
1000 |
|
- |
| Cl.7.1.4(Tensile Test) |
- |
1000 |
|
- |
| Cl.7.1.4(Tensile Test) |
- |
1000 |
|
- |
| Cl.7.1.4(Elongation) |
- |
1000 |
|
- |
| Cl.7.1.4(Elongation) |
- |
1000 |
|
- |
| Cl.7.1.5(Fusion Compatibility) |
- |
2000 |
|
- |
| Cl.7.1.5(Fusion Compatibility) |
- |
2000 |
|
- |
| Cl.7.1.5(Fusion Compatibility) |
- |
2000 |
|
- |
| Cl.7.1.5(Fusion Compatibility) |
- |
2000 |
|
- |
| Cl.7.1.6(Corrected Density) |
- |
2000 |
|
- |
| Cl.7.1.7(MFR Test) |
- |
1000 |
|
- |
| Cl.7.1.7(MFR Test) |
- |
1000 |
|
- |
| Cl.7.1.7(MFR Test) |
- |
1000 |
|
- |
| Cl.7.1.7(MFR Test) |
- |
1000 |
|
- |
| Cl.7.2.l(Leakage Test) |
- |
1000 |
|
- |
| Cl.7.2.l(Leakage Test) |
- |
1000 |
|
- |
| Cl.7.2.l(Leakage Test) |
- |
1000 |
|
- |
| Cl.7.2.l(Leakage Test) |
- |
1000 |
|
- |
| Cl.7.2.l(Leakage Test) |
- |
1000 |
|
- |
| Cl.7.2.2(Cl.7.2.2) |
- |
0 |
|
- |
| Cl.7.2.3(Weld ability Test) |
- |
2000 |
|
- |
| Cl.7.2.3(Weld ability Test) |
- |
2000 |
|
- |
| 6.2 (iii) Rubber Rings (a) Shore hardness(Shore hardness) |
- |
500 |
|
- |
| 6.2 (iii) Rubber Rings (b) Accelerated Storage test(Accelerated Storage test) |
- |
1000 |
|
- |
| 5(Dimensions of pipe (outside diameter, ovality, wall thickness)) |
- |
600 |
|
- |
| 6.1(Thermal Stability (OIT)) |
- |
1500 |
|
- |
| 6.1(Volatile Matter) |
- |
500 |
|
- |
| 6.1(Water content) |
- |
500 |
|
- |
| 6.1(Tensile strength at Yield & Elongation at break) |
- |
1000 |
|
- |
| 6.1(Carbon Black Content) |
- |
1000 |
|
- |
| 6.1(Carbon Black Dispersion) |
- |
1000 |
|
- |
| 6.2.1(Base Density x 2) |
- |
700 |
|
- |
| 6.2.1(Melt Flow Index x 2) |
- |
1000 |
|
- |
| 6.2.1(Thermal Stability (OIT) x 2) |
- |
1500 |
|
- |
| 6.2.1(Volatile Matter x 2) |
- |
500 |
|
- |
| 6.2.1(Water content x 2) |
- |
500 |
|
- |
| 6.2.1(Carbon Black Content x 2) |
- |
1000 |
|
- |
| 6.2.1(Carbon Black Dispersion x 2) |
- |
1000 |
|
- |
| 6.2.1(Wall thickness of male & female coupler) |
- |
200 |
|
- |
| 6.2.4(Workmanship and appearance (Visual)) |
- |
500 |
|
- |
| 6.2.5(Holding attachment for coupler parts) |
- |
0 |
|
- |
| 6.2.5(Material Composition (Chemical Analysis)) |
- |
0 |
|
- |
| 4.2.2(Coating thickness (Hot dip Galvanized or Electroplated or Passivated or Powder Coated)) |
- |
0 |
|
- |
| 6.2.6(Material Identification (Chemical Analysis)) |
- |
0 |
|
- |
| 6.2.6(Color) |
- |
200 |
|
- |
| 6.2.6(Rubber Ring Hardness Shore – A (Before Ageing)) |
- |
500 |
|
- |
| 6.2.6(Ageing Charges for rubber ring) |
- |
1000 |
|
- |
| 7.1.1(Visual appearance of pipes) |
- |
500 |
|
- |
| 7.1.2(Hydraulic Characteristics) |
- |
2000 |
|
- |
| 7.1.2((a) Acceptance Test (48 hrs) / 80˚ C) |
- |
1000 |
|
- |
| 7.1.2((b) Type test ( 165 hrs) / 80˚ C) |
- |
2000 |
|
- |
| 7.1.3(Reversion) |
- |
1000 |
|
- |
| 7.1.4(Tensile strength & elongation) |
- |
1000 |
|
- |
| 7.1.5(Fusion Compatibility test) |
- |
2000 |
|
- |
| 7.1.5((a) Acceptance Test (48 hrs) / 80˚ C) |
- |
1000 |
|
- |
| 7.1.5((b) Type test ( 165 hrs) / 80˚ C) |
- |
2000 |
|
- |
| 7.1.6(Corrected Density) |
- |
700 |
|
- |
| 7.1.6(Base Density) |
- |
700 |
|
- |
| 7.1.6(Carbon black Content) |
- |
1000 |
|
- |
| 7.1.7(Melt Flow Rate (MFR)) |
- |
1000 |
|
- |
| 7.2.1(Leakage test 1hour / 27°C) |
- |
1000 |
|
- |
| 7.2.2(Hydraulic Proof test 1hour / 27°C) |
- |
1000 |
|
- |
| 7.2.3((a) Acceptance Test (48 hrs) / 80˚ C) |
- |
1000 |
|
- |
| 7.2.3((b) Type test ( 165 hrs) / 80˚ C) |
- |
2000 |
|
- |
| 8(Supply of pipe (Visual)) |
- |
0 |
|
- |
| 4.1.1 (Table-1)(Density) |
- |
700 |
|
- |
| 4.1.1 (Table-1)(Melt Flow Index) |
- |
1000 |
|
- |
| 4.1.1 (Table-1)(Oxidation Induction Time) |
- |
1500 |
|
- |
| 4.1.1 (Table-1)(Volatile Matter) |
- |
500 |
|
- |
| 4.1.1 (Table-1)(Water content) |
- |
500 |
|
- |
| 4.1.1 (Table-1)(Tensile strength at Yield & Elongation at break) |
- |
1000 |
|
- |
| 4.1.4(Carbon Black Content) |
- |
1000 |
|
- |
| 4.1.4(Carbon Black Dispersion) |
- |
1000 |
|
- |
| 4.1.1(Polyethylene material) |
- |
0 |
|
- |
| 4.1.3, Table 1,(i)(Bass density) |
- |
700 |
|
- |
| 4.1.3, Table 1,(ii)(Melt flow rate) |
- |
1000 |
|
- |
| 4.1.3, Table 1,(iii)(Thermal stability) |
- |
1500 |
|
- |
| 4.1.3, Table 1,(iv)(Volatile matter) |
- |
500 |
|
- |
| 4.1.3, Table 1,(v)(Water content) |
- |
500 |
|
- |
| 4.1.3, Table 1,(vi)(Minimum tensile strength at yield) |
- |
1000 |
|
- |
| 4.1.3, Table 1,(vii)(Minimum elongation at break) |
- |
1000 |
|
- |
| 4.1.4(The Carbon Content and Dispersion) |
- |
1000 |
|
- |
| 4.1.5(Carbon Black Specification) |
- |
1000 |
|
- |
| 4.1.6(Antioxidant) |
- |
2000 |
|
- |
| 4.1.7(Rework Material) |
- |
0 |
|
- |
| 4.2(Metallic Couplers) |
- |
0 |
|
- |
| 5.1, Table 1,(i)(Plain pipes) |
- |
0 |
|
- |
| 5.1, Table 1,(ii)(90° Bends and tee) |
- |
0 |
|
- |
| 5.1, Table 1,(iii)(Base pipe ) |
- |
0 |
|
- |
| 5.1, Table 1,(iv)(PCN) |
- |
0 |
|
- |
| 5.1, Table 1,(v)(Reducers, ferrule reducers) |
- |
0 |
|
- |
| 5.1, Table 1,(vi)(End caps, insert valve coupler, valve
openers) |
- |
0 |
|
- |
| 5.1, Table 1,(vii)(Riser pipe and socket) |
- |
0 |
|
- |
| 7.1.1(Visual Appearance and Workmanship) |
- |
500 |
|
- |
| 7.1.2(Hydraulic Performance Characteristic) |
- |
2000 |
|
- |
| 7.1.3(Reversion Test) |
- |
1000 |
|
- |
| 7.1.4(Tensile Test) |
- |
1000 |
|
- |
| 7.1.5(Fusion Compatibility Test) |
- |
2000 |
|
- |
| 7.1.6(Corrected Density) |
- |
700 |
|
- |
| 7.1.7(Melt flow rate) |
- |
1000 |
|
- |
| 7.2.1(Leakage Test) |
- |
1000 |
|
- |
| 7.2.2(Hydraulic Proof Test) |
- |
1000 |
|
- |
| 7.2.3(Weldability Test) |
- |
2000 |
|
- |
| 7.3(Quick Couple Fitting) |
- |
0 |
|
- |
| 10(Marking) |
- |
300 |
|
- |
| 5.1.2(Squareness) |
- |
200 |
|
- |
| Cl 6.3.5, Table 5 Dimension of Quick Coupled Sprinkler Saddles (Foot Batten)(Table 5 Dimension of Quick Coupled Sprinkler Saddles (Foot Batten)) |
- |
0 |
|
- |
| 5(Dimensions of pipe - i) Outside diameter) |
- |
- |
|
- |
| 5(Dimensions of pipe - ii) Wall thickness minimum) |
- |
- |
|
- |
| 6(Visual Appearance) |
- |
- |
|
- |
| 7.1(Hydraulic Characteristics - Quality test) |
- |
- |
|
- |
| 7.1(Hydraulic Characteristics - Acceptance test) |
- |
- |
|
- |
| 7.2(Reversion Test) |
- |
- |
|
- |
| 7.3(Tensile Test- i) Tensile Strength) |
- |
- |
|
- |
| 7.3(Tensile Test - ii)Elongation at Break) |
- |
- |
|
- |
| 7.4(Fusion Compatibility Test- a) Quality test) |
- |
- |
|
- |
| 7.4(Fusion Compatibility Test- b) Acceptance test) |
- |
- |
|
- |
| 7.5(Density) |
- |
- |
|
- |
| 7.6(Melt Flow Rate) |
- |
- |
|
- |
| 7.6(Melt Flow Rate) |
- |
- |
|
- |
| 4.2(Carbon black- a)carbon content) |
- |
- |
|
- |
| 4.2(Carbon black- b) Dispersion of carbon black) |
- |
- |
|
- |
| 7.6(Melt now Rate (MFR)) |
- |
- |
|
- |
| 7.5(Density) |
- |
- |
|
- |
| 7.4 Table-2(Fusion Compatibility Test) |
- |
- |
|
- |
| 7.3(Tensile Test) |
- |
- |
|
- |
| 7.2(Reversion Test) |
- |
- |
|
- |
| 7.1 Table -2(Hydraulic Characteristics) |
- |
- |
|
- |
| 6.1(VISUAL APPEARANCE) |
- |
- |
|
- |
| 5.1.2(Ovality) |
- |
- |
|
- |
| 4.3(Anti-oxidant) |
- |
- |
|
- |
| Cl. 4.2 , IS 2530-1963, Cl. 10(Cabon Black Content) |
- |
- |
|
- |
| 4.1.2(The MFR of the material shall be between 0.2 to 1.1 (both inclusive) when tested at 190 T at a nominal load of 50 N by the method prescribed in 7 of IS 2530. The MFR of the material shall also be within 20% of the value declared by the manufacturer.’) |
- |
- |
|
- |
| 4.1.1(density shall be between 940.4 kg/m’ and 958.4 kg/m3 (both inclusive) when determined at 27°C according to procedure prescribed in Annex A of IS 7328. The value of the density shall also not differ from the nominal value by more than 3 kg/m2 as per 5.2.1.1 of IS 7328.) |
- |
- |
|
- |
| 4.1(melt flow rating (MFR) shall not exceed 1.10 g/10 min.) |
- |
- |
|
- |
| 3(CLASSIFICATION OF PIPES) |
- |
- |
|
- |
| 4.1(Quick Coupled Male and Female Couplers) |
- |
- |
|
- |
| 4.1(Quick Coupled Male and Female Couplers) |
- |
- |
|
- |
| 4.1.3(Workmanship and appearance) |
- |
- |
|
- |
| 6.1.3(Weldability Test- b) Acceptance test) |
- |
- |
|
- |
| 3(Quick Coupled pipes) |
- |
- |
|
- |
| 3(QUICK COUPLED PIPES) |
- |
- |
|
- |
| 4.1 (a)(Quick Coupled Male and Female Couplers) |
- |
- |
|
- |
| 4.1 (b)(HDPE couplers —) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31000(Aluminium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31000(Copper Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31000(Magnesium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31000(Silicon Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31000(Iron Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31000(Manganese Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31000(Zinc Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31000(Titanium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31000(Chromium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31000(Remarks) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31500(Aluminium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31500(Copper Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31500(Magnesium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31500(Silicon Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31500(Iron Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31500(Manganese Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31500(Zinc Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31500(Titanium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31500(Chromium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 31500(Remarks) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 40800(Aluminium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 40800(Copper Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 40800(Magnesium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 40800(Silicon Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 40800(Iron Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 40800(Manganese Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 40800(Zinc Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 40800(Titanium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 40800(Chromium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 40800(Remarks) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 51300(Aluminium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 51300(Copper Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 51300(Magnesium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 51300(Silicon Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 51300(Iron Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 51300(Manganese Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 51300(Zinc Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 51300(Titanium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 51300(Chromium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 51300(Remarks) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 52000(Aluminium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 52000(Copper Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 52000(Magnesium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 52000(Silicon Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 52000(Iron Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 52000(Manganese Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 52000(Zinc Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 52000(Titanium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 52000(Chromium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 52000(Cr + Mn) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 53000(Aluminium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 53000(Copper Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 53000(Magnesium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 53000(Silicon Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 53000(Iron Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 53000(Manganese Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 53000(Zinc Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 53000(Titanium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 53000(Chromium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 53000(Cr + Mn) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 55000(Aluminium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 55000(Copper Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 55000(Magnesium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 55000(Silicon Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 55000(Iron Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 55000(Manganese Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 55000(Zinc Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 55000(Titanium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 55000(Chromium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 737-2008, Cl. 6, Table-1 , Desig 55000(Cr + Mn) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 617-1994, Cl. 5, Table-1 , Desig 4600(Copper Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 617-1994, Cl. 5, Table-1 , Desig 4600(Silicon Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 617-1994, Cl. 5, Table-1 , Desig 4600(Magnesium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 617-1994, Cl. 5, Table-1 , Desig 4600(Iron Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 617-1994, Cl. 5, Table-1 , Desig 4600(Manganese Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 617-1994, Cl. 5, Table-1 , Desig 4600(Nickel Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 617-1994, Cl. 5, Table-1 , Desig 4600(Zinc Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 617-1994, Cl. 5, Table-1 , Desig 4600(Lead Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 617-1994, Cl. 5, Table-1 , Desig 4600(Tin Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 617-1994, Cl. 5, Table-1 , Desig 4600(Titanium Content) |
- |
- |
|
- |
| C. 4.1.1.1.1, IS 617-1994, Cl. 5, Table-1 , Desig 4600(Aluminium Content) |
- |
- |
|
- |
| C. 4.1.1.1.2, IS 513 (P-1)-2016, Cl. 7.3, Table-3 , Grade O (CR1)(Carbon Content) |
- |
- |
|
- |
| C. 4.1.1.1.2, IS 513 (P-1)-2016, Cl. 7.3, Table-3 , Grade O (CR1)(Manganese Content) |
- |
- |
|
- |
| C. 4.1.1.1.2, IS 513 (P-1)-2016, Cl. 7.3, Table-3 , Grade O (CR1)(Sulphur Content) |
- |
- |
|
- |
| C. 4.1.1.1.2, IS 513 (P-1)-2016, Cl. 7.3, Table-3 , Grade O (CR1)(Phosphorous Content) |
- |
- |
|
- |
| C. 4.1.1.1.2, IS 513 (P-1)-2016, Cl. 7.3, Table-3 , Grade O (CR1) Al-Killed(Aluminium Content) |
- |
- |
|
- |
| C. 4.1.1.1.2, IS 513 (P-1)-2016, Cl. 7.3, Table-3 , Grade O (CR1) Si-Killed(Silicon Content) |
- |
- |
|
- |
| C. 4.1.1.1.2, IS 513 (P-1)-2016, Cl. 7.3, Table-3 , Grade O (CR1) Al-Si-Killed(Silicon Content) |
- |
- |
|
- |
| C. 4.1.1.1.2, IS 513 (P-1)-2016, Cl. 7.3, Table-3 , Grade O (CR1) Al-Si-Killed(Aluminium Content) |
- |
- |
|
- |
| Cl. 4.1.1.2.1, IS 14151 (P-1)-1999, Cl. 4, IS 2530-1963, Cl. 10(Cabon Black Content) |
- |
- |
|
- |
| Cl. 4.1.1.2.1, IS 14151 (P-1)-1999, Cl. 4, IS 2530-1963, Cl. 16(Carbon Black Dispersion) |
- |
- |
|
- |
| 5.1 table -1(DIMENSIONS OF PIPES) |
- |
- |
|
- |
| 4.1.4(Holding attachments for coupler parts) |
- |
- |
|
- |
| 6.1.3(Weldability Test- a) Quality test) |
- |
- |
|
- |
| 4(QUICK COUPLED FITTINGS) |
- |
- |
|
- |
| 4.1 .1.2.1(HDPE couplers) |
- |
- |
|
- |
| 4.1 .1.2.2(HDPE couplers) |
- |
- |
|
- |
| 4.1.4(a)(Holding Attachments for Coupler Parts) |
- |
- |
|
- |
| 4.1.4(b)(Holding Attachments for Coupler Parts) |
- |
- |
|
- |
| 4.2.1(Quick Coupled ~pe HDPE Fittings) |
- |
- |
|
- |
| 4.2.2(Quick Coupled ~pe HDPE Fittings) |
- |
- |
|
- |
| 4.2.3(Quick Coupled ~pe HDPE Fittings) |
- |
- |
|
- |
| 4.2.4(Quick Coupled ~pe HDPE Fittings) |
- |
- |
|
- |
| 4.2.5(Quick Coupled ~pe HDPE Fittings) |
- |
- |
|
- |
| 4.2.6(Quick Coupled ~pe HDPE Fittings) |
- |
- |
|
- |
| 4.2.7(Quick Coupled ~pe HDPE Fittings) |
- |
- |
|
- |
| 4.2.7(1 Dimensions of Quick Coupled Pipes and Fittings) |
- |
- |
|
- |
| 4.2.7(Reducers Table 1 and 2 of IS 8008 (Part 4)) |
- |
- |
|
- |
| 4.2.7(Ferrule reducers Table 1 of IS 8008 (Part 5)) |
- |
- |
|
- |
| 4.2.7(Pipe ends Table 1 of IS 8008 (Part 6)) |
- |
- |
|
- |
| 4.2.7(End caps Table 1 of IS 8008 (Part 9)) |
- |
- |
|
- |
| 4.2.7(Insert vatve couplers Table 1 of IS 8008 (Part 3)) |
- |
- |
|
- |
| 4.2.7(Valve openers Table 1 of IS 8008 (Part 2)) |
- |
- |
|
- |
| 5.2(Dimensions of Quick Coupled Sprinkler Saddles Table 1.) |
- |
- |
|
- |
| 6.1(Quick Coupled Pipes and Fittings) |
- |
- |
|
- |
| 6.1.1, 6.1.1.1(Leakage Test) |
- |
- |
|
- |
| 6.1.1, 6.1.1.1(Leakage Test) |
- |
- |
|
- |
| 6.1.2, 6.1.2.1(Hydraulic Proof Test) |
- |
- |
|
- |
| 6.1.2.2(Hydraulic Proof Test) |
- |
- |
|
- |
| 6.1.2.2(Hydraulic Proof Test) |
- |
- |
|
- |
| 6.1.3, 6.1.3.1(Weldability Test) |
- |
- |
|
- |
| 6.1.3.1.1(Weldability Test) |
- |
- |
|
- |
| 6.1.3.2(Quick coupled fittings) |
- |
- |
|
- |
| 6.2, 6.2.1(Quick Coupled Fittings) |
- |
- |
|
- |
| 7.2.1(Visual and Workmanship Requirement) |
- |
- |
|
- |
| 6.2 b(Material Identification - Male & Female Coupler) |
- |
- |
|
- |
| 6.3.3(Material Identification - Insert Valve Coupler) |
- |
- |
|
- |
| 6.3.3(Material Identification - Insert Valve Coupler) |
- |
- |
|
- |
| 6.3.4() |
- |
- |
|
- |
| 6.3.5(Material Identification - Saddle) |
- |
- |
|
- |
| 6.3.5(Material Identification - Pipe Ends) |
- |
- |
|
- |
| 6.3.6(Quick Coupled Pump Connectors - Visual) |
- |
- |
|
- |
| 4.2(Metallic Couplers) |
- |
- |
|
- |
| 4.2(Metallic Couplers) |
- |
- |
|
- |
| 7.2.1(Leakage Test) |
- |
- |
|
- |
| Cl.4.1.3(Den sity Test) |
- |
- |
|
- |
| Cl.4.1.3(MFR Test) |
- |
- |
|
- |
| Cl.4.1.3(MFR Test) |
- |
- |
|
- |
| Cl.4.1.3(MFR Test) |
- |
- |
|
- |
| Cl.4.1.3(MFR Test) |
- |
- |
|
- |
| Cl.4.1.3(Thermal Stabi lity) |
- |
- |
|
- |
| Cl.4.1.3(Thermal Stabi lity) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Volatile Matter) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Volatile Matter) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Volatile Matter) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Volatile Matter) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Volatile Matter) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Volatile Matter) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Volatile Matter) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
- |
|
- |
| Cl.4.1.3, T-1(Water Content) |
- |
- |
|
- |
| Cl.4.1.4(Carbon Black Content) |
- |
- |
|
- |
| Cl.4.1.4(Carbon Black Content) |
- |
- |
|
- |
| Cl.4.1.4(Carbon Black Content) |
- |
- |
|
- |
| Cl.4.1.4(Carbon Black Di spersion) |
- |
- |
|
- |
| Cl.4.1.4(Carbon Black Di spersion) |
- |
- |
|
- |
| Cl.4.1.4(Carbon Black Di spersion) |
- |
- |
|
- |
| Cl.5(Di men sion) |
- |
- |
|
- |
| Cl.5.1.l(Outside Diameter) |
- |
- |
|
- |
| Cl.5.1.l(Outside Diameter) |
- |
- |
|
- |
| Cl.6.2.L(Wall Thickness) |
- |
- |
|
- |
| Cl.6.2.4(Workmanship and Appearance) |
- |
- |
|
- |
| Cl.6.2.6(Rubber Ring Hardness) |
- |
- |
|
- |
| Cl.6.2.6(Ageing Test) |
- |
- |
|
- |
| Cl.7.1.l(Visual Anneara nce) |
- |
- |
|
- |
| Cl.7.1.2(Hydraulic Characteristic) |
- |
- |
|
- |
| Cl.7.1.2(Hydraulic Characteristic) |
- |
- |
|
- |
| Cl.7.1.2(Hydraulic Characteristic) |
- |
- |
|
- |
| Cl.7.1.2(Hydraulic Characteristic) |
- |
- |
|
- |
| Cl.7.1.3(Reversion Test) |
- |
- |
|
- |
| Cl.7.1.3(Reversion Test) |
- |
- |
|
- |
| Cl.7.1.4(Tensile Test) |
- |
- |
|
- |
| Cl.7.1.4(Tensile Test) |
- |
- |
|
- |
| Cl.7.1.4(Tensile Test) |
- |
- |
|
- |
| Cl.7.1.4(Elongation) |
- |
- |
|
- |
| Cl.7.1.4(Elongation) |
- |
- |
|
- |
| Cl.7.1.5(Fusion Compatibility) |
- |
- |
|
- |
| Cl.7.1.5(Fusion Compatibility) |
- |
- |
|
- |
| Cl.7.1.5(Fusion Compatibility) |
- |
- |
|
- |
| Cl.7.1.5(Fusion Compatibility) |
- |
- |
|
- |
| Cl.7.1.6(Corrected Density) |
- |
- |
|
- |
| Cl.7.1.7(MFR Test) |
- |
- |
|
- |
| Cl.7.1.7(MFR Test) |
- |
- |
|
- |
| Cl.7.1.7(MFR Test) |
- |
- |
|
- |
| Cl.7.1.7(MFR Test) |
- |
- |
|
- |
| Cl.7.2.l(Leakage Test) |
- |
- |
|
- |
| Cl.7.2.l(Leakage Test) |
- |
- |
|
- |
| Cl.7.2.l(Leakage Test) |
- |
- |
|
- |
| Cl.7.2.l(Leakage Test) |
- |
- |
|
- |
| Cl.7.2.l(Leakage Test) |
- |
- |
|
- |
| Cl.7.2.2(Cl.7.2.2) |
- |
- |
|
- |
| Cl.7.2.3(Weld ability Test) |
- |
- |
|
- |
| Cl.7.2.3(Weld ability Test) |
- |
- |
|
- |
| 6.2 (iii) Rubber Rings (a) Shore hardness(Shore hardness) |
- |
- |
|
- |
| 6.2 (iii) Rubber Rings (b) Accelerated Storage test(Accelerated Storage test) |
- |
- |
|
- |
| 5(Dimensions of pipe (outside diameter, ovality, wall thickness)) |
- |
- |
|
- |
| 6.1(Thermal Stability (OIT)) |
- |
- |
|
- |
| 6.1(Volatile Matter) |
- |
- |
|
- |
| 6.1(Water content) |
- |
- |
|
- |
| 6.1(Tensile strength at Yield & Elongation at break) |
- |
- |
|
- |
| 6.1(Carbon Black Content) |
- |
- |
|
- |
| 6.1(Carbon Black Dispersion) |
- |
- |
|
- |
| 6.2.1(Base Density x 2) |
- |
- |
|
- |
| 6.2.1(Melt Flow Index x 2) |
- |
- |
|
- |
| 6.2.1(Thermal Stability (OIT) x 2) |
- |
- |
|
- |
| 6.2.1(Volatile Matter x 2) |
- |
- |
|
- |
| 6.2.1(Water content x 2) |
- |
- |
|
- |
| 6.2.1(Carbon Black Content x 2) |
- |
- |
|
- |
| 6.2.1(Carbon Black Dispersion x 2) |
- |
- |
|
- |
| 6.2.1(Wall thickness of male & female coupler) |
- |
- |
|
- |
| 6.2.4(Workmanship and appearance (Visual)) |
- |
- |
|
- |
| 6.2.5(Holding attachment for coupler parts) |
- |
- |
|
- |
| 6.2.5(Material Composition (Chemical Analysis)) |
- |
- |
|
- |
| 4.2.2(Coating thickness (Hot dip Galvanized or Electroplated or Passivated or Powder Coated)) |
- |
- |
|
- |
| 6.2.6(Material Identification (Chemical Analysis)) |
- |
- |
|
- |
| 6.2.6(Color) |
- |
- |
|
- |
| 6.2.6(Rubber Ring Hardness Shore – A (Before Ageing)) |
- |
- |
|
- |
| 6.2.6(Ageing Charges for rubber ring) |
- |
- |
|
- |
| 7.1.1(Visual appearance of pipes) |
- |
- |
|
- |
| 7.1.2(Hydraulic Characteristics) |
- |
- |
|
- |
| 7.1.2((a) Acceptance Test (48 hrs) / 80˚ C) |
- |
- |
|
- |
| 7.1.2((b) Type test ( 165 hrs) / 80˚ C) |
- |
- |
|
- |
| 7.1.3(Reversion) |
- |
- |
|
- |
| 7.1.4(Tensile strength & elongation) |
- |
- |
|
- |
| 7.1.5(Fusion Compatibility test) |
- |
- |
|
- |
| 7.1.5((a) Acceptance Test (48 hrs) / 80˚ C) |
- |
- |
|
- |
| 7.1.5((b) Type test ( 165 hrs) / 80˚ C) |
- |
- |
|
- |
| 7.1.6(Corrected Density) |
- |
- |
|
- |
| 7.1.6(Base Density) |
- |
- |
|
- |
| 7.1.6(Carbon black Content) |
- |
- |
|
- |
| 7.1.7(Melt Flow Rate (MFR)) |
- |
- |
|
- |
| 7.2.1(Leakage test 1hour / 27°C) |
- |
- |
|
- |
| 7.2.2(Hydraulic Proof test 1hour / 27°C) |
- |
- |
|
- |
| 7.2.3((a) Acceptance Test (48 hrs) / 80˚ C) |
- |
- |
|
- |
| 7.2.3((b) Type test ( 165 hrs) / 80˚ C) |
- |
- |
|
- |
| 8(Supply of pipe (Visual)) |
- |
- |
|
- |
| 4.1.1 (Table-1)(Density) |
- |
- |
|
- |
| 4.1.1 (Table-1)(Melt Flow Index) |
- |
- |
|
- |
| 4.1.1 (Table-1)(Oxidation Induction Time) |
- |
- |
|
- |
| 4.1.1 (Table-1)(Volatile Matter) |
- |
- |
|
- |
| 4.1.1 (Table-1)(Water content) |
- |
- |
|
- |
| 4.1.1 (Table-1)(Tensile strength at Yield & Elongation at break) |
- |
- |
|
- |
| 4.1.4(Carbon Black Content) |
- |
- |
|
- |
| 4.1.4(Carbon Black Dispersion) |
- |
- |
|
- |
| 4.1.1(Polyethylene material) |
- |
- |
|
- |
| 4.1.3, Table 1,(i)(Bass density) |
- |
- |
|
- |
| 4.1.3, Table 1,(ii)(Melt flow rate) |
- |
- |
|
- |
| 4.1.3, Table 1,(iii)(Thermal stability) |
- |
- |
|
- |
| 4.1.3, Table 1,(iv)(Volatile matter) |
- |
- |
|
- |
| 4.1.3, Table 1,(v)(Water content) |
- |
- |
|
- |
| 4.1.3, Table 1,(vi)(Minimum tensile strength at yield) |
- |
- |
|
- |
| 4.1.3, Table 1,(vii)(Minimum elongation at break) |
- |
- |
|
- |
| 4.1.4(The Carbon Content and Dispersion) |
- |
- |
|
- |
| 4.1.5(Carbon Black Specification) |
- |
- |
|
- |
| 4.1.6(Antioxidant) |
- |
- |
|
- |
| 4.1.7(Rework Material) |
- |
- |
|
- |
| 4.2(Metallic Couplers) |
- |
- |
|
- |
| 5.1, Table 1,(i)(Plain pipes) |
- |
- |
|
- |
| 5.1, Table 1,(ii)(90° Bends and tee) |
- |
- |
|
- |
| 5.1, Table 1,(iii)(Base pipe ) |
- |
- |
|
- |
| 5.1, Table 1,(iv)(PCN) |
- |
- |
|
- |
| 5.1, Table 1,(v)(Reducers, ferrule reducers) |
- |
- |
|
- |
| 5.1, Table 1,(vi)(End caps, insert valve coupler, valve
openers) |
- |
- |
|
- |
| 5.1, Table 1,(vii)(Riser pipe and socket) |
- |
- |
|
- |
| 7.1.1(Visual Appearance and Workmanship) |
- |
- |
|
- |
| 7.1.2(Hydraulic Performance Characteristic) |
- |
- |
|
- |
| 7.1.3(Reversion Test) |
- |
- |
|
- |
| 7.1.4(Tensile Test) |
- |
- |
|
- |
| 7.1.5(Fusion Compatibility Test) |
- |
- |
|
- |
| 7.1.6(Corrected Density) |
- |
- |
|
- |
| 7.1.7(Melt flow rate) |
- |
- |
|
- |
| 7.2.1(Leakage Test) |
- |
- |
|
- |
| 7.2.2(Hydraulic Proof Test) |
- |
- |
|
- |
| 7.2.3(Weldability Test) |
- |
- |
|
- |
| 7.3(Quick Couple Fitting) |
- |
- |
|
- |
| 10(Marking) |
- |
- |
|
- |
| 5.1.2(Squareness) |
- |
- |
|
- |
| Cl 6.3.5, Table 5 Dimension of Quick Coupled Sprinkler Saddles (Foot Batten)(Table 5 Dimension of Quick Coupled Sprinkler Saddles (Foot Batten)) |
- |
- |
|
- |
|
- |
-
Included w.e.f 24.03.2026 |
| 5 |
IS 8887 (2018) |
Bitumen emulsion for roads (Cationic Type) - Specification (Third Revision) |
All |
14050 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl: 3.1(Cationic Emulsion for all grade) |
- |
200 |
|
- |
| CL: 4.4.1(Material For all grades) |
- |
200 |
|
- |
| CL: 4.4.2(Material For all grades) |
- |
200 |
|
- |
| 6.6.1(Requirement for all grades) |
- |
200 |
|
- |
| 6.6.2 Table-1; 1(i)(Residue on 600 micron IS Sieve, (Grad RS-1) IS 8, Annex 9) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(i)(Residue on 600 micron IS Sieve, (Grad RS-2) Annex 9) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(i)(Residue on 600 micron IS Sieve, (Grad MS) Annex 9) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(i)(Residue on 600 micron IS Sieve, (Grad SS-1) Annex 9) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(i)(Residue on 600 micron IS Sieve, (Grad SS-2) Annex 9) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(ii) (1)(Viscosity by saybolt furol viscometer, seconds (Grad RS-1), IS 3117) |
- |
800 |
|
- |
| 6.6.2 Table-1; 1(ii) (1)(Viscosity by saybolt furol viscometer, seconds (Grad RS-2) |
- |
800 |
|
- |
| 6.6.2 Table-1; 1(ii) (1)(Viscosity by saybolt furol viscometer, seconds (Grad MS), IS 3117) |
- |
800 |
|
- |
| 6.6.2 Table-1; 1(ii) (1)(Viscosity by saybolt furol viscometer, seconds (Grad SS-1), IS 3117) |
- |
800 |
|
- |
| 6.6.2 Table-1; 1(ii) (1)(Viscosity by saybolt furol viscometer, seconds (Grad SS-2), IS 3117) |
- |
800 |
|
- |
| 6.6.2 Table-1; 1(ii) (2)(Viscosity by saybolt furol viscometer, seconds (Grad RS-1), IS 3117) |
- |
800 |
|
- |
| 6.6.2 Table-1; 1(ii) (2)(Viscosity by saybolt furol viscometer, seconds (Grad RS-2, IS 3117) |
- |
800 |
|
- |
| 6.6.2 Table-1; 1(ii) (2)(Viscosity by saybolt furol viscometer, seconds (Grad MS), IS 3117) |
- |
800 |
|
- |
| 6.6.2 Table-1; 1(ii) (2)(Viscosity by saybolt furol viscometer, seconds (Grad SS-1), IS 3117) |
- |
800 |
|
- |
| 6.6.2 Table-1; 1(ii) (2)(Viscosity by saybolt furol viscometer, seconds (Grad SS-2), IS 3117) |
- |
800 |
|
- |
| 6.6.2 Table-1; 1(iii)(Coagulation of emulsion at low temperature (Grad RS-1), Annex C) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(iii)(Coagulation of emulsion at low temperature (Grad RS-2), Annex C) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(iii)(Coagulation of emulsion at low temperature (Grad MS), Annex C) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(iii)(Coagulation of emulsion at low temperature (Grad SS-1), Annex C) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(iii)(Coagulation of emulsion at low temperature (Grad SS-2), Annex C) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(iv)(Storage stability after 24 h (Grad RS-1), Annex D) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(iv)(Storage stability after 24 h (Grad RS-2), Annex D) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(iv)(Storage stability after 24 h (Grade MS), Annex D) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(iv)(Storage stability after 24 h (Grade SS-1), Annex D) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(iv)(Storage stability after 24 h (Grade SS-2), Annex D) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(v)(Particle charge (Grad RS-1), Annex E) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(v)(Particle charge (Grad RS-2), Annex E) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(v)(Particle charge (Grad MS), Annex E) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(v)(Particle charge (Grad SS-1), Annex E) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(v)(Particle charge (Grad SS-2), Annex E) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(vi) 1(Coating ability and water resistance:
Coating, dry aggregate (Grade RS-1) Annex F) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vi) 1(Coating ability and water resistance:
Coating, dry aggregate (Grade RS-2) Annex F) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vi) 1(Coating ability and water resistance:
Coating, dry aggregate (Grade MS) Annex F) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vi) 1(Coating ability and water resistance:
Coating, dry aggregate (Grade SS-1) Annex F) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vi) 1(Coating ability and water resistance:
Coating, dry aggregate (Grade SS-2) Annex F) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vi) 2(Coating ability and water resistance:
Coating, after spraying (Grade RS-1) Annex F) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vi) 2(Coating ability and water resistance:
Coating, after spraying (Grade RS-2) Annex F) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vi) 2(Coating ability and water resistance:
Coating, after spraying (Grade MS) Annex F) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vi) 2(Coating ability and water resistance:
Coating, after spraying (Grade SS-1) Annex F) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vi) 2(Coating ability and water resistance:
Coating, after spraying (Grade SS-2) Annex F) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vi) 3(Coating ability and water resistance:
Coating, wet aggregate (Grade RS-1) Annex F) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vi) 3(Coating ability and water resistance:
Coating, wet aggregate (Grade RS-2) Annex F) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vi) 3(Coating ability and water resistance:
Coating, wet aggregate (Grade MS) Annex F) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vi) 3(Coating ability and water resistance:
Coating, wet aggregate (Grade SS-1) Annex F) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vi) 3(Coating ability and water resistance:
Coating, wet aggregate (Grade SS-2) Annex F) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vi) 4(Coating ability and water resistance:
Coating, After Spraying (Grade RS-1) Annex F) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vi) 4(Coating ability and water resistance:
Coating, After Spraying (Grade RS-2) Annex F) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vi) 4(Coating ability and water resistance:
Coating, After Spraying (Grade MS) Annex F) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vi) 4(Coating ability and water resistance:
Coating, After Spraying (Grade SS-1) Annex F) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vi) 4(Coating ability and water resistance:
Coating, After Spraying (Grade SS-2) Annex F) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vii)(Stability to mixing with cement (Grade RS-1) Annex G) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vii)(Stability to mixing with cement (Grade RS-2) Annex G) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vii)(Stability to mixing with cement (Grade MS) Annex G) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vii)(Stability to mixing with cement (Grade SS-1) Annex G) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vii)(Stability to mixing with cement (Grade SS-2) Annex G) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(viii)(Miscibility with water (Grade RS-1) Annex H) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(viii)(Miscibility with water (Grade RS-2) Annex H) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(viii)(Miscibility with water (Grade MS) Annex H) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(viii)(Miscibility with water (Grade SS-1) Annex H) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(viii)(Miscibility with water (Grade SS-2) Annex H) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(ix) 1(Tests on residue: Residue by evaporation (Grade RS-1) Annex J) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 1(Tests on residue: Residue by evaporation (Grade RS-2) Annex J) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 1(Tests on residue: Residue by evaporation (Grade MS) Annex J) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 1(Tests on residue: Residue by evaporation (Grade SS-1) Annex J) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 1(Tests on residue: Residue by evaporation (Grade SS-2) Annex J) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 2(Tests on residue: Penetration (Grade RS-1) IS 1203) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 2(Tests on residue: Penetration (Grade RS-2) IS 1203) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 2(Tests on residue: Penetration (Grade MS) IS 1203) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 2(Tests on residue: Penetration (Grade SS-1) IS 1203) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 2(Tests on residue: Penetration (Grade SS-2) IS 1203) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 3(Tests on residue: Ductility (Grade RS-1) IS 1208) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 3(Tests on residue: Ductility (Grade RS-2) IS 1208) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 3(Tests on residue: Ductility (Grade MS) IS 1208) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 3(Tests on residue: Ductility (Grade SS-1) IS 1208) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 3(Tests on residue: Ductility (Grade SS-2) IS 1208) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 4(Tests on residue: Solubility I tricholoethylne,
(Grade RS-1) IS 1216) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 4(Tests on residue: Solubility I tricholoethylne,
(Grade RS-2) IS 1216) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 4(Tests on residue: Solubility I tricholoethylne,
(Grade MS) IS 1216) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 4(Tests on residue: Solubility I tricholoethylne,
(Grade SS-1) IS 1216) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 4(Tests on residue: Solubility I tricholoethylne,
(Grade SS-2) IS 1216) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 1(Distillation in percent volume of distillate recovered at 360°C (Grade RS-1)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 1(Distillation in percent volume of distillate recovered at 360°C (Grade RS-2)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 1(Distillation in percent volume of distillate recovered at 360°C (Grade MS)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 1(Distillation in percent volume of distillate recovered at 360°C (SS-1)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 1(Distillation in percent volume of distillate recovered at 360°C (Grade SS-2)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 2(Distillation in percent volume of distillate recovered at 360°C (Grade RS-1)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 2(Distillation in percent volume of distillate recovered at 360°C (Grade RS-2)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 2(Distillation in percent volume of distillate recovered at 360°C (Grade MS)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 2(Distillation in percent volume of distillate recovered at 360°C (SS-1)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 2(Distillation in percent volume of distillate recovered at 360°C (Grade SS-2)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 3(Distillation in percent volume of distillate recovered at 360°C (Grade RS-1)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 3(Distillation in percent volume of distillate recovered at 360°C (Grade RS-2)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 3(Distillation in percent volume of distillate recovered at 360°C (Grade MS)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 3(Distillation in percent volume of distillate recovered at 360°C (SS-1)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 3(Distillation in percent volume of distillate recovered at 360°C (Grade SS-2)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 4(Distillation in percent volume of distillate recovered at 360°C (Grade RS-1)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 4(Distillation in percent volume of distillate recovered at 360°C (Grade RS-2)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 4(Distillation in percent volume of distillate recovered at 360°C (Grade MS)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 4(Distillation in percent volume of distillate recovered at 360°C (SS-1)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 4(Distillation in percent volume of distillate recovered at 360°C (Grade SS-2)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 5(Distillation in percent volume of distillate recovered at 360°C (Grade RS-1)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 5(Distillation in percent volume of distillate recovered at 360°C (Grade RS-2)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 5(Distillation in percent volume of distillate recovered at 360°C (Grade MS)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 5(Distillation in percent volume of distillate recovered at 360°C (SS-1)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 5(Distillation in percent volume of distillate recovered at 360°C (Grade SS-2)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(xi)(Water content (Grade RS-1)) |
- |
750 |
|
- |
| 6.6.2 Table-1; 1(xi)(Water content (Grade RS-2)) |
- |
750 |
|
- |
| 6.6.2 Table-1; 1(xi)(Water content (Grade MS)) |
- |
750 |
|
- |
| 6.6.2 Table-1; 1(xi)(Water content (Grade SS-1)) |
- |
750 |
|
- |
| 6.6.2 Table-1; 1(xi)(Water content (Grade SS-2)) |
- |
750 |
|
- |
| Cl: 3.1(Cationic Emulsion for all grade) |
- |
200 |
|
- |
| CL: 4.4.1(Material For all grades) |
- |
200 |
|
- |
| CL: 4.4.2(Material For all grades) |
- |
200 |
|
- |
| 6.6.1(Requirement for all grades) |
- |
200 |
|
- |
| 6.6.2 Table-1; 1(i)(Residue on 600 micron IS Sieve, (Grad RS-1) IS 8, Annex 9) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(i)(Residue on 600 micron IS Sieve, (Grad RS-2) Annex 9) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(i)(Residue on 600 micron IS Sieve, (Grad MS) Annex 9) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(i)(Residue on 600 micron IS Sieve, (Grad SS-1) Annex 9) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(i)(Residue on 600 micron IS Sieve, (Grad SS-2) Annex 9) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(ii) (1)(Viscosity by saybolt furol viscometer, seconds (Grad RS-1), IS 3117) |
- |
800 |
|
- |
| 6.6.2 Table-1; 1(ii) (1)(Viscosity by saybolt furol viscometer, seconds (Grad RS-2) |
- |
800 |
|
- |
| 6.6.2 Table-1; 1(ii) (1)(Viscosity by saybolt furol viscometer, seconds (Grad MS), IS 3117) |
- |
800 |
|
- |
| 6.6.2 Table-1; 1(ii) (1)(Viscosity by saybolt furol viscometer, seconds (Grad SS-1), IS 3117) |
- |
800 |
|
- |
| 6.6.2 Table-1; 1(ii) (1)(Viscosity by saybolt furol viscometer, seconds (Grad SS-2), IS 3117) |
- |
800 |
|
- |
| 6.6.2 Table-1; 1(ii) (2)(Viscosity by saybolt furol viscometer, seconds (Grad RS-1), IS 3117) |
- |
800 |
|
- |
| 6.6.2 Table-1; 1(ii) (2)(Viscosity by saybolt furol viscometer, seconds (Grad RS-2, IS 3117) |
- |
800 |
|
- |
| 6.6.2 Table-1; 1(ii) (2)(Viscosity by saybolt furol viscometer, seconds (Grad MS), IS 3117) |
- |
800 |
|
- |
| 6.6.2 Table-1; 1(ii) (2)(Viscosity by saybolt furol viscometer, seconds (Grad SS-1), IS 3117) |
- |
800 |
|
- |
| 6.6.2 Table-1; 1(ii) (2)(Viscosity by saybolt furol viscometer, seconds (Grad SS-2), IS 3117) |
- |
800 |
|
- |
| 6.6.2 Table-1; 1(iii)(Coagulation of emulsion at low temperature (Grad RS-1), Annex C) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(iii)(Coagulation of emulsion at low temperature (Grad RS-2), Annex C) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(iii)(Coagulation of emulsion at low temperature (Grad MS), Annex C) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(iii)(Coagulation of emulsion at low temperature (Grad SS-1), Annex C) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(iii)(Coagulation of emulsion at low temperature (Grad SS-2), Annex C) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(iv)(Storage stability after 24 h (Grad RS-1), Annex D) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(iv)(Storage stability after 24 h (Grad RS-2), Annex D) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(iv)(Storage stability after 24 h (Grade MS), Annex D) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(iv)(Storage stability after 24 h (Grade SS-1), Annex D) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(iv)(Storage stability after 24 h (Grade SS-2), Annex D) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(v)(Particle charge (Grad RS-1), Annex E) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(v)(Particle charge (Grad RS-2), Annex E) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(v)(Particle charge (Grad MS), Annex E) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(v)(Particle charge (Grad SS-1), Annex E) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(v)(Particle charge (Grad SS-2), Annex E) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(vi) 1(Coating ability and water resistance:
Coating, dry aggregate (Grade RS-1) Annex F) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(vi) 1(Coating ability and water resistance:
Coating, dry aggregate (Grade RS-2) Annex F) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(vi) 1(Coating ability and water resistance:
Coating, dry aggregate (Grade MS) Annex F) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(vi) 1(Coating ability and water resistance:
Coating, dry aggregate (Grade SS-1) Annex F) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(vi) 1(Coating ability and water resistance:
Coating, dry aggregate (Grade SS-2) Annex F) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(vi) 2(Coating ability and water resistance:
Coating, after spraying (Grade RS-1) Annex F) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(vi) 2(Coating ability and water resistance:
Coating, after spraying (Grade RS-2) Annex F) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(vi) 2(Coating ability and water resistance:
Coating, after spraying (Grade MS) Annex F) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(vi) 2(Coating ability and water resistance:
Coating, after spraying (Grade SS-1) Annex F) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(vi) 2(Coating ability and water resistance:
Coating, after spraying (Grade SS-2) Annex F) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(vi) 3(Coating ability and water resistance:
Coating, wet aggregate (Grade RS-1) Annex F) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(vi) 3(Coating ability and water resistance:
Coating, wet aggregate (Grade RS-2) Annex F) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(vi) 3(Coating ability and water resistance:
Coating, wet aggregate (Grade MS) Annex F) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(vi) 3(Coating ability and water resistance:
Coating, wet aggregate (Grade SS-1) Annex F) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(vi) 3(Coating ability and water resistance:
Coating, wet aggregate (Grade SS-2) Annex F) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(vi) 4(Coating ability and water resistance:
Coating, After Spraying (Grade RS-1) Annex F) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(vi) 4(Coating ability and water resistance:
Coating, After Spraying (Grade RS-2) Annex F) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(vi) 4(Coating ability and water resistance:
Coating, After Spraying (Grade MS) Annex F) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(vi) 4(Coating ability and water resistance:
Coating, After Spraying (Grade SS-1) Annex F) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(vi) 4(Coating ability and water resistance:
Coating, After Spraying (Grade SS-2) Annex F) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vii)(Stability to mixing with cement (Grade RS-1) Annex G) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vii)(Stability to mixing with cement (Grade RS-2) Annex G) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vii)(Stability to mixing with cement (Grade MS) Annex G) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vii)(Stability to mixing with cement (Grade SS-1) Annex G) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(vii)(Stability to mixing with cement (Grade SS-2) Annex G) |
- |
1500 |
|
- |
| 6.6.2 Table-1; 1(viii)(Miscibility with water (Grade RS-1) Annex H) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(viii)(Miscibility with water (Grade RS-2) Annex H) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(viii)(Miscibility with water (Grade MS) Annex H) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(viii)(Miscibility with water (Grade SS-1) Annex H) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(viii)(Miscibility with water (Grade SS-2) Annex H) |
- |
1000 |
|
- |
| 6.6.2 Table-1; 1(ix) 1(Tests on residue: Residue by evaporation (Grade RS-1) Annex J) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 1(Tests on residue: Residue by evaporation (Grade RS-2) Annex J) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 1(Tests on residue: Residue by evaporation (Grade MS) Annex J) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 1(Tests on residue: Residue by evaporation (Grade SS-1) Annex J) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 1(Tests on residue: Residue by evaporation (Grade SS-2) Annex J) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 2(Tests on residue: Penetration (Grade RS-1) IS 1203) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 2(Tests on residue: Penetration (Grade RS-2) IS 1203) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 2(Tests on residue: Penetration (Grade MS) IS 1203) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 2(Tests on residue: Penetration (Grade SS-1) IS 1203) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 2(Tests on residue: Penetration (Grade SS-2) IS 1203) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 3(Tests on residue: Ductility (Grade RS-1) IS 1208) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 3(Tests on residue: Ductility (Grade RS-2) IS 1208) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 3(Tests on residue: Ductility (Grade MS) IS 1208) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 3(Tests on residue: Ductility (Grade SS-1) IS 1208) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 3(Tests on residue: Ductility (Grade SS-2) IS 1208) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 4(Tests on residue: Solubility I tricholoethylne,
(Grade RS-1) IS 1216) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 4(Tests on residue: Solubility I tricholoethylne,
(Grade RS-2) IS 1216) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 4(Tests on residue: Solubility I tricholoethylne,
(Grade MS) IS 1216) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 4(Tests on residue: Solubility I tricholoethylne,
(Grade SS-1) IS 1216) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(ix) 4(Tests on residue: Solubility I tricholoethylne,
(Grade SS-2) IS 1216) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 1(Distillation in percent volume of distillate recovered at 360°C (Grade RS-1)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 1(Distillation in percent volume of distillate recovered at 360°C (Grade RS-2)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 1(Distillation in percent volume of distillate recovered at 360°C (Grade MS)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 1(Distillation in percent volume of distillate recovered at 360°C (SS-1)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 1(Distillation in percent volume of distillate recovered at 360°C (Grade SS-2)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 2(Distillation in percent volume of distillate recovered at 360°C (Grade RS-1)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 2(Distillation in percent volume of distillate recovered at 360°C (Grade RS-2)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 2(Distillation in percent volume of distillate recovered at 360°C (Grade MS)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 2(Distillation in percent volume of distillate recovered at 360°C (SS-1)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 2(Distillation in percent volume of distillate recovered at 360°C (Grade SS-2)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 3(Distillation in percent volume of distillate recovered at 360°C (Grade RS-1)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 3(Distillation in percent volume of distillate recovered at 360°C (Grade RS-2)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 3(Distillation in percent volume of distillate recovered at 360°C (Grade MS)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 3(Distillation in percent volume of distillate recovered at 360°C (SS-1)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 3(Distillation in percent volume of distillate recovered at 360°C (Grade SS-2)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 4(Distillation in percent volume of distillate recovered at 360°C (Grade RS-1)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 4(Distillation in percent volume of distillate recovered at 360°C (Grade RS-2)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 4(Distillation in percent volume of distillate recovered at 360°C (Grade MS)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 4(Distillation in percent volume of distillate recovered at 360°C (SS-1)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 4(Distillation in percent volume of distillate recovered at 360°C (Grade SS-2)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 5(Distillation in percent volume of distillate recovered at 360°C (Grade RS-1)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 5(Distillation in percent volume of distillate recovered at 360°C (Grade RS-2)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 5(Distillation in percent volume of distillate recovered at 360°C (Grade MS)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 5(Distillation in percent volume of distillate recovered at 360°C (SS-1)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(x) 5(Distillation in percent volume of distillate recovered at 360°C (Grade SS-2)) |
- |
2000 |
|
- |
| 6.6.2 Table-1; 1(xi)(Water content (Grade RS-1)) |
- |
750 |
|
- |
| 6.6.2 Table-1; 1(xi)(Water content (Grade RS-2)) |
- |
750 |
|
- |
| 6.6.2 Table-1; 1(xi)(Water content (Grade MS)) |
- |
750 |
|
- |
| 6.6.2 Table-1; 1(xi)(Water content (Grade SS-1)) |
- |
750 |
|
- |
| 6.6.2 Table-1; 1(xi)(Water content (Grade SS-2)) |
- |
750 |
|
- |
| xi, Table-1(Water content) |
- |
750 |
|
- |
| 4.1(Materials) |
- |
200 |
|
- |
| 6.2-Table 1-i)(Residue on 600 micron IS Sieve, percent by mass, Max) |
- |
1000 |
|
- |
| 6.2-Table 1-ii)(Viscosity by saybolt furol viscometer, seconds
1) At 25°C
2) At 50°C) |
- |
800 |
|
- |
| 6.2-Table 1-iii)(Coagulation of emulsion at low temperature1)) |
- |
1000 |
|
- |
| 6.2-Table 1-iv)(Storage stability after 24 h, percent, Max) |
- |
1000 |
|
- |
| 6.2-Table 1-v)(Particle charge) |
- |
2000 |
|
- |
| 6.2-Table 1-vi)(Coating ability and water resistance:
1) Coating, dry aggregate
2) Coating, after spraying
3) Coating, wet aggregate
4) Coating, after spraying) |
- |
1500 |
|
- |
| 6.2-Table 1-vii)(Stability to mixing with cement (% coagulation), Max) |
- |
1500 |
|
- |
| 6.2-Table 1-viii)(Miscibility with water) |
- |
1000 |
|
- |
| 6.2-Table 1-ix)(Tests on residue:
1) Residue by evaporation, percent, Min
2) Penetration 25°C/100g/5 sec
3) Ductility 27°C/cm, Min
4) Solubility I tricholoethylne, percent by
mass, Min) |
- |
2000 |
|
- |
| 6.2-Table 1-x)(Distillation in percent volume of distillate recovered at 360°C at
1) 190°C
2) 225°C
3) 260°C
4) 316°C
5) Residue at 360°C, percent, Min) |
- |
2000 |
|
- |
| 6.2-Table 1-xi)(Water content, percent by mass, Max) |
- |
750 |
|
- |
| 8(Marking) |
- |
300 |
|
- |
| Cl: 3.1(Cationic Emulsion for all grade) |
- |
- |
|
- |
| CL: 4.4.1(Material For all grades) |
- |
- |
|
- |
| CL: 4.4.2(Material For all grades) |
- |
- |
|
- |
| 6.6.1(Requirement for all grades) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(i)(Residue on 600 micron IS Sieve, (Grad RS-1) IS 8, Annex 9) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(i)(Residue on 600 micron IS Sieve, (Grad RS-2) Annex 9) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(i)(Residue on 600 micron IS Sieve, (Grad MS) Annex 9) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(i)(Residue on 600 micron IS Sieve, (Grad SS-1) Annex 9) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(i)(Residue on 600 micron IS Sieve, (Grad SS-2) Annex 9) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ii) (1)(Viscosity by saybolt furol viscometer, seconds (Grad RS-1), IS 3117) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ii) (1)(Viscosity by saybolt furol viscometer, seconds (Grad RS-2) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ii) (1)(Viscosity by saybolt furol viscometer, seconds (Grad MS), IS 3117) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ii) (1)(Viscosity by saybolt furol viscometer, seconds (Grad SS-1), IS 3117) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ii) (1)(Viscosity by saybolt furol viscometer, seconds (Grad SS-2), IS 3117) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ii) (2)(Viscosity by saybolt furol viscometer, seconds (Grad RS-1), IS 3117) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ii) (2)(Viscosity by saybolt furol viscometer, seconds (Grad RS-2, IS 3117) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ii) (2)(Viscosity by saybolt furol viscometer, seconds (Grad MS), IS 3117) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ii) (2)(Viscosity by saybolt furol viscometer, seconds (Grad SS-1), IS 3117) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ii) (2)(Viscosity by saybolt furol viscometer, seconds (Grad SS-2), IS 3117) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(iii)(Coagulation of emulsion at low temperature (Grad RS-1), Annex C) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(iii)(Coagulation of emulsion at low temperature (Grad RS-2), Annex C) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(iii)(Coagulation of emulsion at low temperature (Grad MS), Annex C) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(iii)(Coagulation of emulsion at low temperature (Grad SS-1), Annex C) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(iii)(Coagulation of emulsion at low temperature (Grad SS-2), Annex C) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(iv)(Storage stability after 24 h (Grad RS-1), Annex D) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(iv)(Storage stability after 24 h (Grad RS-2), Annex D) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(iv)(Storage stability after 24 h (Grade MS), Annex D) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(iv)(Storage stability after 24 h (Grade SS-1), Annex D) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(iv)(Storage stability after 24 h (Grade SS-2), Annex D) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(v)(Particle charge (Grad RS-1), Annex E) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(v)(Particle charge (Grad RS-2), Annex E) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(v)(Particle charge (Grad MS), Annex E) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(v)(Particle charge (Grad SS-1), Annex E) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(v)(Particle charge (Grad SS-2), Annex E) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 1(Coating ability and water resistance:
Coating, dry aggregate (Grade RS-1) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 1(Coating ability and water resistance:
Coating, dry aggregate (Grade RS-2) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 1(Coating ability and water resistance:
Coating, dry aggregate (Grade MS) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 1(Coating ability and water resistance:
Coating, dry aggregate (Grade SS-1) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 1(Coating ability and water resistance:
Coating, dry aggregate (Grade SS-2) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 2(Coating ability and water resistance:
Coating, after spraying (Grade RS-1) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 2(Coating ability and water resistance:
Coating, after spraying (Grade RS-2) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 2(Coating ability and water resistance:
Coating, after spraying (Grade MS) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 2(Coating ability and water resistance:
Coating, after spraying (Grade SS-1) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 2(Coating ability and water resistance:
Coating, after spraying (Grade SS-2) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 3(Coating ability and water resistance:
Coating, wet aggregate (Grade RS-1) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 3(Coating ability and water resistance:
Coating, wet aggregate (Grade RS-2) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 3(Coating ability and water resistance:
Coating, wet aggregate (Grade MS) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 3(Coating ability and water resistance:
Coating, wet aggregate (Grade SS-1) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 3(Coating ability and water resistance:
Coating, wet aggregate (Grade SS-2) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 4(Coating ability and water resistance:
Coating, After Spraying (Grade RS-1) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 4(Coating ability and water resistance:
Coating, After Spraying (Grade RS-2) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 4(Coating ability and water resistance:
Coating, After Spraying (Grade MS) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 4(Coating ability and water resistance:
Coating, After Spraying (Grade SS-1) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 4(Coating ability and water resistance:
Coating, After Spraying (Grade SS-2) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vii)(Stability to mixing with cement (Grade RS-1) Annex G) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vii)(Stability to mixing with cement (Grade RS-2) Annex G) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vii)(Stability to mixing with cement (Grade MS) Annex G) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vii)(Stability to mixing with cement (Grade SS-1) Annex G) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vii)(Stability to mixing with cement (Grade SS-2) Annex G) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(viii)(Miscibility with water (Grade RS-1) Annex H) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(viii)(Miscibility with water (Grade RS-2) Annex H) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(viii)(Miscibility with water (Grade MS) Annex H) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(viii)(Miscibility with water (Grade SS-1) Annex H) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(viii)(Miscibility with water (Grade SS-2) Annex H) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 1(Tests on residue: Residue by evaporation (Grade RS-1) Annex J) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 1(Tests on residue: Residue by evaporation (Grade RS-2) Annex J) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 1(Tests on residue: Residue by evaporation (Grade MS) Annex J) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 1(Tests on residue: Residue by evaporation (Grade SS-1) Annex J) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 1(Tests on residue: Residue by evaporation (Grade SS-2) Annex J) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 2(Tests on residue: Penetration (Grade RS-1) IS 1203) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 2(Tests on residue: Penetration (Grade RS-2) IS 1203) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 2(Tests on residue: Penetration (Grade MS) IS 1203) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 2(Tests on residue: Penetration (Grade SS-1) IS 1203) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 2(Tests on residue: Penetration (Grade SS-2) IS 1203) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 3(Tests on residue: Ductility (Grade RS-1) IS 1208) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 3(Tests on residue: Ductility (Grade RS-2) IS 1208) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 3(Tests on residue: Ductility (Grade MS) IS 1208) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 3(Tests on residue: Ductility (Grade SS-1) IS 1208) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 3(Tests on residue: Ductility (Grade SS-2) IS 1208) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 4(Tests on residue: Solubility I tricholoethylne,
(Grade RS-1) IS 1216) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 4(Tests on residue: Solubility I tricholoethylne,
(Grade RS-2) IS 1216) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 4(Tests on residue: Solubility I tricholoethylne,
(Grade MS) IS 1216) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 4(Tests on residue: Solubility I tricholoethylne,
(Grade SS-1) IS 1216) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 4(Tests on residue: Solubility I tricholoethylne,
(Grade SS-2) IS 1216) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 1(Distillation in percent volume of distillate recovered at 360°C (Grade RS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 1(Distillation in percent volume of distillate recovered at 360°C (Grade RS-2)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 1(Distillation in percent volume of distillate recovered at 360°C (Grade MS)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 1(Distillation in percent volume of distillate recovered at 360°C (SS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 1(Distillation in percent volume of distillate recovered at 360°C (Grade SS-2)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 2(Distillation in percent volume of distillate recovered at 360°C (Grade RS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 2(Distillation in percent volume of distillate recovered at 360°C (Grade RS-2)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 2(Distillation in percent volume of distillate recovered at 360°C (Grade MS)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 2(Distillation in percent volume of distillate recovered at 360°C (SS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 2(Distillation in percent volume of distillate recovered at 360°C (Grade SS-2)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 3(Distillation in percent volume of distillate recovered at 360°C (Grade RS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 3(Distillation in percent volume of distillate recovered at 360°C (Grade RS-2)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 3(Distillation in percent volume of distillate recovered at 360°C (Grade MS)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 3(Distillation in percent volume of distillate recovered at 360°C (SS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 3(Distillation in percent volume of distillate recovered at 360°C (Grade SS-2)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 4(Distillation in percent volume of distillate recovered at 360°C (Grade RS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 4(Distillation in percent volume of distillate recovered at 360°C (Grade RS-2)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 4(Distillation in percent volume of distillate recovered at 360°C (Grade MS)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 4(Distillation in percent volume of distillate recovered at 360°C (SS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 4(Distillation in percent volume of distillate recovered at 360°C (Grade SS-2)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 5(Distillation in percent volume of distillate recovered at 360°C (Grade RS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 5(Distillation in percent volume of distillate recovered at 360°C (Grade RS-2)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 5(Distillation in percent volume of distillate recovered at 360°C (Grade MS)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 5(Distillation in percent volume of distillate recovered at 360°C (SS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 5(Distillation in percent volume of distillate recovered at 360°C (Grade SS-2)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(xi)(Water content (Grade RS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(xi)(Water content (Grade RS-2)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(xi)(Water content (Grade MS)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(xi)(Water content (Grade SS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(xi)(Water content (Grade SS-2)) |
- |
- |
|
- |
| Cl: 3.1(Cationic Emulsion for all grade) |
- |
- |
|
- |
| CL: 4.4.1(Material For all grades) |
- |
- |
|
- |
| CL: 4.4.2(Material For all grades) |
- |
- |
|
- |
| 6.6.1(Requirement for all grades) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(i)(Residue on 600 micron IS Sieve, (Grad RS-1) IS 8, Annex 9) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(i)(Residue on 600 micron IS Sieve, (Grad RS-2) Annex 9) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(i)(Residue on 600 micron IS Sieve, (Grad MS) Annex 9) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(i)(Residue on 600 micron IS Sieve, (Grad SS-1) Annex 9) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(i)(Residue on 600 micron IS Sieve, (Grad SS-2) Annex 9) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ii) (1)(Viscosity by saybolt furol viscometer, seconds (Grad RS-1), IS 3117) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ii) (1)(Viscosity by saybolt furol viscometer, seconds (Grad RS-2) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ii) (1)(Viscosity by saybolt furol viscometer, seconds (Grad MS), IS 3117) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ii) (1)(Viscosity by saybolt furol viscometer, seconds (Grad SS-1), IS 3117) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ii) (1)(Viscosity by saybolt furol viscometer, seconds (Grad SS-2), IS 3117) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ii) (2)(Viscosity by saybolt furol viscometer, seconds (Grad RS-1), IS 3117) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ii) (2)(Viscosity by saybolt furol viscometer, seconds (Grad RS-2, IS 3117) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ii) (2)(Viscosity by saybolt furol viscometer, seconds (Grad MS), IS 3117) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ii) (2)(Viscosity by saybolt furol viscometer, seconds (Grad SS-1), IS 3117) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ii) (2)(Viscosity by saybolt furol viscometer, seconds (Grad SS-2), IS 3117) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(iii)(Coagulation of emulsion at low temperature (Grad RS-1), Annex C) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(iii)(Coagulation of emulsion at low temperature (Grad RS-2), Annex C) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(iii)(Coagulation of emulsion at low temperature (Grad MS), Annex C) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(iii)(Coagulation of emulsion at low temperature (Grad SS-1), Annex C) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(iii)(Coagulation of emulsion at low temperature (Grad SS-2), Annex C) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(iv)(Storage stability after 24 h (Grad RS-1), Annex D) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(iv)(Storage stability after 24 h (Grad RS-2), Annex D) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(iv)(Storage stability after 24 h (Grade MS), Annex D) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(iv)(Storage stability after 24 h (Grade SS-1), Annex D) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(iv)(Storage stability after 24 h (Grade SS-2), Annex D) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(v)(Particle charge (Grad RS-1), Annex E) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(v)(Particle charge (Grad RS-2), Annex E) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(v)(Particle charge (Grad MS), Annex E) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(v)(Particle charge (Grad SS-1), Annex E) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(v)(Particle charge (Grad SS-2), Annex E) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 1(Coating ability and water resistance:
Coating, dry aggregate (Grade RS-1) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 1(Coating ability and water resistance:
Coating, dry aggregate (Grade RS-2) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 1(Coating ability and water resistance:
Coating, dry aggregate (Grade MS) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 1(Coating ability and water resistance:
Coating, dry aggregate (Grade SS-1) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 1(Coating ability and water resistance:
Coating, dry aggregate (Grade SS-2) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 2(Coating ability and water resistance:
Coating, after spraying (Grade RS-1) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 2(Coating ability and water resistance:
Coating, after spraying (Grade RS-2) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 2(Coating ability and water resistance:
Coating, after spraying (Grade MS) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 2(Coating ability and water resistance:
Coating, after spraying (Grade SS-1) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 2(Coating ability and water resistance:
Coating, after spraying (Grade SS-2) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 3(Coating ability and water resistance:
Coating, wet aggregate (Grade RS-1) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 3(Coating ability and water resistance:
Coating, wet aggregate (Grade RS-2) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 3(Coating ability and water resistance:
Coating, wet aggregate (Grade MS) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 3(Coating ability and water resistance:
Coating, wet aggregate (Grade SS-1) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 3(Coating ability and water resistance:
Coating, wet aggregate (Grade SS-2) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 4(Coating ability and water resistance:
Coating, After Spraying (Grade RS-1) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 4(Coating ability and water resistance:
Coating, After Spraying (Grade RS-2) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 4(Coating ability and water resistance:
Coating, After Spraying (Grade MS) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 4(Coating ability and water resistance:
Coating, After Spraying (Grade SS-1) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vi) 4(Coating ability and water resistance:
Coating, After Spraying (Grade SS-2) Annex F) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vii)(Stability to mixing with cement (Grade RS-1) Annex G) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vii)(Stability to mixing with cement (Grade RS-2) Annex G) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vii)(Stability to mixing with cement (Grade MS) Annex G) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vii)(Stability to mixing with cement (Grade SS-1) Annex G) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(vii)(Stability to mixing with cement (Grade SS-2) Annex G) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(viii)(Miscibility with water (Grade RS-1) Annex H) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(viii)(Miscibility with water (Grade RS-2) Annex H) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(viii)(Miscibility with water (Grade MS) Annex H) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(viii)(Miscibility with water (Grade SS-1) Annex H) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(viii)(Miscibility with water (Grade SS-2) Annex H) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 1(Tests on residue: Residue by evaporation (Grade RS-1) Annex J) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 1(Tests on residue: Residue by evaporation (Grade RS-2) Annex J) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 1(Tests on residue: Residue by evaporation (Grade MS) Annex J) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 1(Tests on residue: Residue by evaporation (Grade SS-1) Annex J) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 1(Tests on residue: Residue by evaporation (Grade SS-2) Annex J) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 2(Tests on residue: Penetration (Grade RS-1) IS 1203) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 2(Tests on residue: Penetration (Grade RS-2) IS 1203) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 2(Tests on residue: Penetration (Grade MS) IS 1203) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 2(Tests on residue: Penetration (Grade SS-1) IS 1203) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 2(Tests on residue: Penetration (Grade SS-2) IS 1203) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 3(Tests on residue: Ductility (Grade RS-1) IS 1208) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 3(Tests on residue: Ductility (Grade RS-2) IS 1208) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 3(Tests on residue: Ductility (Grade MS) IS 1208) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 3(Tests on residue: Ductility (Grade SS-1) IS 1208) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 3(Tests on residue: Ductility (Grade SS-2) IS 1208) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 4(Tests on residue: Solubility I tricholoethylne,
(Grade RS-1) IS 1216) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 4(Tests on residue: Solubility I tricholoethylne,
(Grade RS-2) IS 1216) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 4(Tests on residue: Solubility I tricholoethylne,
(Grade MS) IS 1216) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 4(Tests on residue: Solubility I tricholoethylne,
(Grade SS-1) IS 1216) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(ix) 4(Tests on residue: Solubility I tricholoethylne,
(Grade SS-2) IS 1216) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 1(Distillation in percent volume of distillate recovered at 360°C (Grade RS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 1(Distillation in percent volume of distillate recovered at 360°C (Grade RS-2)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 1(Distillation in percent volume of distillate recovered at 360°C (Grade MS)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 1(Distillation in percent volume of distillate recovered at 360°C (SS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 1(Distillation in percent volume of distillate recovered at 360°C (Grade SS-2)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 2(Distillation in percent volume of distillate recovered at 360°C (Grade RS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 2(Distillation in percent volume of distillate recovered at 360°C (Grade RS-2)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 2(Distillation in percent volume of distillate recovered at 360°C (Grade MS)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 2(Distillation in percent volume of distillate recovered at 360°C (SS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 2(Distillation in percent volume of distillate recovered at 360°C (Grade SS-2)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 3(Distillation in percent volume of distillate recovered at 360°C (Grade RS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 3(Distillation in percent volume of distillate recovered at 360°C (Grade RS-2)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 3(Distillation in percent volume of distillate recovered at 360°C (Grade MS)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 3(Distillation in percent volume of distillate recovered at 360°C (SS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 3(Distillation in percent volume of distillate recovered at 360°C (Grade SS-2)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 4(Distillation in percent volume of distillate recovered at 360°C (Grade RS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 4(Distillation in percent volume of distillate recovered at 360°C (Grade RS-2)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 4(Distillation in percent volume of distillate recovered at 360°C (Grade MS)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 4(Distillation in percent volume of distillate recovered at 360°C (SS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 4(Distillation in percent volume of distillate recovered at 360°C (Grade SS-2)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 5(Distillation in percent volume of distillate recovered at 360°C (Grade RS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 5(Distillation in percent volume of distillate recovered at 360°C (Grade RS-2)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 5(Distillation in percent volume of distillate recovered at 360°C (Grade MS)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 5(Distillation in percent volume of distillate recovered at 360°C (SS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(x) 5(Distillation in percent volume of distillate recovered at 360°C (Grade SS-2)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(xi)(Water content (Grade RS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(xi)(Water content (Grade RS-2)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(xi)(Water content (Grade MS)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(xi)(Water content (Grade SS-1)) |
- |
- |
|
- |
| 6.6.2 Table-1; 1(xi)(Water content (Grade SS-2)) |
- |
- |
|
- |
| xi, Table-1(Water content) |
- |
- |
|
- |
| 4.1(Materials) |
- |
- |
|
- |
| 6.2-Table 1-i)(Residue on 600 micron IS Sieve, percent by mass, Max) |
- |
- |
|
- |
| 6.2-Table 1-ii)(Viscosity by saybolt furol viscometer, seconds
1) At 25°C
2) At 50°C) |
- |
- |
|
- |
| 6.2-Table 1-iii)(Coagulation of emulsion at low temperature1)) |
- |
- |
|
- |
| 6.2-Table 1-iv)(Storage stability after 24 h, percent, Max) |
- |
- |
|
- |
| 6.2-Table 1-v)(Particle charge) |
- |
- |
|
- |
| 6.2-Table 1-vi)(Coating ability and water resistance:
1) Coating, dry aggregate
2) Coating, after spraying
3) Coating, wet aggregate
4) Coating, after spraying) |
- |
- |
|
- |
| 6.2-Table 1-vii)(Stability to mixing with cement (% coagulation), Max) |
- |
- |
|
- |
| 6.2-Table 1-viii)(Miscibility with water) |
- |
- |
|
- |
| 6.2-Table 1-ix)(Tests on residue:
1) Residue by evaporation, percent, Min
2) Penetration 25°C/100g/5 sec
3) Ductility 27°C/cm, Min
4) Solubility I tricholoethylne, percent by
mass, Min) |
- |
- |
|
- |
| 6.2-Table 1-x)(Distillation in percent volume of distillate recovered at 360°C at
1) 190°C
2) 225°C
3) 260°C
4) 316°C
5) Residue at 360°C, percent, Min) |
- |
- |
|
- |
| 6.2-Table 1-xi)(Water content, percent by mass, Max) |
- |
- |
|
- |
| 8(Marking) |
- |
- |
|
- |
|
- |
-
Included w.e.f 17.02.2026 |
| 6 |
IS 7098 : Part 1 (2025) |
Crosslinked Polyethylene Insulated Thermoplastic Sheathed Cables - Specification Part 1 For Working Voltages up to and Including 1 100 Volts (Second Revision) |
- |
25000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl-4(Conductors -Material) |
- |
20 |
|
- |
| Cl-5, Table-1 (i)(Tensile strength) |
- |
100 |
|
- |
| Cl-5, Table-1 (ii) (a)(Elongation at break- Ageing in air oven) |
- |
100 |
|
- |
| Cl-5, Table-1 (ii) (b)(Variation in tensile strength, from that without ageing) |
- |
100 |
|
- |
| Cl-5, Table-1 (ii) (c)(Variation in elongation at break, from that without ageing) |
- |
100 |
|
- |
| Cl-5, Table-1 (iii) (a)(Hot set- Treatment;) |
- |
200 |
|
- |
| Cl-5, Table-1 (iii) (b)(Hot set- Elongation under load) |
- |
200 |
|
- |
| Cl-5, Table-1 (iii) (c)(Hot set- Permanent elongation after cooling) |
- |
200 |
|
- |
| Cl-5, Table-1 (iv)(Shrinkage) |
- |
100 |
|
- |
| Cl-5, Table-1 (v)(Water absorption (gravimetric)) |
- |
250 |
|
- |
| Cl-5, Table-1 (vi)(Volume resistivity) |
- |
200 |
|
- |
| Cl-6.1 (a)(Fillers and inner sheath- Vulcanized or unvulcanized rubber) |
- |
200 |
|
- |
| Cl-6.1 (B)(Fillers and inner sheath- Thermoplastic materials) |
- |
200 |
|
- |
| Cl-7(Armouring) |
- |
100 |
|
- |
| Cl-8(Outer Sheath) |
- |
200 |
|
- |
| Cl-10.3(Tolerance on Thickness of Insulation) |
- |
20 |
|
- |
| Cl-11(Core Identification) |
- |
20 |
|
- |
| Cl-12(Laying up of Cores) |
- |
20 |
|
- |
| Cl-13(Inner Sheath (Common Covering)) |
- |
20 |
|
- |
| Cl-14.1(Armouring- Application) |
- |
20 |
|
- |
| Cl-14.1.2(armour round wires/formed wires) |
- |
100 |
|
- |
| Cl-14.2(Type of Armour) |
- |
50 |
|
- |
| Cl-14.3(Dimensions) |
- |
100 |
|
- |
| Cl-14.4(Joints) |
- |
20 |
|
- |
| Cl-14.5(Resistance) |
- |
400 |
|
- |
| Cl-15.3(Thickness of Outer Sheath) |
- |
50 |
|
- |
| Cl-16.1 (i) (a)(Test on conductor: Annealing test (for copper);) |
- |
500 |
|
- |
| Cl-16.1 (i) (b)(Test on conductor: Tensile test (for aluminium);) |
- |
150 |
|
- |
| Cl-16.1 (i) (c)(Test on conductor: Wrapping test (for aluminium);) |
- |
100 |
|
- |
| Cl-16.1 (i) (d)(Test on conductor: Resistance test) |
- |
500 |
|
- |
| Cl-14.6 (a)(Physical tests on round wires/formed wires- Tensile strength) |
- |
150 |
|
- |
| Cl-14.6 (b)(Physical tests on round wires/formed wires- Elongation at break) |
- |
150 |
|
- |
| Cl-14.6 (c)(Physical tests on round wires/formed wires- Torsion test for round wires) |
- |
100 |
|
- |
| Cl-14.6 (d)(Physical tests on round wires/formed wires- Winding test for formed wires) |
- |
200 |
|
- |
| Cl-14.6 (e)(Physical tests on round wires/formed wires- Uniformity of zinc coating) |
- |
100 |
|
- |
| Cl-14.6 (f)(Physical tests on round wires/formed wires- Mass of zinc coating) |
- |
100 |
|
- |
| Cl-14.6 (g)(Physical tests on round wires/formed wires- Resistivity.) |
- |
150 |
|
- |
| Cl-10, 13, 15(Test for thickness of insulation and sheath) |
- |
100 |
|
- |
| Cl-16.1 (v) (1)(PVC Sheath- Tensile strength and elongation at break;) |
- |
150 |
|
- |
| Cl-16.1 (v) (2)(PVC Sheath- Ageing in air oven) |
- |
100 |
|
- |
| Cl-16.1 (v) (3)(PVC Sheath- Loss of mass in air oven) |
- |
200 |
|
- |
| Cl-16.1 (v) (5)(PVC Sheath- Hot deformation test) |
- |
100 |
|
- |
| Cl-16.1 (v) (6)(PVC Sheath- Heat shock test) |
- |
50 |
|
- |
| Cl-16.1 (v) (7)(PVC Sheath- Thermal stability) |
- |
100 |
|
- |
| Cl-8.3-Table 1A(PE Sheath- Carbon black content) |
- |
100 |
|
- |
| Cl-8.3-Table 1A(PE Sheath- Tensile strength and elongation at break before and after ageing) |
- |
150 |
|
- |
| Cl-8.3-Table 1A(PE Sheath- Hot deformation) |
- |
150 |
|
- |
| Cl-8.3-Table 1A(PE Sheath- Shrinkage test.) |
- |
100 |
|
- |
| Cl- Table 1B(LSHF Sheath- Tensile strength and elongation at break before and after ageing) |
- |
100 |
|
- |
| Cl- Table 1B(LSHF Sheath- Hot deformation) |
- |
100 |
|
- |
| Cl- Table 1B(LSHF Sheath- Water absorption test) |
- |
500 |
|
- |
| Cl- Table 1B(LSHF Sheath- Shrinkage test) |
- |
150 |
|
- |
| Cl-17.2(High voltage test) |
- |
2000 |
|
- |
| Cl-17.3(Flammability test) |
- |
200 |
|
- |
| Cl-17.4(Oxygen index test (FR, FR-LSH or LSHF Sheath)) |
- |
2500 |
|
- |
| Cl-17.5(Flame retardance test on single cable) |
- |
2000 |
|
- |
| Cl-17.6(Flame retardance test on bunched cables (FR, FR-LSH or LSHF Sheathed Cables)) |
- |
1500 |
|
- |
| Cl-17.7(Test for halogen acid evolution (FR-LSH or LSHF Outer Sheath)) |
- |
2000 |
|
- |
| Cl-17.8(Smoke density test (FR-LSH or LSHF Sheath)) |
- |
2000 |
|
- |
| Cl-17.9(Temperature index test; (FR, FR-LSH or LSHF Sheath)) |
- |
2000 |
|
- |
| Cl-17.10(Test for pH and conductivity of LSHF Sheath) |
- |
250 |
|
- |
| Cl-17.11(Test for light transmission for LSHF Sheathed Cables) |
- |
2500 |
|
- |
| Cl-16.4 (i)(Cold bend test for outer sheath) |
- |
100 |
|
- |
| Cl-16.4 (ii)(Cold impact test for outer sheath) |
- |
100 |
|
- |
| Cl-16.4 (iii)(Cold elongation test for LSHF sheath) |
- |
100 |
|
- |
| Cl. 9(Conductor - Regarding Construction Compliance) |
- |
100 |
|
- |
| Cl. 10.4(Application of Insulation) |
- |
100 |
|
- |
| Cl. 13.3(Thickness of Inner sheath) |
- |
100 |
|
- |
| Cl. 15.1(Application of Outer sheath) |
- |
0 |
|
- |
| Cl. 15.2(Clour of Outer sheath) |
- |
10 |
|
- |
|
- |
-
- |
| 7 |
IS 14587 (2025) |
Prelaminated Medium Density Fibre Boards of Wood and Other Lignocellulosic Materials - Specification ( Second Revision ) |
All |
12800 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| As per Clause 8 Table 2(Length -IS 2380 (Part 2)) |
- |
300 |
|
- |
| As per Clause 8 Table 2(Width - IS 2380 (Part 2)) |
- |
300 |
|
- |
| As per Clause 8 Table 2(Thickness - IS 2380 (Part 2)) |
- |
300 |
|
- |
| As per Clause 8 Table 2(Squareness, Max -IS 2380 (Part 2)) |
- |
300 |
|
- |
| As per Clause 8 Table 2(Edge Straighness, Max - IS 2380 (Part 2)) |
- |
300 |
|
- |
| As per Clause 9.1 Table 3(Density -IS 2380 (Part 3)) |
- |
700 |
|
- |
| As per Clause 9.1 Table 3(Variation from mean density, --IS 2380 (Part 3)) |
- |
700 |
|
- |
| As per Clause 9.1 Table 3(Moisture Content -IS 2380 (Part 3)) |
- |
700 |
|
- |
| As per Clause 9.1 Table 4, Table 5, Table 6, Table 7(Modulus of rupture (MoR), Min.-IS 2380 (Part 4)) |
- |
1500 |
|
- |
| As per Clause 9.1 Table 4, Table 5, Table 6, Table 7(Modulus of elasticity (MoE), Min. -(IS 2380 (Part 4)) |
- |
1500 |
|
- |
| As per Clause 9.1 Table 4, Table 5, Table 6, Table7(Internal bond strength, Min. - IS 2380 (Part 5)) |
- |
1500 |
|
- |
| As per Clause 9.1 Table 4, Table 5, Table 6, Table 7(24 h thickness swelling (due to general absorption) Max. - IS 2380 (Part 17)) |
- |
1500 |
|
- |
| As per Clause 9.1 Table 4, Table 5, Table 6, Table 7(Screw withdrawal strength (face) , Min. -IS 2380 (Part 4)) |
- |
1500 |
|
- |
| As per Clause 9.1 Table 4, Table 5, table 6, Table 7(Screw withdrawal strength (edge) , Min. -IS 2380 (Part 4)) |
- |
1500 |
|
- |
| As per Clause 9.1 , Table 5, Table 6, Table 7(Moisture Resistance : Option 1 : Cyclic test (1. )Internal bond strength Min. -IS 2380 (Part 5) see note 1) |
- |
1500 |
|
- |
| As per Clause 9.1 , Table 5, Table 6, Table 7(Moisture Resistance : Option 2 : Boil test (1.) Internal bond strength , Min.- IS 2380 (Part 5) see note 2) |
- |
1500 |
|
- |
| As per Clause 9.1 , Table 8(Abrasion resistance in number of revolutions Min. --Annex. B) |
- |
1500 |
|
- |
| As per Clause 9.1 , Table 8(Resiatnce to stream/water vapour - Annex. C) |
- |
1500 |
|
- |
| As per Clause 9.1 , Table 8(Resitance to crack -Annex. D) |
- |
1500 |
|
- |
| As per Clause 9.1 , Table 8(Resistance to cigarette burn -Annex. E) |
- |
1500 |
|
- |
| As per Clause 9.1 , Table 8(Resiatnce to stain - Annex. F) |
- |
1500 |
|
- |
| As per Clause 9.1 , Table 8(Resiatnce to stain - Annex. F) |
- |
1500 |
|
- |
| As per Clause 9.1 , Table 9(Formaldehyde content Fc, mg/100 g for oven dry board -IS 13745) |
- |
2000 |
|
- |
| As per Clause 9.1 , Table 9(Steady-state formaldehyde emission, Fc, mg/m3 (optional test)) |
- |
0 |
|
- |
|
- |
-
Included w.e.f 17.02.2026
Exclusion: As per Clause 9.1 , Table 9 (Steady-state formaldehyde emission, Fc, mg/m3 (optional test)) |
| 8 |
IS 3087 (2025) |
Medium Density Particle Boards of Wood and other Lignocellulosic Materials for General Purpose - Specification ( Third Revision ) |
All |
11500 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| As per Clause 7(Finish --IS 2380 (Part 2), IS 2380 (Part 3) & Visual) |
- |
500 |
|
- |
| As per Clause 8, Table 2(Length -IS 2380 (Part 2)) |
- |
300 |
|
- |
| As per Clause 8, Table 2(Width - IS 2380 (Part 2)) |
- |
300 |
|
- |
| As per Clause 8, Table 2(Thickness, Sanded/finished panel - IS 2380 (Part 2)) |
- |
300 |
|
- |
| As per Clause 8, Table 2(Squareness, Max. - IS 2380 (Part 2)) |
- |
300 |
|
- |
| As per Clause 8, Table 2(Edge straightness, Max. -IS 2380 (Part 2)) |
- |
300 |
|
- |
| As per Clause 9.1 Table 3(Density -IS 2380 (Part 3)) |
- |
700 |
|
- |
| As per Clause 9.1 Table 3(Variation from mean density, --IS 2380 (Part 3)) |
- |
700 |
|
- |
| As per Clause 9.1 Table 3(Moisture Content -IS 2380 (Part 3)) |
- |
700 |
|
- |
| As per Clause 9.1 Table 4, Table 5, Table 6, Table 7(Modulus of rupture (MoR), Min.-IS 2380 (Part 4)) |
- |
1500 |
|
- |
| As per Clause 9.1 Table 4, Table 6, Table 7(Modulus of elasticity (MoE), Min. -(IS 2380 (Part 4)) |
- |
1500 |
|
- |
| As per Clause 9.1 Table 4, Table 5, Table 6, Table7(Internal bond strength, Min. - IS 2380 (Part 5)) |
- |
1500 |
|
- |
| As per Clause 9.1 Table 6, Table 7(24 h thickness swelling (due to general absorption) Max. - IS 2380 (Part 17)) |
- |
1500 |
|
- |
| As per Clause 9.1 Table 4, Table 5, Table 6, Table 7(Screw withdrawal strength (face) , Min. -IS 2380 (Part 4)) |
- |
1500 |
|
- |
| As per Clause 9.1 Table 4, Table 5, table 6, Table 7(Screw withdrawal strength (edge) , Min. -IS 2380 (Part 4)) |
- |
1500 |
|
- |
| As per Clause 9.1 , Table 6, Table 7(Moisture Resistance : Option 1 : Cyclic test (1. )Internal bond strength Min. -IS 2380 (Part 5) see note 1) |
- |
1500 |
|
- |
| As per Clause 9.1 , Table 6, Table 7(Moisture Resistance : Option 2 : Boil test (1.) Internal bond strength , Min.- IS 2380 (Part 5) see note 2) |
- |
1500 |
|
- |
| As per Clause 9.1 , Table 9(Formaldehyde content Fc, mg/100 g for oven dry board -IS 13745) |
- |
2000 |
|
- |
| As per Clause 9.1 , Table 9(Steady-state formaldehyde emission, Fc, mg/m3 (optional test)) |
- |
0 |
|
- |
|
- |
-
Included w.e.f 01.04.2026
As per Clause 9.1 , Table 9 (Steady-state formaldehyde emission, Fc, mg/m3 (optional test)) |
| 9 |
IS 12823 (2025) |
Prelaminated Medium Density Particle Boards from Wood and other Lignocellulosic Material Specification (Second Revision) |
All |
11400 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| As per Clause 5(Material - IS 3087) |
- |
0 |
|
- |
| As per Clause 8 Table 2(Length -IS 2380 (Part 2)) |
- |
300 |
|
- |
| As per Clause 8 Table 2(Width - IS 2380 (Part 2)) |
- |
300 |
|
- |
| As per Clause 8 Table 2(Thickness - IS 2380 (Part 2)) |
- |
300 |
|
- |
| As per Clause 8 Table 2(Squareness, Max -IS 2380 (Part 2)) |
- |
300 |
|
- |
| As per Clause 8 Table 2(Edge Straighness, Max - IS 2380 (Part 2)) |
- |
300 |
|
- |
| As per Clause 9.1 Table 3(Density -IS 2380 (Part 3)) |
- |
700 |
|
- |
| As per Clause 9.1 Table 3(Variation from mean density, --IS 2380 (Part 3)) |
- |
700 |
|
- |
| As per Clause 9.1 Table 3(Moisture Content -IS 2380 (Part 3)) |
- |
700 |
|
- |
| As per Clause 9.1 Table 4, Table 5, Table 6, Table 7(Modulus of rupture (MoR), Min.-IS 2380 (Part 4)) |
- |
1000 |
|
- |
| As per Clause 9.1 Table 4, Table 6, Table 7(Modulus of elasticity (MoE), Min. -(IS 2380 (Part 4)) |
- |
1000 |
|
- |
| As per Clause 9.1 Table 4, Table 5, Table 6, Table7(Internal bond strength, Min. - IS 2380 (Part 5)) |
- |
1000 |
|
- |
| As per Clause 9.1 Table 6, Table 7(24 h thickness swelling (due to general absorption) Max. - IS 2380 (Part 17)) |
- |
1000 |
|
- |
| As per Clause 9.1 Table 4, Table 5, Table 6, Table 7(Screw withdrawal strength (face) , Min. -IS 2380 (Part 4)) |
- |
1000 |
|
- |
| As per Clause 9.1 Table 4, Table 5, table 6, Table 7(Screw withdrawal strength (edge) , Min. -IS 2380 (Part 4)) |
- |
1000 |
|
- |
| As per Clause 9.1 , Table 6, Table 7(Moisture Resistance : Option 1 : Cyclic test (1. )Internal bond strength Min. -IS 2380 (Part 5) see note 1) |
- |
1500 |
|
- |
| As per Clause 9.1 , Table 6, Table 7(Moisture Resistance : Option 2 : Boil test (1.) Internal bond strength , Min.- IS 2380 (Part 5) see note 2) |
- |
1500 |
|
- |
| As per Clause 9.1 , Table 8(Abrasion resistance in number of revolutions Min. --Annex. B) |
- |
1500 |
|
- |
| As per Clause 9.1 , Table 8(Resiatnce to stream/water vapour - Annex. C) |
- |
1500 |
|
- |
| As per Clause 9.1 , Table 8(Resitance to crack -Annex. D) |
- |
1500 |
|
- |
| As per Clause 9.1 , Table 8(Resistance to cigarette burn -Annex. E) |
- |
1500 |
|
- |
| As per Clause 9.1 , Table 8(Resiatnce to stain - Annex. F) |
- |
1500 |
|
- |
| As per Clause 9.1 , Table 9(Formaldehyde content Fc, mg/100 g for oven dry board -IS 13745) |
- |
2000 |
|
- |
| As per Clause 9.1 , Table 9(Steady-state formaldehyde emission, Fc, mg/m3 (optional test)) |
- |
0 |
|
- |
|
- |
-
Included w.e.f. 10.02.2026
Exclusion: As per Clause 9.1 , Table 9 (Steady-state formaldehyde emission, Fc, mg/m3 (optional test)) |
| 10 |
IS 5509 (2021) |
Fire Retardant Plywood - Specification ( Third Revision ) |
All |
9800 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 8.3 (Table 1)(b) 6 mm and above) |
- |
1000 |
|
- |
| 4.1(Flame retardant chemicals) |
- |
1500 |
|
- |
| 4.2(Flame retardant and preservative treatment) |
- |
1500 |
|
- |
| 4.3(Treatment) |
- |
0 |
|
- |
| 5(PREPARATION FOR TREATMENT) |
- |
0 |
|
- |
| 6.1.1(Treatment of Plywood by Pressure Impregnation after Manufacture) |
- |
0 |
|
- |
| 6.1.2(Soaking Treatment) |
- |
300 |
|
- |
| 6.2(Choice of Treatment) |
- |
0 |
|
- |
| 7(CONDITIONING AFTER TREATMENT) |
- |
0 |
|
- |
| 8.1(Dimensions) |
- |
1000 |
|
- |
| 8.2(Thickness) |
- |
300 |
|
- |
| 8.3, Taable-1 (i)(Tolerance- Length) |
- |
300 |
|
- |
| 9(WORKMANSHIP AND FINISH) |
- |
200 |
|
- |
| 10(SAMPLING AND CRITERIA FOR CONFORMITY) |
- |
0 |
|
- |
| 11 (a)(For flammability) |
- |
2000 |
|
- |
| 11 (b)(For flame penetration) |
- |
2000 |
|
- |
| 11 (c)(For rate of burning) |
- |
2000 |
|
- |
| 12.1 Table - 2 (i)(Moisture content, percent, Max) |
- |
100 |
|
- |
| 12.1 Table - 2 (ii)(Flammability (see Note 1), minutes, Min) |
- |
2000 |
|
- |
| 12.1 Table - 2 (iii)(Flame penetration (see Note 2), minutes, Min) |
- |
2000 |
|
- |
| 12.1 Table - 2 (iv)(Rate of burning (see Note 3), minutes, Min) |
- |
2000 |
|
- |
| 12.2(Other Tests) |
- |
0 |
|
- |
| 14(Marking) |
- |
300 |
|
- |
| Cl-13(ADDITIONAL REQUIREMENTS FOR
ECO-MARK) |
- |
0 |
|
- |
| Cl-8.3, Table-1 (ii)(Tolerances-Width) |
- |
300 |
|
- |
| Cl-8.3, Table-1 (iii)(Tolerances- Thickness) |
- |
300 |
|
- |
| Cl-8.3, Table-1 (iv)(Edge straightness) |
- |
300 |
|
- |
| Cl-8.3, Table-1 (v)(Squareness,) |
- |
300 |
|
- |
|
- |
-
Included w.e.f 30.01.2026 |
| 11 |
IS 12406 (2025) |
Medium Density Fibre Boards of Wood and Other Lignocellulosic Materials for General Purpose - Specification ( Third Revision ) |
All |
9300 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| As per Clause 7(Finish --IS 2380 (Part 2), IS 2380 (Part 3) & Visual) |
- |
300 |
|
- |
| As per Clause 8, Table 2(Length -IS 2380 (Part 2)) |
- |
300 |
|
- |
| As per Clause 8, Table 2(Width - IS 2380 (Part 2)) |
- |
300 |
|
- |
| As per Clause 8, Table 2(Thickness - IS 2380 (Part 2)) |
- |
300 |
|
- |
| As per Clause 8, Table 2(Squareness, Max. - IS 2380 (Part 2)) |
- |
300 |
|
- |
| As per Clause 8, Table 2(Edge straightness, Max.) |
- |
300 |
|
- |
| As per Clause 9.1 Table 3(Density -IS 2380 (Part 3)) |
- |
700 |
|
- |
| As per Clause 9.1 Table 3(Variation from mean density, --IS 2380 (Part 3)) |
- |
700 |
|
- |
| As per Clause 9.1 Table 3(Moisture Content -IS 2380 (Part 3)) |
- |
700 |
|
- |
| As per Clause 9.1 Table 4, Table 5, Table 6, Table 7(Modulus of rupture (MoR), Min.-IS 2380 (Part 4)) |
- |
1000 |
|
- |
| As per Clause 9.1 Table 4, Table 5, Table 6, Table 7(Modulus of elasticity (MoE), Min. -(IS 2380 (Part 4)) |
- |
1000 |
|
- |
| As per Clause 9.1 Table 4, Table 5, Table 6, Table7(Internal bond strength, Min. - IS 2380 (Part 5)) |
- |
1000 |
|
- |
| As per Clause 9.1 Table 4, Table 5, Table 6, Table 7(24 h thickness swelling (due to general absorption) Max. - IS 2380 (Part 17)) |
- |
1000 |
|
- |
| As per Clause 9.1 Table 4, Table 5, Table 6, Table 7(Screw withdrawal strength (face) , Min. -IS 2380 (Part 4)) |
- |
1000 |
|
- |
| As per Clause 9.1 Table 4, Table 5, table 6, Table 7(Screw withdrawal strength (edge) , Min. -IS 2380 (Part 4)) |
- |
1000 |
|
- |
| As per Clause 9.1 , Table 5, Table 6, Table 7(Moisture Resistance : Option 1 : Cyclic test (1. )Internal bond strength Min. -IS 2380 (Part 5) see note 1) |
- |
1000 |
|
- |
| As per Clause 9.1 , Table 5, Table 6, Table 7(Moisture Resistance : Option 2 : Boil test (1.) Internal bond strength , Min.- IS 2380 (Part 5) see note 2) |
- |
1000 |
|
- |
| As per Clause 9.1 , Table 9(Formaldehyde content Fc, mg/100 g for oven dry board -IS 13745) |
- |
2000 |
|
- |
| As per Clause 9.1 , Table 9(Steady-state formaldehyde emission, Fc, mg/m3 (optional test)) |
- |
0 |
|
- |
| Cl-5.1(Wood and Any Other Lignocellulosic
Material) |
- |
0 |
|
- |
| Cl-5.3(Sizing Material) |
- |
0 |
|
- |
| Cl-5.4(Preservative Treatment) |
- |
0 |
|
- |
| Cl-6(MANUFACTURE) |
- |
200 |
|
- |
| Cl-5.2(Adhesive) |
- |
1500 |
|
- |
|
- |
-
Included w.e.f 30.01.2026
Clause 9.1 , Table 9 (Steady-state formaldehyde emission, Fc, mg/m3 (optional test)) |
| 12 |
IS 848 (2025) |
Synthetic Resin Adhesives for Plywood (Phenolic, Aminoplastic and Bio-Materials Based) - Specification ( Third Revision ) |
All |
6300 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| As per Clause 4 Table 1(TYPES) |
- |
200 |
|
- |
| As per Clause 6.6(SETTING TIMES AND CONDITIONS) |
- |
200 |
|
- |
| As per Clause 7.3.2 Table 1(i)(Cyclic Test For BWP Type) |
- |
3500 |
|
- |
| As per Clause 7.3.2 Table 1(ii)(Cyclic Test For BWR Type) |
- |
3500 |
|
- |
| As per Clause 7.3.2 Table 1(iii)(Cyclic Test For MR Type) |
- |
3500 |
|
- |
| As per Clause 7.4(Acidity And Alkalinity (pH)) |
- |
2200 |
|
- |
| As per Clause 9(Marking) |
- |
200 |
|
- |
|
- |
-
Included w.e.f 17.02.2026 |
| 13 |
IS 710 (2024) |
MARINE PLYWOOD - SPECIFICATION (Third Revision) |
All |
13700 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl-4.1(Timber) |
- |
0 |
|
- |
| Cl-4.2(Adhesive) |
- |
1500 |
|
- |
| Cl-5.1(Veneers) |
- |
1000 |
|
- |
| Cl-5.2.1(Glueing) |
- |
200 |
|
- |
| Cl -5.2.2(Thickness of Veneers) |
- |
300 |
|
- |
| Cl - 5.2.3.1(Joint in Veneers) |
- |
200 |
|
- |
| Cl - 5.2.3.2(Edge joints) |
- |
200 |
|
- |
| Cl - 5.2.3.3(End joints) |
- |
200 |
|
- |
| Cl - 5.2.3.4(Scarf joints) |
- |
200 |
|
- |
| Cl - 5.2.4(Grain Direction) |
- |
200 |
|
- |
| Cl-5.3(Treatment) |
- |
200 |
|
- |
| Cl-5.4(Moisture Content) |
- |
700 |
|
- |
| Cl-6.1(Dimensions (length)) |
- |
300 |
|
- |
| Cl-6.2(Thickness) |
- |
300 |
|
- |
| Cl-6.3(Squareness) |
- |
300 |
|
- |
| Cl-7.1, 7.2, 7.3, 7.4, 7.5 & 7.6(Workmanship and finish) |
- |
300 |
|
- |
| Cl-9.3(Moisture Content) |
- |
700 |
|
- |
| Cl-9.4.2(Glue Adhesion in Dry State- Adhesion of Plies) |
- |
1000 |
|
- |
| Cl-9.4.1(Glue Adhesion in Dry State- Glue Shear Strength -Average) |
- |
1000 |
|
- |
| Cl-9.5.1.1(Glue Adhesion in Water Resistance - Glue Shear Strength -Average) |
- |
1000 |
|
- |
| Cl-9.5.1.2(Water Resistance Test-Adhesion of plies) |
- |
1000 |
|
- |
| Cl-9.5.2(Water Resistance Test) |
- |
1000 |
|
- |
| Cl-9.6(Tensile Strength-Along the grain) |
- |
1000 |
|
- |
| Cl-9.7(Mycological Test -Adhesion) |
- |
2000 |
|
- |
| Cl-9.8, Table-2(Static Bending Strength - Modulus of Elasticity - Along the Face Grain - Average) |
- |
1000 |
|
- |
| Cl-9.8, Table-2(Static Bending Strength - Modulus of Elasticity - Along the Face Grain - Minimum Individual) |
- |
1000 |
|
- |
| Cl-9.9, Table-3 (i) a((Modulus of Elasticity: Across the Face Grain: Average) Wet Bending) |
- |
1000 |
|
- |
| Cl-9.9, Table-3 (i) b((Modulus of Elasticity: Across the Face Grain: Minimum Individual) Wet Bending) |
- |
1000 |
|
- |
| Cl-9.10(Retention of Preservative) |
- |
2000 |
|
- |
| Cl-9.11(Formaldehyde Content Test) |
- |
2000 |
|
- |
| Cl-9.12(Steady-State Formaldehyde Emission Test) |
- |
0 |
|
- |
| Cl-9.4.2(Adhesion of Plies) |
- |
1000 |
|
- |
| 5.1.1(Defects in veneers) |
- |
300 |
|
- |
| Cl-9.8, Table-2(Static Bending Strength - Modulus of Elasticity - Across the Face Grain - Average) |
- |
1000 |
|
- |
| Cl-9.8, Table-2(Static Bending Strength - Modulus of Elasticity - Across the Face Grain - Minimum Individual) |
- |
1000 |
|
- |
| Cl-9.9, Table-3 (ii) a((Modulus of Rupture: Across the Face Grain: Average) Wet Bending) |
- |
1000 |
|
- |
| Cl-9.9, Table-3 (ii) b((Modulus of Rupture: Across the Face Grain: Minimum Individual) Wet Bending) |
- |
1000 |
|
- |
| Cl-6.1(Dimensions (width)) |
- |
300 |
|
- |
| Cl-8.3(Edge Straightness) |
- |
300 |
|
- |
| Cl-9.4.1(Glue Adhesion in Dry State- Glue Shear Strength –Minimum Individual) |
- |
1000 |
|
- |
| Cl-9.5.1.1(Glue Adhesion in Water Resistance - Glue Shear Strength –Minimum Individual) |
- |
1000 |
|
- |
| Cl-9.6(Tensile Strength-Across the grain) |
- |
1000 |
|
- |
| Cl-9.7(Glue Adhesion in Mycological test - Glue Shear Strength –Minimum Individual) |
- |
1000 |
|
- |
| Cl-9.7(Glue Adhesion in Mycological test - Glue Shear Strength -Average) |
- |
1000 |
|
- |
| Cl-9.8, Table-2(Static Bending Strength - Modulus of Rupture - Along the Face Grain - Average) |
- |
1000 |
|
- |
| Cl-9.8, Table-2(Static Bending Strength - Modulus of Rupture - Along the Face Grain - Minimum Individual) |
- |
1000 |
|
- |
| Cl-9.8, Table-2(Static Bending Strength - Modulus of Rupture - Across the Face Grain - Minimum Individual) |
- |
1000 |
|
- |
| Cl-9.8, Table-2(Static Bending Strength - Modulus of Rupture - Across the Face Grain - Average) |
- |
1000 |
|
- |
| Cl-11.1(Marking) |
- |
200 |
|
- |
| Cl-11.3(Marking) |
- |
200 |
|
- |
|
- |
-
Included w.e.f 17.02.2026
Exclusion: Cl-9.12 (Steady-State Formaldehyde Emission Test) |
| 14 |
IS 303 (2024) |
Plywood for General Purposes â Specification (Fourth Revision) |
All |
9500 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl-5.1(Classification by appearance) |
- |
200 |
|
- |
| Cl-5.2, Table- 1 (i)(Blister) |
- |
200 |
|
- |
| Cl-5.2, Table- 1 (ii)(Checks) |
- |
200 |
|
- |
| Cl-5.2, Table- 1 (iii)(Discolouration) |
- |
200 |
|
- |
| Cl-5.2, Table- 1 (iv)(Dote) |
- |
200 |
|
- |
| Cl-5.2, Table- 1 (v)(Insect hole) |
- |
200 |
|
- |
| Cl-5.2, Table- 1 (vi)(Joints) |
- |
200 |
|
- |
| Cl-5.2, Table- 1 (vii)(Knots (dead)) |
- |
200 |
|
- |
| Cl-5.2, Table- 1 (viii)(Pin knots (dead)) |
- |
200 |
|
- |
| Cl-5.2, Table- 1 (ix)(Pin knots (live)) |
- |
200 |
|
- |
| Cl-5.2, Table- 1 (x)(Knots (tight)) |
- |
200 |
|
- |
| Cl-5.2, Table- 1 (xi)(Patches) |
- |
200 |
|
- |
| Cl-5.2, Table- 1 (xii)(Splits) |
- |
200 |
|
- |
| Cl-5.2, Table- 1 (xiii)(Swirl) |
- |
200 |
|
- |
| Cl-5.2, Table-2(Maximum Number of Categories of Permissible Defects, per m2) |
- |
200 |
|
- |
| Cl-6.1(Timber) |
- |
200 |
|
- |
| Cl-6.2(Adhesive) |
- |
1500 |
|
- |
| Cl-7.2.1(Thickness of veneers) |
- |
300 |
|
- |
| Cl-7.2.3(Grain Direction) |
- |
200 |
|
- |
| Cl-7.2.5.1(Gaps in cores and cross-bands) |
- |
200 |
|
- |
| Cl-7.2.5.2(Splits) |
- |
200 |
|
- |
| Cl-7.2.5.3(Overlap) |
- |
200 |
|
- |
| Cl-8.1(Dimensions -length) |
- |
300 |
|
- |
| Cl-8.2(Thickness of the plywood boards) |
- |
300 |
|
- |
| Cl-8.3(Squareness) |
- |
300 |
|
- |
| Cl-11.3.1, 11.3.1.1(Water Resistance Test) |
- |
750 |
|
- |
| Cl-11.3.2(Mycological Test) |
- |
2000 |
|
- |
| Cl-11.4(Moisture Content) |
- |
750 |
|
- |
| Cl-11.5, Table 4(Static Bending Strength - Modulus of Elasticity - Along the Face Grain - Average) |
- |
1000 |
|
- |
| Cl-11.5, Table 4(Static Bending Strength - Modulus of Elasticity - Along the Face Grain - Minimum Individual) |
- |
1000 |
|
- |
| Cl-11.6(Formaldehyde Content Test) |
- |
2000 |
|
- |
| Cl-11.7(Steady-State Formaldehyde Emission Test) |
- |
2000 |
|
- |
| Cl-9(WORKMANSHIP AND FINISH) |
- |
300 |
|
- |
| Cl-7.2.4(Scarf Joints) |
- |
200 |
|
- |
| Cl. 4(Grades) |
- |
0 |
|
- |
| Cl.5.1(Type based on classification by appearance) |
- |
0 |
|
- |
| Cl.5.2(Quality Requirements of Plywood for General Purposes) |
- |
0 |
|
- |
| Cl.8.1(Dimensions -width) |
- |
300 |
|
- |
| Cl.8, 8.3 & Annex C(Edge Straightness) |
- |
300 |
|
- |
| Cl.8, 8.3 & Annex C(Edge Squareness) |
- |
300 |
|
- |
| Cl-11.5, Table-4(Static Bending Strength - Modulus of Elasticity - Across the Face Grain - Average) |
- |
1000 |
|
- |
| Cl-11.5, Table-4,(Static Bending Strength - Modulus of Elasticity - Across the Face Grain - Minimum Individual) |
- |
1000 |
|
- |
| Cl-8.3(Edge Straightness) |
- |
300 |
|
- |
| Cl-11.5, Table-4(Static Bending Strength - Modulus of Rupture - Along the Face Grain - Average) |
- |
1000 |
|
- |
| Cl-11.5, Table-4(Static Bending Strength - Modulus of Rupture - Along the Face Grain - Minimum Individual) |
- |
1000 |
|
- |
| Cl-11.5, Table-4(Static Bending Strength - Modulus of Rupture - Across the Face Grain - Average) |
- |
1000 |
|
- |
| Cl-11.5, Table-4(Static Bending Strength - Modulus of Rupture - Across the Face Grain - Minimum Individual) |
- |
1000 |
|
- |
| Cl-13(Marking) |
- |
200 |
|
- |
| Cl-5.1(Classification by appearance) |
- |
- |
|
- |
| Cl-5.2, Table- 1 (i)(Blister) |
- |
- |
|
- |
| Cl-5.2, Table- 1 (ii)(Checks) |
- |
- |
|
- |
| Cl-5.2, Table- 1 (iii)(Discolouration) |
- |
- |
|
- |
| Cl-5.2, Table- 1 (iv)(Dote) |
- |
- |
|
- |
| Cl-5.2, Table- 1 (v)(Insect hole) |
- |
- |
|
- |
| Cl-5.2, Table- 1 (vi)(Joints) |
- |
- |
|
- |
| Cl-5.2, Table- 1 (vii)(Knots (dead)) |
- |
- |
|
- |
| Cl-5.2, Table- 1 (viii)(Pin knots (dead)) |
- |
- |
|
- |
| Cl-5.2, Table- 1 (ix)(Pin knots (live)) |
- |
- |
|
- |
| Cl-5.2, Table- 1 (x)(Knots (tight)) |
- |
- |
|
- |
| Cl-5.2, Table- 1 (xi)(Patches) |
- |
- |
|
- |
| Cl-5.2, Table- 1 (xii)(Splits) |
- |
- |
|
- |
| Cl-5.2, Table- 1 (xiii)(Swirl) |
- |
- |
|
- |
| Cl-5.2, Table-2(Maximum Number of Categories of Permissible Defects, per m2) |
- |
- |
|
- |
| Cl-6.1(Timber) |
- |
- |
|
- |
| Cl-6.2(Adhesive) |
- |
- |
|
- |
| Cl-7.2.1(Thickness of veneers) |
- |
- |
|
- |
| Cl-7.2.3(Grain Direction) |
- |
- |
|
- |
| Cl-7.2.5.1(Gaps in cores and cross-bands) |
- |
- |
|
- |
| Cl-7.2.5.2(Splits) |
- |
- |
|
- |
| Cl-7.2.5.3(Overlap) |
- |
- |
|
- |
| Cl-8.1(Dimensions -length) |
- |
- |
|
- |
| Cl-8.2(Thickness of the plywood boards) |
- |
- |
|
- |
| Cl-8.3(Squareness) |
- |
- |
|
- |
| Cl-11.3.1, 11.3.1.1(Water Resistance Test) |
- |
- |
|
- |
| Cl-11.3.2(Mycological Test) |
- |
- |
|
- |
| Cl-11.4(Moisture Content) |
- |
- |
|
- |
| Cl-11.5, Table 4(Static Bending Strength - Modulus of Elasticity - Along the Face Grain - Average) |
- |
- |
|
- |
| Cl-11.5, Table 4(Static Bending Strength - Modulus of Elasticity - Along the Face Grain - Minimum Individual) |
- |
- |
|
- |
| Cl-11.6(Formaldehyde Content Test) |
- |
- |
|
- |
| Cl-11.7(Steady-State Formaldehyde Emission Test) |
- |
- |
|
- |
| Cl-9(WORKMANSHIP AND FINISH) |
- |
- |
|
- |
| Cl-7.2.4(Scarf Joints) |
- |
- |
|
- |
| Cl. 4(Grades) |
- |
- |
|
- |
| Cl.5.1(Type based on classification by appearance) |
- |
- |
|
- |
| Cl.5.2(Quality Requirements of Plywood for General Purposes) |
- |
- |
|
- |
| Cl.8.1(Dimensions -width) |
- |
- |
|
- |
| Cl.8, 8.3 & Annex C(Edge Straightness) |
- |
- |
|
- |
| Cl.8, 8.3 & Annex C(Edge Squareness) |
- |
- |
|
- |
| Cl-11.5, Table-4(Static Bending Strength - Modulus of Elasticity - Across the Face Grain - Average) |
- |
- |
|
- |
| Cl-11.5, Table-4,(Static Bending Strength - Modulus of Elasticity - Across the Face Grain - Minimum Individual) |
- |
- |
|
- |
| Cl-8.3(Edge Straightness) |
- |
- |
|
- |
| Cl-11.5, Table-4(Static Bending Strength - Modulus of Rupture - Along the Face Grain - Average) |
- |
- |
|
- |
| Cl-11.5, Table-4(Static Bending Strength - Modulus of Rupture - Along the Face Grain - Minimum Individual) |
- |
- |
|
- |
| Cl-11.5, Table-4(Static Bending Strength - Modulus of Rupture - Across the Face Grain - Average) |
- |
- |
|
- |
| Cl-11.5, Table-4(Static Bending Strength - Modulus of Rupture - Across the Face Grain - Minimum Individual) |
- |
- |
|
- |
| Cl-13(Marking) |
- |
- |
|
- |
|
- |
-
Included w.e.f 17.02.2026
Exclusion: Cl-11.7 (Steady-State Formaldehyde Emission Test) |
| 15 |
IS 9968 : Part 1 (2025) |
Elastomer Insulated Cables - Specification Part 1 for Working Voltages up to and including 1100 volts (Second Revision) |
- |
14000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl-4.1(Copper Conductor) |
- |
20 |
|
- |
| Cl-4.2(Aluminum Conductor) |
- |
20 |
|
- |
| Cl-6.1(Proofed Tape) |
- |
20 |
|
- |
| Cl-6.2("Polyethylene Terephthalate (PETP) Tape or
Plastic Tape or Any Other Suitable Tape") |
- |
20 |
|
- |
| Cl-6.3(Glass Tape) |
- |
20 |
|
- |
| Cl-7(Fillers) |
- |
20 |
|
- |
| Cl-8.1(Textile Braid) |
- |
20 |
|
- |
| Cl-8.2(Glass Braid) |
- |
20 |
|
- |
| Cl-9.1(General Service Insulated Cables and Flexible Cords) |
- |
20 |
|
- |
| Cl-9.2(Heat Resisting Insulated Cables) |
- |
20 |
|
- |
| Cl-9.3(Silicon Rubber Insulated Cable) |
- |
20 |
|
- |
| Cl-10.1(Preservative Compound) |
- |
20 |
|
- |
| Cl-10.2(Varnish) |
- |
20 |
|
- |
| Cl-12(separator tape) |
- |
20 |
|
- |
| Cl-14(Core Identification) |
- |
20 |
|
- |
| Cl-18(Laying UP of Cores) |
- |
20 |
|
- |
| Cl-19(Binder Tape) |
- |
20 |
|
- |
| Cl-20.2(Thickness of Sheath) |
- |
10 |
|
- |
| Cl-20.3(Tolerance on Thickness of Sheath) |
- |
100 |
|
- |
| Cl-20.4(Colour) |
- |
50 |
|
- |
| Cl-22.1 (i) (a)(Conductor resistance test) |
- |
500 |
|
- |
| Cl-22.1 (i) (b)(High voltage test or spark test.) |
- |
2000 |
|
- |
| Cl-22.1 (ii) (a)(Annealing test (for copper);) |
- |
500 |
|
- |
| Cl-22.1 (ii) (b)(Tensile Test ((for aluminium);) |
- |
500 |
|
- |
| Cl-22.1 (ii) (c)(Wrapping test (for aluminium);) |
- |
200 |
|
- |
| Cl-22.1 (ii) (f)(Tensile strength and elongation at break of insulation and sheath) |
- |
200 |
|
- |
| Cl-22.1 (ii) (g)(Hot set test for insulation and sheath) |
- |
1000 |
|
- |
| Cl-22.1 (ii) (h)(High voltage test) |
- |
1500 |
|
- |
| Cl-22.1 (ii) (i)(Insulation resistance test) |
- |
500 |
|
- |
| Cl-22.1 (iii) (a)(Persulphate test (for tinned copper);) |
- |
300 |
|
- |
| Cl-22.1 (iii) (f)(Test for thickness of insulation and sheath and overall diameter) |
- |
100 |
|
- |
| Electrical(Tensile strength and elongation at break) |
- |
200 |
|
- |
| Cl-22.1 (iii) (g), 2(Ageing in air oven) |
- |
1000 |
|
- |
| Cl-22.1 (iii) (g), 3(Ageing in air bomb) |
- |
1000 |
|
- |
| Cl-22.1 (iii) (g), 4(Ageing In oxygen bomb) |
- |
1000 |
|
- |
| Cl-22.1 (iii) (g), 5(Hot set) |
- |
1000 |
|
- |
| Cl-22.1 (iii) (g), 6(Oil resistance;) |
- |
500 |
|
- |
| Cl-22.1 (iii) (g), 7(Tear resistance) |
- |
500 |
|
- |
| Cl-22.1 (iii) (i)(High voltage (water immersion) test;) |
- |
1000 |
|
- |
| Cl-22.1 (iii) (j)(Flammability test) |
- |
500 |
|
- |
| Cl-22.1 (iii) (k)(Water absorption test (for insulation as applicable)) |
- |
1000 |
|
- |
| Cl-24.1(Manufacturer’s Identification) |
- |
0 |
|
- |
| Cl-25(Packing and Morning) |
- |
0 |
|
- |
|
- |
-
Included w.e.f. 23.01.2026 |
| 16 |
IS 302 : Part 2 : Sec 30 (2007) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 30 room heaters (First Revision) |
safety of electric radiators (room heaters) for household and similar purposes, their rated voltage being not more than 250 V for single-phase appliances and 415 V for other appliances, |
70000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl.6 (Classification) |
- |
500 |
|
- |
| Cl.6 (Classification) |
- |
500 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
500 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
500 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
500 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
500 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
500 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
500 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.3(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.3(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.3(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.4(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.5(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.6 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.8 of IS :302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.9 of IS :302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.10 of IS :302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.11 of IS :302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2009(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.13 of IS 302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.14 of IS302-1:2008(Marking and Instructions) |
- |
500 |
|
- |
| Cl.7.14(Marking and Instructions) |
- |
500 |
|
- |
| Cl.7.14(Marking and Instructions) |
- |
500 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions) |
- |
500 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.101(Marking and Instructions) |
- |
0 |
|
- |
| Cl.8 & IS:302-1:2008(Protection Against Access to Live Parts) |
- |
1000 |
|
- |
| Cl.10 & IS:302-1:2008(Power Input and Current) |
- |
2000 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
2000 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
2000 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
1000 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
1000 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
1000 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11.8(Heating) |
- |
0 |
|
- |
| Cl.11.8(Heating) |
- |
0 |
|
- |
| Cl.11.8(Heating) |
- |
0 |
|
- |
| Cl.13 & IS:302-1:2008(Leakage Current & Electric Strength at operating temp. ) |
- |
2000 |
|
- |
| Cl.13 & IS:302-1:2008(Leakage Current & Electric Strength at operating temp. ) |
- |
2000 |
|
- |
| Cl.14 & IS:302-1:2008(Transient Over Voltages) |
- |
3000 |
|
- |
| Cl.15 & IS: 302-1:2008(Moisture Resistance
) |
- |
4000 |
|
- |
| Cl.15.3 of IS 302-1:200(Moisture Resistance
) |
- |
1000 |
|
- |
| Cl.16 & IS:302-1:2008(Leakage Current & Electric Strength ) |
- |
1500 |
|
- |
| Cl.16 & IS:302-1:2008(Leakage Current & Electric Strength ) |
- |
1500 |
|
- |
| Cl.17 & IS:302-1:2008(Over load Protection of Transformers and Associated Circuits ) |
- |
1000 |
|
- |
| Cl.18 (Endurance. ) |
- |
0 |
|
- |
| Cl.19 & IS:302-1:2008(Abnormal Operation.) |
- |
3000 |
|
- |
| Cl.19 & IS:302-1:2008(Abnormal Operation.) |
- |
1000 |
|
- |
| Cl.19 & IS:302-1:2008(Abnormal Operation.) |
- |
500 |
|
- |
| Cl.19 & IS:302-1:2008(Abnormal Operation.) |
- |
500 |
|
- |
| Cl.19.101(Abnormal Operation.) |
- |
500 |
|
- |
| Cl.19.102(Abnormal Operation.) |
- |
500 |
|
- |
| Cl.19.103(Abnormal Operation.) |
- |
500 |
|
- |
| Cl.19.104(Abnormal Operation.) |
- |
500 |
|
- |
| Cl.19.105(Abnormal Operation.) |
- |
500 |
|
- |
| Cl.19.106(Abnormal Operation.) |
- |
500 |
|
- |
| Table 8 of IS 302-1:2008(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.107(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.108(Abnormal Operation.) |
- |
500 |
|
- |
| Cl.19.109(Abnormal Operation.) |
- |
500 |
|
- |
| Cl.19.110(Abnormal Operation.) |
- |
500 |
|
- |
| Cl.19.111(Abnormal Operation.) |
- |
500 |
|
- |
| Cl.19.112(Abnormal Operation.) |
- |
500 |
|
- |
| Cl.19.113(Abnormal Operation.) |
- |
500 |
|
- |
| Cl.19.114(Abnormal Operation.) |
- |
500 |
|
- |
| Cl.20 & IS:302-1:2008(Stability & Mechanical Hazards) |
- |
2000 |
|
- |
| Cl.21 & IS:302-1:2008)(Mechanical Strength.) |
- |
2000 |
|
- |
| Cl.21.2 of IS 302-1:2008(Mechanical Strength.) |
- |
2000 |
|
- |
| Cl.21.101 (Mechanical Strength.) |
- |
500 |
|
- |
| Cl.21.102(Mechanical Strength.) |
- |
500 |
|
- |
| Cl.21.103(Mechanical Strength.) |
- |
500 |
|
- |
| Cl.22.1 of IS 302-1:2008(Construction) |
- |
500 |
|
- |
| Cl.22.5 of IS 302-1:2008(Construction) |
- |
500 |
|
- |
| Cl.22.6 of IS 302-1:2008(Construction) |
- |
500 |
|
- |
| Cl.22.7 of IS 302-1:2008(Construction) |
- |
500 |
|
- |
| Cl.22.8 of IS 302-1:2008(Construction) |
- |
500 |
|
- |
| Cl.22.9 of IS 302-1:2008(Construction) |
- |
500 |
|
- |
| Cl.22.11(Construction) |
- |
500 |
|
- |
| Cl.22.12 of IS 302-1:2008(Construction) |
- |
500 |
|
- |
| Cl.22.13 of IS 302-1:2008(Construction) |
- |
500 |
|
- |
| Cl.22.14 of IS 302-1:2008(Construction) |
- |
500 |
|
- |
| Cl.22.15 of IS 302-1:2008(Construction) |
- |
500 |
|
- |
| Cl.22.18 of IS 302-1:2008(Construction) |
- |
500 |
|
- |
| Cl.22.20 of IS 302-1:2008(Construction) |
- |
500 |
|
- |
| Cl.22.21 of IS 302-1:2008(Construction) |
- |
500 |
|
- |
| Cl.23 & IS:302-1:2008(Internal Wiring
) |
- |
3000 |
|
- |
| Cl.23.4 & Cl.29 of 302-1:2008(Internal Wiring
) |
- |
1000 |
|
- |
| Cl.23.5 of 302-1:2008(Internal Wiring
) |
- |
1000 |
|
- |
| Cl.23.7 of 302-1:2008(Internal Wiring
) |
- |
1000 |
|
- |
| C.23.7 of 302-1:2008(Internal Wiring
) |
- |
1000 |
|
- |
| Cl.24.1 of 302-1:2008(Component) |
- |
1000 |
|
- |
| Cl.24.1 of 302-1:2008(Component) |
- |
1000 |
|
- |
| Cl.24.1.3 (Component) |
- |
1000 |
|
- |
| Cl.24.1.3 (Component) |
- |
1000 |
|
- |
| Cl.24.1.3 (Component) |
- |
1000 |
|
- |
| Cl.24.1.3 (Component) |
- |
1000 |
|
- |
| C.24.1.4(Component) |
- |
1000 |
|
- |
| C.24.2 of 302-1:2008(Component) |
- |
1000 |
|
- |
| Cl.24.10(Component) |
- |
1000 |
|
- |
| Cl.25.1 of 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
1000 |
|
- |
| Cl. 25.2 of IS 3021:2008(Supply Connection and External Flexible Cords ) |
- |
1000 |
|
- |
| Cl. 25.3 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
1000 |
|
- |
| Cl.25.5 of 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
1000 |
|
- |
| Cl.25.6 of 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
1000 |
|
- |
| Cl.25.7.(Supply Connection and External Flexible Cords ) |
- |
1000 |
|
- |
| Cl.25.8(Supply Connection and External Flexible Cords ) |
- |
1000 |
|
- |
| Cl. 25.9(Supply Connection and External Flexible Cords ) |
- |
1000 |
|
- |
| Cl.25.10 of 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
1000 |
|
- |
| Cl. 25.11(Supply Connection and External Flexible Cords ) |
- |
500 |
|
- |
| Cl. 25.12(Supply Connection and External Flexible Cords ) |
- |
500 |
|
- |
| Cl. 25.13(Supply Connection and External Flexible Cords ) |
- |
500 |
|
- |
| Cl.25.14 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
2000 |
|
- |
| Cl.25.15 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
1000 |
|
- |
| Cl.25.15 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
1000 |
|
- |
| Cl.25.17 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
500 |
|
- |
| Cl.25.18(Supply Connection and External Flexible Cords ) |
- |
500 |
|
- |
| Cl.25.20(Supply Connection and External Flexible Cords ) |
- |
1000 |
|
- |
| Cl.26.1 of IS 302-1:2008(Terminal for External Conductors
) |
- |
1000 |
|
- |
| Cl.26.10 of IS 302-1:2008(Terminal for External Conductors
) |
- |
1000 |
|
- |
| Cl.26.11 of IS 302-1:2008(Terminal for External Conductors
) |
- |
1000 |
|
- |
| Cl.27.1 of 302-1:2008(Provision for Earthing.) |
- |
500 |
|
- |
| Cl.27.5 of 302-1:2008(Provision for Earthing.) |
- |
4500 |
|
- |
| Cl.28 of 302-1:2008(Screws and Connections.) |
- |
5000 |
|
- |
| Cl.29 & IS:302-1:2008(Clearances, Creepage Distances and Solid Insulation) |
- |
3000 |
|
- |
| Cl.29 & IS:302-1:2008(Clearances, Creepage Distances and Solid Insulation) |
- |
3000 |
|
- |
| Cl.30 & IS:302-1:2008(Resistance to Heat and Fire) |
- |
3000 |
|
- |
| Cl.30.2.2 of 302-1:2008(Resistance to Heat and Fire) |
- |
3000 |
|
- |
| Cl.31 & IS:302-1:2008(Resistance to Rusting.) |
- |
5000 |
|
- |
| Cl.32 & IS:302-1:2008(Radition,Toxicity and similar Hazards.) |
- |
0 |
|
- |
| Cl.31 of IS:302-1:2008(Resistance to Rusting.) |
- |
0 |
|
- |
| Cl.30.2 of 302-1:2008(Resistance to Heat and Fire : Resistance to fire) |
- |
0 |
|
- |
| Cl.30.1 of IS:302-1:2008(Resistance to Heat and Fire: Resistance to heat. ) |
- |
2000 |
|
- |
| Cl.29.2 of IS:302-1:2008(Clearances, Creepage Distances and Solid Insulation : Creepage Distance) |
- |
1000 |
|
- |
| Cl.29.1 of IS:302-1:2008(Clearances, Creepage Distances and Solid Insulation : Clearance ) |
- |
500 |
|
- |
| Cl.28 of 302-1:2008(Screws and Connections.) |
- |
500 |
|
- |
| Cl.27.5 of 302-1:2008(Provision for Earthing : ECR) |
- |
1000 |
|
- |
| Cl.27.1 of 302-1:2008(Provision for Earthing ) |
- |
1000 |
|
- |
| Cl.26 of IS 302-1:2008(Terminal for External Conductors
) |
- |
500 |
|
- |
| Cl.25.20 of 302-1:2008(Supply Connection and External Flexible Cords : Additional insulation ) |
- |
500 |
|
- |
| Cl.25.18 of 302-1:2008(Supply Connection and External Flexible Cords : Arrangement of cord anchorages ) |
- |
500 |
|
- |
| Cl.25.15 of IS 302-1:2008(Supply Connection and External Flexible Cords : Cord grip test - displacement) |
- |
500 |
|
- |
| Cl. 25.13 of 302-1:2008(Supply Connection and External Flexible Cords : Inlet opening of supply cords ) |
- |
500 |
|
- |
| Cl. 25.12 of 302-1:2008(Supply Connection and External Flexible Cords : Moulding of cords ) |
- |
500 |
|
- |
| Cl.25.10 of 302-1:2008(Supply Connection and External Flexible Cords : Colour of earthing wire ) |
- |
500 |
|
- |
| Cl. 25.9 of 302-1:2008(Supply Connection and External Flexible Cords : Contact with sharp edge ) |
- |
500 |
|
- |
| Cl.25.8 of 302-1:2008(Supply Connection and External Flexible Cords : Resistance of supply wires ) |
- |
500 |
|
- |
| Cl.25.7 of IS:302-2-30:2007(Supply Connection and External Flexible Cords : Supply cords material ) |
- |
500 |
|
- |
| Cl.25.5 of 302-1:2008(Supply Connection and External Flexible Cords : Type of attachments ) |
- |
500 |
|
- |
| Cl.25.1 of 302-1:2008(Supply Connection and External Flexible Cords : Means of connection ) |
- |
500 |
|
- |
| Cl.24 of IS:302-2-30:2007(Component) |
- |
500 |
|
- |
| Cl.23.7 of 302-1:2008(Internal Wiring : Colour of earting conductor
) |
- |
500 |
|
- |
| Cl.23 of IS:302-1:2008(Internal Wiring
) |
- |
1000 |
|
- |
| Cl.22.106 of IS:302-2-30:2007(Construction : Checking of thermostats, timers or similar means for visibl glowing radiant heaters) |
- |
500 |
|
- |
| Cl.22.106 of IS:302-2-30:2007(Construction : Checking of openings on the underside) |
- |
500 |
|
- |
| Cl.22.102 & Cl 22.103 of IS:302-2-30:2007(Construction : Fireguard ) |
- |
500 |
|
- |
| Cl.22.101 of IS:302-2-30:2007(Construction : Prevention to contact with heating element) |
- |
500 |
|
- |
| Cl.22.24 of IS:302-2-30:2007(Construction : test of bare heating element) |
- |
500 |
|
- |
| Cl.22.18 of IS 302-1:2008(Construction : Resistance to corrosion ) |
- |
500 |
|
- |
| Cl.22.15 of IS 302-1:2008(Construction : Storage hooks for flexible cords) |
- |
500 |
|
- |
| Cl.22.14 of IS 302-1:2008(Construction : ragged and sharp edges) |
- |
500 |
|
- |
| Cl.22.13 of IS 302-1:2008(Construction : Position of handles ) |
- |
500 |
|
- |
| Cl.22.12 of IS 302-1:2008(Construction : Fixing of Handle, knobs,grips,lever and similer parts ) |
- |
500 |
|
- |
| Cl.22.11 of IS 302-1:2008(Construction : Fixing of non detachable parts ) |
- |
500 |
|
- |
| Cl.22.7 of IS:302-2-30:2007(Construction : Pressure test of oil heater ) |
- |
500 |
|
- |
| Cl.21.101 of IS:302-2-30:2007(Mechanical Strength : fire gaurd deformation test ) |
- |
500 |
|
- |
| Cl.21.2 of IS 302-1:2008(Mechanical Strength : Pentration by sharp implementation ) |
- |
1000 |
|
- |
| Cl.21.1 of IS:302-1:2008)(Mechanical Strength : Rough handling ) |
- |
1000 |
|
- |
| Cl.20 of IS:302-2-30:2007(Stability of Mechanical Hazards) |
- |
1000 |
|
- |
| Cl.19.114 of IS:302-2-30:2007(Abnormal Operation : the temp. of the surface of the container for oil heaters ) |
- |
500 |
|
- |
| Cl.19.112 of IS:302-2-30:2007(Abnormal Operation : Ignition of bleached cotton gauge) |
- |
500 |
|
- |
| Cl.19.111 of IS:302-2-30:2007(Abnormal Operation : Ignition of flannelette for Visibly glowing heaters) |
- |
1000 |
|
- |
| Cl.19.110 of IS:302-2-30:2007(Abnormal Operation : operation against wall for visibly glowing radiant heaters ) |
- |
500 |
|
- |
| Cl.19.109 of IS:302-2-30:2007(Abnormal Operation : operation against wall for fan heater ) |
- |
500 |
|
- |
| Cl.19.106 of IS:302-2-30:2007(Abnormal Operation : Locked rotor of fan hetear ) |
- |
500 |
|
- |
| Cl.19.103 , Cl 19.104 of IS:302-2-30:2007(Abnormal Operation : Operation after Covering by cotton) |
- |
500 |
|
- |
| Cl.19 of IS:302-2-30:2007(Abnormal Operation : High Voltage ) |
- |
500 |
|
- |
| Cl.19 of IS:302-2-30:2007(Abnormal Operation : temp rise of supply cord ) |
- |
1000 |
|
- |
| Cl.19 of IS:302-2-30:2007(Abnormal Operation : Temp rise of test corner ) |
- |
500 |
|
- |
| Cl.19 of IS:302-1:2008(Abnormal Operation : Emission of molten or poisonous or ignitable gas) |
- |
500 |
|
- |
| Cl.16 of IS:302-1:2008(Leakage current and Electric strength (After humidity): Electric Strentgh ) |
- |
500 |
|
- |
| Cl.16 of IS:302-1:2008(Leakage current and Electric strength (After humidity): Leakage current ) |
- |
500 |
|
- |
| Cl.15 of IS 302-1:2008(Moisture Resistance
) |
- |
500 |
|
- |
| Cl.14 of IS:302-1:2008(Transient Over Voltages) |
- |
1000 |
|
- |
| Cl.13 of IS:302-1:2008(Leakage Current of Electric Strength at operating temp. ) |
- |
500 |
|
- |
| Cl.13 of IS:302-1:2008(Leakage Current of Electric Strength at operating temp. ) |
- |
500 |
|
- |
| Cl.11 of IS:302-2:30: 2007(Heating : Room temperature) |
- |
500 |
|
- |
| Cl.11.8 of IS:302-2:30: 2007(Heating : For liquid filled radiators the temp. rise of the outer surface of the liquid container) |
- |
500 |
|
- |
| Cl.11 of IS:302-2:30: 2007(Heating : Temperature rise in winding) |
- |
500 |
|
- |
| Cl.11 of IS:302-2:30: 2007(Heating : Air-outlet grills) |
- |
1000 |
|
- |
| Cl.11 of IS:302-2:30: 2007(Heating : Surfaces of handles, knobs, grips and similar parts) |
- |
500 |
|
- |
| Cl.11 of IS:302-2:30: 2007(Heating : Wooden supports, walls, ceiling and floor of the test corner) |
- |
500 |
|
- |
| Cl.11 of IS:302-2:30: 2007(Heating : PVC Insulation ) |
- |
500 |
|
- |
| Cl.10 of IS:302-1:2008(Power Input and Current) |
- |
500 |
|
- |
| Cl.8 of IS:302-1:2008(Protection Against Access to Live Parts) |
- |
500 |
|
- |
| Cl.7.101 of IS:302-2:30: 2007(Marking and Instructions : standard mark. ) |
- |
500 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions : Visibility of marking concerning covering) |
- |
0 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions : discernibility from the out side ) |
- |
0 |
|
- |
| Cl.7.14 of IS:302-2:30: 2007(Marking and Instructions : Height of “Do not cover”) |
- |
0 |
|
- |
| Cl.7.14 of IS:302-2:30: 2007(Marking and Instructions : height of symbol) |
- |
500 |
|
- |
| Cl.7.14 of IS302-1:2008(Marking and Instructions : Legibility and durability ) |
- |
500 |
|
- |
| Cl.7.13 of IS 302-1:2008(Marking and Instructions : Languge of instruction and texts ) |
- |
0 |
|
- |
| Cl.7.11 of IS :302-1:2008(Marking and Instructions : Controls ) |
- |
0 |
|
- |
| Cl.7.9 of IS :302-1:2008(Marking and Instructions : switches ) |
- |
0 |
|
- |
| Cl.7.8 of IS :302-1:2008(Marking and Instructions : terminals ) |
- |
0 |
|
- |
| Cl.7.6 of IS:302-1:2008(Marking and Instructions : Symbols ) |
- |
0 |
|
- |
| Cl.7.5 of IS:302-1:2008(Marking and Instructions : upper of lower limit of the rated power input ) |
- |
0 |
|
- |
| Cl 7.1 & Cl.7.6 of IS:302-2:30: 2007(Marking and Instructions : Do not cover ) |
- |
0 |
|
- |
| Cl.7.1 of IS:302-1:2008(Marking and Instructions : Country of manufacture ) |
- |
0 |
|
- |
| Cl.7.1 of IS:302-1:2008(Marking and Instructions : Symbol for Class-II ) |
- |
0 |
|
- |
| Cl.7.1 of IS:302-1:2008(Marking and Instructions : Model or type ) |
- |
0 |
|
- |
| Cl.7.1 of IS:302-1:2008(Marking and Instructions : Name , trade-mark or identification mark of the manufacturer ) |
- |
0 |
|
- |
| Cl.7.1 of IS:302-1:2008(Marking and Instructions : rated power input ) |
- |
0 |
|
- |
| Cl.7.1 of IS:302-1:2008(Marking and Instructions : Nature of supply ) |
- |
0 |
|
- |
| Cl.7.1 of IS:302-1:2008(Marking and Instructions : Rated Voltage ) |
- |
0 |
|
- |
| Cl. 25.4 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
500 |
|
- |
| Cl.25.15 of IS 302-1:2008(Supply Connection and External Flexible Cords : Cord grip test - strain at terminals ) |
- |
0 |
|
- |
| Cl.6 (Classification) |
- |
0 |
|
- |
| Cl.6 (Classification) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.3(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.3(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.3(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.4(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.5(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.6 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.8 of IS :302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.9 of IS :302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.10 of IS :302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.11 of IS :302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.12.1 & IS:302-1:2009(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.13 of IS 302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.14 of IS302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.14(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.14(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7.101(Marking and Instructions) |
- |
0 |
|
- |
| Cl.8 & IS:302-1:2008(Protection Against Access to Live Parts) |
- |
0 |
|
- |
| Cl.10 & IS:302-1:2008(Power Input and Current) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 & IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11.8(Heating) |
- |
0 |
|
- |
| Cl.11.8(Heating) |
- |
0 |
|
- |
| Cl.11.8(Heating) |
- |
0 |
|
- |
| Cl.13 & IS:302-1:2008(Leakage Current & Electric Strength at operating temp. ) |
- |
0 |
|
- |
| Cl.13 & IS:302-1:2008(Leakage Current & Electric Strength at operating temp. ) |
- |
0 |
|
- |
| Cl.14 & IS:302-1:2008(Transient Over Voltages) |
- |
0 |
|
- |
| Cl.15 & IS: 302-1:2008(Moisture Resistance
) |
- |
0 |
|
- |
| Cl.15.3 of IS 302-1:200(Moisture Resistance
) |
- |
0 |
|
- |
| Cl.16 & IS:302-1:2008(Leakage Current & Electric Strength ) |
- |
0 |
|
- |
| Cl.16 & IS:302-1:2008(Leakage Current & Electric Strength ) |
- |
0 |
|
- |
| Cl.17 & IS:302-1:2008(Over load Protection of Transformers and Associated Circuits ) |
- |
0 |
|
- |
| Cl.18 (Endurance. ) |
- |
0 |
|
- |
| Cl.19 & IS:302-1:2008(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19 & IS:302-1:2008(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19 & IS:302-1:2008(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19 & IS:302-1:2008(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.101(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.102(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.103(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.104(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.105(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.106(Abnormal Operation.) |
- |
0 |
|
- |
| Table 8 of IS 302-1:2008(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.107(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.108(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.109(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.110(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.111(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.112(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.113(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.19.114(Abnormal Operation.) |
- |
0 |
|
- |
| Cl.20 & IS:302-1:2008(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| Cl.21 & IS:302-1:2008)(Mechanical Strength.) |
- |
0 |
|
- |
| Cl.21.2 of IS 302-1:2008(Mechanical Strength.) |
- |
0 |
|
- |
| Cl.21.101 (Mechanical Strength.) |
- |
0 |
|
- |
| Cl.21.102(Mechanical Strength.) |
- |
0 |
|
- |
| Cl.21.103(Mechanical Strength.) |
- |
0 |
|
- |
| Cl.22.1 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.5 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.6 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.7 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.8 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.9 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.11(Construction) |
- |
0 |
|
- |
| Cl.22.12 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.13 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.14 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.15 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.18 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.20 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22.21 of IS 302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.23 & IS:302-1:2008(Internal Wiring
) |
- |
0 |
|
- |
| Cl.23.4 & Cl.29 of 302-1:2008(Internal Wiring
) |
- |
0 |
|
- |
| Cl.23.5 of 302-1:2008(Internal Wiring
) |
- |
0 |
|
- |
| Cl.23.7 of 302-1:2008(Internal Wiring
) |
- |
0 |
|
- |
| C.23.7 of 302-1:2008(Internal Wiring
) |
- |
0 |
|
- |
| Cl.24.1 of 302-1:2008(Component) |
- |
0 |
|
- |
| Cl.24.1 of 302-1:2008(Component) |
- |
0 |
|
- |
| Cl.24.1.3 (Component) |
- |
0 |
|
- |
| Cl.24.1.3 (Component) |
- |
0 |
|
- |
| Cl.24.1.3 (Component) |
- |
0 |
|
- |
| Cl.24.1.3 (Component) |
- |
0 |
|
- |
| C.24.1.4(Component) |
- |
0 |
|
- |
| C.24.2 of 302-1:2008(Component) |
- |
0 |
|
- |
| Cl.24.10(Component) |
- |
0 |
|
- |
| Cl.25.1 of 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl. 25.2 of IS 3021:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl. 25.3 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.5 of 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.6 of 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.7.(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.8(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl. 25.9(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.10 of 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl. 25.11(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl. 25.12(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl. 25.13(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.14 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.15 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.15 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.17 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.18(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25.20(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.26.1 of IS 302-1:2008(Terminal for External Conductors
) |
- |
0 |
|
- |
| Cl.26.10 of IS 302-1:2008(Terminal for External Conductors
) |
- |
0 |
|
- |
| Cl.26.11 of IS 302-1:2008(Terminal for External Conductors
) |
- |
0 |
|
- |
| Cl.27.1 of 302-1:2008(Provision for Earthing.) |
- |
0 |
|
- |
| Cl.27.5 of 302-1:2008(Provision for Earthing.) |
- |
0 |
|
- |
| Cl.28 of 302-1:2008(Screws and Connections.) |
- |
0 |
|
- |
| Cl.29 & IS:302-1:2008(Clearances, Creepage Distances and Solid Insulation) |
- |
0 |
|
- |
| Cl.29 & IS:302-1:2008(Clearances, Creepage Distances and Solid Insulation) |
- |
0 |
|
- |
| Cl.30 & IS:302-1:2008(Resistance to Heat and Fire) |
- |
0 |
|
- |
| Cl.30.2.2 of 302-1:2008(Resistance to Heat and Fire) |
- |
0 |
|
- |
| Cl.31 & IS:302-1:2008(Resistance to Rusting.) |
- |
0 |
|
- |
| Cl.32 & IS:302-1:2008(Radition,Toxicity and similar Hazards.) |
- |
0 |
|
- |
| Cl. 25.4 of IS 302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
|
- |
-
Included w.e.f 30.01.2026
"19.11.4.1 (Electrostatic discharges)
19.11.4.2 (Radiated fields)
19.11.4.3 (Fast transient bursts)
19.11.4.4 (Surge immunity test)
19.11.4.5 (Injected currents)
19.11.4.6 (Class 3 Voltage dips and interruptions)
19.11.4.7 (Harmonics)" |
| 17 |
IS 8448 (1989) |
Automatic line voltage correctors (Step Type) for domestic use - Specification (First Revision) |
Automatic Iine voltage correctors ( auto-transformers), step type, rated up to and including 5 kVA for single phase operation for use with domestic electrical equipment |
70000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 4.1(Cooling) |
- |
500 |
|
- |
| 5.1(RATINGS : Rated kVA
) |
- |
1000 |
|
- |
| 5.2.1(Rated Voltage : Input Voltage Range
) |
- |
1000 |
|
- |
| 5.2.2(Rated Voltage : Output Voltage Range) |
- |
1000 |
|
- |
| 6.1(CONSTRUCTION) |
- |
500 |
|
- |
| 6.2(CONSTRUCTION) |
- |
500 |
|
- |
| 6.3(CONSTRUCTION) |
- |
500 |
|
- |
| 6.4(CONSTRUCTION) |
- |
500 |
|
- |
| 6.5(CONSTRUCTION) |
- |
500 |
|
- |
| 6.6(CONSTRUCTION) |
- |
500 |
|
- |
| 6.7(CONSTRUCTION) |
- |
500 |
|
- |
| 8 of IS 302:1979( SAFETY REQUIREMENTS : Protection Against Electric Shock) |
- |
2000 |
|
- |
| 13.2 of IS 302:1979( SAFETY REQUIREMENTS : Leakage Current) |
- |
2000 |
|
- |
| 20.1 of IS 302:1979( SAFETY REQUIREMENTS : Stability ) |
- |
2000 |
|
- |
| 21 of IS 302:1979( SAFETY REQUIREMENTS : Mechanical Strength) |
- |
2000 |
|
- |
| 27 of IS 302:1979( SAFETY REQUIREMENTS : Provision for Earthing ) |
- |
2000 |
|
- |
| 28 of IS 302:1979( SAFETY REQUIREMENTS : Screws and Connections ) |
- |
2000 |
|
- |
| 29 of IS 302:1979( SAFETY REQUIREMENTS : Clearances ) |
- |
1000 |
|
- |
| 29 of IS 302:1979( SAFETY REQUIREMENTS : Creepage Distances) |
- |
1000 |
|
- |
| 8.1(LIMITS OF TEMPERATURE-RISE ) |
- |
2000 |
|
- |
| 8.2(LIMITS OF TEMPERATURE-RISE ) |
- |
2000 |
|
- |
| 9.1( PERFORMANCE-REQUIREMENTS ) |
- |
2000 |
|
- |
| 10.1(TERMINAL MARKING ) |
- |
1000 |
|
- |
| 11.1( MARKING : Rating Plate ) |
- |
500 |
|
- |
| 11.1( MARKING : Manufacturer’s name and country of manufacture) |
- |
500 |
|
- |
| 11.1( MARKING : Manufacturer’s serial number land type number) |
- |
500 |
|
- |
| 11.1( MARKING : Rated input voltage range) |
- |
500 |
|
- |
| 11.1( MARKING :Rated output voltage) |
- |
500 |
|
- |
| 11.1( MARKING : Rated frequency ) |
- |
500 |
|
- |
| 11.1( MARKING : Rated output current) |
- |
500 |
|
- |
| 11.1( MARKING : Rated kVA) |
- |
500 |
|
- |
| 11.1( MARKING : Class of insulation.) |
- |
500 |
|
- |
| 12.2(TESTS : Physical examination) |
- |
1000 |
|
- |
| 12.3(TESTS : Output voltage ) |
- |
2000 |
|
- |
| 12.4(TESTS : Insulation resistance) |
- |
2000 |
|
- |
| 12.5(TESTS : High voltage) |
- |
4000 |
|
- |
| 12.6(TESTS : No-load current) |
- |
2000 |
|
- |
| 7.1(TESTS : Protection against electric shock) |
- |
1000 |
|
- |
| 7.3(TESTS : Stability ) |
- |
1000 |
|
- |
| 7.4(TESTS : Mechanical strength ) |
- |
1000 |
|
- |
| 7.5(TESTS : Provision for earthing ) |
- |
2000 |
|
- |
| 7.6(TESTS : Screws and connections ) |
- |
1000 |
|
- |
| 12.7.1( Temperature-rise : Measurment of Temperature of colling Air) |
- |
2000 |
|
- |
| 12.7.2(Temperature-rise : Determination of Winding Temperature ) |
- |
1500 |
|
- |
| 12.7.3(Temperature-rise : Duration of Test of Temperature Rise ) |
- |
1500 |
|
- |
| 12.7.4(Temperature-rise : Leading) |
- |
1500 |
|
- |
| 12.7(Temperature-rise : Temperature Correction for Cooling of Transformer after Shut Down ) |
- |
1500 |
|
- |
| 7.2(TESTS : Leakage current ) |
- |
1000 |
|
- |
| 7.7(TESTS : Creepage distances ) |
- |
1000 |
|
- |
| 7.7(TESTS : clearances ) |
- |
1000 |
|
- |
| 12.8(TESTS : Induced voltage ) |
- |
4000 |
|
- |
| 12.9(TESTS : Damp heat ) |
- |
2500 |
|
- |
| 12.1(TESTS : Stability test for relay operation) |
- |
3000 |
|
- |
| 12.11(TESTS : Test for continuous operation ) |
- |
4500 |
|
- |
| Clause 4(Cooling) |
- |
0 |
|
- |
| Clause 5(Rating) |
- |
0 |
|
- |
| Clause 6(Construction) |
- |
0 |
|
- |
| Clause 7.1(Protection Against
Electric Shock) |
- |
0 |
|
- |
| Clause 7.2(Leakage Current) |
- |
0 |
|
- |
| Clause 7.3(Stability) |
- |
0 |
|
- |
| Clause 7.4(Mechanical Strength) |
- |
0 |
|
- |
| Clause 7.5(Provision for Earthing) |
- |
0 |
|
- |
| Clause 7.6(Screws and Connections) |
- |
0 |
|
- |
| Clause 7.7(Creepage Distances
and Clearances) |
- |
0 |
|
- |
| Clause 8(Limits Of Temperature
rise) |
- |
500 |
|
- |
| Clause 9(Performance Requirement) |
- |
500 |
|
- |
| Clause 10(Terminal Marking) |
- |
500 |
|
- |
| Clause 11(Marking) |
- |
0 |
|
- |
| Clause 12.1(Classification of Tests) |
- |
0 |
|
- |
| Clause 12.2(Physical Examination) |
- |
0 |
|
- |
| Clause 12.3(Output Voltage Test) |
- |
0 |
|
- |
| Clause 12.4(Insulation Resistance
Test) |
- |
0 |
|
- |
| Clause 12.5(High Voltage Test) |
- |
0 |
|
- |
| Clause 12.6(No Load Current Test) |
- |
0 |
|
- |
| Clause 12.7(Temperature-Rise Test) |
- |
0 |
|
- |
| Clause 12.8(Induced Voltage Test) |
- |
0 |
|
- |
| Clause 12.9(Damp Heat Test) |
- |
0 |
|
- |
| Clause 12.10(Stability Test for
Relay Operation) |
- |
0 |
|
- |
| Clause 12.11(Test for Continuous
Operation) |
- |
0 |
|
- |
| 4.1(Cooling) |
- |
0 |
|
- |
| 5.1(RATINGS : Rated kVA
) |
- |
0 |
|
- |
| 5.2.1(Rated Voltage : Input Voltage Range
) |
- |
0 |
|
- |
| 5.2.2(Rated Voltage : Output Voltage Range) |
- |
0 |
|
- |
| 6.1(CONSTRUCTION) |
- |
0 |
|
- |
| 6.2(CONSTRUCTION) |
- |
0 |
|
- |
| 6.3(CONSTRUCTION) |
- |
0 |
|
- |
| 6.4(CONSTRUCTION) |
- |
0 |
|
- |
| 6.5(CONSTRUCTION) |
- |
0 |
|
- |
| 6.6(CONSTRUCTION) |
- |
0 |
|
- |
| 6.7(CONSTRUCTION) |
- |
0 |
|
- |
| 8 of IS 302:1979( SAFETY REQUIREMENTS : Protection Against Electric Shock) |
- |
0 |
|
- |
| 13.2 of IS 302:1979( SAFETY REQUIREMENTS : Leakage Current) |
- |
0 |
|
- |
| 20.1 of IS 302:1979( SAFETY REQUIREMENTS : Stability ) |
- |
0 |
|
- |
| 21 of IS 302:1979( SAFETY REQUIREMENTS : Mechanical Strength) |
- |
0 |
|
- |
| 27 of IS 302:1979( SAFETY REQUIREMENTS : Provision for Earthing ) |
- |
0 |
|
- |
| 28 of IS 302:1979( SAFETY REQUIREMENTS : Screws and Connections ) |
- |
0 |
|
- |
| 29 of IS 302:1979( SAFETY REQUIREMENTS : Clearances ) |
- |
0 |
|
- |
| 29 of IS 302:1979( SAFETY REQUIREMENTS : Creepage Distances) |
- |
0 |
|
- |
| 8.1(LIMITS OF TEMPERATURE-RISE ) |
- |
0 |
|
- |
| 8.2(LIMITS OF TEMPERATURE-RISE ) |
- |
0 |
|
- |
| 9.1( PERFORMANCE-REQUIREMENTS ) |
- |
0 |
|
- |
| 10.1(TERMINAL MARKING ) |
- |
0 |
|
- |
| 11.1( MARKING : Rating Plate ) |
- |
0 |
|
- |
| 11.1( MARKING : Manufacturer’s name and country of manufacture) |
- |
0 |
|
- |
| 11.1( MARKING : Manufacturer’s serial number land type number) |
- |
0 |
|
- |
| 11.1( MARKING : Rated input voltage range) |
- |
0 |
|
- |
| 11.1( MARKING :Rated output voltage) |
- |
0 |
|
- |
| 11.1( MARKING : Rated frequency ) |
- |
0 |
|
- |
| 11.1( MARKING : Rated output current) |
- |
0 |
|
- |
| 11.1( MARKING : Rated kVA) |
- |
0 |
|
- |
| 11.1( MARKING : Class of insulation.) |
- |
0 |
|
- |
| 12.2(TESTS : Physical examination) |
- |
0 |
|
- |
| 12.3(TESTS : Output voltage ) |
- |
0 |
|
- |
| 12.4(TESTS : Insulation resistance) |
- |
0 |
|
- |
| 12.5(TESTS : High voltage) |
- |
0 |
|
- |
| 12.6(TESTS : No-load current) |
- |
0 |
|
- |
| 7.1(TESTS : Protection against electric shock) |
- |
0 |
|
- |
| 7.3(TESTS : Stability ) |
- |
0 |
|
- |
| 7.4(TESTS : Mechanical strength ) |
- |
0 |
|
- |
| 7.5(TESTS : Provision for earthing ) |
- |
0 |
|
- |
| 7.6(TESTS : Screws and connections ) |
- |
0 |
|
- |
| 12.7.1( Temperature-rise : Measurment of Temperature of colling Air) |
- |
0 |
|
- |
| 12.7.2(Temperature-rise : Determination of Winding Temperature ) |
- |
0 |
|
- |
| 12.7.3(Temperature-rise : Duration of Test of Temperature Rise ) |
- |
0 |
|
- |
| 12.7.4(Temperature-rise : Leading) |
- |
0 |
|
- |
| 12.7(Temperature-rise : Temperature Correction for Cooling of Transformer after Shut Down ) |
- |
0 |
|
- |
| 7.2(TESTS : Leakage current ) |
- |
0 |
|
- |
| 7.7(TESTS : Creepage distances ) |
- |
0 |
|
- |
| 7.7(TESTS : clearances ) |
- |
0 |
|
- |
| 12.8(TESTS : Induced voltage ) |
- |
0 |
|
- |
| 12.9(TESTS : Damp heat ) |
- |
0 |
|
- |
| 12.1(TESTS : Stability test for relay operation) |
- |
0 |
|
- |
| 12.11(TESTS : Test for continuous operation ) |
- |
0 |
|
- |
| Clause 4(Cooling) |
- |
0 |
|
- |
| Clause 5(Rating) |
- |
0 |
|
- |
| Clause 6(Construction) |
- |
0 |
|
- |
| Clause 7.1(Protection Against
Electric Shock) |
- |
0 |
|
- |
| Clause 7.2(Leakage Current) |
- |
0 |
|
- |
| Clause 7.3(Stability) |
- |
0 |
|
- |
| Clause 7.4(Mechanical Strength) |
- |
0 |
|
- |
| Clause 7.5(Provision for Earthing) |
- |
0 |
|
- |
| Clause 7.6(Screws and Connections) |
- |
0 |
|
- |
| Clause 7.7(Creepage Distances
and Clearances) |
- |
0 |
|
- |
| Clause 8(Limits Of Temperature
rise) |
- |
0 |
|
- |
| Clause 9(Performance Requirement) |
- |
0 |
|
- |
| Clause 10(Terminal Marking) |
- |
0 |
|
- |
| Clause 11(Marking) |
- |
0 |
|
- |
| Clause 12.1(Classification of Tests) |
- |
0 |
|
- |
| Clause 12.2(Physical Examination) |
- |
0 |
|
- |
| Clause 12.3(Output Voltage Test) |
- |
0 |
|
- |
| Clause 12.4(Insulation Resistance
Test) |
- |
0 |
|
- |
| Clause 12.5(High Voltage Test) |
- |
0 |
|
- |
| Clause 12.6(No Load Current Test) |
- |
0 |
|
- |
| Clause 12.7(Temperature-Rise Test) |
- |
0 |
|
- |
| Clause 12.8(Induced Voltage Test) |
- |
0 |
|
- |
| Clause 12.9(Damp Heat Test) |
- |
0 |
|
- |
| Clause 12.10(Stability Test for
Relay Operation) |
- |
0 |
|
- |
| Clause 12.11(Test for Continuous
Operation) |
- |
0 |
|
- |
| 4.1(Cooling) |
- |
0 |
|
- |
| 5.1(RATINGS : Rated kVA
) |
- |
0 |
|
- |
| 5.2.1(Rated Voltage : Input Voltage Range
) |
- |
0 |
|
- |
| 5.2.2(Rated Voltage : Output Voltage Range) |
- |
0 |
|
- |
| 6.1(CONSTRUCTION) |
- |
0 |
|
- |
| 6.2(CONSTRUCTION) |
- |
0 |
|
- |
| 6.3(CONSTRUCTION) |
- |
0 |
|
- |
| 6.4(CONSTRUCTION) |
- |
0 |
|
- |
| 6.5(CONSTRUCTION) |
- |
0 |
|
- |
| 6.6(CONSTRUCTION) |
- |
0 |
|
- |
| 6.7(CONSTRUCTION) |
- |
0 |
|
- |
| 8 of IS 302:1979( SAFETY REQUIREMENTS : Protection Against Electric Shock) |
- |
0 |
|
- |
| 13.2 of IS 302:1979( SAFETY REQUIREMENTS : Leakage Current) |
- |
0 |
|
- |
| 20.1 of IS 302:1979( SAFETY REQUIREMENTS : Stability ) |
- |
0 |
|
- |
| 21 of IS 302:1979( SAFETY REQUIREMENTS : Mechanical Strength) |
- |
0 |
|
- |
| 27 of IS 302:1979( SAFETY REQUIREMENTS : Provision for Earthing ) |
- |
0 |
|
- |
| 28 of IS 302:1979( SAFETY REQUIREMENTS : Screws and Connections ) |
- |
0 |
|
- |
| 29 of IS 302:1979( SAFETY REQUIREMENTS : Clearances ) |
- |
0 |
|
- |
| 29 of IS 302:1979( SAFETY REQUIREMENTS : Creepage Distances) |
- |
0 |
|
- |
| 8.1(LIMITS OF TEMPERATURE-RISE ) |
- |
0 |
|
- |
| 8.2(LIMITS OF TEMPERATURE-RISE ) |
- |
0 |
|
- |
| 9.1( PERFORMANCE-REQUIREMENTS ) |
- |
0 |
|
- |
| 10.1(TERMINAL MARKING ) |
- |
0 |
|
- |
| 11.1( MARKING : Rating Plate ) |
- |
0 |
|
- |
| 11.1( MARKING : Manufacturer’s name and country of manufacture) |
- |
0 |
|
- |
| 11.1( MARKING : Manufacturer’s serial number land type number) |
- |
0 |
|
- |
| 11.1( MARKING : Rated input voltage range) |
- |
0 |
|
- |
| 11.1( MARKING :Rated output voltage) |
- |
0 |
|
- |
| 11.1( MARKING : Rated frequency ) |
- |
0 |
|
- |
| 11.1( MARKING : Rated output current) |
- |
0 |
|
- |
| 11.1( MARKING : Rated kVA) |
- |
0 |
|
- |
| 11.1( MARKING : Class of insulation.) |
- |
0 |
|
- |
| 12.2(TESTS : Physical examination) |
- |
0 |
|
- |
| 12.3(TESTS : Output voltage ) |
- |
0 |
|
- |
| 12.4(TESTS : Insulation resistance) |
- |
0 |
|
- |
| 12.5(TESTS : High voltage) |
- |
0 |
|
- |
| 12.6(TESTS : No-load current) |
- |
0 |
|
- |
| 7.1(TESTS : Protection against electric shock) |
- |
0 |
|
- |
| 7.3(TESTS : Stability ) |
- |
0 |
|
- |
| 7.4(TESTS : Mechanical strength ) |
- |
0 |
|
- |
| 7.5(TESTS : Provision for earthing ) |
- |
0 |
|
- |
| 7.6(TESTS : Screws and connections ) |
- |
0 |
|
- |
| 12.7.1( Temperature-rise : Measurment of Temperature of colling Air) |
- |
0 |
|
- |
| 12.7.2(Temperature-rise : Determination of Winding Temperature ) |
- |
0 |
|
- |
| 12.7.3(Temperature-rise : Duration of Test of Temperature Rise ) |
- |
0 |
|
- |
| 12.7.4(Temperature-rise : Leading) |
- |
0 |
|
- |
| 12.7(Temperature-rise : Temperature Correction for Cooling of Transformer after Shut Down ) |
- |
0 |
|
- |
| 7.2(TESTS : Leakage current ) |
- |
0 |
|
- |
| 7.7(TESTS : Creepage distances ) |
- |
0 |
|
- |
| 7.7(TESTS : clearances ) |
- |
0 |
|
- |
| 12.8(TESTS : Induced voltage ) |
- |
0 |
|
- |
| 12.9(TESTS : Damp heat ) |
- |
0 |
|
- |
| 12.1(TESTS : Stability test for relay operation) |
- |
0 |
|
- |
| 12.11(TESTS : Test for continuous operation ) |
- |
0 |
|
- |
| Clause 4(Cooling) |
- |
0 |
|
- |
| Clause 5(Rating) |
- |
0 |
|
- |
| Clause 6(Construction) |
- |
0 |
|
- |
| Clause 7.1(Protection Against
Electric Shock) |
- |
0 |
|
- |
| Clause 7.2(Leakage Current) |
- |
0 |
|
- |
| Clause 7.3(Stability) |
- |
0 |
|
- |
| Clause 7.4(Mechanical Strength) |
- |
0 |
|
- |
| Clause 7.5(Provision for Earthing) |
- |
0 |
|
- |
| Clause 7.6(Screws and Connections) |
- |
0 |
|
- |
| Clause 7.7(Creepage Distances
and Clearances) |
- |
0 |
|
- |
| Clause 8(Limits Of Temperature
rise) |
- |
0 |
|
- |
| Clause 9(Performance Requirement) |
- |
0 |
|
- |
| Clause 10(Terminal Marking) |
- |
0 |
|
- |
| Clause 11(Marking) |
- |
0 |
|
- |
| Clause 12.1(Classification of Tests) |
- |
0 |
|
- |
| Clause 12.2(Physical Examination) |
- |
0 |
|
- |
| Clause 12.3(Output Voltage Test) |
- |
0 |
|
- |
| Clause 12.4(Insulation Resistance
Test) |
- |
0 |
|
- |
| Clause 12.5(High Voltage Test) |
- |
0 |
|
- |
| Clause 12.6(No Load Current Test) |
- |
0 |
|
- |
| Clause 12.7(Temperature-Rise Test) |
- |
0 |
|
- |
| Clause 12.8(Induced Voltage Test) |
- |
0 |
|
- |
| Clause 12.9(Damp Heat Test) |
- |
0 |
|
- |
| Clause 12.10(Stability Test for
Relay Operation) |
- |
0 |
|
- |
| Clause 12.11(Test for Continuous
Operation) |
- |
0 |
|
- |
| 4.1(Cooling) |
- |
0 |
|
- |
| 5.1(RATINGS : Rated kVA
) |
- |
0 |
|
- |
| 5.2.1(Rated Voltage : Input Voltage Range
) |
- |
0 |
|
- |
| 5.2.2(Rated Voltage : Output Voltage Range) |
- |
0 |
|
- |
| 6.1(CONSTRUCTION) |
- |
0 |
|
- |
| 6.2(CONSTRUCTION) |
- |
0 |
|
- |
| 6.3(CONSTRUCTION) |
- |
0 |
|
- |
| 6.4(CONSTRUCTION) |
- |
0 |
|
- |
| 6.5(CONSTRUCTION) |
- |
0 |
|
- |
| 6.6(CONSTRUCTION) |
- |
0 |
|
- |
| 6.7(CONSTRUCTION) |
- |
0 |
|
- |
| 8 of IS 302:1979( SAFETY REQUIREMENTS : Protection Against Electric Shock) |
- |
0 |
|
- |
| 13.2 of IS 302:1979( SAFETY REQUIREMENTS : Leakage Current) |
- |
0 |
|
- |
| 20.1 of IS 302:1979( SAFETY REQUIREMENTS : Stability ) |
- |
0 |
|
- |
| 21 of IS 302:1979( SAFETY REQUIREMENTS : Mechanical Strength) |
- |
0 |
|
- |
| 27 of IS 302:1979( SAFETY REQUIREMENTS : Provision for Earthing ) |
- |
0 |
|
- |
| 28 of IS 302:1979( SAFETY REQUIREMENTS : Screws and Connections ) |
- |
0 |
|
- |
| 29 of IS 302:1979( SAFETY REQUIREMENTS : Clearances ) |
- |
0 |
|
- |
| 29 of IS 302:1979( SAFETY REQUIREMENTS : Creepage Distances) |
- |
0 |
|
- |
| 8.1(LIMITS OF TEMPERATURE-RISE ) |
- |
0 |
|
- |
| 8.2(LIMITS OF TEMPERATURE-RISE ) |
- |
0 |
|
- |
| 9.1( PERFORMANCE-REQUIREMENTS ) |
- |
0 |
|
- |
| 10.1(TERMINAL MARKING ) |
- |
0 |
|
- |
| 11.1( MARKING : Rating Plate ) |
- |
0 |
|
- |
| 11.1( MARKING : Manufacturer’s name and country of manufacture) |
- |
0 |
|
- |
| 11.1( MARKING : Manufacturer’s serial number land type number) |
- |
0 |
|
- |
| 11.1( MARKING : Rated input voltage range) |
- |
0 |
|
- |
| 11.1( MARKING :Rated output voltage) |
- |
0 |
|
- |
| 11.1( MARKING : Rated frequency ) |
- |
0 |
|
- |
| 11.1( MARKING : Rated output current) |
- |
0 |
|
- |
| 11.1( MARKING : Rated kVA) |
- |
0 |
|
- |
| 11.1( MARKING : Class of insulation.) |
- |
0 |
|
- |
| 12.2(TESTS : Physical examination) |
- |
0 |
|
- |
| 12.3(TESTS : Output voltage ) |
- |
0 |
|
- |
| 12.4(TESTS : Insulation resistance) |
- |
0 |
|
- |
| 12.5(TESTS : High voltage) |
- |
0 |
|
- |
| 12.6(TESTS : No-load current) |
- |
0 |
|
- |
| 7.1(TESTS : Protection against electric shock) |
- |
0 |
|
- |
| 7.3(TESTS : Stability ) |
- |
0 |
|
- |
| 7.4(TESTS : Mechanical strength ) |
- |
0 |
|
- |
| 7.5(TESTS : Provision for earthing ) |
- |
0 |
|
- |
| 7.6(TESTS : Screws and connections ) |
- |
0 |
|
- |
| 12.7.1( Temperature-rise : Measurment of Temperature of colling Air) |
- |
0 |
|
- |
| 12.7.2(Temperature-rise : Determination of Winding Temperature ) |
- |
0 |
|
- |
| 12.7.3(Temperature-rise : Duration of Test of Temperature Rise ) |
- |
0 |
|
- |
| 12.7.4(Temperature-rise : Leading) |
- |
0 |
|
- |
| 12.7(Temperature-rise : Temperature Correction for Cooling of Transformer after Shut Down ) |
- |
0 |
|
- |
| 7.2(TESTS : Leakage current ) |
- |
0 |
|
- |
| 7.7(TESTS : Creepage distances ) |
- |
0 |
|
- |
| 7.7(TESTS : clearances ) |
- |
0 |
|
- |
| 12.8(TESTS : Induced voltage ) |
- |
0 |
|
- |
| 12.9(TESTS : Damp heat ) |
- |
0 |
|
- |
| 12.1(TESTS : Stability test for relay operation) |
- |
0 |
|
- |
| 12.11(TESTS : Test for continuous operation ) |
- |
0 |
|
- |
| Clause 4(Cooling) |
- |
0 |
|
- |
| Clause 5(Rating) |
- |
0 |
|
- |
| Clause 6(Construction) |
- |
0 |
|
- |
| Clause 7.1(Protection Against
Electric Shock) |
- |
0 |
|
- |
| Clause 7.2(Leakage Current) |
- |
0 |
|
- |
| Clause 7.3(Stability) |
- |
0 |
|
- |
| Clause 7.4(Mechanical Strength) |
- |
0 |
|
- |
| Clause 7.5(Provision for Earthing) |
- |
0 |
|
- |
| Clause 7.6(Screws and Connections) |
- |
0 |
|
- |
| Clause 7.7(Creepage Distances
and Clearances) |
- |
0 |
|
- |
| Clause 8(Limits Of Temperature
rise) |
- |
0 |
|
- |
| Clause 9(Performance Requirement) |
- |
0 |
|
- |
| Clause 10(Terminal Marking) |
- |
0 |
|
- |
| Clause 11(Marking) |
- |
0 |
|
- |
| Clause 12.1(Classification of Tests) |
- |
0 |
|
- |
| Clause 12.2(Physical Examination) |
- |
0 |
|
- |
| Clause 12.3(Output Voltage Test) |
- |
0 |
|
- |
| Clause 12.4(Insulation Resistance
Test) |
- |
0 |
|
- |
| Clause 12.5(High Voltage Test) |
- |
0 |
|
- |
| Clause 12.6(No Load Current Test) |
- |
0 |
|
- |
| Clause 12.7(Temperature-Rise Test) |
- |
0 |
|
- |
| Clause 12.8(Induced Voltage Test) |
- |
0 |
|
- |
| Clause 12.9(Damp Heat Test) |
- |
0 |
|
- |
| Clause 12.10(Stability Test for
Relay Operation) |
- |
0 |
|
- |
| Clause 12.11(Test for Continuous
Operation) |
- |
0 |
|
- |
|
- |
-
included w.e.f 05.01.2026 |
| 18 |
IS 2993 (1998) |
A.C. motor capacitors (Second Revision) |
- |
400000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 2.6(Visual Examination) |
- |
5000 |
|
- |
| 5.1(Check marking) |
- |
10000 |
|
- |
| 2.1(Check of dimensions) |
- |
10000 |
|
- |
| 2.9(Capacitance measurement) |
- |
10000 |
|
- |
| 2.11.1(Robustness of terminations) |
- |
10000 |
|
- |
| 2.11.1.1(Tensile) |
- |
10000 |
|
- |
| 2.11.1.2(Bending (half cf the terminations)) |
- |
5000 |
|
- |
| 2.11 .1.3(Torsion (other half of the terminations)) |
- |
5000 |
|
- |
| 2.11.1.4(Torque (screw terminals)) |
- |
5000 |
|
- |
| 2.11.1.5(Visual Examination) |
- |
5000 |
|
- |
| 2.11.2(Soldering) |
- |
5000 |
|
- |
| 2.11.3(Vibration) |
- |
10000 |
|
- |
| 2.11.4(fixing bolt or stud (if fitted)) |
- |
5000 |
|
- |
| 2.12(Sealing Test) |
- |
10000 |
|
- |
| 2.13(Endurance test) |
- |
20000 |
|
- |
| 2.13.1(Endurance test :Testing in air with forced circulation) |
- |
15000 |
|
- |
| 2.13.3(Endurance test : Conditions of compliance) |
- |
10000 |
|
- |
| 2.5(Tangent of loss angle) |
- |
10000 |
|
- |
| 2.16.4(Destruction tes: Evaluation of the failure ) |
- |
5000 |
|
- |
| 2.10(Check of dimensions) |
- |
5000 |
|
- |
| 2.11.1.1(Test Ua - Tensile) |
- |
10000 |
|
- |
| 2.11.1.2(Test Ub - Bending (half of the terminations)) |
- |
10000 |
|
- |
| 2.11.1.3 (Elec)(Torsion (other half of the terminations)) |
- |
10000 |
|
- |
| 2.11.1.4(Test Ud - Torque (screw terminals)) |
- |
10000 |
|
- |
| 2.11.1.5(Visual examination) |
- |
5000 |
|
- |
| 2.11.2(Soldering) |
- |
5000 |
|
- |
| 2.11.3 (Elec)(Vibration) |
- |
10000 |
|
- |
| 4.1(Creepage distances and clearances) |
- |
5000 |
|
- |
| 4.2(Terminals and connecting cables) |
- |
10000 |
|
- |
| 4.3(Earth connections) |
- |
5000 |
|
- |
| 4.4(Discharge devices) |
- |
10000 |
|
- |
| 2.10 (Elec)(Check of dimensions) |
- |
10000 |
|
- |
| 2.11.1 (Elec)(Robustness of terminations) |
- |
5000 |
|
- |
| 2.11.1.1 (Elec)(Tensile) |
- |
10000 |
|
- |
| 2.11.1.2 (Elec)(Bending (half cf the terminations)) |
- |
10000 |
|
- |
| 2.11.1.4 (Elec)(Torque (screw terminals)) |
- |
10000 |
|
- |
| 2.11.1.5 (Elec)(Visual Examination) |
- |
10000 |
|
- |
| 2.11.2 (Elec)(Soldering) |
- |
5000 |
|
- |
| 2.11.4 (Elec)(fixing bolt or stud (if fitted)) |
- |
10000 |
|
- |
| 2.14(Damping heat test) |
- |
20000 |
|
- |
| 2.15(Self-healing test (if applicable)) |
- |
10000 |
|
- |
| 2.16.3(Destruction test : Test procedure) |
- |
5000 |
|
- |
| 2.16.3.1(Destruction test : Test procedure - Preparation and pre-conditioning ) |
- |
10000 |
|
- |
| 2.16.3.2(Destruction test : Test procedure : DC conditioning) |
- |
5000 |
|
- |
| 2.16.3.3(Destruction test : Test procedure : AC destruction test) |
- |
10000 |
|
- |
| 2.7(Voltage test between terminals) |
- |
10000 |
|
- |
| 2.8(Voltage test between terminals and case) |
- |
5000 |
|
- |
| 2.11.1.3(Test UC - Torsion (other half of the terminations)) |
- |
5000 |
|
- |
| 2.11.3(Vibration) |
- |
5000 |
|
- |
| 2.11.4(Fixing bolt or stud (if fitted)) |
- |
5000 |
|
- |
|
- |
-
included w.e.f 14.01.2026 |
| 19 |
IS 4246 (2025) |
DOMESTIC GAS STOVE AND BUILT IN HOB FOR USE WITH LPG SPECIFICATION (Sixth Revision ) |
All |
25000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 4.1(General - IS 4246 : 2025) |
- |
500 |
|
- |
| 4.1(General - IS 4246 : 2025) |
- |
500 |
|
- |
| 4.1.1(General - IS 4246 : 2025) |
- |
500 |
|
- |
| 5(Materials - Cl. 5 of IS 5116) |
- |
500 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
500 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
500 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
500 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
500 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
500 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
500 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
500 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
500 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
500 |
|
- |
| 5.1(Materials - IS 5116) |
- |
500 |
|
- |
| 5.1(Materials - IS 5116) |
- |
500 |
|
- |
| 5.1.1(Materials - IS 5116) |
- |
500 |
|
- |
| 5.1.1(Materials - IS 5116) |
- |
500 |
|
- |
| 5.2(Materials - IS 5116) |
- |
500 |
|
- |
| 5.2(Materials - IS 5116) |
- |
500 |
|
- |
| 5.3(Materials - IS 5116) |
- |
500 |
|
- |
| 5.5(Materials - IS 5116) |
- |
500 |
|
- |
| 5.5(Materials - IS 5116) |
- |
500 |
|
- |
| 5.5(Materials - IS 5116) |
- |
500 |
|
- |
| 5.7(Materials - IS 5116) |
- |
500 |
|
- |
| 6.1(Design for Maintainance) |
- |
500 |
|
- |
| 6.1(Design for Maintainance) |
- |
500 |
|
- |
| 6.2(Design for Maintainance) |
- |
500 |
|
- |
| 6.2(Design for Maintainance) |
- |
500 |
|
- |
| 6.3(Design for Maintainance) |
- |
500 |
|
- |
| 6.4(Design for Maintainance) |
- |
500 |
|
- |
| 6.5(Design for Maintainance) |
- |
500 |
|
- |
| 6.6(Design for Maintainance) |
- |
500 |
|
- |
| 7.0(Rigidity and Stability) |
- |
500 |
|
- |
| 7.1(Rigidity and Stability) |
- |
500 |
|
- |
| 7.2(Rigidity and Stability) |
- |
500 |
|
- |
| 7.3(Rigidity and Stability) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.2(Workmanship and Finish -) |
- |
500 |
|
- |
| 8.3(Workmanship and Finish -) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
1000 |
|
- |
| 10(Injector Jets) |
- |
500 |
|
- |
| 10(Injector Jets) |
- |
500 |
|
- |
| 10(Injector Jets) |
- |
500 |
|
- |
| 10(Injector Jets) |
- |
500 |
|
- |
| 10(Injector Jets) |
- |
500 |
|
- |
| 10(Injector Jets) |
- |
500 |
|
- |
| 11.1(Burners- Cl. 10 of IS 5116) |
- |
500 |
|
- |
| 11.1(Burners- Cl. 10 of IS 5116) |
- |
500 |
|
- |
| 11.1(Burners- Cl. 10 of IS 5116) |
- |
500 |
|
- |
| 11.1(Burners- Cl. 10 of IS 5116) |
- |
500 |
|
- |
| 11.1(Burners- Cl. 10 of IS 5116) |
- |
500 |
|
- |
| 11.2(Burners) |
- |
500 |
|
- |
| 11.3(Burners) |
- |
500 |
|
- |
| 11.4(Burners) |
- |
500 |
|
- |
| 12.1(Burner Pan Support) |
- |
500 |
|
- |
| 12.2(Burner Pan Support) |
- |
500 |
|
- |
| 12.3(Burner Pan Support) |
- |
500 |
|
- |
| 13.1(Gas Soundness Test - Cl. 16 of IS 5116) |
- |
500 |
|
- |
| 13,2(Gas Soundness Test) |
- |
500 |
|
- |
| 13.2(Gas Leak Detector) |
- |
500 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
500 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
500 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
500 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
500 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
500 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
500 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
500 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
500 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
500 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
500 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
500 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
500 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
500 |
|
- |
| 14.2(Gas Inlet Connection) |
- |
500 |
|
- |
| 14.2(Gas Inlet Connection) |
- |
500 |
|
- |
| 14.2(Gas Inlet Connection) |
- |
500 |
|
- |
| 14.2(Gas Inlet Connection) |
- |
500 |
|
- |
| 14.3(Gas Inlet Connection) |
- |
500 |
|
- |
| 14.4(Gas Inlet Connection) |
- |
500 |
|
- |
| 14.5(Gas Inlet Connection - Cl. 17.3 of IS 5116) |
- |
500 |
|
- |
| 14.6(Gas Inlet Connection) |
- |
500 |
|
- |
| 15.0(Strength and Rigidity) |
- |
1000 |
|
- |
| 15.0(Strength and Rigidity) |
- |
1000 |
|
- |
| 15.0(Strength and Rigidity) |
- |
1000 |
|
- |
| 15.0(Strength and Rigidity) |
- |
1000 |
|
- |
| 17.0(Gas Consumption Test) |
- |
1500 |
|
- |
| 17.0(Gas Consumption Test) |
- |
1500 |
|
- |
| 17.0(Gas Consumption Test) |
- |
1500 |
|
- |
| 17.0(Gas Consumption Test) |
- |
1500 |
|
- |
| 17.0(Gas Consumption Test) |
- |
1500 |
|
- |
| 17.0(Gas Consumption Test) |
- |
1500 |
|
- |
| 17.2(Gas Consumption Test - For Gas Stoves) |
- |
1500 |
|
- |
| 17.2 (a)(Gas Consumption Test - For Gas Stoves) |
- |
1500 |
|
- |
| 17.2 (b)(Gas Consumption Test - For Gas Stoves) |
- |
1500 |
|
- |
| 17.2 (c)(Gas Consumption Test - For Gas Stoves) |
- |
1500 |
|
- |
| 17.3(Gas Consumption Test - For Built in Hobs) |
- |
1500 |
|
- |
| 17.3.1(Gas Consumption Test - For Built in Hobs) |
- |
1500 |
|
- |
| 17.3.2(Gas Consumption Test - For Built in Hobs) |
- |
1500 |
|
- |
| 18.1(Ignition and Flame Travel) |
- |
1000 |
|
- |
| 18.1(Ignition and Flame Travel) |
- |
1000 |
|
- |
| 18.2(Ignition and Flame Travel) |
- |
1000 |
|
- |
| 18.3(Ignition and Flame Travel) |
- |
1000 |
|
- |
| 18.4(Ignition and Flame Travel - Cl. 14 of IS 5116) |
- |
1000 |
|
- |
| 18.4(Ignition and Flame Travel - Cl. 14 of IS 5116) |
- |
1000 |
|
- |
| 18.4(Ignition and Flame Travel - Cl. 14 of IS 5116) |
- |
1000 |
|
- |
| 18.4(Ignition and Flame Travel - Cl. 14 of IS 5116) |
- |
1000 |
|
- |
| 18.4(Ignition and Flame Travel - Cl. 14 of IS 5116) |
- |
1000 |
|
- |
| 18.4(Ignition and Flame Travel - Cl. 14 of IS 5116) |
- |
1000 |
|
- |
| 19.1(Flame Stability) |
- |
1000 |
|
- |
| 19.1.1(Flame Stability) |
- |
1000 |
|
- |
| 19.2(Flame Stability) |
- |
1000 |
|
- |
| 19.3(Flame Stability) |
- |
1000 |
|
- |
| 20(Noise Control) |
- |
500 |
|
- |
| 21(Flash Back) |
- |
500 |
|
- |
| 22(Formation of Soot) |
- |
500 |
|
- |
| 23(Resistance to Draught) |
- |
1000 |
|
- |
| 24.1(Combustion) |
- |
1000 |
|
- |
| 24.1(Combustion) |
- |
1000 |
|
- |
| 24.2(Combustion) |
- |
1000 |
|
- |
| 25.1(Fire Hazard and Limiting Temperatures) |
- |
1500 |
|
- |
| 25.1(Fire Hazard and Limiting Temperatures) |
- |
1500 |
|
- |
| 25.1(Fire Hazard and Limiting Temperatures) |
- |
1500 |
|
- |
| 25.1(Fire Hazard and Limiting Temperatures) |
- |
1500 |
|
- |
| 25.2(Fire Hazard and Limiting Temperatures) |
- |
1500 |
|
- |
| 26.1(Thermal Efficiency- Gas Stoves) |
- |
2000 |
|
- |
| 26.1(Thermal Efficiency- Gas Stoves) |
- |
2000 |
|
- |
| 26.1(Thermal Efficiency- Gas Stoves) |
- |
2000 |
|
- |
| 26.1(Thermal Efficiency- Gas Stoves) |
- |
2000 |
|
- |
| 26.1(Thermal Efficiency- Gas Stoves) |
- |
2000 |
|
- |
| 26.2(Thermal Efficiency- For Built in Hobs) |
- |
2000 |
|
- |
| 26.2(Thermal Efficiency- For Built in Hobs) |
- |
2000 |
|
- |
| 26.2(Thermal Efficiency- For Built in Hobs) |
- |
2000 |
|
- |
| 26.2(Thermal Efficiency- For Built in Hobs) |
- |
2000 |
|
- |
| 26.2(Thermal Efficiency- For Built in Hobs) |
- |
2000 |
|
- |
| 4.1(General - IS 4246 : 2025) |
- |
500 |
|
- |
| 4.1(General - IS 4246 : 2025) |
- |
500 |
|
- |
| 4.1.1(General - IS 4246 : 2025) |
- |
500 |
|
- |
| 5(Materials - Cl. 5 of IS 5116) |
- |
500 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
500 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
500 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
500 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
500 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
500 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
500 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
500 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
500 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
500 |
|
- |
| 5.1(Materials - IS 5116) |
- |
500 |
|
- |
| 5.1(Materials - IS 5116) |
- |
500 |
|
- |
| 5.1.1(Materials - IS 5116) |
- |
500 |
|
- |
| 5.1.1(Materials - IS 5116) |
- |
500 |
|
- |
| 5.2(Materials - IS 5116) |
- |
500 |
|
- |
| 5.2(Materials - IS 5116) |
- |
500 |
|
- |
| 5.3(Materials - IS 5116) |
- |
500 |
|
- |
| 5.5(Materials - IS 5116) |
- |
500 |
|
- |
| 5.5(Materials - IS 5116) |
- |
500 |
|
- |
| 5.5(Materials - IS 5116) |
- |
500 |
|
- |
| 5.7(Materials - IS 5116) |
- |
500 |
|
- |
| 6.1(Design for Maintainance) |
- |
500 |
|
- |
| 6.1(Design for Maintainance) |
- |
500 |
|
- |
| 6.2(Design for Maintainance) |
- |
500 |
|
- |
| 6.2(Design for Maintainance) |
- |
500 |
|
- |
| 6.3(Design for Maintainance) |
- |
500 |
|
- |
| 6.4(Design for Maintainance) |
- |
500 |
|
- |
| 6.5(Design for Maintainance) |
- |
500 |
|
- |
| 6.6(Design for Maintainance) |
- |
500 |
|
- |
| 7.0(Rigidity and Stability) |
- |
500 |
|
- |
| 7.1(Rigidity and Stability) |
- |
500 |
|
- |
| 7.2(Rigidity and Stability) |
- |
500 |
|
- |
| 7.3(Rigidity and Stability) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
500 |
|
- |
| 8.2(Workmanship and Finish -) |
- |
500 |
|
- |
| 8.3(Workmanship and Finish -) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
500 |
|
- |
| 10(Injector Jets) |
- |
1000 |
|
- |
| 10(Injector Jets) |
- |
1000 |
|
- |
| 10(Injector Jets) |
- |
1000 |
|
- |
| 10(Injector Jets) |
- |
1000 |
|
- |
| 10(Injector Jets) |
- |
1000 |
|
- |
| 10(Injector Jets) |
- |
1000 |
|
- |
| 11.1(Burners- Cl. 10 of IS 5116) |
- |
1000 |
|
- |
| 11.1(Burners- Cl. 10 of IS 5116) |
- |
1000 |
|
- |
| 11.1(Burners- Cl. 10 of IS 5116) |
- |
1000 |
|
- |
| 11.1(Burners- Cl. 10 of IS 5116) |
- |
1000 |
|
- |
| 11.1(Burners- Cl. 10 of IS 5116) |
- |
1000 |
|
- |
| 11.2(Burners) |
- |
1000 |
|
- |
| 11.3(Burners) |
- |
1000 |
|
- |
| 11.4(Burners) |
- |
1000 |
|
- |
| 12.1(Burner Pan Support) |
- |
1000 |
|
- |
| 12.2(Burner Pan Support) |
- |
1000 |
|
- |
| 12.3(Burner Pan Support) |
- |
1000 |
|
- |
| 13.1(Gas Soundness Test - Cl. 16 of IS 5116) |
- |
1000 |
|
- |
| 13,2(Gas Soundness Test) |
- |
1000 |
|
- |
| 13.2(Gas Leak Detector) |
- |
1000 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
1000 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
1000 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
1000 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
1000 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
1000 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
1000 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
1000 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
1000 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
1000 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
1000 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
1000 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
1000 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
1000 |
|
- |
| 14.2(Gas Inlet Connection) |
- |
1000 |
|
- |
| 14.2(Gas Inlet Connection) |
- |
1000 |
|
- |
| 14.2(Gas Inlet Connection) |
- |
1000 |
|
- |
| 14.2(Gas Inlet Connection) |
- |
1000 |
|
- |
| 14.3(Gas Inlet Connection) |
- |
1000 |
|
- |
| 14.4(Gas Inlet Connection) |
- |
1000 |
|
- |
| 14.5(Gas Inlet Connection - Cl. 17.3 of IS 5116) |
- |
1000 |
|
- |
| 14.6(Gas Inlet Connection) |
- |
1000 |
|
- |
| 15.0(Strength and Rigidity) |
- |
1000 |
|
- |
| 15.0(Strength and Rigidity) |
- |
1000 |
|
- |
| 15.0(Strength and Rigidity) |
- |
1000 |
|
- |
| 15.0(Strength and Rigidity) |
- |
1000 |
|
- |
| 17.0(Gas Consumption Test) |
- |
2000 |
|
- |
| 17.0(Gas Consumption Test) |
- |
2000 |
|
- |
| 17.0(Gas Consumption Test) |
- |
2000 |
|
- |
| 17.0(Gas Consumption Test) |
- |
2000 |
|
- |
| 17.0(Gas Consumption Test) |
- |
2000 |
|
- |
| 17.0(Gas Consumption Test) |
- |
2000 |
|
- |
| 17.2(Gas Consumption Test - For Gas Stoves) |
- |
2000 |
|
- |
| 17.2 (a)(Gas Consumption Test - For Gas Stoves) |
- |
2000 |
|
- |
| 17.2 (b)(Gas Consumption Test - For Gas Stoves) |
- |
2000 |
|
- |
| 17.2 (c)(Gas Consumption Test - For Gas Stoves) |
- |
2000 |
|
- |
| 17.3(Gas Consumption Test - For Built in Hobs) |
- |
2000 |
|
- |
| 17.3.1(Gas Consumption Test - For Built in Hobs) |
- |
2000 |
|
- |
| 17.3.2(Gas Consumption Test - For Built in Hobs) |
- |
2000 |
|
- |
| 18.1(Ignition and Flame Travel) |
- |
1500 |
|
- |
| 18.1(Ignition and Flame Travel) |
- |
1500 |
|
- |
| 18.2(Ignition and Flame Travel) |
- |
1500 |
|
- |
| 18.3(Ignition and Flame Travel) |
- |
1500 |
|
- |
| 18.4(Ignition and Flame Travel - Cl. 14 of IS 5116) |
- |
1500 |
|
- |
| 18.4(Ignition and Flame Travel - Cl. 14 of IS 5116) |
- |
1500 |
|
- |
| 18.4(Ignition and Flame Travel - Cl. 14 of IS 5116) |
- |
1500 |
|
- |
| 18.4(Ignition and Flame Travel - Cl. 14 of IS 5116) |
- |
1500 |
|
- |
| 18.4(Ignition and Flame Travel - Cl. 14 of IS 5116) |
- |
1500 |
|
- |
| 18.4(Ignition and Flame Travel - Cl. 14 of IS 5116) |
- |
1500 |
|
- |
| 19.1(Flame Stability) |
- |
1000 |
|
- |
| 19.1.1(Flame Stability) |
- |
1000 |
|
- |
| 19.2(Flame Stability) |
- |
1000 |
|
- |
| 19.3(Flame Stability) |
- |
1000 |
|
- |
| 20(Noise Control) |
- |
1000 |
|
- |
| 21(Flash Back) |
- |
1000 |
|
- |
| 22(Formation of Soot) |
- |
1000 |
|
- |
| 23(Resistance to Draught) |
- |
1000 |
|
- |
| 24.1(Combustion) |
- |
1500 |
|
- |
| 24.1(Combustion) |
- |
1500 |
|
- |
| 24.2(Combustion) |
- |
1500 |
|
- |
| 25.1(Fire Hazard and Limiting Temperatures) |
- |
2500 |
|
- |
| 25.1(Fire Hazard and Limiting Temperatures) |
- |
2500 |
|
- |
| 25.1(Fire Hazard and Limiting Temperatures) |
- |
2500 |
|
- |
| 25.1(Fire Hazard and Limiting Temperatures) |
- |
2500 |
|
- |
| 25.2(Fire Hazard and Limiting Temperatures) |
- |
2500 |
|
- |
| 26.1(Thermal Efficiency- Gas Stoves) |
- |
3000 |
|
- |
| 26.1(Thermal Efficiency- Gas Stoves) |
- |
3000 |
|
- |
| 26.1(Thermal Efficiency- Gas Stoves) |
- |
300 |
|
- |
| 26.1(Thermal Efficiency- Gas Stoves) |
- |
2000 |
|
- |
| 26.1(Thermal Efficiency- Gas Stoves) |
- |
2000 |
|
- |
| 26.2(Thermal Efficiency- For Built in Hobs) |
- |
2000 |
|
- |
| 26.2(Thermal Efficiency- For Built in Hobs) |
- |
2000 |
|
- |
| 26.2(Thermal Efficiency- For Built in Hobs) |
- |
2000 |
|
- |
| 26.2(Thermal Efficiency- For Built in Hobs) |
- |
2000 |
|
- |
| 26.2(Thermal Efficiency- For Built in Hobs) |
- |
2000 |
|
- |
| 4.1(General - IS 4246 : 2025) |
- |
0 |
|
- |
| 4.1(General - IS 4246 : 2025) |
- |
0 |
|
- |
| 4.1.1(General - IS 4246 : 2025) |
- |
0 |
|
- |
| 5(Materials - Cl. 5 of IS 5116) |
- |
0 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
0 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
0 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
0 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
0 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
0 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
0 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
0 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
0 |
|
- |
| 5.1.1(Materials - Toughened glass, if provided,) |
- |
0 |
|
- |
| 5.1(Materials - IS 5116) |
- |
0 |
|
- |
| 5.1(Materials - IS 5116) |
- |
0 |
|
- |
| 5.1.1(Materials - IS 5116) |
- |
0 |
|
- |
| 5.1.1(Materials - IS 5116) |
- |
0 |
|
- |
| 5.2(Materials - IS 5116) |
- |
0 |
|
- |
| 5.2(Materials - IS 5116) |
- |
0 |
|
- |
| 5.3(Materials - IS 5116) |
- |
0 |
|
- |
| 5.5(Materials - IS 5116) |
- |
0 |
|
- |
| 5.5(Materials - IS 5116) |
- |
0 |
|
- |
| 5.5(Materials - IS 5116) |
- |
0 |
|
- |
| 5.7(Materials - IS 5116) |
- |
0 |
|
- |
| 6.1(Design for Maintainance) |
- |
0 |
|
- |
| 6.1(Design for Maintainance) |
- |
0 |
|
- |
| 6.2(Design for Maintainance) |
- |
0 |
|
- |
| 6.2(Design for Maintainance) |
- |
0 |
|
- |
| 6.3(Design for Maintainance) |
- |
0 |
|
- |
| 6.4(Design for Maintainance) |
- |
0 |
|
- |
| 6.5(Design for Maintainance) |
- |
0 |
|
- |
| 6.6(Design for Maintainance) |
- |
0 |
|
- |
| 7.0(Rigidity and Stability) |
- |
0 |
|
- |
| 7.1(Rigidity and Stability) |
- |
0 |
|
- |
| 7.2(Rigidity and Stability) |
- |
0 |
|
- |
| 7.3(Rigidity and Stability) |
- |
0 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
0 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
0 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
0 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
0 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
0 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
0 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
0 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
0 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
0 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
0 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
0 |
|
- |
| 8.1(Workmanship and Finish - Cl. 7 of IS 5116) |
- |
0 |
|
- |
| 8.2(Workmanship and Finish -) |
- |
0 |
|
- |
| 8.3(Workmanship and Finish -) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 9(Gas Taps- Cl. 8 of IS 5116 (Except 8.7 and 8.11.1)) |
- |
0 |
|
- |
| 10(Injector Jets) |
- |
0 |
|
- |
| 10(Injector Jets) |
- |
0 |
|
- |
| 10(Injector Jets) |
- |
0 |
|
- |
| 10(Injector Jets) |
- |
0 |
|
- |
| 10(Injector Jets) |
- |
0 |
|
- |
| 10(Injector Jets) |
- |
0 |
|
- |
| 11.1(Burners- Cl. 10 of IS 5116) |
- |
0 |
|
- |
| 11.1(Burners- Cl. 10 of IS 5116) |
- |
0 |
|
- |
| 11.1(Burners- Cl. 10 of IS 5116) |
- |
0 |
|
- |
| 11.1(Burners- Cl. 10 of IS 5116) |
- |
0 |
|
- |
| 11.1(Burners- Cl. 10 of IS 5116) |
- |
0 |
|
- |
| 11.2(Burners) |
- |
0 |
|
- |
| 11.3(Burners) |
- |
0 |
|
- |
| 11.4(Burners) |
- |
0 |
|
- |
| 12.1(Burner Pan Support) |
- |
0 |
|
- |
| 12.2(Burner Pan Support) |
- |
0 |
|
- |
| 12.3(Burner Pan Support) |
- |
0 |
|
- |
| 13.1(Gas Soundness Test - Cl. 16 of IS 5116) |
- |
0 |
|
- |
| 13,2(Gas Soundness Test) |
- |
0 |
|
- |
| 13.2(Gas Leak Detector) |
- |
0 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
0 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
0 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
0 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
0 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
0 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
0 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
0 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
0 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
0 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
0 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
0 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
0 |
|
- |
| 14.1(Gas Inlet Connection - Cl. 18 of IS 5116) |
- |
0 |
|
- |
| 14.2(Gas Inlet Connection) |
- |
0 |
|
- |
| 14.2(Gas Inlet Connection) |
- |
0 |
|
- |
| 14.2(Gas Inlet Connection) |
- |
0 |
|
- |
| 14.2(Gas Inlet Connection) |
- |
0 |
|
- |
| 14.3(Gas Inlet Connection) |
- |
0 |
|
- |
| 14.4(Gas Inlet Connection) |
- |
0 |
|
- |
| 14.5(Gas Inlet Connection - Cl. 17.3 of IS 5116) |
- |
0 |
|
- |
| 14.6(Gas Inlet Connection) |
- |
0 |
|
- |
| 15.0(Strength and Rigidity) |
- |
0 |
|
- |
| 15.0(Strength and Rigidity) |
- |
0 |
|
- |
| 15.0(Strength and Rigidity) |
- |
0 |
|
- |
| 15.0(Strength and Rigidity) |
- |
0 |
|
- |
| 17.0(Gas Consumption Test) |
- |
0 |
|
- |
| 17.0(Gas Consumption Test) |
- |
0 |
|
- |
| 17.0(Gas Consumption Test) |
- |
0 |
|
- |
| 17.0(Gas Consumption Test) |
- |
0 |
|
- |
| 17.0(Gas Consumption Test) |
- |
0 |
|
- |
| 17.0(Gas Consumption Test) |
- |
0 |
|
- |
| 17.2(Gas Consumption Test - For Gas Stoves) |
- |
0 |
|
- |
| 17.2 (a)(Gas Consumption Test - For Gas Stoves) |
- |
0 |
|
- |
| 17.2 (b)(Gas Consumption Test - For Gas Stoves) |
- |
0 |
|
- |
| 17.2 (c)(Gas Consumption Test - For Gas Stoves) |
- |
0 |
|
- |
| 17.3(Gas Consumption Test - For Built in Hobs) |
- |
0 |
|
- |
| 17.3.1(Gas Consumption Test - For Built in Hobs) |
- |
0 |
|
- |
| 17.3.2(Gas Consumption Test - For Built in Hobs) |
- |
0 |
|
- |
| 18.1(Ignition and Flame Travel) |
- |
0 |
|
- |
| 18.1(Ignition and Flame Travel) |
- |
0 |
|
- |
| 18.2(Ignition and Flame Travel) |
- |
0 |
|
- |
| 18.3(Ignition and Flame Travel) |
- |
0 |
|
- |
| 18.4(Ignition and Flame Travel - Cl. 14 of IS 5116) |
- |
0 |
|
- |
| 18.4(Ignition and Flame Travel - Cl. 14 of IS 5116) |
- |
0 |
|
- |
| 18.4(Ignition and Flame Travel - Cl. 14 of IS 5116) |
- |
0 |
|
- |
| 18.4(Ignition and Flame Travel - Cl. 14 of IS 5116) |
- |
0 |
|
- |
| 18.4(Ignition and Flame Travel - Cl. 14 of IS 5116) |
- |
0 |
|
- |
| 18.4(Ignition and Flame Travel - Cl. 14 of IS 5116) |
- |
0 |
|
- |
| 19.1(Flame Stability) |
- |
0 |
|
- |
| 19.1.1(Flame Stability) |
- |
0 |
|
- |
| 19.2(Flame Stability) |
- |
0 |
|
- |
| 19.3(Flame Stability) |
- |
0 |
|
- |
| 20(Noise Control) |
- |
0 |
|
- |
| 21(Flash Back) |
- |
0 |
|
- |
| 22(Formation of Soot) |
- |
0 |
|
- |
| 23(Resistance to Draught) |
- |
0 |
|
- |
| 24.1(Combustion) |
- |
0 |
|
- |
| 24.1(Combustion) |
- |
0 |
|
- |
| 24.2(Combustion) |
- |
0 |
|
- |
| 25.1(Fire Hazard and Limiting Temperatures) |
- |
0 |
|
- |
| 25.1(Fire Hazard and Limiting Temperatures) |
- |
0 |
|
- |
| 25.1(Fire Hazard and Limiting Temperatures) |
- |
0 |
|
- |
| 25.1(Fire Hazard and Limiting Temperatures) |
- |
0 |
|
- |
| 25.2(Fire Hazard and Limiting Temperatures) |
- |
0 |
|
- |
| 26.1(Thermal Efficiency- Gas Stoves) |
- |
0 |
|
- |
| 26.1(Thermal Efficiency- Gas Stoves) |
- |
0 |
|
- |
| 26.1(Thermal Efficiency- Gas Stoves) |
- |
0 |
|
- |
| 26.1(Thermal Efficiency- Gas Stoves) |
- |
0 |
|
- |
| 26.1(Thermal Efficiency- Gas Stoves) |
- |
0 |
|
- |
| 26.2(Thermal Efficiency- For Built in Hobs) |
- |
0 |
|
- |
| 26.2(Thermal Efficiency- For Built in Hobs) |
- |
0 |
|
- |
| 26.2(Thermal Efficiency- For Built in Hobs) |
- |
0 |
|
- |
| 26.2(Thermal Efficiency- For Built in Hobs) |
- |
0 |
|
- |
| 26.2(Thermal Efficiency- For Built in Hobs) |
- |
0 |
|
- |
|
- |
-
Included w.e.f 18.11.2025 |
| 20 |
IS 12701 (1996) |
Rotational moulded polyethylene water storage tanks - specification (First Revision) |
All type of Grade / Type / Size / Designation |
18000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 4.2.3(Carbon Black Content ) |
- |
700 |
|
- |
| 4.2.3(Carbon Dispersion Test) |
- |
700 |
|
- |
| 5(Types and Features ) |
- |
700 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
700 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
700 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
700 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
700 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
700 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
700 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
700 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
700 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
700 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
700 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
700 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
700 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
700 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
700 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
700 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
700 |
|
- |
| 5.3(Types and Features ) |
- |
700 |
|
- |
| 5.6(Types and Features ) |
- |
700 |
|
- |
| 6.1(Finish) |
- |
700 |
|
- |
| 7.1.1(Resistance to Deformation) |
- |
700 |
|
- |
| 7.1.2(Resistance to Deformation) |
- |
700 |
|
- |
| 7.2(Resistance to Impact) |
- |
700 |
|
- |
| 7.3(Test for Top Load Resistance) |
- |
700 |
|
- |
| 7.4(Tensile Strength) |
- |
700 |
|
- |
| 7.5(Flexural Modulus) |
- |
700 |
|
- |
| 7.6(overall Migration) |
- |
700 |
|
- |
| 9.2.1(Man-Hole and Hand-Hole Lids) |
- |
700 |
|
- |
| 9.2(Man-Hole and Hand-Hole Lids) |
- |
700 |
|
- |
| 9.1(Man-Hole and Hand-Hole Lids) |
- |
700 |
|
- |
| 9.1(Lid Thickness) |
- |
700 |
|
- |
| 7.3(Test for Top Load Resistance) |
- |
700 |
|
- |
| 6.1(Finish) |
- |
700 |
|
- |
| 5.4(Wall Thickness above effective height) |
- |
1000 |
|
- |
| 5.2 Table 2 (7)(Minimum Wall Thickness) |
- |
700 |
|
- |
| 5.1 Table 1 (7)(Minimum Weight of Tank (Without Lid)) |
- |
700 |
|
- |
| 4.2.1(Density) |
- |
700 |
|
- |
| 4.2.2(MFI) |
- |
700 |
|
- |
| 7.6(overall Migration) |
- |
700 |
|
- |
| 4.1(MATERIALS) |
- |
700 |
|
- |
| 4.2.2(MFR) |
- |
700 |
|
- |
| 4.2.1(Density) |
- |
700 |
|
- |
| 5.4(Wall Thickness) |
- |
700 |
|
- |
| 10(MARKING) |
- |
700 |
|
- |
| Cl-7.6(Overall Migration) |
- |
1000 |
|
- |
| 4.2.3(Carbon Black Content ) |
- |
1000 |
|
- |
| 4.2.3(Carbon Dispersion Test) |
- |
1000 |
|
- |
| 5(Types and Features ) |
- |
1000 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
1000 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
1000 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
1000 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
1000 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
1000 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
1000 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
1000 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
1000 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
1000 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
1000 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
1000 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
1000 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
1000 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
1000 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
1000 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
1000 |
|
- |
| 5.3(Types and Features ) |
- |
1000 |
|
- |
| 5.6(Types and Features ) |
- |
1000 |
|
- |
| 6.1(Finish) |
- |
1000 |
|
- |
| 7.1.1(Resistance to Deformation) |
- |
1000 |
|
- |
| 7.1.2(Resistance to Deformation) |
- |
1000 |
|
- |
| 7.2(Resistance to Impact) |
- |
1000 |
|
- |
| 7.3(Test for Top Load Resistance) |
- |
1000 |
|
- |
| 7.4(Tensile Strength) |
- |
1000 |
|
- |
| 7.5(Flexural Modulus) |
- |
1000 |
|
- |
| 7.6(overall Migration) |
- |
1000 |
|
- |
| 4.2.1(Density) |
- |
1000 |
|
- |
| 4.2.2(MFI) |
- |
1000 |
|
- |
| 7.6(overall Migration) |
- |
1000 |
|
- |
| 4.1(MATERIALS) |
- |
1000 |
|
- |
| 4.2.2(MFR) |
- |
1000 |
|
- |
| 4.2.1(Density) |
- |
1000 |
|
- |
| 5.4(Wall Thickness) |
- |
1000 |
|
- |
| 10(MARKING) |
- |
1000 |
|
- |
| Cl-7.6(Overall Migration) |
- |
1000 |
|
- |
| 4.2.3(Carbon Black Content ) |
- |
1000 |
|
- |
| 4.2.3(Carbon Dispersion Test) |
- |
1000 |
|
- |
| 5(Types and Features ) |
- |
1000 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
1000 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
1000 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
1000 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
1000 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
1000 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
1000 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
1000 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
1000 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
1000 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
1000 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
1000 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
1000 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
1000 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
1000 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
1000 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
1000 |
|
- |
| 5.3(Types and Features ) |
- |
1000 |
|
- |
| 5.6(Types and Features ) |
- |
1000 |
|
- |
| 6.1(Finish) |
- |
1000 |
|
- |
| 7.1.1(Resistance to Deformation) |
- |
1000 |
|
- |
| 7.1.2(Resistance to Deformation) |
- |
1000 |
|
- |
| 7.2(Resistance to Impact) |
- |
1000 |
|
- |
| 7.3(Test for Top Load Resistance) |
- |
1000 |
|
- |
| 7.4(Tensile Strength) |
- |
1000 |
|
- |
| 7.5(Flexural Modulus) |
- |
1000 |
|
- |
| 7.6(overall Migration) |
- |
1000 |
|
- |
| 4.2.1(Density) |
- |
1000 |
|
- |
| 4.2.2(MFI) |
- |
1000 |
|
- |
| 7.6(overall Migration) |
- |
1000 |
|
- |
| 4.1(MATERIALS) |
- |
1000 |
|
- |
| 4.2.2(MFR) |
- |
1000 |
|
- |
| 4.2.1(Density) |
- |
1000 |
|
- |
| 5.4(Wall Thickness) |
- |
1000 |
|
- |
| 10(MARKING) |
- |
1000 |
|
- |
| Cl-7.6(Overall Migration) |
- |
1000 |
|
- |
| 4.2.3(Carbon Black Content ) |
- |
0 |
|
- |
| 4.2.3(Carbon Dispersion Test) |
- |
0 |
|
- |
| 5(Types and Features ) |
- |
0 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
0 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
0 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
0 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
0 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
0 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
0 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
0 |
|
- |
| 5.1 Table 1(Dimensioas of Cylinderical Vertical Tank) |
- |
0 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
0 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
0 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
0 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
0 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
0 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
0 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
0 |
|
- |
| 5.2 Table 2(Dimensions of Rectangular Loft Tanks) |
- |
0 |
|
- |
| 5.3(Types and Features ) |
- |
0 |
|
- |
| 5.6(Types and Features ) |
- |
0 |
|
- |
| 6.1(Finish) |
- |
0 |
|
- |
| 7.1.1(Resistance to Deformation) |
- |
0 |
|
- |
| 7.1.2(Resistance to Deformation) |
- |
0 |
|
- |
| 7.2(Resistance to Impact) |
- |
0 |
|
- |
| 7.3(Test for Top Load Resistance) |
- |
0 |
|
- |
| 7.4(Tensile Strength) |
- |
0 |
|
- |
| 7.5(Flexural Modulus) |
- |
0 |
|
- |
| 7.6(overall Migration) |
- |
0 |
|
- |
| 4.2.1(Density) |
- |
0 |
|
- |
| 4.2.2(MFI) |
- |
0 |
|
- |
| 7.6(overall Migration) |
- |
0 |
|
- |
| 4.1(MATERIALS) |
- |
0 |
|
- |
| 4.2.2(MFR) |
- |
0 |
|
- |
| 4.2.1(Density) |
- |
0 |
|
- |
| 5.4(Wall Thickness) |
- |
0 |
|
- |
| 10(MARKING) |
- |
0 |
|
- |
| Cl-7.6(Overall Migration) |
- |
0 |
|
- |
|
- |
-
Included w.e.f 15.10.2025 |
| 21 |
IS 12786 (2024) |
Irrigation equipment - Polyethylene pipes for irrigation laterals - Specification (first revision) |
All type of Grade / Type / Size / Designation |
14000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl-4.1(Material) |
- |
500 |
|
- |
| Cl-4.2(Carbon content of finished PE lateral pipe) |
- |
500 |
|
- |
| Cl-5.1(Dimensions of pipes and wall thicknesses) |
- |
500 |
|
- |
| Cl-6.0(Visual Appearance) |
- |
500 |
|
- |
| Cl-7.1(Hydraulic Characteristics- Internal pressure creep rupture test) |
- |
500 |
|
- |
| Cl-7.1(Hydraulic Characteristics- quality acceptance test) |
- |
500 |
|
- |
| Cl-7.2(Reversion Test) |
- |
500 |
|
- |
| Cl-7.3(Tensile Test) |
- |
500 |
|
- |
| Cl-7.3.1(Test Piece) |
- |
500 |
|
- |
| Cl-7.3.2(Procedure) |
- |
500 |
|
- |
| Cl-7.4(Susceptibility to Environmental Stress Cracking) |
- |
500 |
|
- |
| Cl-8.0(Supply of pipes) |
- |
500 |
|
- |
| Cl-9.0(Coiling) |
- |
500 |
|
- |
| Cl-10.0(Sampling and criteria for conformity) |
- |
500 |
|
- |
| Cl-11(Marking) |
- |
500 |
|
- |
| 3(Class of Pipe) |
- |
500 |
|
- |
| 5.1 & Table 1(Dimensions of Pipes - Outside diameters) |
- |
500 |
|
- |
| 5.1 & Table 1(Dimensions of Pipes - Wall thickness) |
- |
500 |
|
- |
| 6(Visual Appearance) |
- |
500 |
|
- |
| 7.1 & Table 2(Hydraulic Characteristics) |
- |
500 |
|
- |
| 7.1 & Table 2(Hydraulic Characteristics) |
- |
500 |
|
- |
| 7.2(Reversion Test) |
- |
500 |
|
- |
| 7.3(Tensile Strength) |
- |
500 |
|
- |
| 7.3(Elongation at Break) |
- |
500 |
|
- |
| 7.4(SusceptibiIity to Environmental Stress Cracking) |
- |
500 |
|
- |
| 4.2(a)(Carbon Black Content-IS 2530) |
- |
500 |
|
- |
| 4.2(b)(Carbon Black Dispersion-IS 2530) |
- |
500 |
|
- |
| Cl-4.1(Material) |
- |
500 |
|
- |
| Cl-4.2(Carbon content of finished PE lateral pipe) |
- |
500 |
|
- |
| Cl-5.1(Dimensions of pipes and wall thicknesses) |
- |
500 |
|
- |
| Cl-6.0(Visual Appearance) |
- |
500 |
|
- |
| Cl-7.1(Hydraulic Characteristics- Internal pressure creep rupture test) |
- |
500 |
|
- |
| Cl-7.1(Hydraulic Characteristics- quality acceptance test) |
- |
500 |
|
- |
| Cl-7.2(Reversion Test) |
- |
500 |
|
- |
| Cl-7.3(Tensile Test) |
- |
500 |
|
- |
| Cl-7.3.1(Test Piece) |
- |
500 |
|
- |
| Cl-7.3.2(Procedure) |
- |
500 |
|
- |
| Cl-7.4(Susceptibility to Environmental Stress Cracking) |
- |
500 |
|
- |
| Cl-8.0(Supply of pipes) |
- |
500 |
|
- |
| Cl-9.0(Coiling) |
- |
500 |
|
- |
| Cl-10.0(Sampling and criteria for conformity) |
- |
500 |
|
- |
| Cl-11(Marking) |
- |
500 |
|
- |
| 3(Class of Pipe) |
- |
500 |
|
- |
| 5.1 & Table 1(Dimensions of Pipes - Outside diameters) |
- |
500 |
|
- |
| 5.1 & Table 1(Dimensions of Pipes - Wall thickness) |
- |
500 |
|
- |
| 6(Visual Appearance) |
- |
500 |
|
- |
| 7.1 & Table 2(Hydraulic Characteristics) |
- |
500 |
|
- |
| 7.1 & Table 2(Hydraulic Characteristics) |
- |
500 |
|
- |
| 7.2(Reversion Test) |
- |
500 |
|
- |
| 7.3(Tensile Strength) |
- |
500 |
|
- |
| 7.3(Elongation at Break) |
- |
500 |
|
- |
| 7.4(SusceptibiIity to Environmental Stress Cracking) |
- |
500 |
|
- |
| 4.2(a)(Carbon Black Content-IS 2530) |
- |
500 |
|
- |
| 4.2(b)(Carbon Black Dispersion-IS 2530) |
- |
500 |
|
- |
| Cl-4.2(Carbon content of finished PE lateral pipe) |
- |
500 |
|
- |
| Cl-5.1(Dimensions of pipes and wall thicknesses) |
- |
500 |
|
- |
| Cl-6.0(Visual Appearance) |
- |
500 |
|
- |
| Cl-7.1(Hydraulic Characteristics- Internal pressure creep rupture test) |
- |
500 |
|
- |
| Cl-7.1(Hydraulic Characteristics- quality acceptance test) |
- |
500 |
|
- |
| Cl-7.2(Reversion Test) |
- |
500 |
|
- |
| Cl-7.3(Tensile Test) |
- |
500 |
|
- |
| Cl-7.3.1(Test Piece) |
- |
500 |
|
- |
| Cl-7.3.2(Procedure) |
- |
500 |
|
- |
| Cl-7.4(Susceptibility to Environmental Stress Cracking) |
- |
500 |
|
- |
| Cl-8.0(Supply of pipes) |
- |
500 |
|
- |
| Cl-9.0(Coiling) |
- |
500 |
|
- |
| Cl-10.0(Sampling and criteria for conformity) |
- |
500 |
|
- |
| Cl-11(Marking) |
- |
500 |
|
- |
| 3(Class of Pipe) |
- |
500 |
|
- |
| 5.1 & Table 1(Dimensions of Pipes - Outside diameters) |
- |
500 |
|
- |
| 5.1 & Table 1(Dimensions of Pipes - Wall thickness) |
- |
500 |
|
- |
| 6(Visual Appearance) |
- |
500 |
|
- |
| 7.1 & Table 2(Hydraulic Characteristics) |
- |
500 |
|
- |
| 7.1 & Table 2(Hydraulic Characteristics) |
- |
500 |
|
- |
| 7.2(Reversion Test) |
- |
500 |
|
- |
| 7.3(Tensile Strength) |
- |
500 |
|
- |
| 7.3(Elongation at Break) |
- |
500 |
|
- |
| 7.4(SusceptibiIity to Environmental Stress Cracking) |
- |
500 |
|
- |
| 4.2(a)(Carbon Black Content-IS 2530) |
- |
500 |
|
- |
| 4.2(b)(Carbon Black Dispersion-IS 2530) |
- |
500 |
|
- |
| Cl-4.2(Carbon content of finished PE lateral pipe) |
- |
0 |
|
- |
| Cl-5.1(Dimensions of pipes and wall thicknesses) |
- |
0 |
|
- |
| Cl-6.0(Visual Appearance) |
- |
0 |
|
- |
| Cl-7.1(Hydraulic Characteristics- Internal pressure creep rupture test) |
- |
0 |
|
- |
| Cl-7.1(Hydraulic Characteristics- quality acceptance test) |
- |
0 |
|
- |
| Cl-7.2(Reversion Test) |
- |
0 |
|
- |
| Cl-7.3(Tensile Test) |
- |
0 |
|
- |
| Cl-7.3.1(Test Piece) |
- |
0 |
|
- |
| Cl-7.3.2(Procedure) |
- |
0 |
|
- |
| Cl-7.4(Susceptibility to Environmental Stress Cracking) |
- |
0 |
|
- |
| Cl-8.0(Supply of pipes) |
- |
0 |
|
- |
| Cl-9.0(Coiling) |
- |
0 |
|
- |
| Cl-10.0(Sampling and criteria for conformity) |
- |
0 |
|
- |
| Cl-11(Marking) |
- |
0 |
|
- |
| 3(Class of Pipe) |
- |
0 |
|
- |
| 5.1 & Table 1(Dimensions of Pipes - Outside diameters) |
- |
0 |
|
- |
| 5.1 & Table 1(Dimensions of Pipes - Wall thickness) |
- |
0 |
|
- |
| 6(Visual Appearance) |
- |
0 |
|
- |
| 7.1 & Table 2(Hydraulic Characteristics) |
- |
0 |
|
- |
| 7.1 & Table 2(Hydraulic Characteristics) |
- |
0 |
|
- |
| 7.2(Reversion Test) |
- |
0 |
|
- |
| 7.3(Tensile Strength) |
- |
0 |
|
- |
| 7.3(Elongation at Break) |
- |
0 |
|
- |
| 7.4(SusceptibiIity to Environmental Stress Cracking) |
- |
0 |
|
- |
| 4.2(a)(Carbon Black Content-IS 2530) |
- |
0 |
|
- |
| 4.2(b)(Carbon Black Dispersion-IS 2530) |
- |
0 |
|
- |
| Cl-4.1(Material) |
- |
0 |
|
- |
|
- |
-
Included w.e.f 15.10.2025 |
| 22 |
IS 366 (1991) |
Electric iron - Specification (Fourth Revision) |
There rated voltage not exceed 250V ac. |
29500 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 7.0(Classification (as per Cl.6 of IS 302-2-3 and Cl.6.1 of IS 302-1)) |
- |
500 |
|
- |
| 7.0(Classification (as per Cl.6 of IS 302-2-3 and Cl.6.2 of IS 302-1)) |
- |
0 |
|
- |
| 9.0(Protection against access to live parts (as per Cl. 8 of IS 302-2-3 and IS 302-1)) |
- |
500 |
|
- |
| 9.0(Power input and current (as per Cl. 10 of IS 302-2-3 and IS 302-1)) |
- |
500 |
|
- |
| 9.0(Temperature Rise (as per Cl. 11 of IS 302-2-3 and IS 302-1)) |
- |
1000 |
|
- |
| 9.0(Temperature Rise (as per Cl. 11 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Temperature Rise (as per Cl. 11 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Temperature Rise (as per Cl. 11 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Leakage current and Electric Strength at Operating Temperature (as per Cl. 13 of IS 302-2-3 and IS 302-1)) |
- |
1000 |
|
- |
| 9.0(Leakage current and Electric Strength at Operating Temperature (as per Cl. 13 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Transient Overvoltage (as per of Cl. 14 of IS 302-2-3 and Table 6 of IS 302-1)) |
- |
0 |
|
- |
| 9.0(Moisture Resistance (as per of Cl.15 of IS 302-2-3 and IS 302-1)) |
- |
2000 |
|
- |
| 9.0(Abnormal Operation (as per of Cl.19 of IS 302-2-3 and IS 302-1) ) |
- |
1000 |
|
- |
| 9.0(Abnormal Operation (as per of Cl.19 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Abnormal Operation (as per of Cl.19 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Abnormal Operation (as per of Cl.19 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Abnormal Operation (as per of Cl.19 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Staibilty and mechanical hazards (as per of Cl.20 of IS 302-2-3 and IS 302-1) ) |
- |
500 |
|
- |
| 9.0(Mechanical strength (as per of Cl.21 of IS 302-2-3 and IS 302-1) ) |
- |
500 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
500 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Internal wiring (as per of Cl.23 of IS 302-2-3 and IS 302-1) ) |
- |
500 |
|
- |
| 9.0(Internal wiring (as per of Cl.23 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Internal wiring (as per of Cl.23 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Internal wiring (as per of Cl.23 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Components (as per of Cl.24 of IS 302-2-3 and IS 302-1) ) |
- |
500 |
|
- |
| 9.0(Supply connection and external flexible cord (as per of Cl.25 of IS 302-2-3 and IS 302-1) ) |
- |
1000 |
|
- |
| 9.0(Supply connection and external flexible cord (as per of Cl.25 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Supply connection and external flexible cord (as per of Cl.25 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Supply connection and external flexible cord (as per of Cl.25 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Supply connection and external flexible cord (as per of Cl.25 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Terminals for external conductors (as per of Cl.26 of IS 302-2-3 and IS 302-1) ) |
- |
500 |
|
- |
| 9.0(Provision for earthing (as per of Cl.27 of IS 302-2-3 and IS 302-1) ) |
- |
500 |
|
- |
| 9.0(Provision for earthing (as per of Cl.27 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Provision for earthing (as per of Cl.27 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Provision for earthing (as per of Cl.27 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Screw and connections (as per of Cl.28 of IS 302-2-3 and IS 302-1)) |
- |
500 |
|
- |
| 9.0(Screw and connections (as per of Cl.28 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Clearances, creepage distances and solid insulation (as per of Cl.29 of IS 302-2-3 and IS 302-1)) |
- |
500 |
|
- |
| 9.0(Clearances, creepage distances and solid insulation (as per of Cl.29 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Resistance to Heat and Fire (as per of Cl.30 of IS 302-2-3 and IS 302-1)) |
- |
1000 |
|
- |
| 9.0(Resistance to Rusting (as per of Cl.31 of IS 302-2-3 and IS 302-1)) |
- |
1000 |
|
- |
| 10.0(Measurement of Heating up time) |
- |
1000 |
|
- |
| 10.0(Measurement of Heating up time) |
- |
0 |
|
- |
| 11.0(Measurement of sole plate temperature) |
- |
2000 |
|
- |
| 11.0(Measurement of sole plate temperature) |
- |
0 |
|
- |
| 11.0(Measurement of sole plate temperature) |
- |
0 |
|
- |
| 11.0(Measurement of sole plate temperature) |
- |
0 |
|
- |
| 12.0(Measurement of Tempearture Distribution) |
- |
2000 |
|
- |
| 13.0(Measurement of Initial overswing temperature and Heating up excess temperature) |
- |
2000 |
|
- |
| 13.0(Measurement of Initial overswing temperature and Heating up excess temperature) |
- |
0 |
|
- |
| 14.0(Measurement of Cyclic fluctuation of temperature of hottest point ) |
- |
2000 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
5000 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 7.0(Classification (as per Cl.6 of IS 302-2-3 and Cl.6.1 of IS 302-1)) |
- |
0 |
|
- |
| 9.0(Moisture Resistance (as per of Cl.15 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 7.0(Classification (as per Cl.6 of IS 302-2-3 and Cl.6.2 of IS 302-1)) |
- |
0 |
|
- |
| 9.0(Protection against access to live parts (as per Cl. 8 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Power input and current (as per Cl. 10 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Temperature Rise (as per Cl. 11 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Temperature Rise (as per Cl. 11 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Temperature Rise (as per Cl. 11 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Temperature Rise (as per Cl. 11 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Leakage current and Electric Strength at Operating Temperature (as per Cl. 13 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Leakage current and Electric Strength at Operating Temperature (as per Cl. 13 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Transient Overvoltage (as per of Cl. 14 of IS 302-2-3 and Table 6 of IS 302-1)) |
- |
0 |
|
- |
| 9.0(Moisture Resistance (as per of Cl.15 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Moisture Resistance (as per of Cl.15 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Abnormal Operation (as per of Cl.19 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Abnormal Operation (as per of Cl.19 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Abnormal Operation (as per of Cl.19 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Abnormal Operation (as per of Cl.19 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Abnormal Operation (as per of Cl.19 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Staibilty and mechanical hazards (as per of Cl.20 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Mechanical strength (as per of Cl.21 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Construction (as per of Cl.22 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Internal wiring (as per of Cl.23 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Internal wiring (as per of Cl.23 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Internal wiring (as per of Cl.23 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Internal wiring (as per of Cl.23 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Components (as per of Cl.24 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Supply connection and external flexible cord (as per of Cl.25 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Supply connection and external flexible cord (as per of Cl.25 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Supply connection and external flexible cord (as per of Cl.25 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Supply connection and external flexible cord (as per of Cl.25 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Supply connection and external flexible cord (as per of Cl.25 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Terminals for external conductors (as per of Cl.26 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Provision for earthing (as per of Cl.27 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Provision for earthing (as per of Cl.27 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Provision for earthing (as per of Cl.27 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 9.0(Screw and connections (as per of Cl.28 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Screw and connections (as per of Cl.28 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Clearances, creepage distances and solid insulation (as per of Cl.29 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Clearances, creepage distances and solid insulation (as per of Cl.29 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Resistance to Heat and Fire (as per of Cl.30 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 9.0(Resistance to Rusting (as per of Cl.31 of IS 302-2-3 and IS 302-1)) |
- |
0 |
|
- |
| 10.0(Measurement of Heating up time) |
- |
0 |
|
- |
| 10.0(Measurement of Heating up time) |
- |
0 |
|
- |
| 11.0(Measurement of sole plate temperature) |
- |
0 |
|
- |
| 11.0(Measurement of sole plate temperature) |
- |
0 |
|
- |
| 11.0(Measurement of sole plate temperature) |
- |
0 |
|
- |
| 11.0(Measurement of sole plate temperature) |
- |
0 |
|
- |
| 12.0(Measurement of Tempearture Distribution) |
- |
0 |
|
- |
| 13.0(Measurement of Initial overswing temperature and Heating up excess temperature) |
- |
0 |
|
- |
| 13.0(Measurement of Initial overswing temperature and Heating up excess temperature) |
- |
0 |
|
- |
| 14.0(Measurement of Cyclic fluctuation of temperature of hottest point ) |
- |
0 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16.0(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 6(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 15(MEASUREMENT OF TEMPERATURE DROP UNDER LOAD) |
- |
0 |
|
- |
| 17(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16 of IS 302-2-3(Leakage current electric strength) |
- |
0 |
|
- |
| 4(GENERAL REQUIREMENTS) |
- |
0 |
|
- |
| 5(GENERAL NOTES ON TESTS) |
- |
0 |
|
- |
| 8(Marking) |
- |
500 |
|
- |
| (Cl.8 of IS 366:1991 )(Marking and Instructions) |
- |
0 |
|
- |
| (Cl.8 of IS 366:1991 )(Marking and Instructions) |
- |
0 |
|
- |
| (Cl.8 of IS 366:1991 )(Marking and Instructions) |
- |
0 |
|
- |
| (Cl.8 of IS 366:1991 )(Marking and Instructions) |
- |
0 |
|
- |
| (Cl.11 of IS 302-2-3 :2007)(Heating) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-3 :2007)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-3 :2007)(Construction) |
- |
0 |
|
- |
| (Cl.32 of IS 302-2-3 :2007)(Radiation, Toxicity and similar) |
- |
0 |
|
- |
| 9.0(Provision for earthing (as per of Cl.27 of IS 302-2-3 and IS 302-1) ) |
- |
0 |
|
- |
| 6(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 15(MEASUREMENT OF TEMPERATURE DROP UNDER LOAD) |
- |
0 |
|
- |
| 17(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16 of IS 302-2-3(Leakage current electric strength) |
- |
0 |
|
- |
| 4(GENERAL REQUIREMENTS) |
- |
0 |
|
- |
| 5(GENERAL NOTES ON TESTS) |
- |
0 |
|
- |
| 8(Marking) |
- |
0 |
|
- |
| (Cl.8 of IS 366:1991 )(Marking and Instructions) |
- |
0 |
|
- |
| (Cl.8 of IS 366:1991 )(Marking and Instructions) |
- |
0 |
|
- |
| (Cl.8 of IS 366:1991 )(Marking and Instructions) |
- |
0 |
|
- |
| (Cl.8 of IS 366:1991 )(Marking and Instructions) |
- |
0 |
|
- |
| (Cl.11 of IS 302-2-3 :2007)(Heating) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-3 :2007)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-3 :2007)(Construction) |
- |
0 |
|
- |
| (Cl.32 of IS 302-2-3 :2007)(Radiation, Toxicity and similar) |
- |
0 |
|
- |
| 6(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 15(MEASUREMENT OF TEMPERATURE DROP UNDER LOAD) |
- |
0 |
|
- |
| 17(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16 of IS 302-2-3(Leakage current electric strength) |
- |
0 |
|
- |
| 4(GENERAL REQUIREMENTS) |
- |
0 |
|
- |
| 5(GENERAL NOTES ON TESTS) |
- |
0 |
|
- |
| 8(Marking) |
- |
0 |
|
- |
| (Cl.8 of IS 366:1991 )(Marking and Instructions) |
- |
0 |
|
- |
| (Cl.8 of IS 366:1991 )(Marking and Instructions) |
- |
0 |
|
- |
| (Cl.8 of IS 366:1991 )(Marking and Instructions) |
- |
0 |
|
- |
| (Cl.8 of IS 366:1991 )(Marking and Instructions) |
- |
0 |
|
- |
| (Cl.11 of IS 302-2-3 :2007)(Heating) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-3 :2007)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-3 :2007)(Construction) |
- |
0 |
|
- |
| (Cl.32 of IS 302-2-3 :2007)(Radiation, Toxicity and similar) |
- |
0 |
|
- |
| 6(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 15(MEASUREMENT OF TEMPERATURE DROP UNDER LOAD) |
- |
0 |
|
- |
| 17(Measurement of Thermostatic staibility) |
- |
0 |
|
- |
| 16 of IS 302-2-3(Leakage current electric strength) |
- |
0 |
|
- |
| 4(GENERAL REQUIREMENTS) |
- |
0 |
|
- |
| 5(GENERAL NOTES ON TESTS) |
- |
0 |
|
- |
| 8(Marking) |
- |
0 |
|
- |
| (Cl.8 of IS 366:1991 )(Marking and Instructions) |
- |
0 |
|
- |
| (Cl.8 of IS 366:1991 )(Marking and Instructions) |
- |
0 |
|
- |
| (Cl.8 of IS 366:1991 )(Marking and Instructions) |
- |
0 |
|
- |
| (Cl.8 of IS 366:1991 )(Marking and Instructions) |
- |
0 |
|
- |
| (Cl.11 of IS 302-2-3 :2007)(Heating) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-3 :2007)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-3 :2007)(Construction) |
- |
0 |
|
- |
| (Cl.32 of IS 302-2-3 :2007)(Radiation, Toxicity and similar) |
- |
0 |
|
- |
| Cl-8(Marking and Instructions) |
- |
0 |
|
- |
|
- |
-
Included w.e.f 05.12.2025
Exclusion: Radiation, Toxicity and similar, Components, Cl.19.11.4.1 TO 19.11.4.7 (EMI/EMC) |
| 23 |
IS 2312 (1967) |
Specification for propeller type AC ventilating fans (First Revision) |
There rated voltage not exceed 250V, ac for single phase or 440V ac for three phase. |
21000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 13.1(Marking) |
- |
1000 |
|
- |
| 13.1 (a)(Marking) |
- |
0 |
|
- |
| 13.1 (b)(Marking) |
- |
0 |
|
- |
| 13.1 (c)(Marking) |
- |
0 |
|
- |
| 13.1 (d)(Marking) |
- |
0 |
|
- |
| 13.1 (e)(Marking) |
- |
0 |
|
- |
| 13.1 (f)(Marking) |
- |
0 |
|
- |
| 13.1 (g)(Marking) |
- |
0 |
|
- |
| 13.1 (h)(Marking) |
- |
0 |
|
- |
| 13.1 (j)(Marking) |
- |
0 |
|
- |
| 13.2(Marking) |
- |
0 |
|
- |
| 13.4(Marking) |
- |
0 |
|
- |
| 3.1(Sizes ) |
- |
500 |
|
- |
| 4.1(Rated Voltage) |
- |
500 |
|
- |
| 5.1(Rated frequency) |
- |
500 |
|
- |
| 6.1(Design and General Construction) |
- |
500 |
|
- |
| 6.3(Design and General Construction) |
- |
0 |
|
- |
| 6.3(Design and General Construction) |
- |
0 |
|
- |
| 6.4(Design and General Construction) |
- |
0 |
|
- |
| 6.5(Design and General Construction) |
- |
0 |
|
- |
| 6.6(Design and General Construction) |
- |
0 |
|
- |
| 6.7(Design and General Construction) |
- |
0 |
|
- |
| 6.9(Design and General Construction) |
- |
0 |
|
- |
| 6.1(Design and General Construction) |
- |
0 |
|
- |
| 6.11(Design and General Construction) |
- |
0 |
|
- |
| 6.12(Design and General Construction) |
- |
0 |
|
- |
| 7.1(Design and General Construction) |
- |
0 |
|
- |
| 8.1(Design and General Construction) |
- |
0 |
|
- |
| 9(Design and General Construction) |
- |
0 |
|
- |
| 10.1(Starting ) |
- |
100 |
|
- |
| 11.1(Interchangeability) |
- |
1000 |
|
- |
| 14.2 & 15.1(Air Delivery) |
- |
3000 |
|
- |
| 14.3.A(Temperature-Rise (for motors)) |
- |
2000 |
|
- |
| 14.3.A(Temperature-Rise (for motors)) |
- |
0 |
|
- |
| 14.3.A(Temperature-Rise (for motors)) |
- |
0 |
|
- |
| 14.3.A(Temperature-Rise (for motors)) |
- |
0 |
|
- |
| 14.3.B(Temperature-Rise (for regulators)) |
- |
1000 |
|
- |
| 14.3.B(Temperature-Rise (for regulators)) |
- |
0 |
|
- |
| 14.3.B(Moistureproofness (for regulators only)) |
- |
3000 |
|
- |
| 14.3.B(Moistureproofness (for regulators only)) |
- |
0 |
|
- |
| 14.5(Mechanical Endurance (for regulators only)) |
- |
2000 |
|
- |
| 14.1 & 14.6(Power factor) |
- |
500 |
|
- |
| 14.7(ac leakage) |
- |
500 |
|
- |
| 14.8(High voltage test) |
- |
500 |
|
- |
| 14.9(Insulation-Resistance) |
- |
500 |
|
- |
| 14.1(Earthing continuity) |
- |
500 |
|
- |
| 14.11 & 15.1(Electrical Input) |
- |
500 |
|
- |
| 14.12 & 16(Fan Speed) |
- |
500 |
|
- |
| 13.1(Marking) |
- |
0 |
|
- |
| 13.1 (a)(Marking) |
- |
0 |
|
- |
| 13.1 (b)(Marking) |
- |
0 |
|
- |
| 13.1 (c)(Marking) |
- |
0 |
|
- |
| 13.1 (d)(Marking) |
- |
0 |
|
- |
| 13.1 (e)(Marking) |
- |
0 |
|
- |
| 13.1 (f)(Marking) |
- |
0 |
|
- |
| 13.1 (g)(Marking) |
- |
0 |
|
- |
| 13.1 (h)(Marking) |
- |
0 |
|
- |
| 13.1 (j)(Marking) |
- |
0 |
|
- |
| 13.2(Marking) |
- |
0 |
|
- |
| 13.4(Marking) |
- |
0 |
|
- |
| 3.1(Sizes ) |
- |
0 |
|
- |
| 4.1(Rated Voltage) |
- |
0 |
|
- |
| 5.1(Rated frequency) |
- |
0 |
|
- |
| 6.1(Design and General Construction) |
- |
0 |
|
- |
| 6.3(Design and General Construction) |
- |
0 |
|
- |
| 6.3(Design and General Construction) |
- |
0 |
|
- |
| 6.4(Design and General Construction) |
- |
0 |
|
- |
| 6.5(Design and General Construction) |
- |
0 |
|
- |
| 6.6(Design and General Construction) |
- |
0 |
|
- |
| 6.7(Design and General Construction) |
- |
0 |
|
- |
| 6.9(Design and General Construction) |
- |
0 |
|
- |
| 6.1(Design and General Construction) |
- |
0 |
|
- |
| 6.11(Design and General Construction) |
- |
0 |
|
- |
| 6.12(Design and General Construction) |
- |
0 |
|
- |
| 7.1(Design and General Construction) |
- |
0 |
|
- |
| 8.1(Design and General Construction) |
- |
0 |
|
- |
| 9(Design and General Construction) |
- |
0 |
|
- |
| 10.1(Starting ) |
- |
0 |
|
- |
| 11.1(Interchangeability) |
- |
0 |
|
- |
| 14.2 & 15.1(Air Delivery) |
- |
0 |
|
- |
| 14.3(Temperature-Rise) |
- |
0 |
|
- |
| 14.3(Temperature-Rise) |
- |
0 |
|
- |
| 14.3(Temperature-Rise) |
- |
0 |
|
- |
| 14.3(Temperature-Rise) |
- |
0 |
|
- |
| 14.3(Temperature-Rise) |
- |
0 |
|
- |
| 14.3(Temperature-Rise) |
- |
0 |
|
- |
| 14.3(Temperature-Rise) |
- |
0 |
|
- |
| 14.4(Moistureproofness (for regulators only)) |
- |
0 |
|
- |
| 14.4(Moistureproofness (for regulators only)) |
- |
0 |
|
- |
| 14.5(Mechanical Endurance (for regulators only)) |
- |
0 |
|
- |
| 14.1 & 14.6(Power factor) |
- |
0 |
|
- |
| 14.7(ac leakage) |
- |
0 |
|
- |
| 14.8(High voltage test) |
- |
0 |
|
- |
| 14.9(Insulation-Resistance) |
- |
0 |
|
- |
| 14.1(Earthing continuity) |
- |
0 |
|
- |
| 14.11 & 15.1(Electrical Input) |
- |
0 |
|
- |
| 14.12 & 16(Fan Speed) |
- |
0 |
|
- |
| 14.13(Flash Test) |
- |
0 |
|
- |
| 12(Silent Operation) |
- |
0 |
|
- |
| Cl-16(Tolerances on ratings) |
- |
0 |
|
- |
| 13.1(Marking) |
- |
0 |
|
- |
| 13.1 (a)(Marking) |
- |
0 |
|
- |
| 13.1 (b)(Marking) |
- |
0 |
|
- |
| 13.1 (c)(Marking) |
- |
0 |
|
- |
| 13.1 (d)(Marking) |
- |
0 |
|
- |
| 13.1 (e)(Marking) |
- |
0 |
|
- |
| 13.1 (f)(Marking) |
- |
0 |
|
- |
| 13.1 (g)(Marking) |
- |
0 |
|
- |
| 13.1 (h)(Marking) |
- |
0 |
|
- |
| 13.1 (j)(Marking) |
- |
0 |
|
- |
| 13.2(Marking) |
- |
0 |
|
- |
| 13.4(Marking) |
- |
0 |
|
- |
| 3.1(Sizes ) |
- |
0 |
|
- |
| 4.1(Rated Voltage) |
- |
0 |
|
- |
| 5.1(Rated frequency) |
- |
0 |
|
- |
| 6.1(Design and General Construction) |
- |
0 |
|
- |
| 6.3(Design and General Construction) |
- |
0 |
|
- |
| 6.3(Design and General Construction) |
- |
0 |
|
- |
| 6.4(Design and General Construction) |
- |
0 |
|
- |
| 6.5(Design and General Construction) |
- |
0 |
|
- |
| 6.6(Design and General Construction) |
- |
0 |
|
- |
| 6.7(Design and General Construction) |
- |
0 |
|
- |
| 6.9(Design and General Construction) |
- |
0 |
|
- |
| 6.1(Design and General Construction) |
- |
0 |
|
- |
| 6.11(Design and General Construction) |
- |
0 |
|
- |
| 6.12(Design and General Construction) |
- |
0 |
|
- |
| 7.1(Design and General Construction) |
- |
0 |
|
- |
| 8.1(Design and General Construction) |
- |
0 |
|
- |
| 9(Design and General Construction) |
- |
0 |
|
- |
| 10.1(Starting ) |
- |
0 |
|
- |
| 11.1(Interchangeability) |
- |
0 |
|
- |
| 14.2 & 15.1(Air Delivery) |
- |
0 |
|
- |
| 14.3.A(Temperature-Rise (for motors)) |
- |
0 |
|
- |
| 14.3.A(Temperature-Rise (for motors)) |
- |
0 |
|
- |
| 14.3.A(Temperature-Rise (for motors)) |
- |
0 |
|
- |
| 14.3.A(Temperature-Rise (for motors)) |
- |
0 |
|
- |
| 14.3.B(Temperature-Rise (for regulators)) |
- |
0 |
|
- |
| 14.3.B(Temperature-Rise (for regulators)) |
- |
0 |
|
- |
| 14.3.B(Moistureproofness (for regulators only)) |
- |
0 |
|
- |
| 14.3.B(Moistureproofness (for regulators only)) |
- |
0 |
|
- |
| 14.5(Mechanical Endurance (for regulators only)) |
- |
0 |
|
- |
| 14.1 & 14.6(Power factor) |
- |
0 |
|
- |
| 14.7(ac leakage) |
- |
0 |
|
- |
| 14.8(High voltage test) |
- |
0 |
|
- |
| 14.9(Insulation-Resistance) |
- |
0 |
|
- |
| 14.1(Earthing continuity) |
- |
0 |
|
- |
| 14.11 & 15.1(Electrical Input) |
- |
0 |
|
- |
| 14.12 & 16(Fan Speed) |
- |
0 |
|
- |
| 13.1(Marking) |
- |
0 |
|
- |
| 13.1 (a)(Marking) |
- |
0 |
|
- |
| 13.1 (b)(Marking) |
- |
0 |
|
- |
| 13.1 (c)(Marking) |
- |
0 |
|
- |
| 13.1 (d)(Marking) |
- |
0 |
|
- |
| 13.1 (e)(Marking) |
- |
0 |
|
- |
| 13.1 (f)(Marking) |
- |
0 |
|
- |
| 13.1 (g)(Marking) |
- |
0 |
|
- |
| 13.1 (h)(Marking) |
- |
0 |
|
- |
| 13.1 (j)(Marking) |
- |
0 |
|
- |
| 13.2(Marking) |
- |
0 |
|
- |
| 13.4(Marking) |
- |
0 |
|
- |
| 3.1(Sizes ) |
- |
0 |
|
- |
| 4.1(Rated Voltage) |
- |
0 |
|
- |
| 5.1(Rated frequency) |
- |
0 |
|
- |
| 6.1(Design and General Construction) |
- |
0 |
|
- |
| 6.3(Design and General Construction) |
- |
0 |
|
- |
| 6.3(Design and General Construction) |
- |
0 |
|
- |
| 6.4(Design and General Construction) |
- |
0 |
|
- |
| 6.5(Design and General Construction) |
- |
0 |
|
- |
| 6.6(Design and General Construction) |
- |
0 |
|
- |
| 6.7(Design and General Construction) |
- |
0 |
|
- |
| 6.9(Design and General Construction) |
- |
0 |
|
- |
| 6.1(Design and General Construction) |
- |
0 |
|
- |
| 6.11(Design and General Construction) |
- |
0 |
|
- |
| 6.12(Design and General Construction) |
- |
0 |
|
- |
| 7.1(Design and General Construction) |
- |
0 |
|
- |
| 8.1(Design and General Construction) |
- |
0 |
|
- |
| 9(Design and General Construction) |
- |
0 |
|
- |
| 10.1(Starting ) |
- |
0 |
|
- |
| 11.1(Interchangeability) |
- |
0 |
|
- |
| 14.2 & 15.1(Air Delivery) |
- |
0 |
|
- |
| 14.3(Temperature-Rise) |
- |
0 |
|
- |
| 14.3(Temperature-Rise) |
- |
0 |
|
- |
| 14.3(Temperature-Rise) |
- |
0 |
|
- |
| 14.3(Temperature-Rise) |
- |
0 |
|
- |
| 14.3(Temperature-Rise) |
- |
0 |
|
- |
| 14.3(Temperature-Rise) |
- |
0 |
|
- |
| 14.3(Temperature-Rise) |
- |
0 |
|
- |
| 14.4(Moistureproofness (for regulators only)) |
- |
0 |
|
- |
| 14.4(Moistureproofness (for regulators only)) |
- |
0 |
|
- |
| 14.5(Mechanical Endurance (for regulators only)) |
- |
0 |
|
- |
| 14.1 & 14.6(Power factor) |
- |
0 |
|
- |
| 14.7(ac leakage) |
- |
0 |
|
- |
| 14.8(High voltage test) |
- |
0 |
|
- |
| 14.9(Insulation-Resistance) |
- |
0 |
|
- |
| 14.1(Earthing continuity) |
- |
0 |
|
- |
| 14.11 & 15.1(Electrical Input) |
- |
0 |
|
- |
| 14.12 & 16(Fan Speed) |
- |
0 |
|
- |
| 14.13(Flash Test) |
- |
0 |
|
- |
| 12(Silent Operation) |
- |
0 |
|
- |
| Cl-16(Tolerances on ratings) |
- |
0 |
|
- |
|
- |
-
Included w.e.f. 18.08.2025 |
| 24 |
IS 302 : Part 2 : Sec 202 (1992) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 202 electric stoves |
Rated voltage not exceed 250V, a.c, for single phase ac supply. |
13500 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 6(Classification- IS 302-1 ) |
- |
500 |
|
- |
| 6(Classification- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
500 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.3(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.4(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.6(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.11(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.12(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.13(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.14(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.15(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.101(Marking) |
- |
0 |
|
- |
| 8( Protection Against Electric Shock, IS 302-1) |
- |
500 |
|
- |
| 10(Power Input and Current, IS 302-1) |
- |
500 |
|
- |
| 11(Heating, IS 302-1) |
- |
1000 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 12(Operation under overload conditions of appliances with heating elements, IS 302-2-202: 1992) |
- |
0 |
|
- |
| 13(Electrical Insulation and Leakage Current at Operating Temperature: Leakage current, IS 302-1) |
- |
1000 |
|
- |
| 13(Electrical Insulation and Leakage Current at Operating Temperature: High Voltage, IS 302-1) |
- |
0 |
|
- |
| 15.1(Moisture Resistance, IS 302-1) |
- |
1500 |
|
- |
| 15.3(Moisture Resistance, IS 302-1) |
- |
0 |
|
- |
| 16(Electrical Insulation and Leakage Current at Operating Temperature: Leakage current, IS 302-1) |
- |
1000 |
|
- |
| 16(Electrical Insulation and Leakage Current at Operating Temperature: High Voltage, IS 302-1) |
- |
0 |
|
- |
| 19.2(Abnormal Operation, IS 302-1) |
- |
1000 |
|
- |
| 19.2(Abnormal Operation, IS 302-1) |
- |
0 |
|
- |
| 19.3(Abnormal Operation, IS 302-1) |
- |
0 |
|
- |
| 19.3(Abnormal Operation, IS 302-1) |
- |
0 |
|
- |
| 20.1(Stability & Mechanical Hazards, IS 302-1) |
- |
500 |
|
- |
| 21.1(Mechanical Strength, IS 302-1 & IS 302-2-202) |
- |
500 |
|
- |
| 22(Construction, IS 302-1) |
- |
500 |
|
- |
| 22.101(Construction) |
- |
0 |
|
- |
| 22.102(Construction) |
- |
0 |
|
- |
| 22.103(Construction) |
- |
0 |
|
- |
| 22.104(Construction) |
- |
0 |
|
- |
| 22.105(Construction) |
- |
0 |
|
- |
| 22.105.1(Construction) |
- |
0 |
|
- |
| 22.105.2(Construction) |
- |
0 |
|
- |
| 22.106(Construction) |
- |
0 |
|
- |
| 22.107(Construction) |
- |
0 |
|
- |
| 11.107.1(Construction) |
- |
0 |
|
- |
| 23.1(Internal Wiring, IS 302-1) |
- |
500 |
|
- |
| 23.2(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.8(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.9(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.10(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 24.1(Components, IS 302-1) |
- |
500 |
|
- |
| 24.2(Components, IS 302-1) |
- |
0 |
|
- |
| 24.101(Components) |
- |
0 |
|
- |
| 25.1(Supply Connection and External Flexible Cords, IS 302-1) |
- |
500 |
|
- |
| 25.4(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| 25.5(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.6(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.8(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 26.9(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.1(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.11(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.12(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.15(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.16(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.17(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.18(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.19(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.2(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.21(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.22(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 26(Terminals for External Conductors, IS 302-1) |
- |
500 |
|
- |
| 27.1(Provision for Earthing, IS 302-1) |
- |
500 |
|
- |
| 27.2(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27.3(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27.4(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27.5(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 28(Screws & Connections, IS 302-1) |
- |
500 |
|
- |
| 29.1(Clearances, Creepage distances and Solid Insulation, IS 302-1) |
- |
500 |
|
- |
| 29.2(Clearances, Creepage distances and Solid Insulation, IS 302-1) |
- |
0 |
|
- |
| 30.1(Resistance to Heat, Fire & Tracking, IS 302-1) |
- |
500 |
|
- |
| 30.2(Resistance to Heat, Fire & Tracking, IS 302-1) |
- |
0 |
|
- |
| 31(Resistance of Rusting, IS 302-1) |
- |
500 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
|
- |
-
Included w.e.f. 18.08.2025
Exclusion: "19.11.4.7 (Harmonics)
19.11.4.6 (Class 3 Voltage dips and interruptions)
19.11.4.5 (Immunity to conducted discharges)
19.11.4.4 (Surge immunity test)
19.11.4.3 (Fast transient bursts)
19.11.4.2 (Radiated fields)
19.11.4.1 (Electrostatic discharges)
" |
| 25 |
IS 302 : Part 2 : Sec 23 (2009) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 23 appliances for skin or hair care (First Revision) |
Their rated voltage being not more than 250 V |
18000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 32(Radiation ,Toxicity and similar hazards) |
- |
0 |
|
- |
| 31(Resistance to Rusting) |
- |
1000 |
|
- |
| 30(Resistance to Heat & Fire) |
- |
1000 |
|
- |
| 29(Clearances, Creepage Distances & Solid Insulation) |
- |
500 |
|
- |
| 28(Screws & Connection) |
- |
500 |
|
- |
| 27(Provision For Earthing) |
- |
500 |
|
- |
| 26(Terminals For External Conductors) |
- |
500 |
|
- |
| 25(Supply Connection & External Flexible Cables and Cords) |
- |
2000 |
|
- |
| 24(Component) |
- |
500 |
|
- |
| 23(Internal wiring) |
- |
1000 |
|
- |
| 22(Construction) |
- |
1000 |
|
- |
| 21(Mechanical strength) |
- |
1000 |
|
- |
| 20(Stability & Mechanical Hazards) |
- |
500 |
|
- |
| 19(Abnormal Operation) |
- |
1000 |
|
- |
| 18(Endurance) |
- |
0 |
|
- |
| 17(Overload Protection/ Overload Protection of Transformers & Associated Circuits) |
- |
0 |
|
- |
| 16(Leakage Current and Electric Strength) |
- |
1000 |
|
- |
| 15(Moisture Resistance) |
- |
2000 |
|
- |
| 14(Transient Over Voltage) |
- |
0 |
|
- |
| 13(Leakage Current and Electric Strength at Operating Temperature) |
- |
1000 |
|
- |
| 11(Temperature Rise/Heating) |
- |
1000 |
|
- |
| 10(Power Input
& Current) |
- |
500 |
|
- |
| 9(Starting Of Motor Operated Appliances) |
- |
0 |
|
- |
| 8(Protection against Electric Shock/ Protection against Access to Live Parts) |
- |
500 |
|
- |
| 7(Marking/ Marking & Instructions) |
- |
500 |
|
- |
| 6(Classification) |
- |
500 |
|
- |
| 22.32(CONSTRUCTION) |
- |
0 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
| 32(Radiation ,Toxicity and similar hazards) |
- |
0 |
|
- |
| 31(Resistance to Rusting) |
- |
0 |
|
- |
| 30(Resistance to Heat & Fire) |
- |
0 |
|
- |
| 29(Clearances, Creepage Distances & Solid Insulation) |
- |
0 |
|
- |
| 28(Screws & Connection) |
- |
0 |
|
- |
| 27(Provision For Earthing) |
- |
0 |
|
- |
| 26(Terminals For External Conductors) |
- |
0 |
|
- |
| 25(Supply Connection & External Flexible Cables and Cords) |
- |
0 |
|
- |
| 24(Component) |
- |
0 |
|
- |
| 23(Internal wiring) |
- |
0 |
|
- |
| 22(Construction) |
- |
0 |
|
- |
| 21(Mechanical strength) |
- |
0 |
|
- |
| 20(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| 19(Abnormal Operation) |
- |
0 |
|
- |
| 18(Endurance) |
- |
0 |
|
- |
| 17(Overload Protection/ Overload Protection of Transformers & Associated Circuits) |
- |
0 |
|
- |
| 16(Leakage Current and Electric Strength) |
- |
0 |
|
- |
| 15(Moisture Resistance) |
- |
0 |
|
- |
| 14(Transient Over Voltage) |
- |
0 |
|
- |
| 13(Leakage Current and Electric Strength at Operating Temperature) |
- |
0 |
|
- |
| 11(Temperature Rise/Heating) |
- |
0 |
|
- |
| 10(Power Input
& Current) |
- |
0 |
|
- |
| 9(Starting Of Motor Operated Appliances) |
- |
0 |
|
- |
| 8(Protection against Electric Shock/ Protection against Access to Live Parts) |
- |
0 |
|
- |
| 7(Marking/ Marking & Instructions) |
- |
0 |
|
- |
| 6(Classification) |
- |
0 |
|
- |
| 22.32(CONSTRUCTION) |
- |
0 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
| 32(Radiation ,Toxicity and similar hazards) |
- |
0 |
|
- |
| 31(Resistance to Rusting) |
- |
0 |
|
- |
| 30(Resistance to Heat & Fire) |
- |
0 |
|
- |
| 29(Clearances, Creepage Distances & Solid Insulation) |
- |
0 |
|
- |
| 28(Screws & Connection) |
- |
0 |
|
- |
| 27(Provision For Earthing) |
- |
0 |
|
- |
| 26(Terminals For External Conductors) |
- |
0 |
|
- |
| 25(Supply Connection & External Flexible Cables and Cords) |
- |
0 |
|
- |
| 24(Component) |
- |
0 |
|
- |
| 23(Internal wiring) |
- |
0 |
|
- |
| 22(Construction) |
- |
0 |
|
- |
| 21(Mechanical strength) |
- |
0 |
|
- |
| 20(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| 19(Abnormal Operation) |
- |
0 |
|
- |
| 18(Endurance) |
- |
0 |
|
- |
| 17(Overload Protection/ Overload Protection of Transformers & Associated Circuits) |
- |
0 |
|
- |
| 16(Leakage Current and Electric Strength) |
- |
0 |
|
- |
| 15(Moisture Resistance) |
- |
0 |
|
- |
| 14(Transient Over Voltage) |
- |
0 |
|
- |
| 13(Leakage Current and Electric Strength at Operating Temperature) |
- |
0 |
|
- |
| 11(Temperature Rise/Heating) |
- |
0 |
|
- |
| 10(Power Input
& Current) |
- |
0 |
|
- |
| 9(Starting Of Motor Operated Appliances) |
- |
0 |
|
- |
| 8(Protection against Electric Shock/ Protection against Access to Live Parts) |
- |
0 |
|
- |
| 7(Marking/ Marking & Instructions) |
- |
0 |
|
- |
| 6(Classification) |
- |
0 |
|
- |
| 22.32(CONSTRUCTION) |
- |
0 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
| 32(Radiation ,Toxicity and similar hazards) |
- |
0 |
|
- |
| 31(Resistance to Rusting) |
- |
0 |
|
- |
| 30(Resistance to Heat & Fire) |
- |
0 |
|
- |
| 29(Clearances, Creepage Distances & Solid Insulation) |
- |
0 |
|
- |
| 28(Screws & Connection) |
- |
0 |
|
- |
| 27(Provision For Earthing) |
- |
0 |
|
- |
| 26(Terminals For External Conductors) |
- |
0 |
|
- |
| 25(Supply Connection & External Flexible Cables and Cords) |
- |
0 |
|
- |
| 24(Component) |
- |
0 |
|
- |
| 23(Internal wiring) |
- |
0 |
|
- |
| 22(Construction) |
- |
0 |
|
- |
| 21(Mechanical strength) |
- |
0 |
|
- |
| 20(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| 19(Abnormal Operation) |
- |
0 |
|
- |
| 18(Endurance) |
- |
0 |
|
- |
| 17(Overload Protection/ Overload Protection of Transformers & Associated Circuits) |
- |
0 |
|
- |
| 16(Leakage Current and Electric Strength) |
- |
0 |
|
- |
| 15(Moisture Resistance) |
- |
0 |
|
- |
| 14(Transient Over Voltage) |
- |
0 |
|
- |
| 13(Leakage Current and Electric Strength at Operating Temperature) |
- |
0 |
|
- |
| 11(Temperature Rise/Heating) |
- |
0 |
|
- |
| 10(Power Input
& Current) |
- |
0 |
|
- |
| 9(Starting Of Motor Operated Appliances) |
- |
0 |
|
- |
| 8(Protection against Electric Shock/ Protection against Access to Live Parts) |
- |
0 |
|
- |
| 7(Marking/ Marking & Instructions) |
- |
0 |
|
- |
| 6(Classification) |
- |
0 |
|
- |
| 22.32(CONSTRUCTION) |
- |
0 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
| 32(Radiation ,Toxicity and similar hazards) |
- |
0 |
|
- |
| 31(Resistance to Rusting) |
- |
0 |
|
- |
| 30(Resistance to Heat & Fire) |
- |
0 |
|
- |
| 29(Clearances, Creepage Distances & Solid Insulation) |
- |
0 |
|
- |
| 28(Screws & Connection) |
- |
0 |
|
- |
| 27(Provision For Earthing) |
- |
0 |
|
- |
| 26(Terminals For External Conductors) |
- |
0 |
|
- |
| 25(Supply Connection & External Flexible Cables and Cords) |
- |
0 |
|
- |
| 24(Component) |
- |
0 |
|
- |
| 23(Internal wiring) |
- |
0 |
|
- |
| 22(Construction) |
- |
0 |
|
- |
| 21(Mechanical strength) |
- |
0 |
|
- |
| 20(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| 19(Abnormal Operation) |
- |
0 |
|
- |
| 18(Endurance) |
- |
0 |
|
- |
| 17(Overload Protection/ Overload Protection of Transformers & Associated Circuits) |
- |
0 |
|
- |
| 16(Leakage Current and Electric Strength) |
- |
0 |
|
- |
| 15(Moisture Resistance) |
- |
0 |
|
- |
| 14(Transient Over Voltage) |
- |
0 |
|
- |
| 13(Leakage Current and Electric Strength at Operating Temperature) |
- |
0 |
|
- |
| 11(Temperature Rise/Heating) |
- |
0 |
|
- |
| 10(Power Input
& Current) |
- |
0 |
|
- |
| 9(Starting Of Motor Operated Appliances) |
- |
0 |
|
- |
| 8(Protection against Electric Shock/ Protection against Access to Live Parts) |
- |
0 |
|
- |
| 7(Marking/ Marking & Instructions) |
- |
0 |
|
- |
| 6(Classification) |
- |
0 |
|
- |
| 22.32(CONSTRUCTION) |
- |
0 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
| 32(Radiation ,Toxicity and similar hazards) |
- |
0 |
|
- |
| 31(Resistance to Rusting) |
- |
0 |
|
- |
| 30(Resistance to Heat & Fire) |
- |
0 |
|
- |
| 29(Clearances, Creepage Distances & Solid Insulation) |
- |
0 |
|
- |
| 28(Screws & Connection) |
- |
0 |
|
- |
| 27(Provision For Earthing) |
- |
0 |
|
- |
| 26(Terminals For External Conductors) |
- |
0 |
|
- |
| 25(Supply Connection & External Flexible Cables and Cords) |
- |
0 |
|
- |
| 24(Component) |
- |
0 |
|
- |
| 23(Internal wiring) |
- |
0 |
|
- |
| 22(Construction) |
- |
0 |
|
- |
| 21(Mechanical strength) |
- |
0 |
|
- |
| 20(Stability & Mechanical Hazards) |
- |
0 |
|
- |
| 19(Abnormal Operation) |
- |
0 |
|
- |
| 18(Endurance) |
- |
0 |
|
- |
| 17(Overload Protection/ Overload Protection of Transformers & Associated Circuits) |
- |
0 |
|
- |
| 16(Leakage Current and Electric Strength) |
- |
0 |
|
- |
| 15(Moisture Resistance) |
- |
0 |
|
- |
| 14(Transient Over Voltage) |
- |
0 |
|
- |
| 13(Leakage Current and Electric Strength at Operating Temperature) |
- |
0 |
|
- |
| 11(Temperature Rise/Heating) |
- |
0 |
|
- |
| 10(Power Input
& Current) |
- |
0 |
|
- |
| 9(Starting Of Motor Operated Appliances) |
- |
0 |
|
- |
| 8(Protection against Electric Shock/ Protection against Access to Live Parts) |
- |
0 |
|
- |
| 7(Marking/ Marking & Instructions) |
- |
0 |
|
- |
| 6(Classification) |
- |
0 |
|
- |
| 22.32(CONSTRUCTION) |
- |
0 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
|
- |
-
Included w.e.f.03.09.2025
Exclusion
"19.11.4.1 TO 19.11.4.7 EMI/EMC
32 (Radiation ,Toxicity and similar hazards)
24 (Component)" |
| 26 |
IS 302 : Part 2 : Sec 6 (2009) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 6 cooking ranges, hobs, ovens and similar appliances (First Revision) |
Their rated voltage being not more than 250 V for single-phase appliances connected between one phase and neutral, and 480 V for other appliances. |
17000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 6.0(Classification) |
- |
500 |
|
- |
| 7.0(Marking and instructions) |
- |
1000 |
|
- |
| 8.0(Protection against access to live part test) |
- |
500 |
|
- |
| 9.0(Starting of motor-operated appliances test) |
- |
0 |
|
- |
| 10.0(Power Input and current test) |
- |
500 |
|
- |
| 11.0(Heating test) |
- |
1000 |
|
- |
| 13.0(Leakage current and electric strength test) |
- |
1000 |
|
- |
| 14.0(Transient voltages) |
- |
0 |
|
- |
| 15.0(Moisture Resistance) |
- |
2000 |
|
- |
| 16.0(Leakage current and electric strength test) |
- |
1000 |
|
- |
| 17.0(Overload protection of transformers test) |
- |
0 |
|
- |
| 18.0(Endurance test) |
- |
0 |
|
- |
| 19.0(Abnormal Operations) |
- |
1000 |
|
- |
| 20.0(Stability and Mechanical Hazards) |
- |
500 |
|
- |
| 21.0(Mechanical Strength) |
- |
500 |
|
- |
| 22.0(Construction verification related tests) |
- |
500 |
|
- |
| 23.0(Internal wiring) |
- |
500 |
|
- |
| 24.0(Components) |
- |
500 |
|
- |
| 25.0(Supply connections and External Flexible Cords) |
- |
1000 |
|
- |
| 26.0(Terminal for External Conductors) |
- |
500 |
|
- |
| 27.0(Provision for Earthing) |
- |
500 |
|
- |
| 28.0(Screws and connections) |
- |
500 |
|
- |
| 29.0(Clearances and Creepage distances and solid insulation) |
- |
500 |
|
- |
| 30.0(Resistance to heat and fire) |
- |
2000 |
|
- |
| 31.0(Resistance to rusting) |
- |
1000 |
|
- |
| 32.0(Radiation, Toxicity and Similar hazards) |
- |
0 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
| 4(General Requirements) |
- |
0 |
|
- |
| 5(General condition for the tests) |
- |
0 |
|
- |
| 22.111(Pyrolytic self-cleaning) |
- |
0 |
|
- |
| 6.0(Classification) |
- |
0 |
|
- |
| 7.0(Marking and instructions) |
- |
0 |
|
- |
| 8.0(Protection against access to live part test) |
- |
0 |
|
- |
| 9.0(Starting of motor-operated appliances test) |
- |
0 |
|
- |
| 10.0(Power Input and current test) |
- |
0 |
|
- |
| 11.0(Heating test) |
- |
0 |
|
- |
| 13.0(Leakage current and electric strength test) |
- |
0 |
|
- |
| 14.0(Transient voltages) |
- |
0 |
|
- |
| 15.0(Moisture Resistance) |
- |
0 |
|
- |
| 16.0(Leakage current and electric strength test) |
- |
0 |
|
- |
| 17.0(Overload protection of transformers test) |
- |
0 |
|
- |
| 18.0(Endurance test) |
- |
0 |
|
- |
| 19.0(Abnormal Operations) |
- |
0 |
|
- |
| 20.0(Stability and Mechanical Hazards) |
- |
0 |
|
- |
| 21.0(Mechanical Strength) |
- |
0 |
|
- |
| 22.0(Construction verification related tests) |
- |
0 |
|
- |
| 23.0(Internal wiring) |
- |
0 |
|
- |
| 24.0(Components) |
- |
0 |
|
- |
| 25.0(Supply connections and External Flexible Cords) |
- |
0 |
|
- |
| 26.0(Terminal for External Conductors) |
- |
0 |
|
- |
| 27.0(Provision for Earthing) |
- |
0 |
|
- |
| 28.0(Screws and connections) |
- |
0 |
|
- |
| 29.0(Clearances and Creepage distances and solid insulation) |
- |
0 |
|
- |
| 30.0(Resistance to heat and fire) |
- |
0 |
|
- |
| 31.0(Resistance to rusting) |
- |
0 |
|
- |
| 32.0(Radiation, Toxicity and Similar hazards) |
- |
0 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
| 4(General Requirements) |
- |
0 |
|
- |
| 5(General condition for the tests) |
- |
0 |
|
- |
| 22.111(Pyrolytic self-cleaning) |
- |
0 |
|
- |
| 6.0(Classification) |
- |
0 |
|
- |
| 7.0(Marking and instructions) |
- |
0 |
|
- |
| 8.0(Protection against access to live part test) |
- |
0 |
|
- |
| 9.0(Starting of motor-operated appliances test) |
- |
0 |
|
- |
| 10.0(Power Input and current test) |
- |
0 |
|
- |
| 11.0(Heating test) |
- |
0 |
|
- |
| 13.0(Leakage current and electric strength test) |
- |
0 |
|
- |
| 14.0(Transient voltages) |
- |
0 |
|
- |
| 15.0(Moisture Resistance) |
- |
0 |
|
- |
| 16.0(Leakage current and electric strength test) |
- |
0 |
|
- |
| 17.0(Overload protection of transformers test) |
- |
0 |
|
- |
| 18.0(Endurance test) |
- |
0 |
|
- |
| 19.0(Abnormal Operations) |
- |
0 |
|
- |
| 20.0(Stability and Mechanical Hazards) |
- |
0 |
|
- |
| 21.0(Mechanical Strength) |
- |
0 |
|
- |
| 22.0(Construction verification related tests) |
- |
0 |
|
- |
| 23.0(Internal wiring) |
- |
0 |
|
- |
| 24.0(Components) |
- |
0 |
|
- |
| 25.0(Supply connections and External Flexible Cords) |
- |
0 |
|
- |
| 26.0(Terminal for External Conductors) |
- |
0 |
|
- |
| 27.0(Provision for Earthing) |
- |
0 |
|
- |
| 28.0(Screws and connections) |
- |
0 |
|
- |
| 29.0(Clearances and Creepage distances and solid insulation) |
- |
0 |
|
- |
| 30.0(Resistance to heat and fire) |
- |
0 |
|
- |
| 31.0(Resistance to rusting) |
- |
0 |
|
- |
| 32.0(Radiation, Toxicity and Similar hazards) |
- |
0 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
| 4(General Requirements) |
- |
0 |
|
- |
| 5(General condition for the tests) |
- |
0 |
|
- |
| 22.111(Pyrolytic self-cleaning) |
- |
0 |
|
- |
| 6.0(Classification) |
- |
0 |
|
- |
| 7.0(Marking and instructions) |
- |
0 |
|
- |
| 8.0(Protection against access to live part test) |
- |
0 |
|
- |
| 9.0(Starting of motor-operated appliances test) |
- |
0 |
|
- |
| 10.0(Power Input and current test) |
- |
0 |
|
- |
| 11.0(Heating test) |
- |
0 |
|
- |
| 13.0(Leakage current and electric strength test) |
- |
0 |
|
- |
| 14.0(Transient voltages) |
- |
0 |
|
- |
| 15.0(Moisture Resistance) |
- |
0 |
|
- |
| 16.0(Leakage current and electric strength test) |
- |
0 |
|
- |
| 17.0(Overload protection of transformers test) |
- |
0 |
|
- |
| 18.0(Endurance test) |
- |
0 |
|
- |
| 19.0(Abnormal Operations) |
- |
0 |
|
- |
| 20.0(Stability and Mechanical Hazards) |
- |
0 |
|
- |
| 21.0(Mechanical Strength) |
- |
0 |
|
- |
| 22.0(Construction verification related tests) |
- |
0 |
|
- |
| 23.0(Internal wiring) |
- |
0 |
|
- |
| 24.0(Components) |
- |
0 |
|
- |
| 25.0(Supply connections and External Flexible Cords) |
- |
0 |
|
- |
| 26.0(Terminal for External Conductors) |
- |
0 |
|
- |
| 27.0(Provision for Earthing) |
- |
0 |
|
- |
| 28.0(Screws and connections) |
- |
0 |
|
- |
| 29.0(Clearances and Creepage distances and solid insulation) |
- |
0 |
|
- |
| 30.0(Resistance to heat and fire) |
- |
0 |
|
- |
| 31.0(Resistance to rusting) |
- |
0 |
|
- |
| 32.0(Radiation, Toxicity and Similar hazards) |
- |
0 |
|
- |
| 19.11.4.1(Electrostatic discharges) |
- |
0 |
|
- |
| 19.11.4.2(Radiated fields) |
- |
0 |
|
- |
| 19.11.4.3(Fast transient bursts) |
- |
0 |
|
- |
| 19.11.4.4(Surge immunity test) |
- |
0 |
|
- |
| 19.11.4.5(Immunity to conducted discharges) |
- |
0 |
|
- |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
0 |
|
- |
| 19.11.4.7(Harmonics) |
- |
0 |
|
- |
| 4(General Requirements) |
- |
0 |
|
- |
| 5(General condition for the tests) |
- |
0 |
|
- |
| 22.111(Pyrolytic self-cleaning) |
- |
0 |
|
- |
|
- |
-
Included w.e.f. 21.08.2025
Exclusion: "19.11.4.1 (Electrostatic discharges)
19.11.4.2 (Radiated fields)
19.11.4.3 (Fast transient bursts)
19.11.4.4 (Surge immunity test)
19.11.4.5 (Immunity to conducted discharges)
19.11.4.6 (Class 3 Voltage dips and interruptions)
19.11.4.7 (Harmonics)
32.0 (Radiation, Toxicity and Similar hazards)
" |
| 27 |
IS 302 : Part 2 : Sec 3 (2024) |
Household and Similar Electrical Appliances âSafety Part 2 Particular Requirements Section 3 Electric Irons (Second Revision) |
Rated voltage being not more than 250V include direct current (DC) supplied appliances and battery-operated appliances. |
21000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl-4(General requirement) |
- |
0 |
|
- |
| Cl-7(Marking and instructions) |
- |
1000 |
|
- |
| Cl-8(Protection against access to live parts) |
- |
500 |
|
- |
| Cl-10(Power input and current) |
- |
1000 |
|
- |
| Cl-11(Heating) |
- |
2000 |
|
- |
| Cl-12(Charging of metal-ion batteries) |
- |
0 |
|
- |
| Cl-13(Leakage current and electric strength at operating temperature) |
- |
1000 |
|
- |
| Cl-14(Transient overvoltages) |
- |
0 |
|
- |
| Cl-15(Moisture resistance) |
- |
2000 |
|
- |
| Cl-16(Leakage current and electric strength) |
- |
1000 |
|
- |
| Cl-17(Overload protection of transformers and associated circuits) |
- |
0 |
|
- |
| Cl-18(Endurance) |
- |
0 |
|
- |
| Cl-19(Abnormal operation) |
- |
2000 |
|
- |
| Cl-20(Stability and mechanical hazards) |
- |
500 |
|
- |
| Cl-21(Mechanical strength) |
- |
1000 |
|
- |
| Cl-22(Construction) |
- |
500 |
|
- |
| Cl-23(Internal wiring) |
- |
1000 |
|
- |
| Cl-24(Components) |
- |
500 |
|
- |
| Cl-25(Supply connection and external flexible cords) |
- |
2000 |
|
- |
| Cl-26(Terminals for external conductors) |
- |
500 |
|
- |
| Cl-27(Provision for earthing) |
- |
1000 |
|
- |
| Cl-28(Screws and connections) |
- |
500 |
|
- |
| Cl-29(Clearances, creepage distances and solid insulation) |
- |
500 |
|
- |
| Cl-30(Resistance to heat and fire) |
- |
2000 |
|
- |
| Cl-31(Resistance to rusting) |
- |
1000 |
|
- |
| Cl-32(Radiation, toxicity and similar hazards) |
- |
0 |
|
- |
| Cl-4(General requirement) |
- |
0 |
|
- |
| Cl-7(Marking and instructions) |
- |
0 |
|
- |
| Cl-8(Protection against access to live parts) |
- |
0 |
|
- |
| Cl-10(Power input and current) |
- |
0 |
|
- |
| Cl-11(Heating) |
- |
0 |
|
- |
| Cl-12(Charging of metal-ion batteries) |
- |
0 |
|
- |
| Cl-13(Leakage current and electric strength at operating temperature) |
- |
0 |
|
- |
| Cl-14(Transient overvoltages) |
- |
0 |
|
- |
| Cl-15(Moisture resistance) |
- |
0 |
|
- |
| Cl-16(Leakage current and electric strength) |
- |
0 |
|
- |
| Cl-17(Overload protection of transformers and associated circuits) |
- |
0 |
|
- |
| Cl-18(Endurance) |
- |
0 |
|
- |
| Cl-19(Abnormal operation) |
- |
0 |
|
- |
| Cl-20(Stability and mechanical hazards) |
- |
0 |
|
- |
| Cl-21(Mechanical strength) |
- |
0 |
|
- |
| Cl-22(Construction) |
- |
0 |
|
- |
| Cl-23(Internal wiring) |
- |
0 |
|
- |
| Cl-24(Components) |
- |
0 |
|
- |
| Cl-25(Supply connection and external flexible cords) |
- |
0 |
|
- |
| Cl-26(Terminals for external conductors) |
- |
0 |
|
- |
| Cl-27(Provision for earthing) |
- |
0 |
|
- |
| Cl-28(Screws and connections) |
- |
0 |
|
- |
| Cl-29(Clearances, creepage distances and solid insulation) |
- |
0 |
|
- |
| Cl-30(Resistance to heat and fire) |
- |
0 |
|
- |
| Cl-31(Resistance to rusting) |
- |
0 |
|
- |
| Cl-32(Radiation, toxicity and similar hazards) |
- |
0 |
|
- |
| Cl-4(General requirement) |
- |
0 |
|
- |
| Cl-7(Marking and instructions) |
- |
0 |
|
- |
| Cl-8(Protection against access to live parts) |
- |
0 |
|
- |
| Cl-10(Power input and current) |
- |
0 |
|
- |
| Cl-11(Heating) |
- |
0 |
|
- |
| Cl-12(Charging of metal-ion batteries) |
- |
0 |
|
- |
| Cl-13(Leakage current and electric strength at operating temperature) |
- |
0 |
|
- |
| Cl-14(Transient overvoltages) |
- |
0 |
|
- |
| Cl-15(Moisture resistance) |
- |
0 |
|
- |
| Cl-16(Leakage current and electric strength) |
- |
0 |
|
- |
| Cl-17(Overload protection of transformers and associated circuits) |
- |
0 |
|
- |
| Cl-18(Endurance) |
- |
0 |
|
- |
| Cl-19(Abnormal operation) |
- |
0 |
|
- |
| Cl-20(Stability and mechanical hazards) |
- |
0 |
|
- |
| Cl-21(Mechanical strength) |
- |
0 |
|
- |
| Cl-22(Construction) |
- |
0 |
|
- |
| Cl-23(Internal wiring) |
- |
0 |
|
- |
| Cl-24(Components) |
- |
0 |
|
- |
| Cl-25(Supply connection and external flexible cords) |
- |
0 |
|
- |
| Cl-26(Terminals for external conductors) |
- |
0 |
|
- |
| Cl-27(Provision for earthing) |
- |
0 |
|
- |
| Cl-28(Screws and connections) |
- |
0 |
|
- |
| Cl-29(Clearances, creepage distances and solid insulation) |
- |
0 |
|
- |
| Cl-30(Resistance to heat and fire) |
- |
0 |
|
- |
| Cl-31(Resistance to rusting) |
- |
0 |
|
- |
| Cl-32(Radiation, toxicity and similar hazards) |
- |
0 |
|
- |
| Cl-4(General requirement) |
- |
0 |
|
- |
| Cl-7(Marking and instructions) |
- |
0 |
|
- |
| Cl-8(Protection against access to live parts) |
- |
0 |
|
- |
| Cl-10(Power input and current) |
- |
0 |
|
- |
| Cl-11(Heating) |
- |
0 |
|
- |
| Cl-12(Charging of metal-ion batteries) |
- |
0 |
|
- |
| Cl-13(Leakage current and electric strength at operating temperature) |
- |
0 |
|
- |
| Cl-14(Transient overvoltages) |
- |
0 |
|
- |
| Cl-15(Moisture resistance) |
- |
0 |
|
- |
| Cl-16(Leakage current and electric strength) |
- |
0 |
|
- |
| Cl-17(Overload protection of transformers and associated circuits) |
- |
0 |
|
- |
| Cl-18(Endurance) |
- |
0 |
|
- |
| Cl-19(Abnormal operation) |
- |
0 |
|
- |
| Cl-20(Stability and mechanical hazards) |
- |
0 |
|
- |
| Cl-21(Mechanical strength) |
- |
0 |
|
- |
| Cl-22(Construction) |
- |
0 |
|
- |
| Cl-23(Internal wiring) |
- |
0 |
|
- |
| Cl-24(Components) |
- |
0 |
|
- |
| Cl-25(Supply connection and external flexible cords) |
- |
0 |
|
- |
| Cl-26(Terminals for external conductors) |
- |
0 |
|
- |
| Cl-27(Provision for earthing) |
- |
0 |
|
- |
| Cl-28(Screws and connections) |
- |
0 |
|
- |
| Cl-29(Clearances, creepage distances and solid insulation) |
- |
0 |
|
- |
| Cl-30(Resistance to heat and fire) |
- |
0 |
|
- |
| Cl-31(Resistance to rusting) |
- |
0 |
|
- |
| Cl-32(Radiation, toxicity and similar hazards) |
- |
0 |
|
- |
| Cl-4(General requirement) |
- |
0 |
|
- |
| Cl-7(Marking and instructions) |
- |
0 |
|
- |
| Cl-8(Protection against access to live parts) |
- |
0 |
|
- |
| Cl-10(Power input and current) |
- |
0 |
|
- |
| Cl-11(Heating) |
- |
0 |
|
- |
| Cl-12(Charging of metal-ion batteries) |
- |
0 |
|
- |
| Cl-13(Leakage current and electric strength at operating temperature) |
- |
0 |
|
- |
| Cl-14(Transient overvoltages) |
- |
0 |
|
- |
| Cl-15(Moisture resistance) |
- |
0 |
|
- |
| Cl-16(Leakage current and electric strength) |
- |
0 |
|
- |
| Cl-17(Overload protection of transformers and associated circuits) |
- |
0 |
|
- |
| Cl-18(Endurance) |
- |
0 |
|
- |
| Cl-19(Abnormal operation) |
- |
0 |
|
- |
| Cl-20(Stability and mechanical hazards) |
- |
0 |
|
- |
| Cl-21(Mechanical strength) |
- |
0 |
|
- |
| Cl-22(Construction) |
- |
0 |
|
- |
| Cl-23(Internal wiring) |
- |
0 |
|
- |
| Cl-24(Components) |
- |
0 |
|
- |
| Cl-25(Supply connection and external flexible cords) |
- |
0 |
|
- |
| Cl-26(Terminals for external conductors) |
- |
0 |
|
- |
| Cl-27(Provision for earthing) |
- |
0 |
|
- |
| Cl-28(Screws and connections) |
- |
0 |
|
- |
| Cl-29(Clearances, creepage distances and solid insulation) |
- |
0 |
|
- |
| Cl-30(Resistance to heat and fire) |
- |
0 |
|
- |
| Cl-31(Resistance to rusting) |
- |
0 |
|
- |
| Cl-32(Radiation, toxicity and similar hazards) |
- |
0 |
|
- |
| Cl-4(General requirement) |
- |
0 |
|
- |
| Cl-7(Marking and instructions) |
- |
0 |
|
- |
| Cl-8(Protection against access to live parts) |
- |
0 |
|
- |
| Cl-10(Power input and current) |
- |
0 |
|
- |
| Cl-11(Heating) |
- |
0 |
|
- |
| Cl-12(Charging of metal-ion batteries) |
- |
0 |
|
- |
| Cl-13(Leakage current and electric strength at operating temperature) |
- |
0 |
|
- |
| Cl-14(Transient overvoltages) |
- |
0 |
|
- |
| Cl-15(Moisture resistance) |
- |
0 |
|
- |
| Cl-16(Leakage current and electric strength) |
- |
0 |
|
- |
| Cl-17(Overload protection of transformers and associated circuits) |
- |
0 |
|
- |
| Cl-18(Endurance) |
- |
0 |
|
- |
| Cl-19(Abnormal operation) |
- |
0 |
|
- |
| Cl-20(Stability and mechanical hazards) |
- |
0 |
|
- |
| Cl-21(Mechanical strength) |
- |
0 |
|
- |
| Cl-22(Construction) |
- |
0 |
|
- |
| Cl-23(Internal wiring) |
- |
0 |
|
- |
| Cl-24(Components) |
- |
0 |
|
- |
| Cl-25(Supply connection and external flexible cords) |
- |
0 |
|
- |
| Cl-26(Terminals for external conductors) |
- |
0 |
|
- |
| Cl-27(Provision for earthing) |
- |
0 |
|
- |
| Cl-28(Screws and connections) |
- |
0 |
|
- |
| Cl-29(Clearances, creepage distances and solid insulation) |
- |
0 |
|
- |
| Cl-30(Resistance to heat and fire) |
- |
0 |
|
- |
| Cl-31(Resistance to rusting) |
- |
0 |
|
- |
| Cl-32(Radiation, toxicity and similar hazards) |
- |
0 |
|
- |
|
- |
-
Included w.e.f.01.10.2025
Exclusion
"Cl-32 (Radiation, toxicity and similar hazards)
Cl-12 (Charging of metal-ion batteries)
Cl-24 (Components) |
| 28 |
IS 14772 (2020) |
Boxes and Enclosures for Electrical Accessories for Household and Similar Fixed Electrical Installations — General Requirements ( First Revision ) |
Electrical accessories with a rated voltage not exceeding 440 V a.c. intended for household or similar fixed electrical installations, either indoors or outdoors. |
26000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 7.1(Nature of material) |
- |
500 |
|
- |
| 7.2(Type of installation) |
- |
500 |
|
- |
| 7.3(Types of inlets) |
- |
500 |
|
- |
| 7.4(Clamping means) |
- |
500 |
|
- |
| 7.5(Minimum temperature during installation) |
- |
500 |
|
- |
| 7.6, 7.7, 7.8(The degree of ingress protection) |
- |
1000 |
|
- |
| 7.9(The provision for fixing accessories to the boxes ) |
- |
500 |
|
- |
| 7.1(The method of fixing the terminals) |
- |
500 |
|
- |
| 8.1(marking) |
- |
500 |
|
- |
| 8.2(By Inspection and The marking is rubbed by hand 15s width a piece of
cloth soaked with water and again for 15s with a piece of cloth soaked with petroleum spirit.) |
- |
500 |
|
- |
| 8.3(BIS Certification Marking) |
- |
500 |
|
- |
| 9.0(Dimensions) |
- |
500 |
|
- |
| 10.0(Protection against electric shock) |
- |
500 |
|
- |
| 11.0(PROVISION FOR EARTHING) |
- |
500 |
|
- |
| 12.0(Constructions) |
- |
2000 |
|
- |
| 13.0(Resistance to ingress of solid objects) |
- |
2000 |
|
- |
| 13.0(Resistance toharmful ingress of water) |
- |
2000 |
|
- |
| 13.0(Resistance to ageing) |
- |
2000 |
|
- |
| 14.0(insultation resistance) |
- |
500 |
|
- |
| 14.0(electric strength) |
- |
500 |
|
- |
| 15.0(Mechanical strength) |
- |
1000 |
|
- |
| 16.0(resistance to heat) |
- |
1000 |
|
- |
| 17.0(creepage distance) |
- |
500 |
|
- |
| 17.0(clearances) |
- |
500 |
|
- |
| 17.0(distance through seating compund) |
- |
500 |
|
- |
| 18.0(Resistance to insulating material to abnormal heat and fire) |
- |
2000 |
|
- |
| 19.0(Resistance to tracking) |
- |
1000 |
|
- |
| 20.0(Resistance to corrosion) |
- |
2000 |
|
- |
| 21.0(Electromagnetic compatibility (EMC)) |
- |
0 |
|
- |
|
- |
-
Included w.e.f. 18.08.2025
Exclusion: 21.0 (Electromagnetic compatibility (EMC)) |
| 29 |
IS 2993 : Part 1 (2024) |
a.c. Motor Capacitors Part 1 General - Performance, Testing and Rating - Safety Requirements - Guidance for Installation and Operation ( Third Revision ) |
This standard covers impregnated or unimpregnated capacitors having a dielectric of paper, plastic film, or a combination of both, either metallized or with metal-foil electrodes, with rated voltages up to and including 660 V. The minimum cross-sectional |
400000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 5.1.1(General) |
- |
5000 |
|
- |
| 5.5(Tangent of loss angle) |
- |
5000 |
|
- |
| 5.7("Voltage test between terminals
") |
- |
5000 |
|
- |
| 5.8(Voltage test between terminals and case) |
- |
5000 |
|
- |
| 5.9(Capacitance measurement) |
- |
5000 |
|
- |
| 5.9(Capacitance measurement) |
- |
0 |
|
- |
| 5.1(Check of dimensions) |
- |
5000 |
|
- |
| 5.11(Mechanical tests) |
- |
5000 |
|
- |
| 5.12(Sealing test) |
- |
5000 |
|
- |
| 5.13(Endurance test) |
- |
100000 |
|
- |
| 5.14(Damp heat test) |
- |
120000 |
|
- |
| 5.15(Self-healing test) |
- |
20000 |
|
- |
| 5.16(Destruction test) |
- |
30000 |
|
- |
| 5.17(Resistance to heat, fire and tracking) |
- |
20000 |
|
- |
| 5.17.1(Ball-pressure test) |
- |
0 |
|
- |
| 5.17.2(Glow-wire test) |
- |
0 |
|
- |
| 5.17.3(Tracking test) |
- |
0 |
|
- |
| 6.1(Maximum permissible voltage) |
- |
5000 |
|
- |
| 6.2("Maximum permissible current
") |
- |
5000 |
|
- |
| 6.3(Maximum permissible reactive output) |
- |
5000 |
|
- |
| 7(Safety requirements) |
- |
5000 |
|
- |
| 7.1(Requirements for Creepage distances and clearances) |
- |
500 |
|
- |
| 7.2(Terminals and connecting cables) |
- |
5000 |
|
- |
| 7.3(Earth connections) |
- |
5000 |
|
- |
| 7.4(Discharge devices) |
- |
5000 |
|
- |
| 8(Marking) |
- |
10000 |
|
- |
| 9.2.1(Measurements of working voltage) |
- |
4000 |
|
- |
| 9.2.2(Influence of capacitance) |
- |
4000 |
|
- |
| 9.3(Checking capacitor temperature) |
- |
4000 |
|
- |
| 9.4(Checking transients) |
- |
4000 |
|
- |
| 9.5(Leakage current) |
- |
4000 |
|
- |
| 5.1.1(General) |
- |
0 |
|
- |
| 5.5(Tangent of loss angle) |
- |
0 |
|
- |
| 5.7("Voltage test between terminals
") |
- |
0 |
|
- |
| 5.8(Voltage test between terminals and case) |
- |
0 |
|
- |
| 5.9(Capacitance measurement) |
- |
0 |
|
- |
| 5.9(Capacitance measurement) |
- |
0 |
|
- |
| 5.1(Check of dimensions) |
- |
0 |
|
- |
| 5.11(Mechanical tests) |
- |
0 |
|
- |
| 5.12(Sealing test) |
- |
0 |
|
- |
| 5.13(Endurance test) |
- |
0 |
|
- |
| 5.14(Damp heat test) |
- |
0 |
|
- |
| 5.15(Self-healing test) |
- |
0 |
|
- |
| 5.16(Destruction test) |
- |
0 |
|
- |
| 5.17(Resistance to heat, fire and tracking) |
- |
0 |
|
- |
| 5.17.1(Ball-pressure test) |
- |
0 |
|
- |
| 5.17.2(Glow-wire test) |
- |
0 |
|
- |
| 5.17.3(Tracking test) |
- |
0 |
|
- |
| 6.1(Maximum permissible voltage) |
- |
0 |
|
- |
| 6.2("Maximum permissible current
") |
- |
0 |
|
- |
| 6.3(Maximum permissible reactive output) |
- |
0 |
|
- |
| 7(Safety requirements) |
- |
0 |
|
- |
| 7.1(Requirements for Creepage distances and clearances) |
- |
0 |
|
- |
| 7.2(Terminals and connecting cables) |
- |
0 |
|
- |
| 7.3(Earth connections) |
- |
0 |
|
- |
| 7.4(Discharge devices) |
- |
0 |
|
- |
| 8(Marking) |
- |
0 |
|
- |
| 9.2.1(Measurements of working voltage) |
- |
0 |
|
- |
| 9.2.2(Influence of capacitance) |
- |
0 |
|
- |
| 9.3(Checking capacitor temperature) |
- |
0 |
|
- |
| 9.4(Checking transients) |
- |
0 |
|
- |
| 9.5(Leakage current) |
- |
0 |
|
- |
| 5.1.1(General) |
- |
0 |
|
- |
| 5.5(Tangent of loss angle) |
- |
0 |
|
- |
| 5.7("Voltage test between terminals
") |
- |
0 |
|
- |
| 5.8(Voltage test between terminals and case) |
- |
0 |
|
- |
| 5.9(Capacitance measurement) |
- |
0 |
|
- |
| 5.9(Capacitance measurement) |
- |
0 |
|
- |
| 5.1(Check of dimensions) |
- |
0 |
|
- |
| 5.11(Mechanical tests) |
- |
0 |
|
- |
| 5.12(Sealing test) |
- |
0 |
|
- |
| 5.13(Endurance test) |
- |
0 |
|
- |
| 5.14(Damp heat test) |
- |
0 |
|
- |
| 5.15(Self-healing test) |
- |
0 |
|
- |
| 5.16(Destruction test) |
- |
0 |
|
- |
| 5.17(Resistance to heat, fire and tracking) |
- |
0 |
|
- |
| 5.17.1(Ball-pressure test) |
- |
0 |
|
- |
| 5.17.2(Glow-wire test) |
- |
0 |
|
- |
| 5.17.3(Tracking test) |
- |
0 |
|
- |
| 6.1(Maximum permissible voltage) |
- |
0 |
|
- |
| 6.2("Maximum permissible current
") |
- |
0 |
|
- |
| 6.3(Maximum permissible reactive output) |
- |
0 |
|
- |
| 7(Safety requirements) |
- |
0 |
|
- |
| 7.1(Requirements for Creepage distances and clearances) |
- |
0 |
|
- |
| 7.2(Terminals and connecting cables) |
- |
0 |
|
- |
| 7.3(Earth connections) |
- |
0 |
|
- |
| 7.4(Discharge devices) |
- |
0 |
|
- |
| 8(Marking) |
- |
0 |
|
- |
| 9.2.1(Measurements of working voltage) |
- |
0 |
|
- |
| 9.2.2(Influence of capacitance) |
- |
0 |
|
- |
| 9.3(Checking capacitor temperature) |
- |
0 |
|
- |
| 9.4(Checking transients) |
- |
0 |
|
- |
| 9.5(Leakage current) |
- |
0 |
|
- |
| 5.1.1(General) |
- |
0 |
|
- |
| 5.5(Tangent of loss angle) |
- |
0 |
|
- |
| 5.7("Voltage test between terminals
") |
- |
0 |
|
- |
| 5.8(Voltage test between terminals and case) |
- |
0 |
|
- |
| 5.9(Capacitance measurement) |
- |
0 |
|
- |
| 5.9(Capacitance measurement) |
- |
0 |
|
- |
| 5.1(Check of dimensions) |
- |
0 |
|
- |
| 5.11(Mechanical tests) |
- |
0 |
|
- |
| 5.12(Sealing test) |
- |
0 |
|
- |
| 5.13(Endurance test) |
- |
0 |
|
- |
| 5.14(Damp heat test) |
- |
0 |
|
- |
| 5.15(Self-healing test) |
- |
0 |
|
- |
| 5.16(Destruction test) |
- |
0 |
|
- |
| 5.17(Resistance to heat, fire and tracking) |
- |
0 |
|
- |
| 5.17.1(Ball-pressure test) |
- |
0 |
|
- |
| 5.17.2(Glow-wire test) |
- |
0 |
|
- |
| 5.17.3(Tracking test) |
- |
0 |
|
- |
| 6.1(Maximum permissible voltage) |
- |
0 |
|
- |
| 6.2("Maximum permissible current
") |
- |
0 |
|
- |
| 6.3(Maximum permissible reactive output) |
- |
0 |
|
- |
| 7(Safety requirements) |
- |
0 |
|
- |
| 7.1(Requirements for Creepage distances and clearances) |
- |
0 |
|
- |
| 7.2(Terminals and connecting cables) |
- |
0 |
|
- |
| 7.3(Earth connections) |
- |
0 |
|
- |
| 7.4(Discharge devices) |
- |
0 |
|
- |
| 8(Marking) |
- |
0 |
|
- |
| 9.2.1(Measurements of working voltage) |
- |
0 |
|
- |
| 9.2.2(Influence of capacitance) |
- |
0 |
|
- |
| 9.3(Checking capacitor temperature) |
- |
0 |
|
- |
| 9.4(Checking transients) |
- |
0 |
|
- |
| 9.5(Leakage current) |
- |
0 |
|
- |
|
- |
-
Included w.e.f. 18.08.2025 |
| 30 |
IS 7809 : Part 3 : Sec 1 (1986) |
Specification for pressure sensitive adhesive insulating tapes for electrical purposes: Part 3 requirements or individual materials: Sec 1 plasticized polyvinylchloride tapes with non - Thermosetting adhesive (First Revision) |
This standard (Part 3/Sec 1) covers requirements for pressure sensitive adhesive tapes made of plasticized PVC with a non-thermosetting adhesive. |
20000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
500 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 2.1.1(Type and Desiganation) |
- |
500 |
|
- |
| 2.1.2(Type and Desiganation) |
- |
0 |
|
- |
| 3.1(General Requirments,as per IS 7809 (Part 1 ) :1975 ) |
- |
1000 |
|
- |
| 3.2(General Requirments,as per IS 7809 (Part 1 ) :1975 ) |
- |
0 |
|
- |
| 3.3(General Requirments,as per IS 7809 (Part 1 ) :1975 ) |
- |
0 |
|
- |
| 3.4(General Requirments,as per IS 7809 (Part 1 ) :1975 ) |
- |
0 |
|
- |
| 4.1(Performance Requirments) |
- |
500 |
|
- |
| 4.2(Performance Requirments) |
- |
500 |
|
- |
| 4.3(Performance Requirments) |
- |
500 |
|
- |
| 4.4(Performance Requirments) |
- |
500 |
|
- |
| 4.5(Performance Requirments) |
- |
500 |
|
- |
| 4.6(Flammability ,Cl 6 of IS 7809 (Part 2): 1977) |
- |
500 |
|
- |
| 4.6(Flammability ,Cl 6 of IS 7809 (Part 2): 1977) |
- |
500 |
|
- |
| 4.6(Flammability ,Cl 6 of IS 7809 (Part 2): 1977) |
- |
500 |
|
- |
| 4.6(Flammability ,Cl 6 of IS 7809 (Part 2): 1977) |
- |
500 |
|
- |
| 4.7(Electrolytic corrosion) |
- |
2000 |
|
- |
| 4.7(Electrolytic corrosion) |
- |
0 |
|
- |
| 4.7(Electrolytic corrosion) |
- |
0 |
|
- |
| 4.8(Stability to accelerated ageing ) |
- |
1000 |
|
- |
| 4.9(Insulation resistance test) |
- |
500 |
|
- |
| 3.1( Minimum Storage Life Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
500 |
|
- |
| 3.1( Minimum Storage Life Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
0 |
|
- |
| 3.1( Minimum Storage Life Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
0 |
|
- |
| 3.1(Minimum Storage Life ,Dimensions , Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
0 |
|
- |
| 3.1(Minimum Storage Life ,Dimensions , Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
0 |
|
- |
| 3.1(Minimum Storage Life ,Dimensions , Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
0 |
|
- |
| 3.1(Minimum Storage Life ,Dimensions , Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 2.1.1(Type and Desiganation) |
- |
0 |
|
- |
| 2.1.2(Type and Desiganation) |
- |
0 |
|
- |
| 3.1(General Requirments,as per IS 7809 (Part 1 ) :1975 ) |
- |
500 |
|
- |
| 3.2(General Requirments,as per IS 7809 (Part 1 ) :1975 ) |
- |
500 |
|
- |
| 3.3(General Requirments,as per IS 7809 (Part 1 ) :1975 ) |
- |
500 |
|
- |
| 3.4(General Requirments,as per IS 7809 (Part 1 ) :1975 ) |
- |
500 |
|
- |
| 4.1(Performance Requirments) |
- |
500 |
|
- |
| 4.2(Performance Requirments) |
- |
500 |
|
- |
| 4.3(Performance Requirments) |
- |
500 |
|
- |
| 4.4(Performance Requirments) |
- |
500 |
|
- |
| 4.5(Performance Requirments) |
- |
500 |
|
- |
| 4.6(Flammability ,Cl 6 of IS 7809 (Part 2): 1977) |
- |
500 |
|
- |
| 4.6(Flammability ,Cl 6 of IS 7809 (Part 2): 1977) |
- |
0 |
|
- |
| 4.6(Flammability ,Cl 6 of IS 7809 (Part 2): 1977) |
- |
0 |
|
- |
| 4.6(Flammability ,Cl 6 of IS 7809 (Part 2): 1977) |
- |
0 |
|
- |
| 4.7(Electrolytic corrosion) |
- |
0 |
|
- |
| 4.7(Electrolytic corrosion) |
- |
500 |
|
- |
| 4.7(Electrolytic corrosion) |
- |
0 |
|
- |
| 4.8(Stability to accelerated ageing ) |
- |
500 |
|
- |
| 4.9(Insulation resistance test) |
- |
100 |
|
- |
| 3.1( Minimum Storage Life Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
0 |
|
- |
| 3.1(Appearance) |
- |
0 |
|
- |
| 3.1(Freedom from defects) |
- |
0 |
|
- |
| 3.1(Minimum Storage Life ,Dimensions , Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
0 |
|
- |
| 3.1(Minimum Storage Life ,Dimensions , Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
0 |
|
- |
| 3.1(Minimum Storage Life ,Dimensions , Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
0 |
|
- |
| 3.1(Minimum Storage Life ,Dimensions , Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
0 |
|
- |
| Cl.No.4 of IS 7809 (Part 1)-1975(Appearance) |
- |
0 |
|
- |
| Cl.No.5 of IS 7809 (Part 1)-1975(Freedom From Deffects) |
- |
500 |
|
- |
| Cl.No.3.2(Width) |
- |
500 |
|
- |
| Cl.No.3.3(Length) |
- |
500 |
|
- |
| Cl.No.3.4(Thickness) |
- |
500 |
|
- |
| Cl.No.4.1(Tensile Strength) |
- |
500 |
|
- |
| Cl.No.4.2(Adhesion to Steel) |
- |
500 |
|
- |
| Cl.No.4.3(Adhesion to backing) |
- |
500 |
|
- |
| Cl.No.4.4(Electric Strength at RT) |
- |
500 |
|
- |
| Cl.No.4.5(Electric Strength after Humid Conditioning) |
- |
500 |
|
- |
| Cl.No.4.6(Flammability) |
- |
500 |
|
- |
| Cl.No.4.7() |
- |
500 |
|
- |
| Cl.No.4.8(Stability to accelerated ageing) |
- |
500 |
|
- |
| Cl.No.4.9(Insulation Resistance) |
- |
1000 |
|
- |
| Cl.No.7 of IS 7809 (Part 1)-1975(Minimum Storage Life) |
- |
500 |
|
- |
| Cl.No.4 of IS 7809 (Part 1)-1975(Appearance after minimum storage Life) |
- |
500 |
|
- |
| Cl.No.5 of IS 7809 (Part 1)-1975(Freedom From Deffects after minimum storage Life) |
- |
500 |
|
- |
| Cl.No.3.2(Width after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.3.3(Length after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.3.4(Thickness after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.4.1(Tensile Strength after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.4.2(Adhesion to Steel after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.4.3(Adhesion to backing after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.4.4(Electric Strength at RT after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.4.5(Electric Strength after Humid Conditioning after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.4.6(Flammability after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.4.7(Electrolytic Corrosion after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.4.8(Stability to accelerated ageing after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.4.9(Insulation Resistance after minimum storage Life) |
- |
0 |
|
- |
| 3.1(Marking) |
- |
0 |
|
- |
| Cl 9 of IS 7809- 1-1975(Marking) |
- |
0 |
|
- |
| Cl. 4.1 of IS 7809-1-1975(Appearance) |
- |
0 |
|
- |
| Cl. 4.1 of IS 7809-1-1976(Minimum life storage test) |
- |
0 |
|
- |
| Cl. 5.1 of IS 7809-1-1975(Freedom from defects) |
- |
0 |
|
- |
| Cl-4 of IS:7809, Pt-I(Appearance) |
- |
0 |
|
- |
| Cl-5 of IS:7809, Pt-I(Freedom from Defects) |
- |
0 |
|
- |
| Cl 9.1 of IS:7809, Pt-I(Marking) |
- |
500 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 2.1.1(Type and Desiganation) |
- |
0 |
|
- |
| 2.1.2(Type and Desiganation) |
- |
0 |
|
- |
| 3.1(General Requirments,as per IS 7809 (Part 1 ) :1975 ) |
- |
500 |
|
- |
| 3.2(General Requirments,as per IS 7809 (Part 1 ) :1975 ) |
- |
500 |
|
- |
| 3.3(General Requirments,as per IS 7809 (Part 1 ) :1975 ) |
- |
500 |
|
- |
| 3.4(General Requirments,as per IS 7809 (Part 1 ) :1975 ) |
- |
500 |
|
- |
| 4.1(Performance Requirments) |
- |
500 |
|
- |
| 4.2(Performance Requirments) |
- |
500 |
|
- |
| 4.3(Performance Requirments) |
- |
500 |
|
- |
| 4.4(Performance Requirments) |
- |
500 |
|
- |
| 4.5(Performance Requirments) |
- |
500 |
|
- |
| 4.6(Flammability ,Cl 6 of IS 7809 (Part 2): 1977) |
- |
500 |
|
- |
| 4.6(Flammability ,Cl 6 of IS 7809 (Part 2): 1977) |
- |
500 |
|
- |
| 4.6(Flammability ,Cl 6 of IS 7809 (Part 2): 1977) |
- |
500 |
|
- |
| 4.6(Flammability ,Cl 6 of IS 7809 (Part 2): 1977) |
- |
500 |
|
- |
| 4.7(Electrolytic corrosion) |
- |
500 |
|
- |
| 4.7(Electrolytic corrosion) |
- |
500 |
|
- |
| 4.7(Electrolytic corrosion) |
- |
500 |
|
- |
| 4.8(Stability to accelerated ageing ) |
- |
500 |
|
- |
| 4.9(Insulation resistance test) |
- |
500 |
|
- |
| 3.1( Minimum Storage Life Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
500 |
|
- |
| 3.1( Minimum Storage Life Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
0 |
|
- |
| 3.1( Minimum Storage Life Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
0 |
|
- |
| 3.1(Minimum Storage Life ,Dimensions , Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
0 |
|
- |
| 3.1(Minimum Storage Life ,Dimensions , Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
0 |
|
- |
| 3.1(Minimum Storage Life ,Dimensions , Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
0 |
|
- |
| 3.1(Minimum Storage Life ,Dimensions , Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 3.1(Marking, Cl.9 of IS 7809 (Part 1):1975) |
- |
0 |
|
- |
| 2.1.1(Type and Desiganation) |
- |
0 |
|
- |
| 2.1.2(Type and Desiganation) |
- |
0 |
|
- |
| 3.1(General Requirments,as per IS 7809 (Part 1 ) :1975 ) |
- |
0 |
|
- |
| 3.2(General Requirments,as per IS 7809 (Part 1 ) :1975 ) |
- |
0 |
|
- |
| 3.3(General Requirments,as per IS 7809 (Part 1 ) :1975 ) |
- |
0 |
|
- |
| 3.4(General Requirments,as per IS 7809 (Part 1 ) :1975 ) |
- |
0 |
|
- |
| 4.1(Performance Requirments) |
- |
0 |
|
- |
| 4.2(Performance Requirments) |
- |
0 |
|
- |
| 4.3(Performance Requirments) |
- |
0 |
|
- |
| 4.4(Performance Requirments) |
- |
0 |
|
- |
| 4.5(Performance Requirments) |
- |
0 |
|
- |
| 4.6(Flammability ,Cl 6 of IS 7809 (Part 2): 1977) |
- |
0 |
|
- |
| 4.6(Flammability ,Cl 6 of IS 7809 (Part 2): 1977) |
- |
0 |
|
- |
| 4.6(Flammability ,Cl 6 of IS 7809 (Part 2): 1977) |
- |
0 |
|
- |
| 4.6(Flammability ,Cl 6 of IS 7809 (Part 2): 1977) |
- |
0 |
|
- |
| 4.7(Electrolytic corrosion) |
- |
0 |
|
- |
| 4.7(Electrolytic corrosion) |
- |
0 |
|
- |
| 4.7(Electrolytic corrosion) |
- |
0 |
|
- |
| 4.8(Stability to accelerated ageing ) |
- |
0 |
|
- |
| 4.9(Insulation resistance test) |
- |
0 |
|
- |
| 3.1( Minimum Storage Life Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
0 |
|
- |
| 3.1(Appearance) |
- |
0 |
|
- |
| 3.1(Freedom from defects) |
- |
0 |
|
- |
| 3.1(Minimum Storage Life ,Dimensions , Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
0 |
|
- |
| 3.1(Minimum Storage Life ,Dimensions , Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
0 |
|
- |
| 3.1(Minimum Storage Life ,Dimensions , Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
0 |
|
- |
| 3.1(Minimum Storage Life ,Dimensions , Cl. 7.1 of IS 7809(Part 1) :1975) |
- |
0 |
|
- |
| Cl.No.4 of IS 7809 (Part 1)-1975(Appearance) |
- |
0 |
|
- |
| Cl.No.5 of IS 7809 (Part 1)-1975(Freedom From Deffects) |
- |
500 |
|
- |
| Cl.No.3.2(Width) |
- |
500 |
|
- |
| Cl.No.3.3(Length) |
- |
500 |
|
- |
| Cl.No.3.4(Thickness) |
- |
500 |
|
- |
| Cl.No.4.1(Tensile Strength) |
- |
500 |
|
- |
| Cl.No.4.2(Adhesion to Steel) |
- |
500 |
|
- |
| Cl.No.4.3(Adhesion to backing) |
- |
400 |
|
- |
| Cl.No.4.4(Electric Strength at RT) |
- |
400 |
|
- |
| Cl.No.4.5(Electric Strength after Humid Conditioning) |
- |
400 |
|
- |
| Cl.No.4.6(Flammability) |
- |
500 |
|
- |
| Cl.No.4.7() |
- |
500 |
|
- |
| Cl.No.4.8(Stability to accelerated ageing) |
- |
500 |
|
- |
| Cl.No.4.9(Insulation Resistance) |
- |
500 |
|
- |
| Cl.No.7 of IS 7809 (Part 1)-1975(Minimum Storage Life) |
- |
500 |
|
- |
| Cl.No.4 of IS 7809 (Part 1)-1975(Appearance after minimum storage Life) |
- |
500 |
|
- |
| Cl.No.5 of IS 7809 (Part 1)-1975(Freedom From Deffects after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.3.2(Width after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.3.3(Length after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.3.4(Thickness after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.4.1(Tensile Strength after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.4.2(Adhesion to Steel after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.4.3(Adhesion to backing after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.4.4(Electric Strength at RT after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.4.5(Electric Strength after Humid Conditioning after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.4.6(Flammability after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.4.7(Electrolytic Corrosion after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.4.8(Stability to accelerated ageing after minimum storage Life) |
- |
0 |
|
- |
| Cl.No.4.9(Insulation Resistance after minimum storage Life) |
- |
0 |
|
- |
| 3.1(Marking) |
- |
0 |
|
- |
| Cl 9 of IS 7809- 1-1975(Marking) |
- |
500 |
|
- |
| Cl. 4.1 of IS 7809-1-1975(Appearance) |
- |
0 |
|
- |
| Cl. 4.1 of IS 7809-1-1976(Minimum life storage test) |
- |
0 |
|
- |
| Cl. 5.1 of IS 7809-1-1975(Freedom from defects) |
- |
0 |
|
- |
| Cl-4 of IS:7809, Pt-I(Appearance) |
- |
0 |
|
- |
| Cl-5 of IS:7809, Pt-I(Freedom from Defects) |
- |
0 |
|
- |
| Cl 9.1 of IS:7809, Pt-I(Marking) |
- |
0 |
|
- |
|
- |
-
Included w.e.f 14.08.2025 |
