| 1 |
IS 302 : Part 2 : Sec 203 (1994) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 203 electric call bells and buzzers for indoor use |
----- |
20500 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 5(Rating) |
- |
500 |
|
- |
| 6(Classification) |
- |
500 |
|
- |
| 7(Marking) |
- |
1000 |
|
- |
| 8(Protection against Access to Live Parts) |
- |
1500 |
|
- |
| 11(Temperature Rise/ Heating) |
- |
2500 |
|
- |
| 13(Leakage Current and Electric Strength at Operating Temperature) |
- |
2000 |
|
- |
| 14("Radio and Television Interference Suppression / Transient Over Voltage
") |
- |
3000 |
|
- |
| 15(Moisture Resistance) |
- |
2500 |
|
- |
| 16(Leakage Current and Electric Strength/ Insulation Resistance and Electric Strength (After Humidity treatment)) |
- |
2000 |
|
- |
| 21(Mechanical strength) |
- |
3000 |
|
- |
| 22(Construction) |
- |
1500 |
|
- |
| 23(Internal Wiring) |
- |
2500 |
|
- |
| 24(Components) |
- |
2500 |
|
- |
| 25(Supply Connection & External Flexible Cords) |
- |
2000 |
|
- |
| 26(Terminals For External Conductors) |
- |
1500 |
|
- |
| 27(Provision For Earthing) |
- |
2000 |
|
- |
| 28(Screws & Connections) |
- |
1000 |
|
- |
| 29(Clearances, Creepage Distances & Solid Insulation) |
- |
1000 |
|
- |
| 30(Resistance to Heat & Fire) |
- |
1000 |
|
- |
| 31(Resistance to Rusting) |
- |
1000 |
|
- |
| 5(Rating) |
- |
0 |
|
- |
| 6(Classification) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 8(Protection against Access to Live Parts) |
- |
0 |
|
- |
| 11(Temperature Rise/ Heating) |
- |
0 |
|
- |
| 13(Leakage Current and Electric Strength at Operating Temperature) |
- |
0 |
|
- |
| 14("Radio and Television Interference Suppression / Transient Over Voltage
") |
- |
0 |
|
- |
| 15(Moisture Resistance) |
- |
0 |
|
- |
| 16(Leakage Current and Electric Strength/ Insulation Resistance and Electric Strength (After Humidity treatment)) |
- |
0 |
|
- |
| 21(Mechanical strength) |
- |
0 |
|
- |
| 22(Construction) |
- |
0 |
|
- |
| 23(Internal Wiring) |
- |
0 |
|
- |
| 24(Components) |
- |
0 |
|
- |
| 25(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| 26(Terminals For External Conductors) |
- |
0 |
|
- |
| 27(Provision For Earthing) |
- |
0 |
|
- |
| 28(Screws & Connections) |
- |
0 |
|
- |
| 29(Clearances, Creepage Distances & Solid Insulation) |
- |
0 |
|
- |
| 30(Resistance to Heat & Fire) |
- |
0 |
|
- |
| 31(Resistance to Rusting) |
- |
0 |
|
- |
| 5(Rating) |
- |
0 |
|
- |
| 6(Classification) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 8(Protection against Access to Live Parts) |
- |
0 |
|
- |
| 11(Temperature Rise/ Heating) |
- |
0 |
|
- |
| 13(Leakage Current and Electric Strength at Operating Temperature) |
- |
0 |
|
- |
| 14("Radio and Television Interference Suppression / Transient Over Voltage
") |
- |
0 |
|
- |
| 15(Moisture Resistance) |
- |
0 |
|
- |
| 16(Leakage Current and Electric Strength/ Insulation Resistance and Electric Strength (After Humidity treatment)) |
- |
0 |
|
- |
| 21(Mechanical strength) |
- |
0 |
|
- |
| 22(Construction) |
- |
0 |
|
- |
| 23(Internal Wiring) |
- |
0 |
|
- |
| 24(Components) |
- |
0 |
|
- |
| 25(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| 26(Terminals For External Conductors) |
- |
0 |
|
- |
| 27(Provision For Earthing) |
- |
0 |
|
- |
| 28(Screws & Connections) |
- |
0 |
|
- |
| 29(Clearances, Creepage Distances & Solid Insulation) |
- |
0 |
|
- |
| 30(Resistance to Heat & Fire) |
- |
0 |
|
- |
| 31(Resistance to Rusting) |
- |
0 |
|
- |
|
03 Oct, 2027 |
- included w.e.f 15.09.2026
32 (Radiation hazards) RADIATION HAZARDS The laboratory does not have the equipment for Radiation Hazards testing; therefore, this parameter has been excluded from the scope.
2 Cl 19.11.4.1 (Electrostatic discharges) ELECTROSTATIC DISCHARGED FACILITY NOT AVAILABLE
3 Cl 19.11.4.2 (Radiated fields) RADIATED FIELDS FACILITY NOT AVAILABLE
4 Cl 19.11.4.3 (Fast transient bursts) FAST TRANSIENT BURSTS FACILITY NOT AVAILABLE
5 Cl 19.11.4.4 (Surge immunity test) SURGE IMMUNITY TEST FACILITY NOT AVAILABLE
6 Cl 19.11.4.5 (Immunity to conducted discharges) IMMUNITY TO CONDUCTED DISCHARGE FACILITY NOT AVAILABLE
7 Cl 19.11.4.6 (Class 3 Voltage dips and interruptions) VOLTAGE DIPS AND INTERRUPTION FACILITY NOT AVAILABLE
8 Cl 19.11.4.7 (Harmonics) HARMONICS FACILITY NOT AVAILABLE" |
| 2 |
IS 302 : Part 2 : Sec 45 (1994) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 45 electric heating tools |
----- |
34000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 5(Rating) |
- |
500 |
|
- |
| 6(Classification) |
- |
500 |
|
- |
| 7(Marking) |
- |
1000 |
|
- |
| 8(Protection against Access to Live Parts) |
- |
1500 |
|
- |
| 9(Starting Of Motor Operated Appliances) |
- |
1000 |
|
- |
| 10("Power Input
& Current") |
- |
2000 |
|
- |
| 11(Temperature Rise/ Heating) |
- |
2000 |
|
- |
| 12(Operation Under Overload Condition) |
- |
1000 |
|
- |
| 13(Electric Insulation at Operating Temperature) |
- |
1500 |
|
- |
| 14("Radio and Television Interference Suppression / Transient Over Voltage
") |
- |
2500 |
|
- |
| 15(Moisture Resistance) |
- |
1500 |
|
- |
| 16(Insulation Resistance and Electric Strength/ Leakage Current and Electric Strength (After Humidity Treatment)) |
- |
2000 |
|
- |
| 17(Overload Protection/ Overload Protection of Transformers & Associated Circuits) |
- |
2000 |
|
- |
| 18(Endurance) |
- |
2500 |
|
- |
| 19(Abnormal Operation) |
- |
1500 |
|
- |
| 20(Stability & Mechanical Hazards) |
- |
1000 |
|
- |
| 21(Mechanical strength) |
- |
1000 |
|
- |
| 22(Construction) |
- |
3000 |
|
- |
| 23(Internal Wiring) |
- |
1500 |
|
- |
| 25(Supply Connection & External Flexible Cords) |
- |
1000 |
|
- |
| 26(Terminals For External Conductors) |
- |
1000 |
|
- |
| 27(Provision For Earthing) |
- |
1500 |
|
- |
| 28(Screws & Connections) |
- |
1000 |
|
- |
| 29(Creepage Distances & Clearances) |
- |
1000 |
|
- |
| 30(Resistance to Heat, Fire and Tracking) |
- |
1000 |
|
- |
| XXV of Table 101(Resistance to Rusting) |
- |
1000 |
|
- |
| 4(General Requirement) |
- |
1000 |
|
- |
| 24(Components) |
- |
1000 |
|
- |
|
03 Oct, 2027 |
- included w.e.f 15.09.2026
31 (Radiation hazards) Cl. 32 Radiation, Toxicity and Similar hazard TEST FACILITY NOT AVAILABLE
2 19.11.4.7 (Harmonics) Cl. 19.11.4.7 Harmonics and inter-harmonics TEST FACILITY NOT AVAILABLE
3 19.11.4.6 (Class 3 Voltage dips and interruptions) Cl. 19.11.4.6 Voltage dips and interruptions TEST FACILITY NOT AVAILABLE
4 19.11.4.5 (Immunity to conducted discharges) Cl. 19.11.4.5 Immunity to conducted disturbance TEST FACILITY NOT AVAILABLE
5 19.11.4.4 (Surge immunity test) Cl. 19.11.4.4 surges Immunity Test TEST FACILITY NOT AVAILABLE
6 19.11.4.3 (Fast transient bursts) Cl. 19.11.4.3 Fast transient bursts TEST FACILITY NOT AVAILABLE
7 19.11.4.2 (Radiated fields) Cl. 19.11.4.2 Radiated fields TEST FACILITY NOT AVAILABLE
8 19.11.4.1 (Electrostatic discharges) Cl. 19.11.4.1 Electrostatic discharges TEST FACILITY NOT AVAILABLE" |
| 3 |
IS 398 : Part 6 (2021) |
Aluminium Conductors For Overhead Transmission Purposes Part 6: High conductivity aluminium alloy stranded conductors |
---- |
90000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 16.2(Visual Examination) |
- |
100 |
|
- |
| 16.3, Table 4(Measurement of Lay Ratio / Direction of Lay) |
- |
250 |
|
- |
| 16.3, Table 4(Measurement of Lay Ratio / Direction of Lay) |
- |
250 |
|
- |
| 16.3, Table 4(Measurement of Lay Ratio / Direction of Lay) |
- |
250 |
|
- |
| 16.3, Table 4(Measurement of Lay Ratio / Direction of Lay) |
- |
250 |
|
- |
| 16.4, Table 2(Measurement of Diameter of Individual Aluminium Alloy Wires) |
- |
500 |
|
- |
| 16.5, Table 2(Breaking Load Test - before stranding) |
- |
500 |
|
- |
| 16.5, Table 2(Breaking Load Test - after stranding) |
- |
500 |
|
- |
| 16.6, Table 1(Elongation Test - before stranding) |
- |
500 |
|
- |
| 16.6, Table 1(Elongation Test - after stranding) |
- |
500 |
|
- |
| 16.7, Table 2(Resistivity Test) |
- |
1500 |
|
- |
| 16.8(Wrapping Test) |
- |
1000 |
|
- |
| 11(Stranding) |
- |
500 |
|
- |
| 8(Freedom from defects) |
- |
500 |
|
- |
| 16.9, Table 3(Ultimate Tensile Strength on Stranded Conductor) |
- |
2500 |
|
- |
| 16.10, Table 3(d.c. Resistance Test on Stranded Conductor) |
- |
2000 |
|
- |
| 16.11(Stress-strain Test) |
- |
2000 |
|
- |
| Cl-7, Table-1(Diameter of Wire (mm)) |
- |
500 |
|
- |
| Cl-7, Table-1(Minimum Tensile Strength of Wire) |
- |
500 |
|
- |
| Cl-7, Table-1(Minimum Elongation on 250 mm (percent)) |
- |
250 |
|
- |
| Cl-8(Freedom from Defects) |
- |
500 |
|
- |
| Cl-9.1.1(Wires-Nominal Sizes) |
- |
500 |
|
- |
| Cl-9.2.1(Stranded Conductors- Size) |
- |
500 |
|
- |
| Cl-10(Joints in Wires) |
- |
500 |
|
- |
|
03 Oct, 2027 |
- included w.e.f 15.09.2026
Cl-5 (MATERIAL COMPOSITION) Material Composition |
| 4 |
IS 302 : Part 2 : Sec 2 (1997) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 2 vacuum cleaners and water suction cleaning appliances |
---- |
28500 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 5(Rating) |
- |
100 |
|
- |
| 6(Classification) |
- |
450 |
|
- |
| 7(Marking) |
- |
500 |
|
- |
| 8(Protection against Access to Live Parts) |
- |
1000 |
|
- |
| 9(Starting Of Motor Operated Appliances) |
- |
1500 |
|
- |
| 10("Power Input
& Current") |
- |
1000 |
|
- |
| 11(Temperature Rise/ Heating) |
- |
1500 |
|
- |
| 12(OPERATION UNDER OVERLOAD
CONDITIONS OF APPLIANCES WITH
HEATING ELEMENTS) |
- |
1500 |
|
- |
| 13(LEAKAGE CURRENT AND ELECTRIC
STRENGTH AT OPERATING TEMPERATURE) |
- |
1000 |
|
- |
| 14(RADIO AND TELEVISION
INTERFERENCE SUPPRESSION) |
- |
1500 |
|
- |
| 15(MOISTURE RESISTANCE) |
- |
1000 |
|
- |
| 16(INSULATION RESISTANCE AND
ELECTRIC STRENGTH ( AFTER HUMIDITY
TREATMENT )) |
- |
1500 |
|
- |
| 17(OVERLOAD PROTECTION) |
- |
1000 |
|
- |
| 19(ABNORMAL OPERATION) |
- |
1000 |
|
- |
| 20(STABILITY AND MECHANICAL
HAZARDS) |
- |
1500 |
|
- |
| 21(MECHANICAL STRENGTH) |
- |
1000 |
|
- |
| 22(Construction) |
- |
500 |
|
- |
| 23(INTERNAL WIRING) |
- |
500 |
|
- |
| 24(COMPONENTS) |
- |
1000 |
|
- |
| 25(SUPPLY CONNECTION AND EXTERNAL
FLEXIBLE CABLES AND CORDS) |
- |
1500 |
|
- |
| 26(TERMINALS FOR EXTERNAL CONDUCTORS) |
- |
1500 |
|
- |
| 27(PROVISION FOR EARTHING) |
- |
1000 |
|
- |
| 28(SCREWS AND CONNECTIONS) |
- |
1500 |
|
- |
| 29(CREEPAGE DISTANCES, CLEARANCES
AND DISTANCES THROUGH INSULATION) |
- |
1000 |
|
- |
| 30(RESISTANCE TO HEAT, FIRE AND
TRACKING) |
- |
1000 |
|
- |
| 31(RESISTANCE TO RUSTING) |
- |
1000 |
|
- |
| 5(Rating) |
- |
0 |
|
- |
| 6(Classification) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 8(Protection against Access to Live Parts) |
- |
0 |
|
- |
| 9(Starting Of Motor Operated Appliances) |
- |
0 |
|
- |
| 10("Power Input
& Current") |
- |
0 |
|
- |
| 11(Temperature Rise/ Heating) |
- |
0 |
|
- |
| 12(OPERATION UNDER OVERLOAD
CONDITIONS OF APPLIANCES WITH
HEATING ELEMENTS) |
- |
0 |
|
- |
| 13(LEAKAGE CURRENT AND ELECTRIC
STRENGTH AT OPERATING TEMPERATURE) |
- |
0 |
|
- |
| 14(RADIO AND TELEVISION
INTERFERENCE SUPPRESSION) |
- |
0 |
|
- |
| 15(MOISTURE RESISTANCE) |
- |
0 |
|
- |
| 16(INSULATION RESISTANCE AND
ELECTRIC STRENGTH ( AFTER HUMIDITY
TREATMENT )) |
- |
0 |
|
- |
| 17(OVERLOAD PROTECTION) |
- |
0 |
|
- |
| 19(ABNORMAL OPERATION) |
- |
0 |
|
- |
| 20(STABILITY AND MECHANICAL
HAZARDS) |
- |
0 |
|
- |
| 21(MECHANICAL STRENGTH) |
- |
0 |
|
- |
| 22(Construction) |
- |
0 |
|
- |
| 23(INTERNAL WIRING) |
- |
0 |
|
- |
| 24(COMPONENTS) |
- |
0 |
|
- |
| 25(SUPPLY CONNECTION AND EXTERNAL
FLEXIBLE CABLES AND CORDS) |
- |
0 |
|
- |
| 26(TERMINALS FOR EXTERNAL CONDUCTORS) |
- |
0 |
|
- |
| 27(PROVISION FOR EARTHING) |
- |
0 |
|
- |
| 28(SCREWS AND CONNECTIONS) |
- |
0 |
|
- |
| 29(CREEPAGE DISTANCES, CLEARANCES
AND DISTANCES THROUGH INSULATION) |
- |
0 |
|
- |
| 30(RESISTANCE TO HEAT, FIRE AND
TRACKING) |
- |
0 |
|
- |
| 31(RESISTANCE TO RUSTING) |
- |
0 |
|
- |
|
03 Oct, 2027 |
- Included w.e.f 25.09.2026
Exclusion: 19.11.4.1-19.11.4.7 (EMI/EMC), 32 (Radiation hazards) |
| 5 |
IS 302 : Part 2 : Sec 209 (1994) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 209 low speed food grinding machines |
Electrical |
34500 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl. 31 302-2-209 : 1994(Resistance to Rusting) |
- |
1000 |
|
- |
| Cl. 30 302-2-209 : 1994(Resistance to Heat Fire & Tracking ) |
- |
1500 |
|
- |
| Cl. 29 302-2-209 : 1994(Clearances, Creepage Distances & Solid insulation ) |
- |
1000 |
|
- |
| Cl. 28 302-2-209 : 1994(Screws & Connections) |
- |
500 |
|
- |
| Cl. 27 302-2-209 : 1994(Provision for Earthing ) |
- |
1000 |
|
- |
| Cl. 26 302-2-209 : 1994(Terminals for External conductors ) |
- |
500 |
|
- |
| Cl. 25 302-2-209 : 1994(Supply Connection & External Flexible Cords) |
- |
1000 |
|
- |
| Cl. 24 302-2-209 : 1994(Components) |
- |
1000 |
|
- |
| Cl. 23 302-2-209 : 1994(Internal Wiring) |
- |
1500 |
|
- |
| Cl. 22 302-2-209 : 1994(Construction ) |
- |
500 |
|
- |
| Cl. 21 302-2-209 : 1994(Mechanical strength) |
- |
500 |
|
- |
| Cl. 20 302-2-209 : 1994(Stability & Mechanical Hazards) |
- |
1000 |
|
- |
| Cl. 19 302-2-209 : 1994(Abnormal Operation ) |
- |
500 |
|
- |
| Cl. 18 302-2-209 : 1994(Endurance) |
- |
2000 |
|
- |
| Cl. 17 302-2-209 : 1994(Overload Protection of Transformers and Associated Circuit) |
- |
1500 |
|
- |
| Cl. 16 302-2-209 : 1994(Leakage Current & Electric Strength at Operating Temperature (After Humidity Treatment)) |
- |
1000 |
|
- |
| Cl. 15 302-2-209 : 1994(Moisture Resistance Test ) |
- |
1500 |
|
- |
| Cl. 14 302-2-209 : 1994(Radio and television interference suppression / Transient over voltages) |
- |
2500 |
|
- |
| Cl. 13 302-2-209 : 1994(Leakage Current & Electric Strength at Operating Temperature) |
- |
1000 |
|
- |
| Cl. 11 302-2-209 : 1994(Temperature Rise) |
- |
1000 |
|
- |
| Cl. 10 302-2-209 : 1994(Power Input and Current ) |
- |
500 |
|
- |
| Cl. 9 302-2-209 : 1994(Starting of motor operated appliances) |
- |
500 |
|
- |
| Cl. 8 302-2-209 : 1994(Protection Against Electric Shock ) |
- |
1000 |
|
- |
| Cl. 7 302-2-209 : 1994(Marking) |
- |
500 |
|
- |
| (CI. 6 IS 302-2-209 : 1994(Classification ) |
- |
500 |
|
- |
| Cl. 5 IS 302-2-209 :1994(Rating) |
- |
500 |
|
- |
|
03 Oct, 2027 |
- Included w.e.f 22.09.2026
Exclusions-
Cl-19.11.4.1 (Electrostatic discharge)
Cl-19.11.4.2 (Radiated Fields)
Cl-19.11.4.3 (Fast transient bursts)
Cl-19.11.4.4 (Surge Immunity test)
Cl-19.11.4.5 (Immunity to conducted discharge)
Cl-19.11.4.6 (Voltage dips and interruptions)
Cl-19.11.4.7 (Harmonics)
Cl. 32 302-2-209 : 1994 (Radiation Hazards) |
| 6 |
IS 302 : Part 2 : Sec 74 (2024) |
Household and Similar Electrical Appliances�Safety Part 2 Particular Requirements Section 74 Portable immersion heaters |
----- |
15500 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 7(Marking and instructions) |
- |
250 |
|
- |
| 8(Protection against access to live parts) |
- |
500 |
|
- |
| 10(Power input and current) |
- |
1000 |
|
- |
| 10(Power input and current) |
- |
500 |
|
- |
| 11(Heating) |
- |
999.99 |
|
- |
| 13.1 &13.2(Leakage current test) |
- |
500 |
|
- |
| 14(Transient overvoltages) |
- |
2000 |
|
- |
| 15(Moisture resistance) |
- |
1000 |
|
- |
| 16.1 &16.2(Leakage current test) |
- |
500 |
|
- |
| 16.1 & 16.3(Electric strength test) |
- |
1000 |
|
- |
| 17(Overload protection of transformers and associated circuits) |
- |
500 |
|
- |
| 19.1 to 19.13, Table No. - 9(Abnormal operation) |
- |
500 |
|
- |
| 20.1(Stability and mechanical hazards) |
- |
1000 |
|
- |
| 20.2(Stability and mechanical hazards) |
- |
500 |
|
- |
| 21(Mechanical strength) |
- |
500 |
|
- |
| 22(Construction) |
- |
500 |
|
- |
| 23(Internal wiring) |
- |
500 |
|
- |
| 24(Components) |
- |
1000 |
|
- |
| 25("Supply connection and
external flexible cords") |
- |
500 |
|
- |
| 26("Terminals for external
conductors") |
- |
450 |
|
- |
| 27(Provision for earthing) |
- |
500 |
|
- |
| 28(Screws and connections) |
- |
500 |
|
- |
| 29("Clearances, creepage
distances and solid insulation") |
- |
500 |
|
- |
| 30(Resistance to heat and fire) |
- |
500 |
|
- |
| 30.101(Resistance to heat and fire) |
- |
500 |
|
- |
| 31(Resistance to rusting) |
- |
499.99 |
|
- |
| 13.1 &13.3(Electric strength test) |
- |
500.01 |
|
- |
| 15.3(Moisture resistance) |
- |
500 |
|
- |
| 24.101(Components) |
- |
500 |
|
- |
| Cl 19.11.4.8(Abnormal operation) |
- |
500 |
|
- |
| 7(Marking and instructions) |
- |
0 |
|
- |
| 8(Protection against access to live parts) |
- |
0 |
|
- |
| 10(Power input and current) |
- |
0 |
|
- |
| 10(Power input and current) |
- |
0 |
|
- |
| 11(Heating) |
- |
0 |
|
- |
| 13.1 &13.2(Leakage current test) |
- |
0 |
|
- |
| 14(Transient overvoltages) |
- |
0 |
|
- |
| 15(Moisture resistance) |
- |
0 |
|
- |
| 16.1 &16.2(Leakage current test) |
- |
0 |
|
- |
| 16.1 & 16.3(Electric strength test) |
- |
0 |
|
- |
| 17(Overload protection of transformers and associated circuits) |
- |
0 |
|
- |
| 19.1 to 19.13, Table No. - 9(Abnormal operation) |
- |
0 |
|
- |
| 20.1(Stability and mechanical hazards) |
- |
0 |
|
- |
| 20.2(Stability and mechanical hazards) |
- |
0 |
|
- |
| 21(Mechanical strength) |
- |
0 |
|
- |
| 22(Construction) |
- |
0 |
|
- |
| 23(Internal wiring) |
- |
0 |
|
- |
| 24(Components) |
- |
0 |
|
- |
| 25("Supply connection and
external flexible cords") |
- |
0 |
|
- |
| 26("Terminals for external
conductors") |
- |
0 |
|
- |
| 27(Provision for earthing) |
- |
0 |
|
- |
| 28(Screws and connections) |
- |
0 |
|
- |
| 29("Clearances, creepage
distances and solid insulation") |
- |
0 |
|
- |
| 30(Resistance to heat and fire) |
- |
0 |
|
- |
| 30.101(Resistance to heat and fire) |
- |
0 |
|
- |
| 31(Resistance to rusting) |
- |
0 |
|
- |
| 13.1 &13.3(Electric strength test) |
- |
0 |
|
- |
| 15.3(Moisture resistance) |
- |
0 |
|
- |
| 24.101(Components) |
- |
0 |
|
- |
| Cl 19.11.4.8(Abnormal operation) |
- |
0 |
|
- |
|
03 Oct, 2027 |
- Included w.e.f 22.07.2026
Exclusions:
32 (""Radiation, toxicity and similar hazards""),
Cl 19.11.4.1 (Electrostatic discharges),
Cl 19.11.4.2 (Radiated fields),
Cl 19.11.4.3 (Fast transient bursts),
Cl 19.11.4.4 (Voltage surges),
Cl 19.11.4.5 (Immunity to conducted disturbances),
Cl 19.11.4.6 (Voltage dips and interruptions),
Cl 19.11.4.7 (Harmonics and inter-harmonics) |
| 7 |
IS 14772 (2020) |
Boxes and Enclosures for Electrical Accessories for Household and Similar Fixed Electrical Installations — General Requirements ( First Revision ) |
---- |
18800 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 7.1(Nature of material) |
- |
200 |
|
- |
| 7.2(Type of installation) |
- |
200 |
|
- |
| 7.3(Types of inlets) |
- |
200 |
|
- |
| 7.4(Clamping means) |
- |
200 |
|
- |
| 7.5(Minimum temperature during installation) |
- |
200 |
|
- |
| 7.6, 7.7, 7.8(The degree of ingress protection) |
- |
200 |
|
- |
| 7.9(The provision for fixing accessories to the boxes ) |
- |
200 |
|
- |
| 7.1(The method of fixing the terminals) |
- |
200 |
|
- |
| 8.1(marking) |
- |
500 |
|
- |
| 8.2(By Inspection and The marking is rubbed by hand 15s width a piece of
cloth soaked with water and again for 15s with a piece of cloth soaked with petroleum spirit.) |
- |
500 |
|
- |
| 8.3(BIS Certification Marking) |
- |
200 |
|
- |
| 9.0(Dimensions) |
- |
500 |
|
- |
| 10.0(Protection against electric shock) |
- |
1000 |
|
- |
| 11.0(PROVISION FOR EARTHING) |
- |
1000 |
|
- |
| 12.0(Constructions) |
- |
500 |
|
- |
| 13.0(Resistance to ageing) |
- |
1000 |
|
- |
| 14.0(insultation resistance) |
- |
1000 |
|
- |
| 14.0(electric strength) |
- |
1000 |
|
- |
| 15.0(Mechanical strength) |
- |
1000 |
|
- |
| 16.0(resistance to heat) |
- |
500 |
|
- |
| 17.0(creepage distance) |
- |
500 |
|
- |
| 17.0(clearances) |
- |
500 |
|
- |
| 17.0(distance through seating compund) |
- |
1000 |
|
- |
| 18.0(Resistance to insulating material to abnormal heat and fire) |
- |
1000 |
|
- |
| 19.0(Resistance to tracking) |
- |
1000 |
|
- |
| 20.0(Resistance to corrosion) |
- |
500 |
|
- |
|
03 Oct, 2027 |
- Included w.e.f 20.05.2026 |
| 8 |
IS 15787 (2025) |
Switched Socket-Outlets without Interlock for Fixed Installations- Particular Requirements ( First Revision ) |
---- |
22000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl-4(General Requirements) |
- |
200 |
|
- |
| Cl-6(Rating) |
- |
500 |
|
- |
| Cl-8(Marking) |
- |
500 |
|
- |
| Cl-9(Checking of Dimensions) |
- |
1000 |
|
- |
| Cl-10(Protection against electric shock) |
- |
500 |
|
- |
| Cl-11(Provision for earthing) |
- |
500 |
|
- |
| Cl-12(Terminals) |
- |
500 |
|
- |
| Cl-13(Construction of fixed socket-outlet) |
- |
500 |
|
- |
| Cl-14(Construction of plugs and portable socket-outlets) |
- |
500 |
|
- |
| Cl-16(Resistance to ageing, harmful ingress of water and to humidity) |
- |
500 |
|
- |
| Cl-17(Insulation resistance & electric strength) |
- |
500 |
|
- |
| Cl-17.3(Electric Strength (Flash Test)) |
- |
500 |
|
- |
| Cl-18(Operation of earthing contacts) |
- |
500 |
|
- |
| Cl-19(Temperature rise) |
- |
500 |
|
- |
| Cl-20(Breaking capacity) |
- |
1000 |
|
- |
| Cl-21(Normal operation) |
- |
500 |
|
- |
| Cl-22(Force necessary to withdraw the plug) |
- |
500 |
|
- |
| Cl-24(Mechanical strength) |
- |
500 |
|
- |
| Cl-25(Resistance to heat) |
- |
500 |
|
- |
| Cl-26(Screws, current carrying parts and connections) |
- |
500 |
|
- |
| Cl-27(Creepage distance & clearances & distance through sealing compound) |
- |
500 |
|
- |
| Cl-28(Resistance of Insulating material to abnormal heat, fire and tracking) |
- |
500 |
|
- |
| Cl-29(Resistance to rusting) |
- |
500 |
|
- |
|
03 Oct, 2027 |
- Included w.e.f 19.05.2026 |
| 9 |
IS 398 : Part 2 (2025) |
Aluminium Conductor for Overhead Transmission Purposes - Specification Part 2 Aluminium Conductors Galvanized Steel Reinforced (Fourth Revision) |
---- |
10000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl-6(Material) |
- |
100 |
|
Rs 10000 (up to 80 Sq.mm), Rs 18000 (100 SQ.MM), Rs 37000 (Above 100 SQ.MM and upto Including 200 SQ.MM), Rs 55000 (above 200 SQ.MM) |
| Cl-6.1.1(chemical composition of high carbon steel) |
- |
100 |
|
- |
| Cl-6.2(zinc used for galvanizing) |
- |
100 |
|
- |
| Cl-7(Freedom From Defects) |
- |
100 |
|
- |
| Cl-8.1(Wires-Nominal Sizes) |
- |
100 |
|
- |
| Cl-8.2(Aluminum Conductors, Galvanized Steel- Reinforced) |
- |
200 |
|
- |
| Cl-9.1(Joint in Wires) |
- |
100 |
|
- |
| Cl-9.2(Aluminium Wires) |
- |
100 |
|
- |
| Cl-9.3(Galvanized Steel Wires) |
- |
100 |
|
- |
| Cl-10.2(Lay Ratio of Aluminium Conductors Galvanized Steel-Reinforced) |
- |
250 |
|
- |
| Cl-13.3(Conductor- Visual examination) |
- |
100 |
|
- |
| Cl- 13.5(Conductor- Measurement of lay ratio/direction of lay) |
- |
500 |
|
- |
| Cl- 13.12(Conductor- d.c. Resistance test on stranded conductor) |
- |
1000 |
|
- |
| Cl- 13.14(Conductor- Ultimate tensile strength test on stranded conductor) |
- |
2500 |
|
- |
| Cl-13.4(Aluminium wires-Measurement of diameter) |
- |
500 |
|
- |
| Cl- 13.6(Aluminium wires -Breaking load test) |
- |
1000 |
|
- |
| Cl- 13.8(Aluminium wires- Wrapping test) |
- |
250 |
|
- |
| Cl- 13.9(Aluminium wires- d.c. resistance test) |
- |
500 |
|
- |
| Cl- 13.11(Aluminium wires Procedure qualification test on welded joint of aluminium strands) |
- |
200 |
|
- |
| Cl- 13.4(Steel wires- Measurement of diameter) |
- |
200 |
|
- |
| Cl- 13.6(Steel wires- Breaking load test) |
- |
1000 |
|
- |
| Cl- 13.7(Steel wires- Ductility test) |
- |
200 |
|
- |
| Cl- 13.8(Steel wires- Wrapping test) |
- |
250 |
|
- |
| Cl- 13.10(Steel wires- Galvanizing test) |
- |
500 |
|
- |
| Cl-13.7.1(Torsion Test) |
- |
500 |
|
- |
| Cl-13.7.2(Elongation Test) |
- |
500 |
|
- |
| Cl-11.1(Standard Length) |
- |
200 |
|
- |
| Cl-11.2(Random Lengths) |
- |
200 |
|
- |
| Cl- 13.13(Conductor- Surface condition test on stranded conductor) |
- |
2500 |
|
- |
|
03 Oct, 2027 |
- Included w.e.f 31.12.2025
Exclusion: Cl- 13.15 (Conductor- Corona test (for conductors intended for use at 400 kV and above voltage level for a.c. and ± 320 kV and above voltage level for d.c.)), Cl-13.16 (Conductor- Radio interference voltage test) |
| 10 |
IS 7098 : Part 1 (2025) |
Crosslinked Polyethylene Insulated Thermoplastic Sheathed Cables - Specification Part 1 For Working Voltages up to and Including 1 100 Volts (Second Revision) |
---- |
65000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl-4(Conductors -Material) |
- |
0 |
|
65000/-
Rs. 13500/- for Single Core Unarmoured Cable Category-01; Rs. 23500/- for Single Core Unarmoured Cable Category - C1 / C2; Rs. 36500/- for Single Core Unarmoured Cable Category-C3 (LSHF); Rs. 16500/- for Single Core Armoured Cable; |
| Cl-5, Table-1 (i)(Tensile strength) |
- |
500 |
|
Rs. 27500/- for Single Core Armoured Cable Category - C1 / C2; Rs. 40500/- Single Core armoured Cable Category-C3 (LSHF); Rs. 18000/- for up to 4 Cores Unarmoured Cable Category – 01; Rs. 28000/- for up to 4 Cores Unarmoured Cable Category – C1 / C2; |
| Cl-5, Table-1 (ii) (a)(Elongation at break- Ageing in air oven) |
- |
500 |
|
Rs. 41000/- for up to 4 Cores Unarmoured Cable Category – C3 (LSHF); Rs. 19000/- for up to 4 Cores Armoured Cable Category – 01; Rs. 25000/- for above 4 Cores and up to 12 Cores Armoured Cable Category – 01; |
| Cl-5, Table-1 (ii) (b)(Variation in tensile strength, from that without ageing) |
- |
0 |
|
Rs. 32000/- for above 12 Cores and up to 19 Cores Armoured Cable Category – 01; Rs. 40000/- for above 19 cores and up to 37 Cores armoured cable Category – 01; Rs. 55000/- for above 37 cores and up to 61 Cores armoured cable Category – 01; |
| Cl-5, Table-1 (ii) (c)(Variation in elongation at break, from that without ageing) |
- |
0 |
|
Rs. 29000/- for up to 4 cores armoured cable Category – C1 / C2; Rs.42000/- for up to 4 cores armoured cable Category – C3(LSHF); Rs. 35000/- for above 4 cores and up to 12 Cores armoured cable Category – C1 / C2; |
| Cl-5, Table-1 (iii) (a)(Hot set- Treatment;) |
- |
500 |
|
Rs. 48000/- for above 4 cores and up to 12 Cores armoured cable Category – C3 (LSHF); Rs. 42000/- for above 12 cores and up to 19 Cores armoured cable Category – C1 / C2; Rs.55000/- for above 12 cores and up to 19 Cores armoured cable Category – C3 (LSHF) |
| Cl-5, Table-1 (iii) (b)(Hot set- Elongation under load) |
- |
500 |
|
Rs. 50000/- for above 19 cores and up to 37 Cores armoured cable Category – C1 / C2; Rs.63000/- for above 12 cores and up to 19 Cores armoured cable Category – C3 (LSHF) Rs. 65000/- for above 37 cores and up to 61 Cores armoured cable Category – C1 / C2; |
| Cl-5, Table-1 (iii) (c)(Hot set- Permanent elongation after cooling) |
- |
500 |
|
Rs. 78000/- for above 37 cores and up to 61 Cores armoured cable Category – C3 (LSHF); Rs. 3000/- Carbon black Content Test (PE Sheath); Rs. 2500/- for optional tests (cold bend / cold impact); Rs. 4000/- for Cold elongation Test |
| Cl-5, Table-1 (iv)(Shrinkage) |
- |
500 |
|
Rs. 1500/- for Armour Resistance Test |
| Cl-5, Table-1 (v)(Water absorption (gravimetric)) |
- |
3000 |
|
- |
| Cl-5, Table-1 (vi)(Volume resistivity) |
- |
500 |
|
- |
| Cl-6.1 (a)(Fillers and inner sheath- Vulcanized or unvulcanized rubber) |
- |
0 |
|
- |
| Cl-6.1 (B)(Fillers and inner sheath- Thermoplastic materials) |
- |
0 |
|
- |
| Cl-7(Armouring) |
- |
0 |
|
- |
| Cl-8(Outer Sheath) |
- |
0 |
|
- |
| Cl-10.3(Tolerance on Thickness of Insulation) |
- |
350 |
|
- |
| Cl-11(Core Identification) |
- |
0 |
|
- |
| Cl-12(Laying up of Cores) |
- |
250 |
|
- |
| Cl-13(Inner Sheath (Common Covering)) |
- |
0 |
|
- |
| Cl-14.1(Armouring- Application) |
- |
0 |
|
- |
| Cl-14.1.2(armour round wires/formed wires) |
- |
0 |
|
- |
| Cl-14.2(Type of Armour) |
- |
0 |
|
- |
| Cl-14.3(Dimensions) |
- |
250 |
|
- |
| Cl-14.4(Joints) |
- |
0 |
|
- |
| Cl-14.5(Resistance) |
- |
1500 |
|
- |
| Cl-15.3(Thickness of Outer Sheath) |
- |
500 |
|
- |
| Cl-16.1 (i) (a)(Test on conductor: Annealing test (for copper);) |
- |
350 |
|
- |
| Cl-16.1 (i) (b)(Test on conductor: Tensile test (for aluminium);) |
- |
700 |
|
- |
| Cl-16.1 (i) (c)(Test on conductor: Wrapping test (for aluminium);) |
- |
350 |
|
- |
| Cl-16.1 (i) (d)(Test on conductor: Resistance test) |
- |
750 |
|
- |
| Cl-14.6 (a)(Physical tests on round wires/formed wires- Tensile strength) |
- |
500 |
|
- |
| Cl-14.6 (b)(Physical tests on round wires/formed wires- Elongation at break) |
- |
500 |
|
- |
| Cl-14.6 (c)(Physical tests on round wires/formed wires- Torsion test for round wires) |
- |
350 |
|
- |
| Cl-14.6 (d)(Physical tests on round wires/formed wires- Winding test for formed wires) |
- |
350 |
|
- |
| Cl-14.6 (e)(Physical tests on round wires/formed wires- Uniformity of zinc coating) |
- |
350 |
|
- |
| Cl-14.6 (f)(Physical tests on round wires/formed wires- Mass of zinc coating) |
- |
350 |
|
- |
| Cl-14.6 (g)(Physical tests on round wires/formed wires- Resistivity.) |
- |
350 |
|
- |
| Cl-10, 13, 15(Test for thickness of insulation and sheath) |
- |
1500 |
|
- |
| Cl-16.1 (v) (1)(PVC Sheath- Tensile strength and elongation at break;) |
- |
2000 |
|
- |
| Cl-16.1 (v) (2)(PVC Sheath- Ageing in air oven) |
- |
1000 |
|
- |
| Cl-16.1 (v) (3)(PVC Sheath- Loss of mass in air oven) |
- |
2000 |
|
- |
| Cl-16.1 (v) (5)(PVC Sheath- Hot deformation test) |
- |
750 |
|
- |
| Cl-16.1 (v) (6)(PVC Sheath- Heat shock test) |
- |
350 |
|
- |
| Cl-16.1 (v) (7)(PVC Sheath- Thermal stability) |
- |
500 |
|
- |
| Cl-8.3-Table 1A(PE Sheath- Carbon black content) |
- |
3000 |
|
- |
| Cl-8.3-Table 1A(PE Sheath- Tensile strength and elongation at break before and after ageing) |
- |
1500 |
|
- |
| Cl-8.3-Table 1A(PE Sheath- Hot deformation) |
- |
750 |
|
- |
| Cl-8.3-Table 1A(PE Sheath- Shrinkage test.) |
- |
250 |
|
- |
| Cl- Table 1B(LSHF Sheath- Tensile strength and elongation at break before and after ageing) |
- |
2000 |
|
- |
| Cl- Table 1B(LSHF Sheath- Hot deformation) |
- |
750 |
|
- |
| Cl- Table 1B(LSHF Sheath- Water absorption test) |
- |
3000 |
|
- |
| Cl- Table 1B(LSHF Sheath- Shrinkage test) |
- |
250 |
|
- |
| Cl-17.2(High voltage test) |
- |
1000 |
|
- |
| Cl-17.3(Flammability test) |
- |
1500 |
|
- |
| Cl-17.4(Oxygen index test (FR, FR-LSH or LSHF Sheath)) |
- |
1500 |
|
- |
| Cl-17.5(Flame retardance test on single cable) |
- |
1000 |
|
- |
| Cl-17.6(Flame retardance test on bunched cables (FR, FR-LSH or LSHF Sheathed Cables)) |
- |
7500 |
|
- |
| Cl-17.7(Test for halogen acid evolution (FR-LSH or LSHF Outer Sheath)) |
- |
2500 |
|
- |
| Cl-17.8(Smoke density test (FR-LSH or LSHF Sheath)) |
- |
4000 |
|
- |
| Cl-17.9(Temperature index test; (FR, FR-LSH or LSHF Sheath)) |
- |
1500 |
|
- |
| Cl-17.10(Test for pH and conductivity of LSHF Sheath) |
- |
1500 |
|
- |
| Cl-17.11(Test for light transmission for LSHF Sheathed Cables) |
- |
5000 |
|
- |
| Cl-16.4 (i)(Cold bend test for outer sheath) |
- |
1000 |
|
- |
| Cl-16.4 (ii)(Cold impact test for outer sheath) |
- |
1000 |
|
- |
| Cl-16.4 (iii)(Cold elongation test for LSHF sheath) |
- |
4000 |
|
- |
|
03 Oct, 2027 |
- Included w.e.f 04.11.2025 |
| 11 |
IS 302 : Part 2 : Sec 3 (2024) |
Household and Similar Electrical Appliances âSafety Part 2 Particular Requirements Section 3 Electric Irons (Second Revision) |
---- |
20000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl-4(General requirement) |
- |
500 |
|
- |
| Cl-7(Marking and instructions) |
- |
500 |
|
- |
| Cl-8(Protection against access to live parts) |
- |
500 |
|
- |
| Cl-10(Power input and current) |
- |
500 |
|
- |
| Cl-11(Heating) |
- |
500 |
|
- |
| Cl-12(Charging of metal-ion batteries) |
- |
500 |
|
- |
| Cl-13(Leakage current and electric strength at operating temperature) |
- |
1000 |
|
- |
| Cl-14(Transient overvoltages) |
- |
1500 |
|
- |
| Cl-15(Moisture resistance) |
- |
1000 |
|
- |
| Cl-16(Leakage current and electric strength) |
- |
1000 |
|
- |
| Cl-17(Overload protection of transformers and associated circuits) |
- |
0 |
|
- |
| Cl-18(Endurance) |
- |
0 |
|
- |
| Cl-19(Abnormal operation) |
- |
1000 |
|
- |
| Cl-20(Stability and mechanical hazards) |
- |
1000 |
|
- |
| Cl-21(Mechanical strength) |
- |
500 |
|
- |
| Cl-22(Construction) |
- |
500 |
|
- |
| Cl-23(Internal wiring) |
- |
500 |
|
- |
| Cl-24(Components) |
- |
500 |
|
- |
| Cl-25(Supply connection and external flexible cords) |
- |
1000 |
|
- |
| Cl-26(Terminals for external conductors) |
- |
500 |
|
- |
| Cl-27(Provision for earthing) |
- |
500 |
|
- |
| Cl-28(Screws and connections) |
- |
500 |
|
- |
| Cl-29(Clearances, creepage distances and solid insulation) |
- |
500 |
|
- |
| Cl-30(Resistance to heat and fire) |
- |
500 |
|
- |
| Cl-31(Resistance to rusting) |
- |
500 |
|
- |
| Cl-4(General requirement) |
- |
0 |
|
- |
| Cl-7(Marking and instructions) |
- |
0 |
|
- |
| Cl-8(Protection against access to live parts) |
- |
0 |
|
- |
| Cl-10(Power input and current) |
- |
0 |
|
- |
| Cl-11(Heating) |
- |
0 |
|
- |
| Cl-12(Charging of metal-ion batteries) |
- |
0 |
|
- |
| Cl-13(Leakage current and electric strength at operating temperature) |
- |
0 |
|
- |
| Cl-14(Transient overvoltages) |
- |
0 |
|
- |
| Cl-15(Moisture resistance) |
- |
0 |
|
- |
| Cl-16(Leakage current and electric strength) |
- |
0 |
|
- |
| Cl-17(Overload protection of transformers and associated circuits) |
- |
0 |
|
- |
| Cl-18(Endurance) |
- |
0 |
|
- |
| Cl-19(Abnormal operation) |
- |
0 |
|
- |
| Cl-20(Stability and mechanical hazards) |
- |
0 |
|
- |
| Cl-21(Mechanical strength) |
- |
0 |
|
- |
| Cl-22(Construction) |
- |
0 |
|
- |
| Cl-23(Internal wiring) |
- |
0 |
|
- |
| Cl-25(Supply connection and external flexible cords) |
- |
0 |
|
- |
| Cl-26(Terminals for external conductors) |
- |
0 |
|
- |
| Cl-27(Provision for earthing) |
- |
0 |
|
- |
| Cl-28(Screws and connections) |
- |
0 |
|
- |
| Cl-29(Clearances, creepage distances and solid insulation) |
- |
0 |
|
- |
| Cl-30(Resistance to heat and fire) |
- |
0 |
|
- |
| Cl-31(Resistance to rusting) |
- |
0 |
|
- |
| Cl-24(Components) |
- |
0 |
|
- |
| Cl-4(General requirement) |
- |
0 |
|
- |
| Cl-7(Marking and instructions) |
- |
0 |
|
- |
| Cl-8(Protection against access to live parts) |
- |
0 |
|
- |
| Cl-10(Power input and current) |
- |
0 |
|
- |
| Cl-11(Heating) |
- |
0 |
|
- |
| Cl-12(Charging of metal-ion batteries) |
- |
0 |
|
- |
| Cl-13(Leakage current and electric strength at operating temperature) |
- |
0 |
|
- |
| Cl-14(Transient overvoltages) |
- |
0 |
|
- |
| Cl-15(Moisture resistance) |
- |
0 |
|
- |
| Cl-16(Leakage current and electric strength) |
- |
0 |
|
- |
| Cl-17(Overload protection of transformers and associated circuits) |
- |
0 |
|
- |
| Cl-18(Endurance) |
- |
0 |
|
- |
| Cl-19(Abnormal operation) |
- |
0 |
|
- |
| Cl-20(Stability and mechanical hazards) |
- |
0 |
|
- |
| Cl-21(Mechanical strength) |
- |
0 |
|
- |
| Cl-22(Construction) |
- |
0 |
|
- |
| Cl-23(Internal wiring) |
- |
0 |
|
- |
| Cl-25(Supply connection and external flexible cords) |
- |
0 |
|
- |
| Cl-26(Terminals for external conductors) |
- |
0 |
|
- |
| Cl-27(Provision for earthing) |
- |
0 |
|
- |
| Cl-28(Screws and connections) |
- |
0 |
|
- |
| Cl-29(Clearances, creepage distances and solid insulation) |
- |
0 |
|
- |
| Cl-30(Resistance to heat and fire) |
- |
0 |
|
- |
| Cl-31(Resistance to rusting) |
- |
0 |
|
- |
| Cl-24(Components) |
- |
0 |
|
- |
| Cl-4(General requirement) |
- |
0 |
|
- |
| Cl-7(Marking and instructions) |
- |
0 |
|
- |
| Cl-8(Protection against access to live parts) |
- |
0 |
|
- |
| Cl-10(Power input and current) |
- |
0 |
|
- |
| Cl-11(Heating) |
- |
0 |
|
- |
| Cl-12(Charging of metal-ion batteries) |
- |
0 |
|
- |
| Cl-13(Leakage current and electric strength at operating temperature) |
- |
0 |
|
- |
| Cl-14(Transient overvoltages) |
- |
0 |
|
- |
| Cl-15(Moisture resistance) |
- |
0 |
|
- |
| Cl-16(Leakage current and electric strength) |
- |
0 |
|
- |
| Cl-17(Overload protection of transformers and associated circuits) |
- |
0 |
|
- |
| Cl-18(Endurance) |
- |
0 |
|
- |
| Cl-19(Abnormal operation) |
- |
0 |
|
- |
| Cl-20(Stability and mechanical hazards) |
- |
0 |
|
- |
| Cl-21(Mechanical strength) |
- |
0 |
|
- |
| Cl-22(Construction) |
- |
0 |
|
- |
| Cl-23(Internal wiring) |
- |
0 |
|
- |
| Cl-25(Supply connection and external flexible cords) |
- |
0 |
|
- |
| Cl-26(Terminals for external conductors) |
- |
0 |
|
- |
| Cl-27(Provision for earthing) |
- |
0 |
|
- |
| Cl-28(Screws and connections) |
- |
0 |
|
- |
| Cl-29(Clearances, creepage distances and solid insulation) |
- |
0 |
|
- |
| Cl-30(Resistance to heat and fire) |
- |
0 |
|
- |
| Cl-31(Resistance to rusting) |
- |
0 |
|
- |
| Cl-24(Components) |
- |
0 |
|
- |
| Cl-4(General requirement) |
- |
0 |
|
- |
| Cl-7(Marking and instructions) |
- |
0 |
|
- |
| Cl-8(Protection against access to live parts) |
- |
0 |
|
- |
| Cl-10(Power input and current) |
- |
0 |
|
- |
| Cl-11(Heating) |
- |
0 |
|
- |
| Cl-12(Charging of metal-ion batteries) |
- |
0 |
|
- |
| Cl-13(Leakage current and electric strength at operating temperature) |
- |
0 |
|
- |
| Cl-14(Transient overvoltages) |
- |
0 |
|
- |
| Cl-15(Moisture resistance) |
- |
0 |
|
- |
| Cl-16(Leakage current and electric strength) |
- |
0 |
|
- |
| Cl-17(Overload protection of transformers and associated circuits) |
- |
0 |
|
- |
| Cl-18(Endurance) |
- |
0 |
|
- |
| Cl-19(Abnormal operation) |
- |
0 |
|
- |
| Cl-20(Stability and mechanical hazards) |
- |
0 |
|
- |
| Cl-21(Mechanical strength) |
- |
0 |
|
- |
| Cl-22(Construction) |
- |
0 |
|
- |
| Cl-23(Internal wiring) |
- |
0 |
|
- |
| Cl-25(Supply connection and external flexible cords) |
- |
0 |
|
- |
| Cl-26(Terminals for external conductors) |
- |
0 |
|
- |
| Cl-27(Provision for earthing) |
- |
0 |
|
- |
| Cl-28(Screws and connections) |
- |
0 |
|
- |
| Cl-29(Clearances, creepage distances and solid insulation) |
- |
0 |
|
- |
| Cl-30(Resistance to heat and fire) |
- |
0 |
|
- |
| Cl-31(Resistance to rusting) |
- |
0 |
|
- |
| Cl-24(Components) |
- |
0 |
|
Cl. 24.1, 24.1.3, 24.1.4, 24.1.5 (IPX1 & IPX2), 24.2, 24.3, 24.5, 24.101 |
| Cl-4(General requirement) |
- |
0 |
|
- |
| Cl-7(Marking and instructions) |
- |
0 |
|
- |
| Cl-8(Protection against access to live parts) |
- |
0 |
|
- |
| Cl-10(Power input and current) |
- |
0 |
|
- |
| Cl-11(Heating) |
- |
0 |
|
- |
| Cl-12(Charging of metal-ion batteries) |
- |
0 |
|
- |
| Cl-13(Leakage current and electric strength at operating temperature) |
- |
0 |
|
- |
| Cl-14(Transient overvoltages) |
- |
0 |
|
- |
| Cl-15(Moisture resistance) |
- |
0 |
|
- |
| Cl-16(Leakage current and electric strength) |
- |
0 |
|
- |
| Cl-17(Overload protection of transformers and associated circuits) |
- |
0 |
|
- |
| Cl-18(Endurance) |
- |
0 |
|
- |
| Cl-19(Abnormal operation) |
- |
0 |
|
- |
| Cl-20(Stability and mechanical hazards) |
- |
0 |
|
- |
| Cl-21(Mechanical strength) |
- |
0 |
|
- |
| Cl-22(Construction) |
- |
0 |
|
- |
| Cl-23(Internal wiring) |
- |
0 |
|
- |
| Cl-25(Supply connection and external flexible cords) |
- |
0 |
|
- |
| Cl-26(Terminals for external conductors) |
- |
0 |
|
- |
| Cl-27(Provision for earthing) |
- |
0 |
|
- |
| Cl-28(Screws and connections) |
- |
0 |
|
- |
| Cl-29(Clearances, creepage distances and solid insulation) |
- |
0 |
|
- |
| Cl-30(Resistance to heat and fire) |
- |
0 |
|
- |
| Cl-31(Resistance to rusting) |
- |
0 |
|
- |
| Cl-24(Components) |
- |
0 |
|
- |
|
03 Oct, 2027 |
- "Included w.e.f 02.01.2026
Cl-32 (Radiation, toxicity and similar hazards)
Cl-19.11.4.1 (Electrostatic discharges)
Cl-19.11.4.2 (Radiated fields)
Cl-19.11.4.3 (Fast transient bursts)
Cl-19.11.4.4 (Surge immunity test)
Cl-19.11.4.5 (Immunity to conducted discharges)
Cl-19.11.4.6 (Class 3 Voltage dips and interruptions)
Cl-19.11.4.7 (Harmonics)
Cl-24 (Components)" |
| 12 |
IS 398 : Part 4 (1994) |
Aluminium conductors for overhead transmission purposes: Part 4 aluminium alloy stranded conductors (Aluminium - Magnesium - Silicon Type) - Specification (Third Revision) |
- |
10000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 6.1(Freedom from Defects) |
- |
100 |
|
For 22, 34, 55, 80,100 Rs. 10,000/- each 125, 148, 173, 200 525, 570, 604, 642, 695,767 sq.mm Rs. 15,500/- each |
| 7.1 Table-1(Dimensional measurement of wires) |
- |
500 |
|
- |
| 7.2.2 Table-2, Table-4(Calculated resistance of Stranded Conductor) |
- |
500 |
|
- |
| 8.1(Joints in wires-Conductors Containing Seven Wires) |
- |
100 |
|
- |
| 8.2(Joints in wires-Conductors Containing More Than Seven Wires) |
- |
100 |
|
- |
| 9.1(Stranding) |
- |
200 |
|
- |
| 9.2 Table 3(Lay Ratio of stranded conductors) |
- |
100 |
|
- |
| 9.3(Direction of Lay) |
- |
200 |
|
- |
| 9.4(Multiple layers of wires) |
- |
400 |
|
- |
| 11(Packing and Marking) |
- |
100 |
|
- |
| 12.2 Table 1(Breaking Load Test- Before Stranding) |
- |
500 |
|
- |
| 12.2 Table 1(Breaking Load Test- After Stranding) |
- |
500 |
|
- |
| 12.3 Table 1(Elongation Test- Before Stranding) |
- |
500 |
|
- |
| 12.3 Table 1(Elongation Test- After Stranding) |
- |
500 |
|
- |
| 12.4 Table 1(Resistance of Aluminium wire) |
- |
200 |
|
- |
| 9.2(Lay Ratio 24 wire layer) |
- |
200 |
|
- |
| 9.2(Lay Ratio 18 wire layer) |
- |
500 |
|
- |
| 9.2(Lay Ratio 12 wire layer) |
- |
300 |
|
- |
| 9.2(Lay Ratio 3/6 wire layer) |
- |
300 |
|
- |
| 7.2.1(Sizes) |
- |
200 |
|
- |
| Cl-7.2 (7.2.1, 7.2.2), Table-2(Stranding and Wire Dia) |
- |
500 |
|
- |
| Cl- 7.2 (7.2.1, 7.2.2), Table-2(Approx Overall Dia) |
- |
500 |
|
- |
| Cl. 7.2 (7.2.1, 7.2.2), Table 2(Approx Mass) |
- |
500 |
|
- |
| Cl- 7.2 (7.2.1, 7.2.2), Table-2(Calculated Maximum Resistance at 20°C) |
- |
500 |
|
- |
| Cl- 7.2 (7.2.1, 7.2.2), Table-2(Approx Calculated Breaking Load) |
- |
500 |
|
- |
| 6.1(Freedom from Defects) |
- |
0 |
|
- |
| 7.1 Table-1(Dimensional measurement of wires) |
- |
0 |
|
- |
| 7.2.2 Table-2, Table-4(Calculated resistance of Stranded Conductor) |
- |
0 |
|
- |
| 8.1(Joints in wires-Conductors Containing Seven Wires) |
- |
0 |
|
- |
| 8.2(Joints in wires-Conductors Containing More Than Seven Wires) |
- |
0 |
|
- |
| 9.1(Stranding) |
- |
0 |
|
- |
| 9.2 Table 3(Lay Ratio of stranded conductors) |
- |
0 |
|
- |
| 9.3(Direction of Lay) |
- |
0 |
|
- |
| 9.4(Multiple layers of wires) |
- |
0 |
|
- |
| 11(Packing and Marking) |
- |
0 |
|
- |
| 12.2 Table 1(Breaking Load Test- Before Stranding) |
- |
0 |
|
- |
| 12.2 Table 1(Breaking Load Test- After Stranding) |
- |
0 |
|
- |
| 12.3 Table 1(Elongation Test- Before Stranding) |
- |
0 |
|
- |
| 12.3 Table 1(Elongation Test- After Stranding) |
- |
0 |
|
- |
| 12.4 Table 1(Resistance of Aluminium wire) |
- |
0 |
|
- |
| 9.2(Lay Ratio 24 wire layer) |
- |
0 |
|
- |
| 9.2(Lay Ratio 18 wire layer) |
- |
0 |
|
- |
| 9.2(Lay Ratio 12 wire layer) |
- |
0 |
|
- |
| 9.2(Lay Ratio 3/6 wire layer) |
- |
0 |
|
- |
| 7.2.1(Sizes) |
- |
0 |
|
- |
| Cl-7.2 (7.2.1, 7.2.2), Table-2(Stranding and Wire Dia) |
- |
0 |
|
- |
| Cl- 7.2 (7.2.1, 7.2.2), Table-2(Approx Overall Dia) |
- |
0 |
|
- |
| Cl. 7.2 (7.2.1, 7.2.2), Table 2(Approx Mass) |
- |
0 |
|
- |
| Cl- 7.2 (7.2.1, 7.2.2), Table-2(Calculated Maximum Resistance at 20°C) |
- |
0 |
|
- |
| Cl- 7.2 (7.2.1, 7.2.2), Table-2(Approx Calculated Breaking Load) |
- |
0 |
|
- |
| 6.1(Freedom from Defects) |
- |
0 |
|
- |
| 7.1 Table-1(Dimensional measurement of wires) |
- |
0 |
|
- |
| 7.2.2 Table-2, Table-4(Calculated resistance of Stranded Conductor) |
- |
0 |
|
- |
| 8.1(Joints in wires-Conductors Containing Seven Wires) |
- |
0 |
|
- |
| 8.2(Joints in wires-Conductors Containing More Than Seven Wires) |
- |
0 |
|
- |
| 9.1(Stranding) |
- |
0 |
|
- |
| 9.2 Table 3(Lay Ratio of stranded conductors) |
- |
0 |
|
- |
| 9.3(Direction of Lay) |
- |
0 |
|
- |
| 9.4(Multiple layers of wires) |
- |
0 |
|
- |
| 11(Packing and Marking) |
- |
0 |
|
- |
| 12.2 Table 1(Breaking Load Test- Before Stranding) |
- |
0 |
|
- |
| 12.2 Table 1(Breaking Load Test- After Stranding) |
- |
0 |
|
- |
| 12.3 Table 1(Elongation Test- Before Stranding) |
- |
0 |
|
- |
| 12.3 Table 1(Elongation Test- After Stranding) |
- |
0 |
|
- |
| 12.4 Table 1(Resistance of Aluminium wire) |
- |
0 |
|
- |
| 9.2(Lay Ratio 24 wire layer) |
- |
0 |
|
- |
| 9.2(Lay Ratio 18 wire layer) |
- |
0 |
|
- |
| 9.2(Lay Ratio 12 wire layer) |
- |
0 |
|
- |
| 9.2(Lay Ratio 3/6 wire layer) |
- |
0 |
|
- |
| 7.2.1(Sizes) |
- |
0 |
|
- |
| Cl-7.2 (7.2.1, 7.2.2), Table-2(Stranding and Wire Dia) |
- |
0 |
|
- |
| Cl- 7.2 (7.2.1, 7.2.2), Table-2(Approx Overall Dia) |
- |
0 |
|
- |
| Cl. 7.2 (7.2.1, 7.2.2), Table 2(Approx Mass) |
- |
0 |
|
- |
| Cl- 7.2 (7.2.1, 7.2.2), Table-2(Calculated Maximum Resistance at 20°C) |
- |
0 |
|
- |
| Cl- 7.2 (7.2.1, 7.2.2), Table-2(Approx Calculated Breaking Load) |
- |
0 |
|
- |
|
03 Oct, 2027 |
- Incuded w.e.f. 14.10.2025 |
| 13 |
IS 3854 (2023) |
Switches for Domestic and Similar Purposes - Specification (Third Revision) |
UP TO AND INCLUDING 32A |
19800 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl-4(General Requirements) |
- |
20 |
|
- |
| Cl-5(General notes on tests) |
- |
20 |
|
- |
| Cl-6(Rating) |
- |
50 |
|
- |
| Cl-7(Classification) |
- |
50 |
|
- |
| Cl-8(Marking) |
- |
200 |
|
- |
| Cl-9(Checking of dimensions) |
- |
200 |
|
- |
| Cl-10.1, 10.2(Prevention of Access to Live Parts) |
- |
300 |
|
- |
| Cl-10.3(Requirements for Accessible Metal Parts) |
- |
150 |
|
- |
| Cl-10.4(Requirements for Insulation of the Mechanism) |
- |
250 |
|
- |
| Cl. 10.5(Requirements for Insulation of the Mechanism with Respect to the Surrounding Environment) |
- |
250 |
|
- |
| Cl-10.6(Requirements for Switches Operated Indirectly) |
- |
250 |
|
- |
| Cl-10.7(Requirements for Switches with Replaceable Pull Cord) |
- |
250 |
|
- |
| Cl-11(Provision for earthing) |
- |
300 |
|
- |
| Cl-12(Terminals) |
- |
200 |
|
- |
| Cl-13(Constructional requirements) |
- |
200 |
|
- |
| Cl-14(Mechanism) |
- |
250 |
|
- |
| Cl-15.1(Resistance to Ageing) |
- |
500 |
|
- |
| Cl-15.3(Resistance to Humidity) |
- |
1000 |
|
- |
| Cl-16.1(General) |
- |
200 |
|
- |
| Cl-16.2(Test for Measuring the Insulation Resistance) |
- |
150 |
|
- |
| Cl-16.3(Electric Strength Test) |
- |
1000 |
|
- |
| Cl-17(Temperature rise) |
- |
500 |
|
- |
| Cl-18(Making and breaking capacity) |
- |
2000 |
|
- |
| Cl-19(Normal operation) |
- |
2000 |
|
- |
| Cl-20(Mechanical strength) |
- |
200 |
|
- |
| Cl-21(Resistance to heat) |
- |
1000 |
|
- |
| Cl-22(Screws, current carrying parts and connections) |
- |
200 |
|
- |
| Cl-23(Creepage distances, clearances and distance through sealing compound) |
- |
250 |
|
- |
| Cl-24.1(Resistance to abnormal heat and fire) |
- |
250 |
|
- |
| Cl-24.2(Resistance to tracking) |
- |
250 |
|
- |
| Cl-25(Resistance to rusting) |
- |
250 |
|
- |
| 19.1(Test for Switches Intended for Inductive Loads) |
- |
500 |
|
- |
| 19.2(Test for Switches Intended for Externally Ballasted Lamp Loads) |
- |
500 |
|
- |
| 19.3(Test for Switches Intended for Self-ballasted Lamp Loads) |
- |
3000 |
|
- |
| 13.5(Attachment of knobs) |
- |
200 |
|
- |
| 12.3.11(Table 11)(Test Current for the Verification of Electrical and Thermal Stresses in Normal Use of Screwless Terminals) |
- |
250 |
|
- |
| 12.3.12(Table 13)(Deflection Test Forces) |
- |
230 |
|
- |
| Cl-4(General Requirements) |
- |
0 |
|
- |
| Cl-5(General notes on tests) |
- |
0 |
|
- |
| Cl-6(Rating) |
- |
0 |
|
- |
| Cl-7(Classification) |
- |
0 |
|
- |
| Cl-8(Marking) |
- |
0 |
|
- |
| Cl-9(Checking of dimensions) |
- |
0 |
|
- |
| Cl-10.1, 10.2(Prevention of Access to Live Parts) |
- |
0 |
|
- |
| Cl-10.3(Requirements for Accessible Metal Parts) |
- |
0 |
|
- |
| Cl-10.4(Requirements for Insulation of the Mechanism) |
- |
0 |
|
- |
| Cl. 10.5(Requirements for Insulation of the Mechanism with Respect to the Surrounding Environment) |
- |
0 |
|
- |
| Cl-10.6(Requirements for Switches Operated Indirectly) |
- |
0 |
|
- |
| Cl-10.7(Requirements for Switches with Replaceable Pull Cord) |
- |
0 |
|
- |
| Cl-11(Provision for earthing) |
- |
0 |
|
- |
| Cl-12(Terminals) |
- |
0 |
|
- |
| Cl-13(Constructional requirements) |
- |
0 |
|
- |
| Cl-14(Mechanism) |
- |
0 |
|
- |
| Cl-15.1(Resistance to Ageing) |
- |
0 |
|
- |
| Cl-15.3(Resistance to Humidity) |
- |
0 |
|
- |
| Cl-16.1(General) |
- |
0 |
|
- |
| Cl-16.2(Test for Measuring the Insulation Resistance) |
- |
0 |
|
- |
| Cl-16.3(Electric Strength Test) |
- |
0 |
|
- |
| Cl-17(Temperature rise) |
- |
0 |
|
- |
| Cl-18(Making and breaking capacity) |
- |
0 |
|
- |
| Cl-19(Normal operation) |
- |
0 |
|
- |
| Cl-20(Mechanical strength) |
- |
0 |
|
- |
| Cl-21(Resistance to heat) |
- |
0 |
|
- |
| Cl-22(Screws, current carrying parts and connections) |
- |
0 |
|
- |
| Cl-23(Creepage distances, clearances and distance through sealing compound) |
- |
0 |
|
- |
| Cl-24.1(Resistance to abnormal heat and fire) |
- |
0 |
|
- |
| Cl-24.2(Resistance to tracking) |
- |
0 |
|
- |
| Cl-25(Resistance to rusting) |
- |
0 |
|
- |
| 19.1(Test for Switches Intended for Inductive Loads) |
- |
0 |
|
- |
| 19.2(Test for Switches Intended for Externally Ballasted Lamp Loads) |
- |
0 |
|
- |
| 19.3(Test for Switches Intended for Self-ballasted Lamp Loads) |
- |
0 |
|
- |
| 12.3.11(Table 11)(Test Current for the Verification of Electrical and Thermal Stresses in Normal Use of Screwless Terminals) |
- |
0 |
|
- |
| 12.3.12(Table 13)(Deflection Test Forces) |
- |
0 |
|
- |
| 13.5(Attachment of knobs) |
- |
0 |
|
- |
|
03 Oct, 2027 |
- Included w.e.f 10.10.2025
Exclusion: Cl-15.2 (Protection Provided by Enclosures of Switches) |
| 14 |
IS 302 : Part 2 : Sec 202 (1992) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 202 electric stoves |
- |
14500 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 6(Classification- IS 302-1 ) |
- |
200 |
|
- |
| 6(Classification- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
500 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.1(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.3(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.4(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.6(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.11(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.12(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.13(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.14(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.15(Marking- IS 302-1) |
- |
0 |
|
- |
| 7.101(Marking) |
- |
0 |
|
- |
| 8( Protection Against Electric Shock, IS 302-1) |
- |
500 |
|
- |
| 10(Power Input and Current, IS 302-1) |
- |
1000 |
|
- |
| 11(Heating, IS 302-1) |
- |
1000 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 11(Heating, IS 302-1) |
- |
0 |
|
- |
| 12(Operation under overload conditions of appliances with heating elements, IS 302-2-202: 1992) |
- |
500 |
|
- |
| 13(Electrical Insulation and Leakage Current at Operating Temperature: Leakage current, IS 302-1) |
- |
500 |
|
- |
| 13(Electrical Insulation and Leakage Current at Operating Temperature: High Voltage, IS 302-1) |
- |
0 |
|
- |
| 15.1(Moisture Resistance, IS 302-1) |
- |
1000 |
|
- |
| 15.3(Moisture Resistance, IS 302-1) |
- |
500 |
|
- |
| 16(Electrical Insulation and Leakage Current at Operating Temperature: Leakage current, IS 302-1) |
- |
500 |
|
- |
| 16(Electrical Insulation and Leakage Current at Operating Temperature: High Voltage, IS 302-1) |
- |
0 |
|
- |
| 19.2(Abnormal Operation, IS 302-1) |
- |
1000 |
|
- |
| 19.2(Abnormal Operation, IS 302-1) |
- |
500 |
|
- |
| 19.3(Abnormal Operation, IS 302-1) |
- |
1000 |
|
- |
| 19.3(Abnormal Operation, IS 302-1) |
- |
0 |
|
- |
| 20.1(Stability & Mechanical Hazards, IS 302-1) |
- |
500 |
|
- |
| 21.1(Mechanical Strength, IS 302-1 & IS 302-2-202) |
- |
500 |
|
- |
| 22(Construction, IS 302-1) |
- |
1000 |
|
- |
| 22.101(Construction) |
- |
0 |
|
- |
| 22.102(Construction) |
- |
0 |
|
- |
| 22.103(Construction) |
- |
0 |
|
- |
| 22.104(Construction) |
- |
0 |
|
- |
| 22.105(Construction) |
- |
0 |
|
- |
| 22.105.1(Construction) |
- |
0 |
|
- |
| 22.105.2(Construction) |
- |
0 |
|
- |
| 22.106(Construction) |
- |
0 |
|
- |
| 22.107(Construction) |
- |
0 |
|
- |
| 11.107.1(Construction) |
- |
0 |
|
- |
| 23.1(Internal Wiring, IS 302-1) |
- |
500 |
|
- |
| 23.2(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.8(Internal Wiring, IS 302-1) |
- |
500 |
|
- |
| 23.9(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 23.10(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 24.1(Components, IS 302-1) |
- |
500 |
|
- |
| 24.2(Components, IS 302-1) |
- |
0 |
|
- |
| 24.101(Components) |
- |
0 |
|
- |
| 25.1(Supply Connection and External Flexible Cords, IS 302-1) |
- |
1000 |
|
- |
| 25.4(Supply Connection and External Flexible Cords) |
- |
0 |
|
- |
| 25.5(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.6(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.8(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 26.9(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.1(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.11(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.12(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.15(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.16(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.17(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.18(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.19(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.2(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.21(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.22(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 26(Terminals for External Conductors, IS 302-1) |
- |
500 |
|
- |
| 27.1(Provision for Earthing, IS 302-1) |
- |
500 |
|
- |
| 27.2(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27.3(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27.4(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 27.5(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 28(Screws & Connections, IS 302-1) |
- |
500 |
|
- |
| 29.1(Clearances, Creepage distances and Solid Insulation, IS 302-1) |
- |
500 |
|
- |
| 29.2(Clearances, Creepage distances and Solid Insulation, IS 302-1) |
- |
0 |
|
0 |
| 30.1(Resistance to Heat, Fire & Tracking, IS 302-1) |
- |
500 |
|
- |
| 30.2(Resistance to Heat, Fire & Tracking, IS 302-1) |
- |
500 |
|
- |
| 31(Resistance of Rusting, IS 302-1) |
- |
500 |
|
- |
|
03 Oct, 2027 |
- Included w.e.f 04.08.2025
Exclusion: Cl 19.11.4.1-19.11.4.7(EMI/EMC) |
| 15 |
IS 302 : Part 2 : Sec 80 (2017) |
Household and similar electrical appliances - Safety: Part 2 - 80 particular requirements for fans (First Revision) |
- |
14900 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 31.0(Resistance To Rusting) |
- |
1000 |
|
- |
| 30.0(Resistance To Heat and Fire) |
- |
1000 |
|
- |
| 29.0(Creepage Distances and Clearances) |
- |
300 |
|
- |
| 28.0(Screws and Connections) |
- |
300 |
|
- |
| 27.0(Provision For Earthing) |
- |
500 |
|
- |
| 26.0(Terminals for external conductors) |
- |
500 |
|
- |
| 25.0(Supply Connection and External Flexible Cords) |
- |
500 |
|
- |
| 24.0(Components) |
- |
300 |
|
- |
| 23.0(Internal Wiring) |
- |
500 |
|
- |
| 22.0(Construction) |
- |
300 |
|
- |
| 21.0(Mechanical Strength) |
- |
300 |
|
- |
| 20.0(Stability and mechanical hazards) |
- |
200 |
|
- |
| 19.0(Abnormal Operation) |
- |
1500 |
|
- |
| 17.0(Overload Protection of transformer and associated circuit) |
- |
200 |
|
- |
| 16.0(Leakage current and Electric strength (After Humidity (Environmental) Treatment)) |
- |
500 |
|
- |
| 15.0(Moisture resistance) |
- |
1500 |
|
- |
| 14.0(Transient Overvoltage) |
- |
500 |
|
- |
| 13.0(Leakage Current and electric strength at operating temperature) |
- |
500 |
|
- |
| 11.0(Heating) |
- |
1500 |
|
- |
| 10.0(Input and Current) |
- |
1500 |
|
- |
| 8.0(Protection against access to live parts) |
- |
1000 |
|
- |
| 7.0(Classification) |
- |
200 |
|
- |
| 6.0(Marking and Instructions) |
- |
300 |
|
- |
| 4(GENERAL REQUIREMENT) |
- |
200 |
|
- |
| 5(GENERAL CONDITIONS FOR THE TESTS) |
- |
200 |
|
- |
|
03 Oct, 2027 |
- Included w.e.f.31.07.2025
Exclusion
Cl 19.11.4.1 to Cl 19.11.4.7(EMI/EMC)
Cl 32 (Radiation, Toxicity and similar hazards) |
| 16 |
IS 4250 (2025) |
Electric Food-Mixers (Liquidizers and Grinders) and Centrifugal Juicers � Specification ( Second Revision ) |
- |
30000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl-4(General Requirements) |
- |
500 |
|
- |
| Cl-5(General Conditions for the tests) |
- |
500 |
|
- |
| Cl-6(Classification) |
- |
500 |
|
- |
| Cl-7(Marking) |
- |
1000 |
|
- |
| Cl-8(Safety Requirements) |
- |
2000 |
|
- |
| Cl-9(Endurance fpr motor and base assembly) |
- |
5000 |
|
- |
| Cl-10.2("Grinding Coffee (for Machines that Have a
Dry Grinding Arrangement)") |
- |
1500 |
|
- |
| Cl-10.3(Whisking Egg Whites (for Machines that have Whisking Egg Arrangement)) |
- |
1500 |
|
- |
| Cl-10.4(Idli Batter) |
- |
1500 |
|
- |
| Cl-10.5(Operational Tests for Juicers) |
- |
1500 |
|
- |
| Cl-11(Temperature Withstand Test for Bowl) |
- |
1000 |
|
- |
| Cl-12.1(Test for Switches) |
- |
3000 |
|
- |
| Cl-13(Strength of Assembly) |
- |
1000 |
|
- |
| Cl-14.2, 14.3 Table-2 (i)(Protection against access to live parts) |
- |
1000 |
|
- |
| Cl-14.2, Table-2 (ii)(Power input and current) |
- |
2000 |
|
- |
| Cl-14.2, 14.3 Table-2 (iii)(Leakage current and electric strength at operating temperature) |
- |
2000 |
|
- |
| Cl-14.2, Table-2 (iv)(Moisture resistance) |
- |
2000 |
|
- |
| Cl-14.2, Table-2 (v)(Leakage current and electric strength) |
- |
2000 |
|
- |
| Cl-14.2, 14.3 Table-2 (vi)(Provision for earthing) |
- |
2000 |
|
- |
|
03 Oct, 2027 |
- - |
| 17 |
IS 14927 : Part 2 : Sec 1 (2023) |
Cable trunking systems and cable ducting Systems for electrical installations Part 2-1: particular requirements cable trunking systems and cable Ducting systems intended for mounting on walls and ceilings first revision |
- |
25000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl.9.1(Sharp edges) |
- |
500 |
|
- |
| Cl.9.2(Apparatus mounting) |
- |
500 |
|
- |
| Cl.9.3(Means for protective separation and/or retention) |
- |
1000 |
|
- |
| Cl.9.4(Mechanical connections) |
- |
1000 |
|
- |
| Cl.9.5(Accessible conductive parts) |
- |
1000 |
|
- |
| Cl.9.6(Equipotential bonding) |
- |
500 |
|
- |
| Cl.9.7(Access to live parts) |
- |
1000 |
|
- |
| Cl.9.8(Inlet openings) |
- |
500 |
|
- |
| Cl.9.9(Membranes) |
- |
1000 |
|
- |
| Cl.9.10(Cable restrainer) |
- |
1000 |
|
- |
| Cl.9.11(Cable anchorage) |
- |
1000 |
|
- |
| Cl. 9.101(Assembling) |
- |
1000 |
|
- |
| Cl. 9.102(Contact between liquids and insulated conductors and live parts) |
- |
1000 |
|
- |
| Cl.10.1(Linear deflection test) |
- |
1000 |
|
- |
| Cl.10.1(Mechanical strength) |
- |
1000 |
|
- |
| Cl.10.2(Cable support test) |
- |
1000 |
|
- |
| Cl.10.3(Impact test) |
- |
1000 |
|
- |
| Cl.10.5(External load test) |
- |
500 |
|
- |
| Cl.10.6(System access cover retention) |
- |
500 |
|
- |
| Cl. 10.101(Compression test for CDS) |
- |
1500 |
|
- |
| Cl.11.1(Electrical continuity) |
- |
1000 |
|
- |
| Cl.11.2(Electrical insulation) |
- |
1000 |
|
- |
| Cl.12(Thermal properties) |
- |
1000 |
|
- |
| Cl.13(Fire hazard) |
- |
2000 |
|
- |
| Cl.14(External influences) |
- |
2000 |
|
- |
|
03 Oct, 2027 |
- Included w.e.f 18.08.2025
Exclusion: Cl. 15 (Electromagnetic compatibility) |
| 18 |
IS 3419 (1988) |
Specification for fittings for rigid non - Metallic (Second Revision) |
---- |
10000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 8 & 5(Visual Examination -IS:3419) |
- |
500 |
|
- |
| 6.2 & 9.1- Table-1, ii(Inside Diameter of Collar for Slip type cuplers -IS:3419) |
- |
500 |
|
- |
| 6.2 & 9.1- Table-1, iii(Inside Diameter of Ridge for Slip type cuplers -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-1, iv(Minimum overall length for Slip type cuplers -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-1, v(Minimum wall thickness for Slip type cuplers -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-2, ii(Inside Diameter of Collar for Socketed type cuplers -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-2, iii(Inside Diameter of Ridge for Socketed type cuplers -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-2, iv(Minimum overall length (a) for Socketed type cuplers -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-2, v(Minimum overall length (l) for Socketed type cuplers -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-2, vi(Minimum wall thickness for Socketed type cuplers -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-3, ii(Inside Diameter of Collar(d6) for Clamp type cuplers -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-3, iii(Inside Diameter of Collar (d5) for Clamp type cuplers -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-3, iv(Inside Diameter of Ridge for Clamp type cuplers -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-3, iv(Minimum length for Clamp type cuplers -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-3, vi(Minimum wall thickness for Clamp type cuplers -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-4, ii(Outside Dameter of Normal type bend -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-4, iii(Minimum Inside Diameter of Normal Type Bend -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-4, iv(Radious(R) of Normal Type Bend -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-4, v(Length (l1) of Normal Type Bend -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-5, ii(Outside Dameter of Slip type cupling bend -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-5, iii(Minimum Inside Diameter of Slip type cupling bend -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-5, iv(Inside Diameter of collar for Slip type cupling bend -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-5, v(R- for Slip type cupling bend -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-5, vi(Y- for Slip type cupling bend -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-5, vii(l2- for Slip type cupling bend -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-6, ii(Inside Diameter of collar for Normal type Elbows -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-6, iii(Length (l) of Normal Type Elbows -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-6, iv(Radious(r) of Normal Type Elbows -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-6, v(Minimum wall thicknes of Elbows -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-7, ii(Inside Diameter of Collear for Normal type Tees -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-7, iii(Length (l) of Normal type Tees -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-7, iv(Radious(r) of Normal type Tees -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-7, v( Minimum wall thicknes of Normal type Tees -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-8, ii(Inside Diameter of Collear for socketed type Tees - IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-8, iii(a - of socketed type Tees -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-8, iv(l - of socketed type Tees -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-8, v(Minimum wall thicknes of socketed type Tees -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-9, ii(B - of spout Type Circular Boxes -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-9, iii(C - of spout Type Circular Boxes -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-9, iv(D - of spout Type Circular Boxes -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-9, v(E - of spout Type Circular Boxes -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-9, vi(F(Max) - of spout Type Circular Boxes -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-9, vii(F(Min) - of spout Type Circular Boxes -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-9, viii(G - of spout Type Circular Boxes -IS:3419) |
- |
0 |
|
- |
| 6.2 & 9.1- Table-9, ix(t - of spout Type Circular Boxes -IS:3419) |
- |
0 |
|
- |
| 10(Resistance to Heat -IS:3419) |
- |
1000 |
|
- |
| 11(Resistance to Burning - IS 3419) |
- |
1000 |
|
- |
| 12(Moisture Absorption - IS 3419) |
- |
500 |
|
- |
| 13.2 &13.3(Resistance to chemival action in Acid solution - IS 3419) |
- |
1000 |
|
- |
| 13.2 &13.3(Resistance to chemival action in Alkaline solution - IS 3419) |
- |
1000 |
|
- |
| 14.1(Copper Test - IS 3419) |
- |
1000 |
|
- |
| 15, 15.3(Resistance to Oil - IS 3419) |
- |
500 |
|
- |
| 15,15.4(Resistance to Oil - IS 3419) |
- |
500 |
|
- |
| 16- Appendix-A(Resistance to Impact -IS 3419) |
- |
500 |
|
- |
| 17.2(Electric Strength - IS 3419) |
- |
500 |
|
- |
| 17.3(Insulation Resistance - IS 3419) |
- |
500 |
|
- |
| Cl.7.1(Marking) |
- |
500 |
|
- |
| Cl.7.1(Construction) |
- |
500 |
|
- |
| Cl. 5(Construction) |
- |
0 |
|
- |
| Cl. 5(Construction) |
- |
0 |
|
- |
| Cl.5.3(Construction) |
- |
500 |
|
- |
| Cl.5.3(Construction) |
- |
0 |
|
- |
| (Cl.6) Table 9(Dimensions A) |
- |
500 |
|
- |
| (Cl.6) Table 9(Dimensions B) |
- |
0 |
|
- |
| (Cl.6) Table 9(Dimensions C) |
- |
0 |
|
- |
| (Cl.6) Table 9(Dimensions D) |
- |
0 |
|
- |
| (Cl.6) Table 9(Dimensions E) |
- |
0 |
|
- |
| (Cl.6) Table 9(Dimensions F) |
- |
0 |
|
- |
| (Cl.6) Table 9(Dimensions G) |
- |
0 |
|
- |
| (Cl.6) Table 9(Dimensions t) |
- |
0 |
|
- |
| Cl. 10(Resistance to Heat) |
- |
0 |
|
0 |
| Cl. 11(Resistance to Burning) |
- |
0 |
|
- |
| Cl. 12(Moisture Absorption Test) |
- |
0 |
|
- |
| Cl.13(Resistance to Chemical Action) |
- |
0 |
|
- |
| Cl.14(Copper Test) |
- |
0 |
|
- |
| Cl. 15(Resistance to Oil) |
- |
0 |
|
- |
| Cl. 15(Resistance to Oil) |
- |
0 |
|
- |
|
03 Oct, 2027 |
- Included w.e.f.29.07.2025 |
| 19 |
IS 9537 : Part 3 (1983) |
Specification for conduits for electrical installations: Part 3 rigid plain conduits of insulating meterials |
---- |
4500 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 6.1(Marking) |
- |
100 |
|
- |
| 6.2(Durability of Marking as per 6.4 of IS: 9537 (Part 1)-1980) |
- |
200 |
|
- |
| 6.3(Standard Mark on Conduit) |
- |
100 |
|
- |
| 7.1.1(Maximum and minimum outside diameter of socket) |
- |
100 |
|
- |
| 7.1.1 Table-2(Length of Socket end) |
- |
100 |
|
- |
| 7.1.2(Maximum and minimum outside diameter of conduit) |
- |
200 |
|
- |
| 7.2(Minimum inside diameter of conduit) |
- |
200 |
|
- |
| 7.3(Length of conduit) |
- |
100 |
|
- |
| 7.4(Unifomity of The wall Thickness) |
- |
100 |
|
- |
| 8.1(Construction as per clause 8 of IS: 9537 (Part 1)-1980) |
- |
100 |
|
- |
| 9.2(Bending Test i) At Room Temp ii) At Low Temp (-5 ±2°C)) |
- |
300 |
|
- |
| 9.3(Compression Test as per caluse 9.3 of IS: 9537 (Part 1)-1980) |
- |
300 |
|
- |
| 9.4(Impact Test as per clause 9.4 of IS: 9537 (Part 1)-1980) |
- |
500 |
|
- |
| 9.5(Collapse Test as per clause 9.5 of IS: 9537 (Part 1)-1980) |
- |
300 |
|
- |
| 10(Resistance to Heat -Ball presure test) |
- |
300 |
|
- |
| 11(Resistance to burning as per clause 11 of IS: 9537 (Part 1)-1980) |
- |
500 |
|
- |
| 12(Electrical Characteristics-Test for electric strength as per clause 12.1.1 of IS: 9537 (Part 1)-1980) |
- |
500 |
|
- |
| 12(Electrical Characteristics-Insulation resistance test as per clause 12.1.2 of IS: 9537 (Part 1)-1980) |
- |
500 |
|
- |
| 13(Tests for external influence as per clause 13 of IS: 9537 (Part 1)-1980) |
- |
200 |
|
- |
| 13(Tests for external influence as per clause 13 of IS: 9537 (Part 1)-1980) |
- |
200 |
|
- |
| 12(3 Characteristics-Insulation resistance test as per clause 12.1.2 of IS: 9537 (Part 1)-1980) |
- |
500 |
|
- |
| 12(3 Characteristics-Test for electric strength as per clause 12.1.1 of IS: 9537 (Part 1)-1980) |
- |
500 |
|
- |
| 11.0(Resistance to burning as per clause 11 of IS: 9537 (Part 1)-1980) |
- |
500 |
|
- |
| 10.0(Resistance to Heat -Ball presure test) |
- |
300 |
|
- |
| 9.5 Fig.5(Collapse Test as per clause 9.5 of IS: 9537 (Part 1)-1980) |
- |
300 |
|
- |
| 9.4(Impact Test as per clause 9.4 of IS: 9537 (Part 1)-1980) |
- |
500 |
|
- |
| 9.3(Compression Test (after removal of force) as per caluse 9.3.3 of IS: 9537 (Part 1)-1980) |
- |
300 |
|
- |
| 9.3(Compression Test at Full force applied (On load)) |
- |
300 |
|
- |
| 9.2(Bending Test At Low Temp (-5 ±2°C)) |
- |
300 |
|
- |
| 9.2(Bending Test At Room Temp) |
- |
300 |
|
- |
| 8.1(Construction as per clause 8 of IS: 9537 (Part 1)-1980) |
- |
100 |
|
- |
| 7.4(Unifomity of The wall Thickness) |
- |
100 |
|
- |
| 7.3(Length of conduit) |
- |
100 |
|
- |
| 7.2 Fig.3(Minimum inside diameter of conduit) |
- |
200 |
|
- |
| 7.1.2 Fig.2(Minimum outside diameter of conduit) |
- |
200 |
|
- |
| 7.1.2 Fig.1(Maximum outside diameter of conduit) |
- |
200 |
|
- |
| 7.1.1 Table-2(Length of Socket end) |
- |
100 |
|
- |
| 7.1.1 Fig.8(Maximum inside diameter of socket) |
- |
100 |
|
- |
| 7.1.1 Fig.7(Maximum outside diameter of socket) |
- |
100 |
|
- |
| 6.3(Standard Mark on Conduit) |
- |
100 |
|
- |
| 6.2(Durability of Marking as per 6.4 of IS: 9537 (Part 1)-1980) |
- |
200 |
|
- |
| 6.1 - d(Marking) |
- |
100 |
|
- |
| 6.1 - c(Marking) |
- |
100 |
|
- |
| 6.1 - b(Marking) |
- |
100 |
|
- |
| 6.1 - a(Marking) |
- |
100 |
|
- |
|
03 Oct, 2027 |
- Included w.e.f.17.07.2025
Exclusion
13 (Tests for external influence as per clause 13 of IS: 9537 (Part 1)-1980) |
| 20 |
IS 302 : Part 1 (2024) |
Household and Similar Electrical Appliances â Safety Part 1 General Requirements (Seventh Revision) |
- |
45000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 12(Charging of metal-ion batteries) |
- |
1000 |
|
- |
| 6(Classification- IS 302-1) |
- |
500 |
|
- |
| 5(General conditions for the tests) |
- |
500 |
|
- |
| 11.8(Temperature rise) |
- |
1000 |
|
- |
| 11.7(Duration corresponding) |
- |
1000 |
|
- |
| 11.6(Combined appliances) |
- |
500 |
|
- |
| 11.5(Motor-operated appliances) |
- |
1000 |
|
- |
| 11.4(Heating appliances) |
- |
1000 |
|
- |
| 8.1.5(Live parts of built-in appliances) |
- |
500 |
|
- |
| 18(Endurance) |
- |
0 |
|
- |
| 17(Overload protection of transformers and associated circuits) |
- |
1000 |
|
- |
| 16(Leakage current and electric strength) |
- |
1000 |
|
- |
| 4(General requirement) |
- |
500 |
|
- |
| 31(Resistance to Rusting) |
- |
500 |
|
- |
| 30.2(Needle Flame Test) |
- |
1000 |
|
- |
| 30.2(Glow Wire Test) |
- |
1000 |
|
- |
| 30.1(Ball pressure test) |
- |
500 |
|
- |
| 29(clearance, creepage distances and solid insulation) |
- |
1000 |
|
- |
| 28(Screw test and connections) |
- |
500 |
|
- |
| 27.1(Provision for Earthing, IS 302-1) |
- |
1000 |
|
- |
| 26(Terminals for external conductors) |
- |
500 |
|
- |
| 25.8(Supply Connection and External Flexible Cords, IS 302-1) |
- |
1000 |
|
- |
| 24(Components) |
- |
500 |
|
- |
| 23.1(Internal Wiring, IS 302-1) |
- |
500 |
|
- |
| 22.1(Construction, IS 302-1) |
- |
500 |
|
- |
| 21.1(Mechanical Strength, IS 302-1) |
- |
1000 |
|
- |
| 20.1(Stability & Mechanical Hazards, IS 302-1) |
- |
500 |
|
- |
| 19(Abnormal Operation) |
- |
1000 |
|
- |
| 18(Endurance) |
- |
0 |
|
- |
| 17(Over Load Protection of Transformers and associated circuits) |
- |
1000 |
|
- |
| 16.3(Electric Strength (after clause 15 and 16.2)) |
- |
1000 |
|
- |
| 16.2(Leakage Current (after Clause 15)) |
- |
500 |
|
- |
| 16.1(General) |
- |
500 |
|
- |
| 16.0(General) |
- |
1000 |
|
- |
| 15.3(Humidity Test) |
- |
500 |
|
- |
| 15.2(Spillage Test) |
- |
500 |
|
- |
| 15.1(Ingress Protection test other than IPX0 (IP test)) |
- |
500 |
|
- |
| 15.0(Moisture resistance) |
- |
1000 |
|
- |
| 14(Transient Over Voltages) |
- |
1000 |
|
- |
| 13.3(Electric Strength at operating temperature) |
- |
1000 |
|
- |
| 13.2(Leakage current at operating temperature) |
- |
500 |
|
- |
| 13(Leakage current and electric strength at operating temperature) |
- |
1000 |
|
- |
| 11.3(Heating) |
- |
1000 |
|
- |
| 11.2(General) |
- |
500 |
|
- |
| 11.1(General) |
- |
500 |
|
- |
| 10.2(Current input) |
- |
500 |
|
- |
| 10.1(Power input) |
- |
1000 |
|
- |
| 9(Starting of motor operation test requirements and tests) |
- |
1000 |
|
- |
| 8.1.4(Protection against live parts against protective impedance) |
- |
500 |
|
- |
| 8.1.3(Protection against live parts in visible glowing heating elements) |
- |
500 |
|
- |
| 8.1.2(Protection against live parts in openings) |
- |
500 |
|
- |
| 8.1.1(Protection against live parts in all positions) |
- |
1000 |
|
- |
| 7(Marking and instructions) |
- |
500 |
|
- |
| A.2(Earth continuity test) |
- |
1000 |
|
- |
| Annex C(Ageing test on motors) |
- |
1000 |
|
- |
| Annex D(Thermal motor protectors) |
- |
1000 |
|
- |
| 15.2(Moisture resistance) |
- |
500 |
|
- |
| 19.17(Abnormal Operation, IS 302-1) |
- |
1000 |
|
- |
| 20.2(Stability & Mechanical Hazards, IS 302-1) |
- |
1000 |
|
- |
| 21.2(Mechanical Strength, IS 302-1) |
- |
500 |
|
- |
| 21.3(Mechanical Strength, IS 302-1) |
- |
1000 |
|
- |
| 22.5(Construction) |
- |
500 |
|
- |
| 22.6(Construction, IS 302-1) |
- |
500 |
|
- |
| 22.11(Construction, IS 302-1) |
- |
500 |
|
- |
| 22.16(Construction) |
- |
500 |
|
- |
| 22.32(Construction, IS 302-1) |
- |
500 |
|
- |
| 22.42(Construction) |
- |
500 |
|
- |
| 23.3(Internal Wiring, IS 302-1) |
- |
1000 |
|
- |
| 25.6(Supply connection and external flexible cords, IS 302-1) |
- |
1000 |
|
- |
| 25.7(Supply Connection and External Flexible Cords, IS 302-1) |
- |
500 |
|
- |
| 25.14(Supply Connection and External Flexible Cords, IS 302-1) |
- |
1000 |
|
- |
| 25.15(Supply Connection and External Flexible Cords, IS 302-1) |
- |
500 |
|
- |
| 26.5(Terminals for external conductors) |
- |
500 |
|
- |
| 27.5(Provision for Earthing, IS 302-1) |
- |
1000 |
|
- |
| 28.1(Screws and connections) |
- |
1000 |
|
- |
| 22.2(Construction, IS 302-1) |
- |
1000 |
|
- |
| 22.3(Construction, IS 302-1) |
- |
1000 |
|
- |
| B.22.4(Construction, IS 302-1) |
- |
1000 |
|
- |
| B.22.5(Construction, IS 302-1) |
- |
1000 |
|
- |
| 12(Charging of metal-ion batteries) |
- |
0 |
|
- |
| 6(Classification- IS 302-1) |
- |
0 |
|
- |
| 5(General conditions for the tests) |
- |
0 |
|
- |
| 11.8(Temperature rise) |
- |
0 |
|
- |
| 11.7(Duration corresponding) |
- |
0 |
|
- |
| 11.6(Combined appliances) |
- |
0 |
|
- |
| 11.5(Motor-operated appliances) |
- |
0 |
|
- |
| 11.4(Heating appliances) |
- |
0 |
|
- |
| 8.1.5(Live parts of built-in appliances) |
- |
0 |
|
- |
| 18(Endurance) |
- |
0 |
|
- |
| 17(Overload protection of transformers and associated circuits) |
- |
0 |
|
- |
| 16(Leakage current and electric strength) |
- |
0 |
|
- |
| 4(General requirement) |
- |
0 |
|
- |
| 31(Resistance to Rusting) |
- |
0 |
|
- |
| 30.2(Needle Flame Test) |
- |
0 |
|
- |
| 30.2(Glow Wire Test) |
- |
0 |
|
- |
| 30.1(Ball pressure test) |
- |
0 |
|
- |
| 29(clearance, creepage distances and solid insulation) |
- |
0 |
|
- |
| 28(Screw test and connections) |
- |
0 |
|
- |
| 27.1(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 26(Terminals for external conductors) |
- |
0 |
|
- |
| 25.8(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 24(Components) |
- |
0 |
|
- |
| 23.1(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 22.1(Construction, IS 302-1) |
- |
0 |
|
- |
| 21.1(Mechanical Strength, IS 302-1) |
- |
0 |
|
- |
| 20.1(Stability & Mechanical Hazards, IS 302-1) |
- |
0 |
|
- |
| 19(Abnormal Operation) |
- |
0 |
|
- |
| 18(Endurance) |
- |
0 |
|
- |
| 17(Over Load Protection of Transformers and associated circuits) |
- |
0 |
|
- |
| 16.3(Electric Strength (after clause 15 and 16.2)) |
- |
0 |
|
- |
| 16.2(Leakage Current (after Clause 15)) |
- |
0 |
|
- |
| 16.1(General) |
- |
0 |
|
- |
| 16.0(General) |
- |
0 |
|
- |
| 15.3(Humidity Test) |
- |
0 |
|
- |
| 15.2(Spillage Test) |
- |
0 |
|
- |
| 15.1(Ingress Protection test other than IPX0 (IP test)) |
- |
0 |
|
- |
| 15.0(Moisture resistance) |
- |
0 |
|
- |
| 14(Transient Over Voltages) |
- |
0 |
|
- |
| 13.3(Electric Strength at operating temperature) |
- |
0 |
|
- |
| 13.2(Leakage current at operating temperature) |
- |
0 |
|
- |
| 13(Leakage current and electric strength at operating temperature) |
- |
0 |
|
- |
| 11.3(Heating) |
- |
0 |
|
- |
| 11.2(General) |
- |
0 |
|
- |
| 11.1(General) |
- |
0 |
|
- |
| 10.2(Current input) |
- |
0 |
|
- |
| 10.1(Power input) |
- |
0 |
|
- |
| 9(Starting of motor operation test requirements and tests) |
- |
0 |
|
- |
| 8.1.4(Protection against live parts against protective impedance) |
- |
0 |
|
- |
| 8.1.3(Protection against live parts in visible glowing heating elements) |
- |
0 |
|
- |
| 8.1.2(Protection against live parts in openings) |
- |
0 |
|
- |
| 8.1.1(Protection against live parts in all positions) |
- |
0 |
|
- |
| 7(Marking and instructions) |
- |
0 |
|
- |
| A.2(Earth continuity test) |
- |
0 |
|
- |
| Annex C(Ageing test on motors) |
- |
0 |
|
- |
| Annex D(Thermal motor protectors) |
- |
0 |
|
- |
| 15.2(Moisture resistance) |
- |
0 |
|
- |
| 19.17(Abnormal Operation, IS 302-1) |
- |
0 |
|
- |
| 20.2(Stability & Mechanical Hazards, IS 302-1) |
- |
0 |
|
- |
| 21.2(Mechanical Strength, IS 302-1) |
- |
0 |
|
- |
| 21.3(Mechanical Strength, IS 302-1) |
- |
0 |
|
- |
| 22.5(Construction) |
- |
0 |
|
- |
| 22.6(Construction, IS 302-1) |
- |
0 |
|
- |
| 22.11(Construction, IS 302-1) |
- |
0 |
|
- |
| 22.16(Construction) |
- |
0 |
|
- |
| 22.32(Construction, IS 302-1) |
- |
0 |
|
- |
| 22.42(Construction) |
- |
0 |
|
- |
| 23.3(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 25.6(Supply connection and external flexible cords, IS 302-1) |
- |
0 |
|
- |
| 25.7(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.14(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.15(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 26.5(Terminals for external conductors) |
- |
0 |
|
- |
| 27.5(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 28.1(Screws and connections) |
- |
0 |
|
- |
| 22.2(Construction, IS 302-1) |
- |
0 |
|
- |
| 22.3(Construction, IS 302-1) |
- |
0 |
|
- |
| B.22.4(Construction, IS 302-1) |
- |
0 |
|
- |
| B.22.5(Construction, IS 302-1) |
- |
0 |
|
- |
| 12(Charging of metal-ion batteries) |
- |
0 |
|
- |
| 6(Classification- IS 302-1) |
- |
0 |
|
- |
| 5(General conditions for the tests) |
- |
0 |
|
- |
| 11.8(Temperature rise) |
- |
0 |
|
- |
| 11.7(Duration corresponding) |
- |
0 |
|
- |
| 11.6(Combined appliances) |
- |
0 |
|
- |
| 11.5(Motor-operated appliances) |
- |
0 |
|
- |
| 11.4(Heating appliances) |
- |
0 |
|
- |
| 8.1.5(Live parts of built-in appliances) |
- |
0 |
|
- |
| 18(Endurance) |
- |
0 |
|
- |
| 17(Overload protection of transformers and associated circuits) |
- |
0 |
|
- |
| 16(Leakage current and electric strength) |
- |
0 |
|
- |
| 4(General requirement) |
- |
0 |
|
- |
| 31(Resistance to Rusting) |
- |
0 |
|
- |
| 30.2(Needle Flame Test) |
- |
0 |
|
- |
| 30.2(Glow Wire Test) |
- |
0 |
|
- |
| 30.1(Ball pressure test) |
- |
0 |
|
- |
| 29(clearance, creepage distances and solid insulation) |
- |
0 |
|
- |
| 28(Screw test and connections) |
- |
0 |
|
- |
| 27.1(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 26(Terminals for external conductors) |
- |
0 |
|
- |
| 25.8(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 23.1(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 22.1(Construction, IS 302-1) |
- |
0 |
|
- |
| 21.1(Mechanical Strength, IS 302-1) |
- |
0 |
|
- |
| 20.1(Stability & Mechanical Hazards, IS 302-1) |
- |
0 |
|
- |
| 19(Abnormal Operation) |
- |
0 |
|
- |
| 18(Endurance) |
- |
0 |
|
- |
| 17(Over Load Protection of Transformers and associated circuits) |
- |
0 |
|
- |
| 16.3(Electric Strength (after clause 15 and 16.2)) |
- |
0 |
|
- |
| 16.2(Leakage Current (after Clause 15)) |
- |
0 |
|
- |
| 16.1(General) |
- |
0 |
|
- |
| 16.0(General) |
- |
0 |
|
- |
| 15.3(Humidity Test) |
- |
0 |
|
- |
| 15.1(Ingress Protection test other than IPX0 (IP test)) |
- |
0 |
|
- |
| 15.0(Moisture resistance) |
- |
0 |
|
- |
| 14(Transient Over Voltages) |
- |
0 |
|
- |
| 13.3(Electric Strength at operating temperature) |
- |
0 |
|
- |
| 13.2(Leakage current at operating temperature) |
- |
0 |
|
- |
| 13(Leakage current and electric strength at operating temperature) |
- |
0 |
|
- |
| 11.3(Heating) |
- |
0 |
|
- |
| 11.2(General) |
- |
0 |
|
- |
| 11.1(General) |
- |
0 |
|
- |
| 10.2(Current input) |
- |
0 |
|
- |
| 10.1(Power input) |
- |
0 |
|
- |
| 9(Starting of motor operation test requirements and tests) |
- |
0 |
|
- |
| 8.1.4(Protection against live parts against protective impedance) |
- |
0 |
|
- |
| 8.1.3(Protection against live parts in visible glowing heating elements) |
- |
0 |
|
- |
| 8.1.2(Protection against live parts in openings) |
- |
0 |
|
- |
| 8.1.1(Protection against live parts in all positions) |
- |
0 |
|
- |
| 7(Marking and instructions) |
- |
0 |
|
- |
| A.2(Earth continuity test) |
- |
0 |
|
- |
| Annex C(Ageing test on motors) |
- |
0 |
|
- |
| Annex D(Thermal motor protectors) |
- |
0 |
|
- |
| 19.17(Abnormal Operation, IS 302-1) |
- |
0 |
|
- |
| 20.2(Stability & Mechanical Hazards, IS 302-1) |
- |
0 |
|
- |
| 21.2(Mechanical Strength, IS 302-1) |
- |
0 |
|
- |
| 21.3(Mechanical Strength, IS 302-1) |
- |
0 |
|
- |
| 22.5(Construction) |
- |
0 |
|
- |
| 22.6(Construction, IS 302-1) |
- |
0 |
|
- |
| 22.11(Construction, IS 302-1) |
- |
0 |
|
- |
| 22.16(Construction) |
- |
0 |
|
- |
| 22.32(Construction, IS 302-1) |
- |
0 |
|
- |
| 22.42(Construction) |
- |
0 |
|
- |
| 23.3(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 25.6(Supply connection and external flexible cords, IS 302-1) |
- |
0 |
|
- |
| 25.7(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.14(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.15(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 26.5(Terminals for external conductors) |
- |
0 |
|
- |
| 27.5(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 28.1(Screws and connections) |
- |
0 |
|
- |
| 22.2(Construction, IS 302-1) |
- |
0 |
|
- |
| 22.3(Construction, IS 302-1) |
- |
0 |
|
- |
| B.22.4(Construction, IS 302-1) |
- |
0 |
|
- |
| B.22.5(Construction, IS 302-1) |
- |
0 |
|
- |
| 15.2(Spillage Test) |
- |
0 |
|
- |
| 15.2(Moisture resistance) |
- |
0 |
|
- |
| 12(Charging of metal-ion batteries) |
- |
0 |
|
- |
| 6(Classification- IS 302-1) |
- |
0 |
|
- |
| 5(General conditions for the tests) |
- |
0 |
|
- |
| 11.8(Temperature rise) |
- |
0 |
|
- |
| 11.7(Duration corresponding) |
- |
0 |
|
- |
| 11.6(Combined appliances) |
- |
0 |
|
- |
| 11.5(Motor-operated appliances) |
- |
0 |
|
- |
| 11.4(Heating appliances) |
- |
0 |
|
- |
| 8.1.5(Live parts of built-in appliances) |
- |
0 |
|
- |
| 18(Endurance) |
- |
0 |
|
- |
| 17(Overload protection of transformers and associated circuits) |
- |
0 |
|
- |
| 16(Leakage current and electric strength) |
- |
0 |
|
- |
| 4(General requirement) |
- |
0 |
|
- |
| 31(Resistance to Rusting) |
- |
0 |
|
- |
| 30.2(Needle Flame Test) |
- |
0 |
|
- |
| 30.2(Glow Wire Test) |
- |
0 |
|
- |
| 30.1(Ball pressure test) |
- |
0 |
|
- |
| 29(clearance, creepage distances and solid insulation) |
- |
0 |
|
- |
| 28(Screw test and connections) |
- |
0 |
|
- |
| 27.1(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 26(Terminals for external conductors) |
- |
0 |
|
- |
| 25.8(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 23.1(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 22.1(Construction, IS 302-1) |
- |
0 |
|
- |
| 21.1(Mechanical Strength, IS 302-1) |
- |
0 |
|
- |
| 20.1(Stability & Mechanical Hazards, IS 302-1) |
- |
0 |
|
- |
| 19(Abnormal Operation) |
- |
0 |
|
- |
| 18(Endurance) |
- |
0 |
|
- |
| 17(Over Load Protection of Transformers and associated circuits) |
- |
0 |
|
- |
| 16.3(Electric Strength (after clause 15 and 16.2)) |
- |
0 |
|
- |
| 16.2(Leakage Current (after Clause 15)) |
- |
0 |
|
- |
| 16.1(General) |
- |
0 |
|
- |
| 16.0(General) |
- |
0 |
|
- |
| 15.3(Humidity Test) |
- |
0 |
|
- |
| 15.1(Ingress Protection test other than IPX0 (IP test)) |
- |
0 |
|
- |
| 15.0(Moisture resistance) |
- |
0 |
|
- |
| 14(Transient Over Voltages) |
- |
0 |
|
- |
| 13.3(Electric Strength at operating temperature) |
- |
0 |
|
- |
| 13.2(Leakage current at operating temperature) |
- |
0 |
|
- |
| 13(Leakage current and electric strength at operating temperature) |
- |
0 |
|
- |
| 11.3(Heating) |
- |
0 |
|
- |
| 11.2(General) |
- |
0 |
|
- |
| 11.1(General) |
- |
0 |
|
- |
| 10.2(Current input) |
- |
0 |
|
- |
| 10.1(Power input) |
- |
0 |
|
- |
| 9(Starting of motor operation test requirements and tests) |
- |
0 |
|
- |
| 8.1.4(Protection against live parts against protective impedance) |
- |
0 |
|
- |
| 8.1.3(Protection against live parts in visible glowing heating elements) |
- |
0 |
|
- |
| 8.1.2(Protection against live parts in openings) |
- |
0 |
|
- |
| 8.1.1(Protection against live parts in all positions) |
- |
0 |
|
- |
| 7(Marking and instructions) |
- |
0 |
|
- |
| A.2(Earth continuity test) |
- |
0 |
|
- |
| Annex C(Ageing test on motors) |
- |
0 |
|
- |
| Annex D(Thermal motor protectors) |
- |
0 |
|
- |
| 19.17(Abnormal Operation, IS 302-1) |
- |
0 |
|
- |
| 20.2(Stability & Mechanical Hazards, IS 302-1) |
- |
0 |
|
- |
| 21.2(Mechanical Strength, IS 302-1) |
- |
0 |
|
- |
| 21.3(Mechanical Strength, IS 302-1) |
- |
0 |
|
- |
| 22.5(Construction) |
- |
0 |
|
- |
| 22.6(Construction, IS 302-1) |
- |
0 |
|
- |
| 22.11(Construction, IS 302-1) |
- |
0 |
|
- |
| 22.16(Construction) |
- |
0 |
|
- |
| 22.32(Construction, IS 302-1) |
- |
0 |
|
- |
| 22.42(Construction) |
- |
0 |
|
- |
| 23.3(Internal Wiring, IS 302-1) |
- |
0 |
|
- |
| 25.6(Supply connection and external flexible cords, IS 302-1) |
- |
0 |
|
- |
| 25.7(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.14(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 25.15(Supply Connection and External Flexible Cords, IS 302-1) |
- |
0 |
|
- |
| 26.5(Terminals for external conductors) |
- |
0 |
|
- |
| 27.5(Provision for Earthing, IS 302-1) |
- |
0 |
|
- |
| 28.1(Screws and connections) |
- |
0 |
|
- |
| 22.2(Construction, IS 302-1) |
- |
0 |
|
- |
| 22.3(Construction, IS 302-1) |
- |
0 |
|
- |
| B.22.4(Construction, IS 302-1) |
- |
0 |
|
- |
| B.22.5(Construction, IS 302-1) |
- |
0 |
|
- |
| 15.2(Spillage Test) |
- |
0 |
|
- |
| 15.2(Moisture resistance) |
- |
0 |
|
- |
| 12(Charging of metal-ion batteries) |
- |
- |
|
- |
| 6(Classification- IS 302-1) |
- |
- |
|
- |
| 5(General conditions for the tests) |
- |
- |
|
- |
| 11.8(Temperature rise) |
- |
- |
|
- |
| 11.7(Duration corresponding) |
- |
- |
|
- |
| 11.6(Combined appliances) |
- |
- |
|
- |
| 11.5(Motor-operated appliances) |
- |
- |
|
- |
| 11.4(Heating appliances) |
- |
- |
|
- |
| 8.1.5(Live parts of built-in appliances) |
- |
- |
|
- |
| 18(Endurance) |
- |
- |
|
- |
| 17(Overload protection of transformers and associated circuits) |
- |
- |
|
- |
| 16(Leakage current and electric strength) |
- |
- |
|
- |
| 4(General requirement) |
- |
- |
|
- |
| 31(Resistance to Rusting) |
- |
- |
|
- |
| 30.2(Needle Flame Test) |
- |
- |
|
- |
| 30.2(Glow Wire Test) |
- |
- |
|
- |
| 30.1(Ball pressure test) |
- |
- |
|
- |
| 29(clearance, creepage distances and solid insulation) |
- |
- |
|
- |
| 28(Screw test and connections) |
- |
- |
|
- |
| 27.1(Provision for Earthing, IS 302-1) |
- |
- |
|
- |
| 26(Terminals for external conductors) |
- |
- |
|
- |
| 25.8(Supply Connection and External Flexible Cords, IS 302-1) |
- |
- |
|
- |
| 23.1(Internal Wiring, IS 302-1) |
- |
- |
|
- |
| 22.1(Construction, IS 302-1) |
- |
- |
|
- |
| 21.1(Mechanical Strength, IS 302-1) |
- |
- |
|
- |
| 20.1(Stability & Mechanical Hazards, IS 302-1) |
- |
- |
|
- |
| 19(Abnormal Operation) |
- |
- |
|
- |
| 18(Endurance) |
- |
- |
|
- |
| 17(Over Load Protection of Transformers and associated circuits) |
- |
- |
|
- |
| 16.3(Electric Strength (after clause 15 and 16.2)) |
- |
- |
|
- |
| 16.2(Leakage Current (after Clause 15)) |
- |
- |
|
- |
| 16.1(General) |
- |
- |
|
- |
| 16.0(General) |
- |
- |
|
- |
| 15.3(Humidity Test) |
- |
- |
|
- |
| 15.1(Ingress Protection test other than IPX0 (IP test)) |
- |
- |
|
- |
| 15.0(Moisture resistance) |
- |
- |
|
- |
| 14(Transient Over Voltages) |
- |
- |
|
- |
| 13.3(Electric Strength at operating temperature) |
- |
- |
|
- |
| 13.2(Leakage current at operating temperature) |
- |
- |
|
- |
| 13(Leakage current and electric strength at operating temperature) |
- |
- |
|
- |
| 11.3(Heating) |
- |
- |
|
- |
| 11.2(General) |
- |
- |
|
- |
| 11.1(General) |
- |
- |
|
- |
| 10.2(Current input) |
- |
- |
|
- |
| 10.1(Power input) |
- |
- |
|
- |
| 9(Starting of motor operation test requirements and tests) |
- |
- |
|
- |
| 8.1.4(Protection against live parts against protective impedance) |
- |
- |
|
- |
| 8.1.3(Protection against live parts in visible glowing heating elements) |
- |
- |
|
- |
| 8.1.2(Protection against live parts in openings) |
- |
- |
|
- |
| 8.1.1(Protection against live parts in all positions) |
- |
- |
|
- |
| 7(Marking and instructions) |
- |
- |
|
- |
| A.2(Earth continuity test) |
- |
- |
|
- |
| Annex C(Ageing test on motors) |
- |
- |
|
- |
| Annex D(Thermal motor protectors) |
- |
- |
|
- |
| 19.17(Abnormal Operation, IS 302-1) |
- |
- |
|
- |
| 20.2(Stability & Mechanical Hazards, IS 302-1) |
- |
- |
|
- |
| 21.2(Mechanical Strength, IS 302-1) |
- |
- |
|
- |
| 21.3(Mechanical Strength, IS 302-1) |
- |
- |
|
- |
| 22.5(Construction) |
- |
- |
|
- |
| 22.6(Construction, IS 302-1) |
- |
- |
|
- |
| 22.11(Construction, IS 302-1) |
- |
- |
|
- |
| 22.16(Construction) |
- |
- |
|
- |
| 22.32(Construction, IS 302-1) |
- |
- |
|
- |
| 22.42(Construction) |
- |
- |
|
- |
| 23.3(Internal Wiring, IS 302-1) |
- |
- |
|
- |
| 25.6(Supply connection and external flexible cords, IS 302-1) |
- |
- |
|
- |
| 25.7(Supply Connection and External Flexible Cords, IS 302-1) |
- |
- |
|
- |
| 25.14(Supply Connection and External Flexible Cords, IS 302-1) |
- |
- |
|
- |
| 25.15(Supply Connection and External Flexible Cords, IS 302-1) |
- |
- |
|
- |
| 26.5(Terminals for external conductors) |
- |
- |
|
- |
| 27.5(Provision for Earthing, IS 302-1) |
- |
- |
|
- |
| 28.1(Screws and connections) |
- |
- |
|
- |
| 22.2(Construction, IS 302-1) |
- |
- |
|
- |
| 22.3(Construction, IS 302-1) |
- |
- |
|
- |
| B.22.4(Construction, IS 302-1) |
- |
- |
|
- |
| B.22.5(Construction, IS 302-1) |
- |
- |
|
- |
| 15.2(Spillage Test) |
- |
- |
|
- |
| 15.2(Moisture resistance) |
- |
- |
|
- |
|
03 Oct, 2027 |
- Included w.e.f 02.09.2025
Cl 19.11.4.1-19.11.4.7(EMI/EMC), Cl 24 (Components), Cl 32 (Radiation Toxicity and Similar Hazards)
"Domestic Electric Clothes Washing Machines
(For testing charges please refer part 2 standard in LIMS)" |
| 21 |
IS 302 : Part 2 : Sec 32 (1994) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 32 massage appliances |
----- |
38500 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl. 31 302-2-32 : 1994(Resistance to Rusting) |
- |
2000 |
|
- |
| Cl. 30 302-2-32 : 1994(Resistance to Heat Fire & Tracking ) |
- |
2500 |
|
- |
| Cl. 29 302-2-32 : 1994(Clearances, Creepage Distances & Solid insulation ) |
- |
1500 |
|
- |
| Cl. 28 302-2-32 : 1994(Screws & Connections) |
- |
1000 |
|
- |
| Cl. 27 302-2-32 : 1994(Provision for Earthing ) |
- |
2000 |
|
- |
| Cl. 26 302-2-32 : 1994(Terminals for External conductors ) |
- |
1000 |
|
- |
| Cl. 25 302-2-32 : 1994(Supply Connection & External Flexible Cords) |
- |
2000 |
|
- |
| Cl. 24 302-2-32 : 1994(Components) |
- |
1000 |
|
- |
| Cl. 23 302-2-32 : 1994(Internal Wiring) |
- |
3000 |
|
- |
| Cl. 22 302-2-32 : 1994(Construction ) |
- |
1000 |
|
- |
| Cl. 21 302-2-32 : 1994(Mechanical strength) |
- |
1500 |
|
- |
| Cl. 20 302-2-32 : 1994(Stability & Mechanical Hazards) |
- |
1500 |
|
- |
| Cl. 19 302-2-32 : 1994(Abnormal Operation ) |
- |
3000 |
|
- |
| Cl. 18 302-2-32 : 1994(Endurance) |
- |
1000 |
|
- |
| Cl. 17 302-2-32 : 1994(Overload Protection of Transformers and Associated Circuit) |
- |
1500 |
|
- |
| Cl. 16 302-2-32 : 1994(Leakage Current & Electric Strength at Operating Temperature (After Humidity Treatment)) |
- |
1500 |
|
- |
| Cl. 15 302-2-32: 1994(Moisture Resistance Test ) |
- |
2000 |
|
- |
| Cl. 14 302-2-32 : 1994(Radio and television interference suppression / Transient over voltages) |
- |
1000 |
|
- |
| Cl. 13 302-2-32 : 1994(Leakage Current & Electric Strength at Operating Temperature) |
- |
1500 |
|
- |
| Cl. 11 302-2-32 : 1994(Temperature Rise) |
- |
3000 |
|
- |
| Cl. 10 302-2-32 : 1994(Power Input and Current ) |
- |
3000 |
|
- |
| Cl. 9 302-2-32 : 1994(Protection Against Electric Shock) |
- |
1000 |
|
- |
| Cl. 8 302-2-32 : 1994(Starting of motor operated appliances) |
- |
1500 |
|
- |
| Cl. 7 302-2-32 : 1994(Marking) |
- |
1000 |
|
- |
| (CI. 6 IS 302-2-32 : 1994(Classification ) |
- |
500 |
|
- |
|
03 Oct, 2027 |
- Included w.e.f 14.08.2025
Exclusion: Cl 19.11.4.1-19.11.4.7(EMI/EMC),Cl. 32 302-2-32 : 1994 (Radiation Hazards) |
| 22 |
IS 302 : Part 2 : Sec 8 (2024) |
Household and Similar Electrical Appliances âSafety Part 2 Particular Requirements Section 8 Shavers, Hair Clippers and Similar Appliances (First Revision) |
- |
28000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 7(Marking and instructions) |
- |
1000 |
|
- |
| 8(Protection against access to live parts) |
- |
1500 |
|
- |
| 10(Power input and current) |
- |
1500 |
|
- |
| 11(Heating) |
- |
1500 |
|
- |
| 12(Charging of metal-ion batteries) |
- |
1500 |
|
- |
| 13.1 &13.2(Leakage current test) |
- |
500 |
|
- |
| 13.1 &13.3(Electric strength test) |
- |
500 |
|
- |
| 14(Transient overvoltages) |
- |
500 |
|
- |
| 15(Moisture resistance) |
- |
1000 |
|
- |
| 15.3(Moisture resistance) |
- |
1000 |
|
- |
| 16.1 &16.2(Leakage current test) |
- |
1000 |
|
- |
| 16.1 & 16.3(Electric strength test) |
- |
1000 |
|
- |
| 17(Overload protection of transformers and associated circuits) |
- |
1500 |
|
- |
| 19.1 to 19.13, Table No. - 9(Abnormal operation) |
- |
1500 |
|
- |
| 19.101(Abnormal operation) |
- |
1500 |
|
- |
| 20.1(Stability and mechanical hazards) |
- |
1000 |
|
- |
| 20.2(Stability and mechanical hazards) |
- |
1000 |
|
- |
| 21(Mechanical strength) |
- |
1000 |
|
- |
| 21.101(Mechanical strength) |
- |
1000 |
|
- |
| 21.102(Mechanical strength) |
- |
1000 |
|
- |
| 21.103(Mechanical strength) |
- |
1000 |
|
- |
| 22(Construction) |
- |
1000 |
|
- |
| 22.101(Construction) |
- |
1000 |
|
- |
| 22.102(Construction) |
- |
1000 |
|
- |
| 22.103(Construction) |
- |
1000 |
|
- |
| 23(Internal wiring) |
- |
1000 |
|
- |
| 24(Components) |
- |
1000 |
|
- |
| 25("Supply connection and
external flexible cords") |
- |
1500 |
|
- |
| 26("Terminals for external
conductors") |
- |
500 |
|
- |
| 27(Provision for earthing) |
- |
1000 |
|
- |
| 28(Screws and connections) |
- |
500 |
|
- |
| 29("Clearances, creepage
distances and solid insulation") |
- |
500 |
|
- |
| 30(Resistance to heat and fire) |
- |
500 |
|
- |
| 31(Resistance to rusting) |
- |
500 |
|
- |
| 7(Marking and instructions) |
- |
1000 |
|
- |
| 8(Protection against access to live parts) |
- |
1500 |
|
- |
| 10(Power input and current) |
- |
1500 |
|
- |
| 11(Heating) |
- |
1500 |
|
- |
| 12(Charging of metal-ion batteries) |
- |
1500 |
|
- |
| 13.1 &13.2(Leakage current test) |
- |
500 |
|
- |
| 13.1 &13.3(Electric strength test) |
- |
500 |
|
- |
| 14(Transient overvoltages) |
- |
500 |
|
- |
| 15(Moisture resistance) |
- |
1000 |
|
- |
| 15.3(Moisture resistance) |
- |
1000 |
|
- |
| 16.1 &16.2(Leakage current test) |
- |
1000 |
|
- |
| 16.1 & 16.3(Electric strength test) |
- |
1000 |
|
- |
| 17(Overload protection of transformers and associated circuits) |
- |
1500 |
|
- |
| 19.1 to 19.13, Table No. - 9(Abnormal operation) |
- |
1500 |
|
- |
| 19.101(Abnormal operation) |
- |
1500 |
|
- |
| 20.1(Stability and mechanical hazards) |
- |
1000 |
|
- |
| 20.2(Stability and mechanical hazards) |
- |
1000 |
|
- |
| 21(Mechanical strength) |
- |
1000 |
|
- |
| 21.101(Mechanical strength) |
- |
1000 |
|
- |
| 21.102(Mechanical strength) |
- |
1000 |
|
- |
| 21.103(Mechanical strength) |
- |
1000 |
|
- |
| 22(Construction) |
- |
1000 |
|
- |
| 22.101(Construction) |
- |
1000 |
|
- |
| 22.102(Construction) |
- |
1000 |
|
- |
| 22.103(Construction) |
- |
1000 |
|
- |
| 23(Internal wiring) |
- |
1000 |
|
- |
| 24(Components) |
- |
1000 |
|
- |
| 25("Supply connection and
external flexible cords") |
- |
1500 |
|
- |
| 26("Terminals for external
conductors") |
- |
500 |
|
- |
| 27(Provision for earthing) |
- |
1000 |
|
- |
| 28(Screws and connections) |
- |
500 |
|
- |
| 29("Clearances, creepage
distances and solid insulation") |
- |
500 |
|
- |
| 30(Resistance to heat and fire) |
- |
500 |
|
- |
| 31(Resistance to rusting) |
- |
500 |
|
- |
|
03 Oct, 2027 |
- Included w.e.f 14.08.2025
Exclusion: Cl 19.11.4.1-19.11.4.7(EMI/EMC), 32 ("Radiation, toxicity and similar hazards") |
| 23 |
IS 1293 (2019) |
Plugs and socket - Outlets of rated Voltage up to and including 250 Volts and rated current up to and including 16 amperes - Specification (Third Revision) |
---- |
14800 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 6(RATINGS) |
- |
100 |
|
- |
| 7.1.1(Accessories Classification) |
- |
50 |
|
- |
| 7.1.2(Accessories Classification) |
- |
50 |
|
- |
| 7.1.3(Accessories Classification) |
- |
50 |
|
- |
| 7.1.4(Accessories Classification) |
- |
50 |
|
- |
| 7.1.5(Accessories Classification) |
- |
50 |
|
- |
| 7.2.1(Socket-Outlets Classification) |
- |
50 |
|
- |
| 7.2.2(Socket-Outlets Classification) |
- |
50 |
|
- |
| 7.2.3(Socket-Outlets Classification) |
- |
50 |
|
- |
| 7.2.4(Socket-Outlets Classification) |
- |
50 |
|
- |
| 7.3(Plug Classification) |
- |
50 |
|
- |
| 8(Marking) |
- |
100 |
|
- |
| 9(CHECKING OF DIMENSIONS) |
- |
100 |
|
- |
| 10(PROTECTION AGAINST ELECTRIC SHOCK) |
- |
2000 |
|
- |
| 11(Provision for earthing) |
- |
1500 |
|
- |
| 12(terminals) |
- |
50 |
|
- |
| 13.1(Construction of fixed Socket Outlets) |
- |
500 |
|
- |
| 13.2(Construction of fixed Socket Outlets) |
- |
50 |
|
- |
| 13.3(Construction of fixed Socket Outlets) |
- |
50 |
|
- |
| 13.4(Construction of fixed Socket Outlets) |
- |
50 |
|
- |
| 13.5(Construction of fixed Socket Outlets) |
- |
50 |
|
- |
| 13.6(Construction of fixed Socket Outlets) |
- |
50 |
|
- |
| 13.7(Construction of fixed Socket Outlets) |
- |
50 |
|
- |
| 13.8(Construction of fixed Socket Outlets) |
- |
50 |
|
- |
| 13.9(Construction of fixed Socket Outlets) |
- |
50 |
|
- |
| 13.10(Construction of fixed Socket Outlets) |
- |
50 |
|
- |
| 13.11(Construction of fixed Socket Outlets) |
- |
50 |
|
- |
| 13.12(Construction of fixed Socket Outlets) |
- |
50 |
|
- |
| 13.14(Construction of fixed Socket Outlets) |
- |
50 |
|
- |
| 13.17(Construction of fixed Socket Outlets) |
- |
50 |
|
- |
| 13.18(Construction of fixed Socket Outlets) |
- |
50 |
|
- |
| 13.19(Construction of fixed Socket Outlets) |
- |
50 |
|
- |
| 13.2(Construction of fixed Socket Outlets) |
- |
50 |
|
- |
| 13.21(Construction of fixed Socket Outlets) |
- |
50 |
|
- |
| 13.22(Construction of fixed Socket Outlets) |
- |
50 |
|
- |
| 13.23(Construction of fixed Socket Outlets) |
- |
50 |
|
- |
| 14.1(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
500 |
|
- |
| 14.2(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.3(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.4(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.5(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.6(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.7(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.8(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.9(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.10(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.11(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.12(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.14(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.15(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.16(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.17(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.18(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.21(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.22(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.23(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.24(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.25(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.26(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 16.1(Resistance to Ageing) |
- |
500 |
|
- |
| 16.3(Resistance to Humidity) |
- |
500 |
|
- |
| 17.1(RESISTANCE AND ELECTRIC STRENGTH) |
- |
100 |
|
- |
| 17.2(INSULATION RESISTANCE AND ELECTRIC STRENGTH) |
- |
50 |
|
- |
| 18(OPERATION OF EARTHING CONTACTS) |
- |
50 |
|
- |
| 19(TEMPERATURE RISE) |
- |
1000 |
|
- |
| 20(Making & Breaking Capacity) |
- |
50 |
|
- |
| 21(Normal Operation) |
- |
100 |
|
- |
| 22.1(Verification of the Maximum Withdrawal Force) |
- |
100 |
|
- |
| 22.2(Verification of Minimum Withdrawal Force) |
- |
100 |
|
- |
| 23.1(FLEXIBLE CABLES AND THEIR CONNECTION) |
- |
100 |
|
- |
| 23.2(FLEXIBLE CABLES AND THEIR CONNECTION) |
- |
50 |
|
- |
| 23.3(FLEXIBLE CABLES AND THEIR CONNECTION) |
- |
50 |
|
- |
| 23.4(FLEXIBLE CABLES AND THEIR CONNECTION) |
- |
50 |
|
- |
| 24.1(MECHANICAL STRENGTH For all kinds of fixed socketoutlets) |
- |
100 |
|
- |
| 24.1(MECHANICAL STRENGTH For portable multiple and combined socket outlets with enclosures, covers or bodies other than thermoplastic or elastomeric material) |
- |
50 |
|
- |
| 24.1(MECHANICAL STRENGTH For surface mounting boxes) |
- |
50 |
|
- |
| 24.2(MECHANICAL STRENGTH For portable single socket-outlets: 1) with enclosures, covers or bodies other than thermoplastic or elastomeric material) |
- |
50 |
|
- |
| 24.2(MECHANICAL STRENGTH For portable multiple and combined socket outlets: 1) with enclosures, covers and bodies of elastomeric or thermoplastic material) |
- |
50 |
|
- |
| 24.2(MECHANICAL STRENGTH For plug 1) with enclosures, covers and bodies of elastomeric or thermoplastic material) |
- |
50 |
|
- |
| 24.2(MECHANICAL STRENGTH For plug 1) with enclosures, covers and bodies of elastomeric or thermoplastic material) |
- |
50 |
|
- |
| 24.4(MECHANICAL STRENGTH For portable single socket-outlets: 1) with enclosures, covers or bodies of thermoplastic or elastomeric material) |
- |
50 |
|
- |
| 24.4(MECHANICAL STRENGTH For portable multiple and combined socket outlets: 1) with enclosures, covers and bodies of elastomeric or thermoplastic material) |
- |
50 |
|
- |
| 24.5(MECHANICAL STRENGTH For Plug 1) with enclosures, covers and bodies of elastomeric or thermoplastic material) |
- |
50 |
|
- |
| 24.6(MECHANICAL STRENGTH For screwed glands of accessories having an IP code higher than IP20) |
- |
50 |
|
- |
| 24.7(MECHANICAL STRENGTH For plug pins provided with insulating sleeves) |
- |
50 |
|
- |
| 24.8(MECHANICAL STRENGTH For shuttered socketoutlets) |
- |
50 |
|
- |
| 24.10(MECHANICAL STRENGTH For Plug (1) with enclosures, covers or bodies other than thermoplastic or elastomeric material) |
- |
50 |
|
- |
| 24.14.1(MECHANICAL STRENGTH For fixed socket-outlets) |
- |
50 |
|
- |
| 24.14.2(MECHANICAL STRENGTH For fixed socket-outlets) |
- |
50 |
|
- |
| 24.14.3(MECHANICAL STRENGTH For plugs and portable socketoutlets) |
- |
50 |
|
- |
| 24.15(MECHANICAL STRENGTH) |
- |
50 |
|
- |
| 24.16(MECHANICAL STRENGTH) |
- |
50 |
|
- |
| 25.1(Resistance to heat) |
- |
100 |
|
- |
| 25.2(Resistance to heat) |
- |
50 |
|
- |
| 25.3(Resistance to heat) |
- |
50 |
|
- |
| 25.4(Resistance to heat) |
- |
50 |
|
- |
| 26.1(SCREWS, CURRENTCARRYING PARTS AND CONNECTIONS) |
- |
100 |
|
- |
| 26.2(SCREWS, CURRENTCARRYING PARTS AND CONNECTIONS) |
- |
50 |
|
- |
| 26.3(SCREWS, CURRENTCARRYING PARTS AND CONNECTIONS) |
- |
50 |
|
- |
| 26.4(SCREWS, CURRENTCARRYING PARTS AND CONNECTIONS) |
- |
50 |
|
- |
| 26.5(SCREWS, CURRENTCARRYING PARTS AND CONNECTIONS) |
- |
50 |
|
- |
| 26.6(SCREWS, CURRENTCARRYING PARTS AND CONNECTIONS) |
- |
50 |
|
- |
| 26.7(SCREWS, CURRENTCARRYING PARTS AND CONNECTIONS) |
- |
50 |
|
- |
| 27.1(CREEPAGE DISTANCES, CLEARANCES AND DISTANCES THROUGH SEALING COMPOUND) |
- |
200 |
|
- |
| 27.2(CREEPAGE DISTANCES, CLEARANCES AND DISTANCES THROUGH SEALING COMPOUND) |
- |
50 |
|
- |
| 28.1.1(Glow-Wire Test) |
- |
500 |
|
- |
| 28.2(Resistance to Tracking) |
- |
500 |
|
- |
| 29(Resistance to Rusting) |
- |
500 |
|
- |
| 30.1(ADDITIONAL TESTS ON PINS PROVIDED WITH INSULATING SLEEVES Pressure Test at High Temperature) |
- |
150 |
|
- |
| 30.2(ADDITIONAL TESTS ON PINS PROVIDED WITH INSULATING SLEEVES Static Damp Heat Test) |
- |
50 |
|
- |
| 30.3(ADDITIONAL TESTS ON PINS PROVIDED WITH INSULATING SLEEVES Tests at Low Temperature) |
- |
50 |
|
- |
| 30.4(ADDITIONAL TESTS ON PINS PROVIDED WITH INSULATING SLEEVES Impact Test at Low Temperature) |
- |
50 |
|
- |
| 13.13(Construction of fixed Socket Outlets) |
- |
50 |
|
- |
| 13.15(Construction of fixed Socket Outlets) |
- |
50 |
|
- |
| 13.16(Construction of fixed Socket Outlets) |
- |
50 |
|
- |
| 14.13(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.19(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 14.20(CONSTRUCTION OF PLUGS AND PORTABLE SOCKETOUTLET) |
- |
50 |
|
- |
| 15(INTERLOCKED SOCKET-OUTLETS) |
- |
50 |
|
- |
| 16.2(RESISTANCE TO HARMFUL INGRESS OF WATER AND TO HUMIDITY) |
- |
50 |
|
- |
| 17.3(INSULATION RESISTANCE AND ELECTRIC STRENGTH) |
- |
50 |
|
- |
| 24.3(MECHANICAL STRENGTH for fixed socket-outlets with a main part intended to be mounted directly on a surface) |
- |
50 |
|
- |
| 24.5(MECHANICAL STRENGTH For portable single socket-outlets: 1) with enclosures, covers or bodies of thermoplastic or elastomeric material) |
- |
50 |
|
- |
| 24.5(MECHANICAL STRENGTH For portable multiple and combined socket outlets: 1) with enclosures, covers and bodies of elastomeric or thermoplastic material) |
- |
50 |
|
- |
| 24.9(MECHANICAL STRENGTH For portable multiple and combined socket outlets (1) with enclosures, covers or bodies other than thermoplastic or elastomeric material) |
- |
50 |
|
- |
| 24.11(MECHANICAL STRENGTH For portable socketoutlets having means for suspension on a wall) |
- |
50 |
|
- |
| 24.12(MECHANICAL STRENGTH For portable socketoutlets having means for suspension on a wall) |
- |
50 |
|
- |
| 24.13(MECHANICAL STRENGTH For portable socketoutlets having means for suspension on a wall) |
- |
50 |
|
- |
| 27.3(CREEPAGE DISTANCES, CLEARANCES AND DISTANCES THROUGH SEALING COMPOUND) |
- |
50 |
|
- |
| 24.9(MECHANICAL STRENGTH For portable multiple and combined socket outlets (1) with enclosures, covers or bodies other than thermoplastic or elastomeric material) |
- |
50 |
|
- |
| 24.10(MECHANICAL STRENGTH For Plug (1) with enclosures, covers or bodies of thermoplastic or elastomeric material) |
- |
50 |
|
- |
| 24.16(MECHANICAL STRENGTH For shroud of portable socket-outlets) |
- |
50 |
|
- |
|
03 Oct, 2027 |
- Included w.e.f. 11-02-2025 |
| 24 |
IS 302 : Part 2 : Sec 8 (1994) |
Safety of household and similar electrical appliances : part 2 particular requirements, section 8 electrical shavers hair, clippers and similar appliances |
---- |
22000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 31(Resistance to Rusting) |
- |
500 |
|
- |
| 30(Resistance to Heat & Fire) |
- |
1000 |
|
- |
| 29(Clearances, Creepage Distances & Solid Insulation) |
- |
1000 |
|
- |
| 28(Screws & Connection) |
- |
500 |
|
- |
| 27(Provision For Earthing) |
- |
1500 |
|
- |
| 26(Terminals For External Conductors) |
- |
500 |
|
- |
| 25(Supply Connection & External Flexible Cables and Cords) |
- |
1000 |
|
- |
| 24(Component) |
- |
500 |
|
- |
| 23(Internal wiring) |
- |
500 |
|
- |
| 22(Construction) |
- |
500 |
|
- |
| 21(Mechanical strength) |
- |
500 |
|
- |
| 20(Stability & Mechanical Hazards) |
- |
500 |
|
- |
| 19(Abnormal Operation) |
- |
1500 |
|
- |
| 18(Endurance) |
- |
200 |
|
- |
| 17(Overload Protection/ Overload Protection of Transformers & Associated Circuits) |
- |
500 |
|
- |
| 16(Leakage Current and Electric Strength) |
- |
1500 |
|
- |
| 15(Moisture Resistance) |
- |
1000 |
|
- |
| 14(Radio and Television Interference Suppression/ Transient Over Voltage) |
- |
1500 |
|
- |
| 13(Leakage Current and Electric Strength at Operating Temperature) |
- |
1500 |
|
- |
| 11(Temperature Rise/Heating) |
- |
1500 |
|
- |
| 10(Power Input
& Current) |
- |
2000 |
|
- |
| 9(Starting Of Motor Operated Appliances) |
- |
200 |
|
- |
| 8(Protection against Electric Shock/ Protection against Access to Live Parts) |
- |
500 |
|
- |
| 7(Marking/ Marking & Instructions) |
- |
1000 |
|
- |
| 6(Classification) |
- |
500 |
|
- |
| 5(Rating) |
- |
100 |
|
- |
|
03 Oct, 2027 |
- Included w.e.f.11.12.2024
Exclusion
32 (Radiation ,Toxicity and similar hazards)
19.11.4.1 to 19.11.4.7 (EMC/EMI) |
| 25 |
IS 302 : Part 2 : Sec 21 (2024) |
Household and Similar Electrical Appliances�Safety Part 2 Particular Requirements Section 21 Storage Water Heaters |
----- |
19800 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 4(General requirement) |
- |
100 |
|
- |
| 5(General conditions for the tests) |
- |
100 |
|
- |
| 6(Classification) |
- |
100 |
|
- |
| 7(Marking and instructions) |
- |
500 |
|
- |
| 8(Protection against access to live parts) |
- |
500 |
|
- |
| 9(Starting of motor-operated appliances) |
- |
100 |
|
- |
| 10(Power input and current) |
- |
2000 |
|
- |
| 11(Heating) |
- |
1500 |
|
- |
| 13(Leakage current and electric strength at operating temperature) |
- |
1500 |
|
- |
| 18(Endurance) |
- |
100 |
|
- |
| 19(Abnormal operation) |
- |
1000 |
|
- |
| 20(Stability and mechanical hazards) |
- |
300 |
|
- |
| 21(Mechanical strength) |
- |
300 |
|
- |
| 22(Construction) |
- |
200 |
|
- |
| 23(Internal wiring) |
- |
200 |
|
- |
| 24(Components) |
- |
200 |
|
- |
| 25(Supply connection and external flexible cords) |
- |
500 |
|
- |
| 26(Terminals for external conductors) |
- |
500 |
|
- |
| 27(Provision for earthing) |
- |
1000 |
|
- |
| 28(Screws and connections) |
- |
500 |
|
- |
| 29(Clearances, creepage distances and solid insulation) |
- |
500 |
|
- |
| 30(Resistance to heat and fire) |
- |
500 |
|
- |
| 31(Resistance to rusting) |
- |
1000 |
|
- |
| A.101(Pressure test) |
- |
500 |
|
- |
| 12(Charging of metal-ion batteries) |
- |
100 |
|
- |
| 22.101(rated pressure) |
- |
500 |
|
- |
| 22.102(Closed water heaters) |
- |
500 |
|
- |
| 22.103(Addition) |
- |
500 |
|
- |
| 22.104(Addition) |
- |
500 |
|
- |
| 22.105(Cistern-type water heaters) |
- |
500 |
|
- |
| 22.109(Addition) |
- |
500 |
|
- |
| 14(Transient overvoltages) |
- |
1000 |
|
- |
| 15(Moisture resistance) |
- |
500 |
|
- |
| 16(Leakage current and electric strength) |
- |
1000 |
|
- |
| 17(Overload protection of transformers and associated circuits) |
- |
500 |
|
- |
|
03 Oct, 2027 |
- Included .w.e.f.04.12.2024
Exclusion
19.11.4.1 (Electrostatic discharges)
19.11.4.2 (Radiated fields)
19.11.4.3 (Fast transient bursts)
19.11.4.4 (Surge immunity test)
19.11.4.5 (Immunity to conducted discharges)
19.11.4.6 (Class 3 Voltage dips and interruptions)
19.11.4.7 (Harmonics)
32 (RADIATION TOXICITY AND SIMILAR HAZARDS) |
| 26 |
IS 302 : Part 2 : SEC 31 (2009) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 31 range hoods |
---- |
36000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Clause No - 5(GENERAL CONDITIONS FOR THE TESTS) |
- |
500 |
|
- |
| Clause No - 5.18(linear and angular dimension) |
- |
500 |
|
- |
| Clause No - 6.2(harmfull ingress of water) |
- |
500 |
|
- |
| Clause No - 8.1.1("PROTECTION AGAINST ACCESS TO LIVE
PART- test probe B") |
- |
500 |
|
- |
| Clause No - 8.1.2("PROTECTION AGAINST ACCESS TO LIVE
PART - test probe 13") |
- |
500 |
|
- |
| Clause No - 8.2(Addition) |
- |
500 |
|
- |
| Clause No - 10.1, Table No. -1(power input deviation) |
- |
4000 |
|
- |
| Clause No - 13.3("LEAKAGE CURRENT AND ELECTRIC
STRENGTH AT OPERATING TEMPERATURE") |
- |
1000 |
|
- |
| Clause No - 13.3,Table No.- 4(voltage for electrical strength) |
- |
1000 |
|
- |
| Clause No - 14(Impulse test voltage) |
- |
1500 |
|
- |
| Clause No - 15.1.1(MOISTURE RESISTANCE) |
- |
1000 |
|
- |
| Clause No -19.7(test is repeated with the capacitor short circuited) |
- |
1000 |
|
- |
| Clause No -21.1(Mechanical strength) |
- |
500 |
|
- |
| Clause No -22.1(construction) |
- |
500 |
|
- |
| Clause No -22.11(push force applied) |
- |
500 |
|
- |
| Clause No -24.1.2(safety isolating transformer) |
- |
500 |
|
- |
| Clause No -24.1.3(for switches) |
- |
1000 |
|
- |
| Clause No -24.1.4(for automatic control) |
- |
1000 |
|
- |
| Clause No -24.1.5(for innterconnection couplers) |
- |
1000 |
|
- |
| Clause No -24.4(plug and socket) |
- |
1000 |
|
- |
| Clause No -25.8, Table no -11(conductor resistance) |
- |
1000 |
|
- |
| Clause No -25.5(dimension for pins) |
- |
1000 |
|
- |
| Clause No -27.6(for circuit board) |
- |
1000 |
|
- |
| Clause No -29.2(comparative tracking index) |
- |
1000 |
|
- |
| Clause No -29.3.3(dry heat test) |
- |
1000 |
|
- |
| Clause No -30.2.1(glow wire test) |
- |
1000 |
|
- |
| Clause No -30.101("incorporate combustible
material") |
- |
1000 |
|
- |
| Clause No - 5(GENERAL CONDITIONS FOR THE TESTS) |
- |
500 |
|
- |
| Clause No - 5.18(linear and angular dimension) |
- |
500 |
|
- |
| Clause No - 6.2(harmfull ingress of water) |
- |
1000 |
|
- |
| Clause No - 8.1.1("PROTECTION AGAINST ACCESS TO LIVE
PART- test probe B") |
- |
1000 |
|
- |
| Clause No - 8.1.2("PROTECTION AGAINST ACCESS TO LIVE
PART - test probe 13") |
- |
1000 |
|
- |
| Clause No - 8.2(Addition) |
- |
1000 |
|
- |
| Clause No - 10.1, Table No. -1(power input deviation) |
- |
0 |
|
- |
| Clause No - 13.3("LEAKAGE CURRENT AND ELECTRIC
STRENGTH AT OPERATING TEMPERATURE") |
- |
0 |
|
- |
| Clause No - 13.3,Table No.- 4(voltage for electrical strength) |
- |
0 |
|
- |
| Clause No - 14(Impulse test voltage) |
- |
0 |
|
- |
| Clause No - 15.1.1(MOISTURE RESISTANCE) |
- |
0 |
|
- |
| Clause No -19.7(test is repeated with the capacitor short circuited) |
- |
0 |
|
- |
| Clause No -21.1(Mechanical strength) |
- |
0 |
|
- |
| Clause No -22.1(construction) |
- |
0 |
|
- |
| Clause No -22.11(push force applied) |
- |
0 |
|
- |
| Clause No -24.1.2(safety isolating transformer) |
- |
0 |
|
- |
| Clause No -24.1.3(for switches) |
- |
0 |
|
- |
| Clause No -24.1.4(for automatic control) |
- |
0 |
|
- |
| Clause No -24.1.5(for innterconnection couplers) |
- |
0 |
|
- |
| Clause No -24.4(plug and socket) |
- |
0 |
|
- |
| Clause No -25.8, Table no -11(conductor resistance) |
- |
0 |
|
- |
| Clause No -25.5(dimension for pins) |
- |
0 |
|
- |
| Clause No -27.6(for circuit board) |
- |
0 |
|
- |
| Clause No -29.2(comparative tracking index) |
- |
0 |
|
- |
| Clause No -29.3.3(dry heat test) |
- |
0 |
|
- |
| Clause No -30.2.1(glow wire test) |
- |
0 |
|
- |
| Clause No -30.101("incorporate combustible
material") |
- |
0 |
|
- |
| 15(MOISTURE RESISTANCE) |
- |
500 |
|
- |
| 16(LEAKAGE CURRENT AND ELECTRIC STRENGTH) |
- |
1000 |
|
- |
| 17(OVERLOAD PROTECTION OF TRANSFORMERS AND ASSOCIATED CIRCUITS) |
- |
1000 |
|
- |
| 18(ENDURANCE) |
- |
1000 |
|
- |
| 28(SCREWS AND CONNECTIONS) |
- |
1000 |
|
- |
| 31(RESISTANCE TO RUSTING) |
- |
1000 |
|
- |
| Clause No - 5(GENERAL CONDITIONS FOR THE TESTS) |
- |
0 |
|
- |
| Clause No - 5.18(linear and angular dimension) |
- |
0 |
|
- |
| Clause No - 6.2(harmfull ingress of water) |
- |
0 |
|
- |
| Clause No - 8.1.1("PROTECTION AGAINST ACCESS TO LIVE
PART- test probe B") |
- |
0 |
|
- |
| Clause No - 8.1.2("PROTECTION AGAINST ACCESS TO LIVE
PART - test probe 13") |
- |
0 |
|
- |
| Clause No - 8.2(Addition) |
- |
0 |
|
- |
| Clause No - 10.1, Table No. -1(power input deviation) |
- |
0 |
|
- |
| Clause No - 13.3("LEAKAGE CURRENT AND ELECTRIC
STRENGTH AT OPERATING TEMPERATURE") |
- |
0 |
|
- |
| Clause No - 13.3,Table No.- 4(voltage for electrical strength) |
- |
0 |
|
- |
| Clause No - 14(Impulse test voltage) |
- |
0 |
|
- |
| Clause No - 15.1.1(MOISTURE RESISTANCE) |
- |
0 |
|
- |
| Clause No -19.7(test is repeated with the capacitor short circuited) |
- |
0 |
|
- |
| Clause No -21.1(Mechanical strength) |
- |
0 |
|
- |
| Clause No -22.1(construction) |
- |
0 |
|
- |
| Clause No -22.11(push force applied) |
- |
0 |
|
- |
| Clause No -24.1.2(safety isolating transformer) |
- |
0 |
|
- |
| Clause No -24.1.3(for switches) |
- |
0 |
|
- |
| Clause No -24.1.4(for automatic control) |
- |
0 |
|
- |
| Clause No -24.1.5(for innterconnection couplers) |
- |
0 |
|
- |
| Clause No -24.4(plug and socket) |
- |
0 |
|
- |
| Clause No -25.8, Table no -11(conductor resistance) |
- |
0 |
|
- |
| Clause No -25.5(dimension for pins) |
- |
0 |
|
- |
| Clause No -27.6(for circuit board) |
- |
0 |
|
- |
| Clause No -29.2(comparative tracking index) |
- |
0 |
|
- |
| Clause No -29.3.3(dry heat test) |
- |
0 |
|
- |
| Clause No -30.2.1(glow wire test) |
- |
0 |
|
- |
| Clause No -30.101("incorporate combustible
material") |
- |
0 |
|
- |
| 15(MOISTURE RESISTANCE) |
- |
0 |
|
- |
| 16(LEAKAGE CURRENT AND ELECTRIC STRENGTH) |
- |
0 |
|
- |
| 17(OVERLOAD PROTECTION OF TRANSFORMERS AND ASSOCIATED CIRCUITS) |
- |
0 |
|
- |
| 18(ENDURANCE) |
- |
0 |
|
- |
| 28(SCREWS AND CONNECTIONS) |
- |
0 |
|
- |
| 31(RESISTANCE TO RUSTING) |
- |
0 |
|
- |
| Clause No - 5(GENERAL CONDITIONS FOR THE TESTS) |
- |
0 |
|
- |
| Clause No - 5.18(linear and angular dimension) |
- |
0 |
|
- |
| Clause No - 6.2(harmfull ingress of water) |
- |
0 |
|
- |
| Clause No - 8.1.1("PROTECTION AGAINST ACCESS TO LIVE
PART- test probe B") |
- |
0 |
|
- |
| Clause No - 8.1.2("PROTECTION AGAINST ACCESS TO LIVE
PART - test probe 13") |
- |
0 |
|
- |
| Clause No - 8.2(Addition) |
- |
0 |
|
- |
| Clause No - 10.1, Table No. -1(power input deviation) |
- |
0 |
|
- |
| Clause No - 13.3("LEAKAGE CURRENT AND ELECTRIC
STRENGTH AT OPERATING TEMPERATURE") |
- |
0 |
|
- |
| Clause No - 13.3,Table No.- 4(voltage for electrical strength) |
- |
0 |
|
- |
| Clause No - 14(Impulse test voltage) |
- |
0 |
|
- |
| Clause No - 15.1.1(MOISTURE RESISTANCE) |
- |
0 |
|
- |
| Clause No -19.7(test is repeated with the capacitor short circuited) |
- |
0 |
|
- |
| Clause No -21.1(Mechanical strength) |
- |
0 |
|
- |
| Clause No -22.1(construction) |
- |
0 |
|
- |
| Clause No -22.11(push force applied) |
- |
0 |
|
- |
| Clause No -24.1.2(safety isolating transformer) |
- |
0 |
|
- |
| Clause No -24.1.3(for switches) |
- |
0 |
|
- |
| Clause No -24.1.4(for automatic control) |
- |
0 |
|
- |
| Clause No -24.1.5(for innterconnection couplers) |
- |
0 |
|
- |
| Clause No -24.4(plug and socket) |
- |
0 |
|
- |
| Clause No -25.8, Table no -11(conductor resistance) |
- |
0 |
|
- |
| Clause No -25.5(dimension for pins) |
- |
0 |
|
- |
| Clause No -27.6(for circuit board) |
- |
0 |
|
- |
| Clause No -29.2(comparative tracking index) |
- |
0 |
|
- |
| Clause No -29.3.3(dry heat test) |
- |
0 |
|
- |
| Clause No -30.2.1(glow wire test) |
- |
0 |
|
- |
| Clause No -30.101("incorporate combustible
material") |
- |
0 |
|
- |
| 15(MOISTURE RESISTANCE) |
- |
0 |
|
- |
| 16(LEAKAGE CURRENT AND ELECTRIC STRENGTH) |
- |
0 |
|
- |
| 17(OVERLOAD PROTECTION OF TRANSFORMERS AND ASSOCIATED CIRCUITS) |
- |
0 |
|
- |
| 18(ENDURANCE) |
- |
0 |
|
- |
| 28(SCREWS AND CONNECTIONS) |
- |
0 |
|
- |
| 31(RESISTANCE TO RUSTING) |
- |
0 |
|
- |
|
03 Oct, 2027 |
- Included.w.e.f.26.11.2024 Exclusion - 19.11.4.1 to 19.11.4.4 (EMI/EMC) |
| 27 |
IS 8978 (1992) |
Specification for electric instantaneous water heaters (Second Revision) |
---- |
14800 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
200 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-35:2017(Marking) |
- |
0 |
|
- |
| Cl.6 of IS 302-2-35:2017(Classification) |
- |
100 |
|
- |
| Cl.6 of IS 302-2-35:2017(Classification) |
- |
0 |
|
- |
| Cl.8 of IS 302-2-35:2017(Protection Against Access To Live Parts) |
- |
500 |
|
- |
| Cl.10 of IS 302-2- 35:2011(Power Input & Current ) |
- |
1200 |
|
- |
| Cl.11 of 302-2-35:2017(Heating) |
- |
1000 |
|
- |
| Cl.11 of 302-2-35:2017(Heating) |
- |
0 |
|
- |
| Cl.11 of 302-2-35:2017(Heating) |
- |
0 |
|
- |
| Cl.11 of 302-2-35:2017(Heating) |
- |
0 |
|
- |
| Cl.13 of IS 302-2-35:2017(Leakage Current & Electrical Strength at Operating Temperature ) |
- |
1000 |
|
- |
| Cl.13 of IS 302-2-35:2017(Leakage Current & Electrical Strength at Operating Temperature ) |
- |
0 |
|
- |
| Cl.14 of IS 302-2-35:2017(Transient Over Voltages ) |
- |
500 |
|
- |
| Cl.15 of IS 302-2-35-2011(Moisture Resistance ) |
- |
500 |
|
- |
| Cl.15 of IS 302-2-35-2011(Moisture Resistance ) |
- |
0 |
|
- |
| Cl.16 of IS 302-2-35:2011(Leakage Current and Electric Strength) |
- |
500 |
|
- |
| Cl.16 of IS 302-2-35:2011(Leakage Current and Electric Strength) |
- |
0 |
|
- |
| Cl.17 IS 302-2-35:2017(Overload Protection of Transformers & Associated circuits ) |
- |
200 |
|
- |
| Cl.19 of IS 302-2-35:2017(Abnormal Operation) |
- |
500 |
|
- |
| Cl.19 of IS 302-2-35:2017(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-35:2017(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-35:2017(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-35:2017(Abnormal Operation) |
- |
0 |
|
- |
| Cl.20 of IS 302-2-35-2011(Stability & Mechanical Hazards
) |
- |
200 |
|
- |
| Cl.21.1 of IS 302-2-35-2011(Mechanical strength) |
- |
200 |
|
- |
| Cl. 21.2 of IS 302-1:2008(Mechanical strength) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
500 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-35-2011(Construction
) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
500 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35-2011(Internal Wiring) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-35:2017(Component
) |
- |
200 |
|
- |
| Cl.24 of IS 302-2-35:2017(Component
) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-35:2017(Component
) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-35:2017(Component
) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
500 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-35:2017(Provision for Earthing) |
- |
500 |
|
- |
| Cl.27 of IS 302-2-35:2017(Provision for Earthing) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-35:2017(Provision for Earthing) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-35:2017(Provision for Earthing) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-35:2017(Provision for Earthing) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-35:2017(Provision for Earthing) |
- |
0 |
|
- |
| Cl.27 of IS 302-2-35:2017(Provision for Earthing) |
- |
0 |
|
- |
| Cl.28 of IS 302-2-35:2017(Screws and Connections
) |
- |
200 |
|
- |
| Cl.29 of IS 302-2-35:2017(Clearances, Creepage Distances and Solid Insulation) |
- |
500 |
|
- |
| Cl.29 of IS 302-2-35:2017(Clearances, Creepage Distances and Solid Insulation) |
- |
0 |
|
- |
| Cl.29 of IS 302-2-35:2017(Clearances, Creepage Distances and Solid Insulation) |
- |
0 |
|
- |
| Cl.30 of IS 302-2-35: 2011(Resistance to Heat and Fire) |
- |
500 |
|
- |
| Cl.30 of IS 302-2-35: 2011(Resistance to Heat and Fire) |
- |
0 |
|
- |
| Cl.31 of IS 302-2-35: 2011(Resistance to Rusting
) |
- |
200 |
|
- |
| Cl.10 of IS 8978 : 1992(Finish) |
- |
500 |
|
- |
| Cl.11 of IS 8978 : 1992(Operation of flow switch) |
- |
500 |
|
- |
| Cl.12 of IS 8978 : 1992(Endurance) |
- |
500 |
|
- |
| Cl.12 of IS 8978 : 1992(Endurance) |
- |
0 |
|
- |
| Cl.10 of IS 8978 : 1992(Finish) |
- |
0 |
|
- |
| Cl.31 of IS 302-2-35: 2017(Resistance to Rusting
) |
- |
0 |
|
- |
| Cl.30.2 of IS 302-1:2008(Resistance to Heat and Fire) |
- |
50 |
|
- |
| Cl.30.1 of IS 302-1:2008(Resistance to Heat and Fire) |
- |
0 |
|
- |
| Cl.29.2 of IS 302-2-35:2017(Clearances, Creepage Distances and Solid Insulation : Creepage distance ) |
- |
50 |
|
- |
| Cl.29.1 of IS 302-2-35:2017(Clearances, Creepage Distances and Solid Insulation : Clearance distance ) |
- |
50 |
|
- |
| Cl.28 of IS 302-2-35:2017(Screws and Connections
) |
- |
50 |
|
- |
| Cl.27.5 of IS 302-2-35:2017(Provision for Earthing : ECR ) |
- |
50 |
|
- |
| Cl.27 of IS 302-2-35:2017(Provision for Earthing) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-35:2017(Internal Wiring ; Colour of earthing conductor) |
- |
50 |
|
- |
| Cl.23 of IS 302-2-35:2017(Internal Wiring) |
- |
0 |
|
- |
| Cl.22.110 of IS 302-2-35:2017(Construction : Provision for fixing to wall
) |
- |
50 |
|
- |
| Cl.22.109 of IS 302-2-35:2017(Construction : Operation of presure switch of open outlet water heater
) |
- |
50 |
|
- |
| Cl.22.108 of IS 302-2-35:2017(Construction : Temperature of outlet water intended to supply for showring
) |
- |
50 |
|
- |
| Cl.22.107 of IS 302-2-35:2017(Construction : Temperature of outlet
) |
- |
50 |
|
- |
| Cl.22.106 of IS 302-2-35:2017(Construction : Operation of thermal cut out for closed water heater
) |
- |
50 |
|
- |
| Cl.22.104 of IS 302-2-35:2017(Construction : Pressure in open outlet water heaters
) |
- |
50 |
|
- |
| Cl.22.103 of IS 302-2-35:2017(Construction : Pressure relief device operation for closed water heater
) |
- |
50 |
|
- |
| Cl.22.102 of IS 302-2-35:2017(Construction : excessive temperature of outlet
) |
- |
50 |
|
- |
| Cl.22.101 of IS 302-2-35:2017(Construction : Rated pressure of closed water heater
) |
- |
50 |
|
- |
| Cl.22.47 of IS 302-2-35:2017(Construction : Water pressure test
) |
- |
50 |
|
- |
| Cl.22.44 of IS 302-1:2008(Construction : Shape and decoration
) |
- |
50 |
|
- |
| Cl.22.34, Cl 22.35 of
IS 302-1:2008(Construction : Shaft of operating Knobs ) |
- |
50 |
|
- |
| Cl.22.33 of
IS 302-1:2008(Construction : Direct contact of liquids ) |
- |
50 |
|
- |
| Cl 22.26 ,Cl.22.28, Cl 22.29, Cl 22.30 , Cl 22.31, Cl 22.32 of
IS 302-1:2008(Construction : Supplymentry/ double / reinforced insulation for Class II/ Class III appliance ) |
- |
50 |
|
- |
| Cl.22.18 of IS 302-1:2008(Construction : Resistance to corrosion
) |
- |
50 |
|
- |
| Cl.22.17 of IS 302-1:2008(Construction : Spacers
) |
- |
50 |
|
- |
| Cl.22.14 of IS 302-1:2008(Construction : Ragged or sharp edges
) |
- |
50 |
|
- |
| Cl.22.12 of IS 302-1:2008(Construction : Fixing of Handle, knob, grips, levers and similar parts
) |
- |
50 |
|
- |
| Cl.22.11 of IS 302-1:2008(Construction : Fixing of non detachable parts
) |
- |
50 |
|
- |
| Cl.22.7 of IS 302-1:2008(Construction : safeguards against the risk of excessive pressure.
) |
- |
50 |
|
- |
| Cl.22.6 of IS 302-2-35:2017(Construction : size of drain hole
) |
- |
100 |
|
- |
| Cl.22.6 of IS 302-1:2008(Construction : effect of water on 3 insulation
) |
- |
100 |
|
- |
| Cl.22.2 of IS 302-1:2008(Construction : connection to supply mains
) |
- |
100 |
|
- |
| Cl.22.1 of IS 302-1:2008(Construction : IP test
) |
- |
100 |
|
- |
| Cl. 21.2 of IS 302-1:2008(Mechanical strength : prevent penetration by sharp implements. ) |
- |
50 |
|
- |
| Cl.21.1 of IS 302-1:2008(Mechanical strength : Rough handling in normal use) |
- |
100 |
|
- |
| Cl.20 of IS 302-2-35:2017(Stability & Mechanical Hazards
) |
- |
200 |
|
- |
| Cl.19 of IS 302-2-35:2017(Abnormal Operation : effect on container) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-35:2017(Abnormal Operation : High voltage) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-35:2017(Abnormal Operation : Temperature rise of insulation of supply cord) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-35:2017(Abnormal Operation : Temperature rise of test corner) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-35:2017(Abnormal Operation : Emission of flames, molten metal ,or poisonous or ignitable gas) |
- |
0 |
|
- |
| Cl.16 of IS 302-2-35:2017(Leakage Current and Electric Strength (After Humidity)) |
- |
0 |
|
- |
| Cl.16 of IS 302-2-35:2017(Leakage Current and Electric Strength (After Humidity)) |
- |
0 |
|
- |
| Cl.15 of IS 302-2-35:2017(Moisture Resistance ) |
- |
0 |
|
- |
| Cl.14 of IS 302-2-35:2017(Transient Over Voltages ) |
- |
0 |
|
- |
| Cl.13 of IS 302-2-35:2017(Leakage Current & 3 Strength at Operating Temperature : High voltage ) |
- |
100 |
|
- |
| Cl.13 of IS 302-2-35:2017(Leakage Current & 3 Strength at Operating Temperature ) |
- |
100 |
|
- |
| Cl.11 of 302-2-35:2017(Heating : room temperature) |
- |
100 |
|
- |
| Cl.11 of 302-2-35:2017(Heating : Insulation of supply cord) |
- |
100 |
|
- |
| Cl.11 of 302-2-35:2017(Heating : Temperature rise of test corner) |
- |
100 |
|
- |
| Cl.10 of IS 302-2- 35:2017(Power Input & Current ) |
- |
0 |
|
- |
| Cl.8 of IS 302-2-35:2017(Protection Against Access To Live Parts) |
- |
0 |
|
- |
| Cl.7.102 of IS 302-2-35:2017(Marking : Standard mark) |
- |
0 |
|
- |
| Cl.7.101 of IS 302-2-35:2017(Marking : Woter inlet and outlet idetification) |
- |
0 |
|
- |
| Cl.7.15 of IS 302-1:2008(Marking : Position of marking) |
- |
0 |
|
- |
| Cl.7.14 of IS 302-1:2008(Marking ; Legibility and durability) |
- |
100 |
|
- |
| Cl.7.13 of IS 302-1:2008(Marking : Language) |
- |
0 |
|
- |
| Cl.7.10 & 7.11 of IS 302-1:2008(Marking : Indication for direction of control) |
- |
0 |
|
- |
| Cl.7.8 of IS 302-1:2008(Marking : Terminal for connection ) |
- |
0 |
|
- |
| Cl.7.6 of IS 302-1:2008(Marking : Symbols) |
- |
0 |
|
- |
| Cl.7.1 of IS 302-2-35:2017(Marking : rated pressure) |
- |
0 |
|
- |
| Cl.7.1 of IS 302-1:2008(Marking : Country of manufacture) |
- |
0 |
|
- |
| Cl.7.1 of IS 302-1:2008(Marking : IP number ) |
- |
0 |
|
- |
| Cl.7.1 of IS 302-1:2008(Marking : Symbol for class II) |
- |
0 |
|
- |
| Cl.7.1 of IS 302-1:2008(Marking : Molel or type) |
- |
0 |
|
- |
| Cl.7.1 of IS 302-1:2008(Marking : Manufacture identification) |
- |
0 |
|
- |
| Cl.7.1 of IS 302-1:2008(Marking : Rated power input) |
- |
0 |
|
- |
| Cl.7.1 of IS 302-1:2008(Marking : Nature of supply) |
- |
0 |
|
- |
| Cl.7.1 of IS 302-1:2008(Marking : Rated Voltage) |
- |
0 |
|
- |
| 4(GENERAL REQUIREMENTS) |
- |
0 |
|
- |
| 5(GENERAL NOTE ON TEST) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| 7(Marking) |
- |
0 |
|
- |
| (Cl.7.1 of IS 302-2-35:2017)(Marking) |
- |
0 |
|
- |
| (Cl.7.101 of IS 302-2-35:2017)(Marking) |
- |
100 |
|
- |
| (Cl.8.1.1 of IS 8978:1992)(Marking) |
- |
0 |
|
- |
| (Cl.19.13 of IS 302-2-35:2017)(Abnormal operation) |
- |
50 |
|
- |
| (Cl.19.13 of IS 302-2-35:2017)(Abnormal operation) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-35:2017)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-35:2017)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-35:2017)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-35:2017)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-35:2017)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-35:2017)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-35:2017)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-35:2017)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-35:2017)(Construction) |
- |
0 |
|
- |
| (Cl.22 of IS 302-2-35:2017)(Construction) |
- |
0 |
|
- |
| (Cl.23 of IS 302-2-35:2017)(Internal wiring) |
- |
0 |
|
- |
| (Cl.23 of IS 302-2-35:2017)(Internal wiring) |
- |
0 |
|
- |
| (Cl.23 of IS 302-2-35:2017)(Internal wiring) |
- |
0 |
|
- |
| (Cl.23 of IS 302-2-35:2017)(Internal wiring) |
- |
0 |
|
- |
| (Cl.24 of IS 302-2-35:2017)(Components) |
- |
0 |
|
- |
| (Cl.24 of IS 302-2-35:2017)(Components) |
- |
0 |
|
- |
| (Cl.24 of IS 302-2-35:2017)(Components) |
- |
0 |
|
- |
| (Cl.24 of IS 302-2-35:2017)(Components) |
- |
0 |
|
- |
| (Cl.24 of IS 302-2-35:2017)(Components) |
- |
0 |
|
- |
| (Cl.25.8 of IS 302-2-35:2017)(Supply Connection and External Flexible cords) |
- |
300 |
|
- |
| (CL.27.5 of IS 302-2-35:2017)(Provision for Earthing) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-35:2017(Component
) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-35:2017(Terminals for External Conductors) |
- |
0 |
|
- |
| Cl.25.18 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.25.15 of IS 302-2-35:2017(Supply Connection & External Flexible Cords : Cord grip test - displacement ) |
- |
0 |
|
- |
| Cl.25.15 of IS 302-2-35:2017(Supply Connection & External Flexible Cords : Cord grip test ) |
- |
0 |
|
- |
| Cl.25.12 of IS 302-2-35:2017(Supply Connection & External Flexible Cords : Moulding of supply cord ) |
- |
0 |
|
- |
| Cl.25.10 of IS 302-2-35:2017(Supply Connection & External Flexible Cords : Colour of Earthing conductor ) |
- |
0 |
|
- |
| Cl.25.8 of IS 302-2-35:2017(Supply Connection & External Flexible Cords : Resistance of supply cord ) |
- |
0 |
|
- |
| Cl.25.5 of IS 302-2-35:2017(Supply Connection & External Flexible Cords : Type of attachment ) |
- |
0 |
|
- |
| Cl.25.1 of IS 302-2-35:2017(Supply Connection & External Flexible Cords : connection to the supply mains) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-35:2017(Supply Connection & External Flexible Cords) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-35:2017(Component
) |
- |
0 |
|
- |
|
03 Oct, 2027 |
- Included.w.e.f.26.11.2024 Exclusion 32 (RADIATION, TOXICITY AND SIMILAR HAZARDS), 19.11.4.1 to 19.11.4.7 (EMI/EMC). |
| 28 |
IS 369 (2019) |
Household electric direct - Acting room heaters - Performance requirements (Fourth Revision) |
---- |
16500 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl.6 of IS 302-2-30:2007(Classification) |
- |
200 |
|
- |
| Cl.6 of IS 302-2-30:2007(Classification) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
200 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
| Cl.8 of IS 302-2-30:2007 &IS:302-1:2008(Protection Against Access to Live Parts) |
- |
200 |
|
- |
| Cl.10 of IS 302-2-30:2007 &IS:302-1:2008(Power Input and Current) |
- |
1000 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
500 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 302-2-30:2007 &IS:302-1:2008(Heating) |
- |
0 |
|
- |
| Cl.13 of IS 302-2-30:2007 &IS:302-1:2008(Leakage Current & Electric Strength at operating temp) |
- |
1000 |
|
- |
| Cl.13 of IS 302-2-30:2007 &IS:302-1:2008(Leakage Current & Electric Strength at operating temp) |
- |
0 |
|
- |
| Cl.14 of IS 302-2-30:2007 &IS:302-1:2008(Transient Over Voltages) |
- |
200 |
|
- |
| Cl.14 of IS 302-2-30:2007 &IS:302-1:2008(Transient Over Voltages) |
- |
0 |
|
- |
| Cl.14 of IS 302-2-30:2007 &IS:302-1:2008(Transient Over Voltages) |
- |
0 |
|
- |
| Cl.14 of IS 302-2-30:2007 &IS:302-1:2008(Transient Over Voltages) |
- |
0 |
|
- |
| Cl.15 of IS 302-2-30:2007 &IS:302-1:2008(Moisture Resistance) |
- |
200 |
|
- |
| Cl.15 of IS 302-2-30:2007 &IS:302-1:2008(Moisture Resistance) |
- |
0 |
|
- |
| Cl.16 of IS 302-2-30:2007 &IS:302-1:2008(Leakage Current & Electric Strength ) |
- |
1000 |
|
- |
| Cl.16 of IS 302-2-30:2007 &IS:302-1:2008(Leakage Current & Electric Strength ) |
- |
0 |
|
- |
| Cl.18 of IS 302-2-30:2007 (Endurance) |
- |
200 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
500 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19 of IS 302-2-30:2007 &IS:302-1:2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.20 of IS 302-2-30:2007 &IS:302-1:2008(Stability & Mechanical Hazards) |
- |
200 |
|
- |
| Cl.21 of IS 302-2-30:2007 &IS:302-1:2008(Mechanical Strength) |
- |
200 |
|
- |
| Cl.21 of IS 302-2-30:2007 &IS:302-1:2008(Mechanical Strength) |
- |
0 |
|
- |
| Cl.21 of IS 302-2-30:2007 &IS:302-1:2008(Mechanical Strength) |
- |
0 |
|
- |
| Cl.21 of IS 302-2-30:2007 &IS:302-1:2008(Mechanical Strength) |
- |
0 |
|
- |
| Cl.21 of IS 302-2-30:2007 &IS:302-1:2008(Mechanical Strength) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-30:2007 &IS:302-1:2008(Construction) |
- |
200 |
|
- |
| Cl.22 of IS 302-2-30:2007 &IS:302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-30:2007 &IS:302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-30:2007 &IS:302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-30:2007 &IS:302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-30:2007 &IS:302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-30:2007 &IS:302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-30:2007 &IS:302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-30:2007 &IS:302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-30:2007 &IS:302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-30:2007 &IS:302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-30:2007 &IS:302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-30:2007 &IS:302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.22 of IS 302-2-30:2007 &IS:302-1:2008(Construction) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-30:2007 &IS:302-1:2008(Internal Wiring) |
- |
200 |
|
- |
| Cl.23 of IS 302-2-30:2007 &IS:302-1:2008(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-30:2007 &IS:302-1:2008(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-30:2007 &IS:302-1:2008(Internal Wiring) |
- |
0 |
|
- |
| Cl.23 of IS 302-2-30:2007 &IS:302-1:2008(Internal Wiring) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-30:2007 &IS:302-1:2008(Component) |
- |
200 |
|
- |
| Cl.24 of IS 302-2-30:2007 &IS:302-1:2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-30:2007 &IS:302-1:2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-30:2007 &IS:302-1:2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-30:2007 &IS:302-1:2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-30:2007 &IS:302-1:2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-30:2007 &IS:302-1:2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-30:2007 &IS:302-1:2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-30:2007 &IS:302-1:2008(Component) |
- |
0 |
|
- |
| Cl.24 of IS 302-2-30:2007 &IS:302-1:2008(Component) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-30:2007 &IS:302-1:2008(Supply Connection and External Flexible Cords ) |
- |
200 |
|
- |
| Cl.25 of IS 302-2-30:2007 &IS:302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-30:2007 &IS:302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-30:2007 &IS:302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-30:2007 &IS:302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-30:2007 &IS:302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-30:2007 &IS:302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-30:2007 &IS:302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-30:2007 &IS:302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-30:2007 &IS:302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-30:2007 &IS:302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-30:2007 &IS:302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.25 of IS 302-2-30:2007 &IS:302-1:2008(Supply Connection and External Flexible Cords ) |
- |
0 |
|
- |
| Cl.26 of IS 302-2-30:2007 &IS:302-1:2008(Terminal for External Conductors) |
- |
200 |
|
- |
| Cl.27 of IS 302-2-30:2007 &IS:302-1:2008(Provision for Earthing) |
- |
500 |
|
- |
| Cl.27 of IS 302-2-30:2007 &IS:302-1:2008(Provision for Earthing) |
- |
0 |
|
- |
| Cl.28 of IS 302-2-30:2007 &IS:302-1:2008(Screws and Connections) |
- |
200 |
|
- |
| Cl.29 of IS 302-2-30:2007 &IS:302-1:2008(Clearances, Creepage Distances and Solid Insulation.) |
- |
200 |
|
- |
| Cl.29 of IS 302-2-30:2007 &IS:302-1:2008(Clearances, Creepage Distances and Solid Insulation.) |
- |
0 |
|
- |
| Cl.30 of IS 302-2-30:2007 &IS:302-1:2008(Resistance to Heat and Fire.) |
- |
200 |
|
- |
| Cl.30 of IS 302-2-30:2007 &IS:302-1:2008(Resistance to Heat and Fire.) |
- |
0 |
|
- |
| Cl.31 of IS 302-2-30:2007 &IS:302-1:2008(Resistance to Rusting) |
- |
200 |
|
- |
| Cl.7 of IS 369:2019(Dimensions) |
- |
500 |
|
- |
| Cl.7 of IS 369:2019(Dimensions) |
- |
0 |
|
- |
| Cl.7 of IS 369:2019(Dimensions) |
- |
0 |
|
- |
| Cl.8 of IS 369:2019(Temperature rises of air-outlet grilles and external surfaces) |
- |
700 |
|
- |
| Cl.8 of IS 369:2019(Temperature rises of air-outlet grilles and external surfaces) |
- |
700 |
|
- |
| Cl.8 of IS 369:2019(Temperature rises of air-outlet grilles and external surfaces) |
- |
800 |
|
- |
| Cl.9 of IS 369:2019(Temperature rises of surfaces surrounding the heater) |
- |
800 |
|
- |
| Cl.9 of IS 369:2019(Temperature rises of surfaces surrounding the heater) |
- |
0 |
|
- |
| Cl.9 of IS 369:2019(Temperature rises of surfaces surrounding the heater) |
- |
0 |
|
- |
| Cl.9 of IS 369:2019(Temperature rises of surfaces surrounding the heater) |
- |
0 |
|
- |
| Cl.9 of IS 369:2019(Temperature rises of surfaces surrounding the heater) |
- |
0 |
|
- |
| Cl.9 of IS 369:2019(Temperature rises of surfaces surrounding the heater) |
- |
0 |
|
- |
| Cl.10 of IS 369:2019(Warming-up time of the heater) |
- |
700 |
|
- |
| Cl.11 of IS 369:2019(Stability of room temperature) |
- |
700 |
|
- |
| Cl.11 of IS 369:2019(Stability of room temperature) |
- |
0 |
|
- |
| Cl.11 of IS 369:2019(Stability of room temperature) |
- |
0 |
|
- |
| Cl.11 of IS 369:2019(Stability of room temperature) |
- |
0 |
|
- |
| Cl.12 of IS 369:2019(Set-back) |
- |
700 |
|
- |
| Cl.13 of IS 369:2019(Frost protection temperature) |
- |
500 |
|
- |
| Cl.14 of IS 369:2019(Inrush current) |
- |
500 |
|
- |
| Cl.15 of IS 369:2019(Effect of radiant heat) |
- |
500 |
|
- |
| Cl.15 of IS 369:2019(Effect of radiant heat) |
- |
500 |
|
- |
| Cl.15 of IS 369:2019(Effect of radiant heat) |
- |
0 |
|
- |
| Cl.16 of IS 369:2019(Usable power) |
- |
500 |
|
- |
| Cl.17 of IS 302-2-30:2007(OVERLOAD PROTECTION OF TRANSFORMERS AND ASSOCIATED CIRCUITS) |
- |
500 |
|
- |
| Cl.7 of IS 302-2-30:2007 &IS:302-1:2008(Marking and Instructions) |
- |
0 |
|
- |
|
03 Oct, 2027 |
- Included.w.e.f.26.11.2024 |
| 29 |
IS 368 (2014) |
Electric immersion water heaters - Specification (Fifth Revision) |
----- |
25000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl.6 of IS 302-‐2-‐201:2008(Classification) |
- |
500 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
50 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
50 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
50 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
50 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
50 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
50 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
50 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
50 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
50 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
50 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
50 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
50 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
50 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
50 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
50 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
50 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
50 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
50 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
50 |
|
- |
| Cl.7 of IS 302-2-201:2008(Marking and Instruction ) |
- |
50 |
|
- |
| Cl.8 of IS 302‐2-201: 2008(Protection Against Access to Live Parts) |
- |
500 |
|
- |
| Cl.10 of IS 302‐2‐201:2008(Power Input and Current ) |
- |
2000 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
1500 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
50 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
50 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
50 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
50 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
50 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
50 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
50 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
50 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
50 |
|
- |
| Cl.11 of IS 302-2201: 2008(Heating) |
- |
50 |
|
- |
| Cl. 12 of IS 368:2014(Operation under overload conditions of appliances with heating elements) |
- |
500 |
|
- |
| Cl.13 of IS 302-2-201: 2008(Leakage Current & Electric Strength at Operating Temperature) |
- |
1500 |
|
- |
| Cl.13 of IS 302-2-201: 2009(Leakage Current & Electric Strength at Operating Temperature) |
- |
50 |
|
- |
| Cl.14 of IS 302‐2-201:2008(Transient Over Voltages ) |
- |
1000 |
|
- |
| Cl.15 of IS 302-2-201:2008(Moisture Resistance ) |
- |
1000 |
|
- |
| Cl.15 of IS 302-2-201:2008(Moisture Resistance ) |
- |
0 |
|
- |
| Cl.16 of IS 302-2-201:2008(Leakage Current & Electric Strength) |
- |
1500 |
|
- |
| Cl.16 of IS 302-2-201:2008(Leakage Current & Electric Strength) |
- |
50 |
|
- |
| Cl.17 of IS 302‐2-201: 2008(Overload Protection of Transformers & Associated Circuits) |
- |
500 |
|
- |
| Cl.18 of IS 368:2014(Endurance) |
- |
1000 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
1500 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
50 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
50 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
50 |
|
- |
| Cl.19 of IS 302‐2-201: 2008(Abnormal Operation ) |
- |
50 |
|
- |
| Cl.20 of IS 302-2-201: 2008(Stability & Mechanical Hazards) |
- |
500 |
|
- |
| Cl.21 of IS 302-2-201: 2008(Mechanical Strength ) |
- |
500 |
|
- |
| Cl.21 of IS 302-2-201: 2008(Mechanical Strength ) |
- |
50 |
|
- |
| Cl.21 of IS 302-2-201: 2008(Mechanical Strength ) |
- |
50 |
|
- |
| Cl.22 of IS 302-2-201: 2008(Construction) |
- |
500 |
|
- |
| Cl.22 of IS 302-2-201: 2008(Construction) |
- |
50 |
|
- |
| Cl.22 of IS 302-2-201: 2008(Construction) |
- |
50 |
|
- |
| Cl.22 of IS 302-2-201: 2008(Construction) |
- |
50 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
500 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
50 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
50 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
50 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
50 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
50 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
50 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
50 |
|
- |
| Cl.23 of 302-2-201:2008(Internal Wiring ) |
- |
50 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
500 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
50 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
50 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
50 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
50 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
50 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
50 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
50 |
|
- |
| Cl.24 of IS 302-2-201: 2008(Component) |
- |
50 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
500 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
50 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
50 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
50 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
50 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
50 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
50 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
50 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
50 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
50 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
50 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
50 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
50 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
50 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
50 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
50 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
50 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
50 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
50 |
|
- |
| Cl.25 of IS 302-2-201: 2008(Supply Connection and External Flexible Cords) |
- |
50 |
|
- |
| Cl.26 of IS 302-2-201: 2008(Terminals for External Conductors) |
- |
500 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
1000 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
50 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
50 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
50 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
50 |
|
- |
| Cl.27 of IS 302-2-201: 2008(Provision for Earthing ) |
- |
50 |
|
- |
| Cl.28 of IS 302-2-201: 2008(Screws & Connections ) |
- |
500 |
|
- |
| Cl.29 of IS 302-2‐201:2008(Clearances, Creepage Distances and Solid Insulation ) |
- |
1000 |
|
- |
| Cl.29 of IS 302-2‐201:2008(Clearances, Creepage Distances and Solid Insulation ) |
- |
50 |
|
- |
| Cl.30 of IS 302-2‐201:2008(Resistance to Heat and Fire ) |
- |
700 |
|
- |
| Cl.30 of IS 302-2‐201:2008(Resistance to Heat and Fire ) |
- |
100 |
|
- |
| Cl.31 of IS 302-2-201:2008(Resistance of Rusting ) |
- |
500 |
|
- |
| 4(GENERAL REQUIREMENT) |
- |
50 |
|
- |
| 5(GENERAL CONDITIONS FOR THE TESTS) |
- |
50 |
|
- |
|
03 Oct, 2027 |
- Included.w.e.f.09.11.2024 Exclusion 32 (RADIATION, TOXICITY AND SIMILAR HAZARDS) 19.11.4.1 to 19.11.4.5 (EMI/EMC) |
| 30 |
IS 4159 (2021) |
Mineral Filled Sheathed Heating Elements |
---- |
14800 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| "Cl. 6 IS 4159:2021"(Classification) |
- |
100 |
|
- |
| "Cl. 8 IS 4159:2021"(Protection against access to live parts) |
- |
500 |
|
- |
| "Cl. 9 IS 4159:2021"(Starting of motor operated appliances) |
- |
100 |
|
- |
| "Cl. 10 IS 4159:2021"(Power Input and Current) |
- |
1500 |
|
- |
| "Cl. 11 IS 4159:2021"(Heating) |
- |
1000 |
|
- |
| "Cl. 13 IS 4159:2021"(Leakage Current & Electrical Strength at Operating Temperature) |
- |
1000 |
|
- |
| "Cl. 14 IS 4159:2021"(Transient Over Voltage) |
- |
500 |
|
- |
| "Cl. 15 IS 4159:2021"(Moisture Resistance) |
- |
500 |
|
- |
| "Cl. 16 IS 4159:2021"(Leakage Current and Electric strength) |
- |
1000 |
|
- |
| "Cl. 17 IS 4159:2021"(Overload protection of transformers and associated circuits.) |
- |
100 |
|
- |
| "Cl. 18 IS 4159:2021"(Endurance) |
- |
500 |
|
- |
| "Cl. 19 IS 4159:2021"(Abnormal Operation) |
- |
500 |
|
- |
| "Cl. 20 IS 4159:2021"(Stability and mechanical Hazards) |
- |
200 |
|
- |
| "Cl. 21 IS 4159:2021"(Mechanical Strength) |
- |
200 |
|
- |
| "Cl. 22 IS 4159:2021"(Construction) |
- |
500 |
|
- |
| "Cl. 23 IS 4159:2021"(Internal Wiring) |
- |
500 |
|
- |
| "Cl. 24 IS 4159:2021"(Components) |
- |
500 |
|
- |
| "Cl. 25 IS 4159:2021"(Supply Connections and External Flexible Cables and Cords) |
- |
200 |
|
- |
| "Cl. 26 IS 4159:2021"(Terminal For External Conductors) |
- |
200 |
|
- |
| "Cl. 27 IS 4159:2021"(Provision For Earthing) |
- |
500 |
|
- |
| "Cl. 28 IS 4159:2021"(Screws and Connections) |
- |
200 |
|
- |
| "Cl. 29 IS 4159:2021"(Creepage Distances, Clearances And Distances Through Insulation) |
- |
500 |
|
- |
| "Cl. 30 IS 4159:2021"(Resistance To Heat, Fire And Tracking) |
- |
500 |
|
- |
| "Cl. 31 IS 4159:2021"(Resistance To Rusting) |
- |
500 |
|
- |
| "Cl. 102 IS 4159:2021"(Leakage and hydrostatic strength (for oil heating elements)) |
- |
50 |
|
- |
| Cl.22.106(CONSTRUCTION) |
- |
100 |
|
- |
| Cl.7.1 of IS 4159:2021(Marking) |
- |
50 |
|
- |
| Cl.7.1 of IS 4159:2021(Marking) |
- |
50 |
|
- |
| Cl.7.1 of IS 4159:2021(Marking) |
- |
50 |
|
- |
| Cl.7.1 of IS 4159:2021(Marking) |
- |
50 |
|
- |
| Cl.7.1 of IS 4159:2021(Marking) |
- |
50 |
|
- |
| Cl.7.1 of IS 4159:2021(Marking) |
- |
50 |
|
- |
| Cl.7.2 of IS 4159:2021(Marking) |
- |
50 |
|
- |
| Cl.7.3 of IS 4159:2021(Marking) |
- |
50 |
|
- |
| Cl.10 of IS 302-1:2008(Power Input & Current) |
- |
0 |
|
- |
| Cl.11 of IS 4159:2021 & IS 302‐1:2008(Heating) |
- |
0 |
|
- |
| Cl.11 of IS 4159:2021 & IS 302‐1:2008(Heating) |
- |
0 |
|
- |
| Cl.11.2 of IS 4159:2021(Heating) |
- |
0 |
|
- |
| Cl.11.101 of IS 4159:2021(Heating) |
- |
0 |
|
- |
| Cl.18 of IS 4159:2021(Endurance Test) |
- |
50 |
|
- |
| Cl.19.2 of IS 302-1: 2008(Abnormal Operation) |
- |
50 |
|
- |
| Cl.19.3 of IS 302-1: 2008(Abnormal Operation) |
- |
50 |
|
- |
| Cl.19.13 IS 302-1: 2008(Abnormal Operation) |
- |
50 |
|
- |
| Cl.19.13 IS 302-1: 2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19.13 IS 302-1: 2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.22.101 of IS 4159:2021(Construction) |
- |
50 |
|
- |
| Cl.22.102 of IS 4159:2021(Construction) |
- |
50 |
|
- |
| Cl.22.103 of IS 4159:2021(Construction) |
- |
50 |
|
- |
| Cl.22.104 of IS 4159:2021(Construction) |
- |
50 |
|
- |
| Cl.22.105 of IS 4159:2021(Construction) |
- |
50 |
|
- |
| Cl.22.106 of IS 4159:2021(Construction) |
- |
50 |
|
- |
| Cl.22.107 of IS 4159:2021(Construction) |
- |
50 |
|
- |
| Cl.22.108 of IS 4159:2021(Construction) |
- |
50 |
|
- |
| Cl.22.109 of IS 4159:2021(Construction) |
- |
50 |
|
- |
| Cl.22.110 of IS 4159:2021(Construction) |
- |
50 |
|
- |
| Cl.22.111 of IS 4159:2021(Construction) |
- |
50 |
|
- |
| Cl.27 & IS 302-1: 2008(Provision for Earthing) |
- |
1000 |
|
- |
| Cl.27 & IS 302-1: 2008(Provision for Earthing) |
- |
0 |
|
- |
| Cl.28.1 & IS 302-1: 2008(Screws & Connection) |
- |
100 |
|
- |
| Cl.28.4 IS 302-1: 2008(Screws & Connection) |
- |
100 |
|
- |
| Cl. 29.1 & IS 302-1: 2008(Creepage Distances & Clearances) |
- |
500 |
|
- |
| Cl. 29.2 & IS 302-1: 2009(Creepage Distances & Clearances) |
- |
50 |
|
- |
| "Cl. 6 IS 4159:2021"(Classification) |
- |
100 |
|
- |
| "Cl. 8 IS 4159:2021"(Protection against access to live parts) |
- |
500 |
|
- |
| "Cl. 9 IS 4159:2021"(Starting of motor operated appliances) |
- |
0 |
|
- |
| "Cl. 10 IS 4159:2021"(Power Input and Current) |
- |
1200 |
|
- |
| "Cl. 11 IS 4159:2021"(Heating) |
- |
1000 |
|
- |
| "Cl. 13 IS 4159:2021"(Leakage Current & Electrical Strength at Operating Temperature) |
- |
1000 |
|
- |
| "Cl. 14 IS 4159:2021"(Transient Over Voltage) |
- |
500 |
|
- |
| "Cl. 15 IS 4159:2021"(Moisture Resistance) |
- |
500 |
|
- |
| "Cl. 16 IS 4159:2021"(Leakage Current and Electric strength) |
- |
500 |
|
- |
| "Cl. 17 IS 4159:2021"(Overload protection of transformers and associated circuits.) |
- |
200 |
|
- |
| "Cl. 18 IS 4159:2021"(Endurance) |
- |
0 |
|
- |
| "Cl. 19 IS 4159:2021"(Abnormal Operation) |
- |
500 |
|
- |
| "Cl. 20 IS 4159:2021"(Stability and mechanical Hazards) |
- |
200 |
|
- |
| "Cl. 21 IS 4159:2021"(Mechanical Strength) |
- |
200 |
|
- |
| "Cl. 22 IS 4159:2021"(Construction) |
- |
500 |
|
- |
| "Cl. 23 IS 4159:2021"(Internal Wiring) |
- |
500 |
|
- |
| "Cl. 24 IS 4159:2021"(Components) |
- |
200 |
|
- |
| "Cl. 25 IS 4159:2021"(Supply Connections and External Flexible Cables and Cords) |
- |
500 |
|
- |
| "Cl. 26 IS 4159:2021"(Terminal For External Conductors) |
- |
200 |
|
- |
| "Cl. 27 IS 4159:2021"(Provision For Earthing) |
- |
500 |
|
- |
| "Cl. 28 IS 4159:2021"(Screws and Connections) |
- |
200 |
|
- |
| "Cl. 29 IS 4159:2021"(Creepage Distances, Clearances And Distances Through Insulation) |
- |
500 |
|
- |
| "Cl. 30 IS 4159:2021"(Resistance To Heat, Fire And Tracking) |
- |
500 |
|
- |
| "Cl. 31 IS 4159:2021"(Resistance To Rusting) |
- |
200 |
|
- |
| "Cl. 102 IS 4159:2021"(Leakage and hydrostatic strength (for oil heating elements)) |
- |
500 |
|
- |
| Cl.22.106(CONSTRUCTION) |
- |
50 |
|
- |
| Cl.7.1 of IS 4159:2021(Marking) |
- |
200 |
|
- |
| Cl.7.1 of IS 4159:2021(Marking) |
- |
0 |
|
- |
| Cl.7.1 of IS 4159:2021(Marking) |
- |
0 |
|
- |
| Cl.7.1 of IS 4159:2021(Marking) |
- |
0 |
|
- |
| Cl.7.1 of IS 4159:2021(Marking) |
- |
0 |
|
- |
| Cl.7.1 of IS 4159:2021(Marking) |
- |
0 |
|
- |
| Cl.7.2 of IS 4159:2021(Marking) |
- |
0 |
|
- |
| Cl.7.3 of IS 4159:2021(Marking) |
- |
0 |
|
- |
| Cl.10 of IS 302-1:2008(Power Input & Current) |
- |
0 |
|
- |
| Cl.11 of IS 4159:2021 & IS 302‐1:2008(Heating) |
- |
1000 |
|
- |
| Cl.11 of IS 4159:2021 & IS 302‐1:2008(Heating) |
- |
0 |
|
- |
| Cl.11.2 of IS 4159:2021(Heating) |
- |
0 |
|
- |
| Cl.11.101 of IS 4159:2021(Heating) |
- |
0 |
|
- |
| Cl.18 of IS 4159:2021(Endurance Test) |
- |
500 |
|
- |
| Cl.19.2 of IS 302-1: 2008(Abnormal Operation) |
- |
500 |
|
- |
| Cl.19.3 of IS 302-1: 2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19.13 IS 302-1: 2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19.13 IS 302-1: 2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.19.13 IS 302-1: 2008(Abnormal Operation) |
- |
0 |
|
- |
| Cl.22.101 of IS 4159:2021(Construction) |
- |
500 |
|
- |
| Cl.22.102 of IS 4159:2021(Construction) |
- |
0 |
|
- |
| Cl.22.103 of IS 4159:2021(Construction) |
- |
0 |
|
- |
| Cl.22.104 of IS 4159:2021(Construction) |
- |
0 |
|
- |
| Cl.22.105 of IS 4159:2021(Construction) |
- |
0 |
|
- |
| Cl.22.106 of IS 4159:2021(Construction) |
- |
0 |
|
- |
| Cl.22.107 of IS 4159:2021(Construction) |
- |
0 |
|
- |
| Cl.22.108 of IS 4159:2021(Construction) |
- |
0 |
|
- |
| Cl.22.109 of IS 4159:2021(Construction) |
- |
0 |
|
- |
| Cl.22.110 of IS 4159:2021(Construction) |
- |
0 |
|
- |
| Cl.22.111 of IS 4159:2021(Construction) |
- |
0 |
|
- |
| Cl.27 & IS 302-1: 2008(Provision for Earthing) |
- |
500 |
|
- |
| Cl.27 & IS 302-1: 2008(Provision for Earthing) |
- |
0 |
|
- |
| Cl.28.1 & IS 302-1: 2008(Screws & Connection) |
- |
200 |
|
- |
| Cl.28.4 IS 302-1: 2008(Screws & Connection) |
- |
0 |
|
- |
| Cl. 29.1 & IS 302-1: 2008(Creepage Distances & Clearances) |
- |
500 |
|
- |
| Cl. 29.2 & IS 302-1: 2009(Creepage Distances & Clearances) |
- |
0 |
|
- |
|
03 Oct, 2027 |
- Included.w.e.f.26.11.2024 Exclusion - 19.11.4.1 to 19.11.4.7 (EMI/EMC) |