| 8221 |
Kailtech Test and Research Centre Pvt. Ltd., Indore
| 8125636
| IS 1812 (1982) |
Specification for carbon steel wire for the manufacture of wood screws (Second Revision) |
all |
20000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl. 5.1(Carbon- IS 228 and relevant parts or any other established Instrumental/Chemical method.) |
- |
2000 |
|
- |
| Cl. 5.1(Manganese- IS 228 and relevant parts or any other established Instrumental/Chemical method.) |
- |
2000 |
|
- |
| Cl. 5.1(Sulphur- IS 228 and relevant parts or any other established Instrumental/Chemical method.) |
- |
2000 |
|
- |
| Cl. 5.1(Phosphorus- IS 228 and relevant parts or any other established Instrumental/Chemical method.) |
- |
2000 |
|
- |
| Cl. 5.1(Silicon- IS 228 and relevant parts or any other established Instrumental/Chemical method.) |
- |
2000 |
|
- |
| 6.1( Tensile Test IS1608(P-1)) |
- |
5000 |
|
- |
| 6.2( Bend Test ) |
- |
2000 |
|
- |
| 6.3( Wrapping Test ) |
- |
2000 |
|
- |
| 7(. SIZE TOLERANCE) |
- |
1000 |
|
- |
| 8( FREEDOM FROM DEFECTS) |
- |
1000 |
|
- |
|
18 Dec, 2027 |
- Included w.e.f 10.10.2024 |
| 8222 |
Kailtech Test and Research Centre Pvt. Ltd., Indore
| 8125636
| IS 1673 (1984) |
Spectfication for mild steel wire, cold heading quality (Second Revision) |
All |
15000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl. 5.1(Carbon- IS 228 and relevant parts or any other established Instrumental/Chemical method.) |
- |
2000 |
|
- |
| Cl. 5.1(Manganese- IS 228 and relevant parts or any other established Instrumental/Chemical method.) |
- |
2000 |
|
- |
| Cl. 5.1(Sulphur- IS 228 and relevant parts or any other established Instrumental/Chemical method.) |
- |
2000 |
|
- |
| Cl. 5.1(Phosphorus- IS 228 and relevant parts or any other established Instrumental/Chemical method.) |
- |
2000 |
|
- |
| Cl. 5.1(Silicon- IS 228 and relevant parts or any other established Instrumental/Chemical method.) |
- |
2000 |
|
- |
| 6(FREEDOM FROM DEFECTS) |
- |
1000 |
|
- |
| 7.2(ii) Reverse Torsion Test) |
- |
2000 |
|
- |
| 7.3(iii) Crushing Test) |
- |
1000 |
|
- |
| 8( DIMENSIONS AND TOLERANCES) |
- |
1000 |
|
- |
| 7.1(i)Ultimate Tensile Strength,) |
- |
3000 |
|
- |
|
18 Dec, 2027 |
- Included w.e.f 10.10.2024 |
| 8223 |
Kailtech Test and Research Centre Pvt. Ltd., Indore
| 8125636
| IS 16732 (2019) |
Galvanized structural steel - Specification |
Excluding Y Groove Groove Crackability Test for Round Bars for Grade E 250C more than 12 mm |
15000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 4(Supply of material) |
- |
0 |
|
- |
| 5(Grades) |
- |
0 |
|
- |
| 6(Manufacture) |
- |
0 |
|
- |
| 7.1(Black material) |
- |
1000 |
|
- |
| 7.2(Galvanized steel) |
- |
0 |
|
- |
| 8.1(Ladle Analys) |
- |
0 |
|
- |
| 8.2(Product Analysis) |
- |
5000 |
|
- |
| 9.1(Quality of Zinc) |
- |
0 |
|
- |
| 9.2(Mass of Zinc Coating) |
- |
1000 |
|
- |
| 11.1(Tensile Test Pieces) |
- |
1000 |
|
- |
| 11.2(Tensile Test) |
- |
1000 |
|
- |
| 12.1(Bend Test Piece) |
- |
1000 |
|
- |
| 12.2(Bend Test) |
- |
1000 |
|
- |
| 13(Impact test) |
- |
2000 |
|
- |
| 15.1(Mass of Galvanized Coating) |
- |
0 |
|
- |
| 15.2(Determination of Uniformity of Galvanized) |
- |
1000 |
|
- |
| 15.3(Thickness of Zinc Coating) |
- |
1000 |
|
- |
| 16(Dimensions and Tolerances) |
- |
4000 |
|
- |
| 17(Fabrication and tolerances) |
- |
0 |
|
- |
| 18(Other optional test) |
- |
0 |
|
- |
| 21(Marking) |
- |
0 |
|
- |
| 15.4(Adhesion of Galvanized Coating) |
- |
1000 |
|
- |
| 4(Supply of material) |
- |
0 |
|
- |
| 5(Grades) |
- |
0 |
|
- |
| 6(Manufacture) |
- |
0 |
|
- |
| 7.1(Black material) |
- |
0 |
|
- |
| 7.2(Galvanized steel) |
- |
0 |
|
- |
| 8.1(Ladle Analys) |
- |
0 |
|
- |
| 8.2(Product Analysis) |
- |
0 |
|
- |
| 9.1(Quality of Zinc) |
- |
0 |
|
- |
| 9.2(Mass of Zinc Coating) |
- |
0 |
|
- |
| 11.1(Tensile Test Pieces) |
- |
0 |
|
- |
| 11.2(Tensile Test) |
- |
0 |
|
- |
| 12.1(Bend Test Piece) |
- |
0 |
|
- |
| 12.2(Bend Test) |
- |
0 |
|
- |
| 13(Impact test) |
- |
0 |
|
- |
| 15.1(Mass of Galvanized Coating) |
- |
0 |
|
- |
| 15.2(Determination of Uniformity of Galvanized) |
- |
0 |
|
- |
| 15.3(Thickness of Zinc Coating) |
- |
0 |
|
- |
| 16(Dimensions and Tolerances) |
- |
0 |
|
- |
| 17(Fabrication and tolerances) |
- |
0 |
|
- |
| 18(Other optional test) |
- |
0 |
|
- |
| 21(Marking) |
- |
0 |
|
- |
| 15.4(Adhesion of Galvanized Coating) |
- |
0 |
|
- |
|
18 Dec, 2027 |
- Included w.e.f 10.10.2024
Excluding 14 (Y groove crackability test) |
| 8224 |
Kailtech Test and Research Centre Pvt. Ltd., Indore
| 8125636
| IS 2385 (1977) |
Specification for hot - Rolled mild steel sheet and strip in coil form for cold - Reduced tinplate and cold - Reduced blackplate (First Revision) |
All |
12000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl. 5.1, 5.2 & Table1(Carbon- Appropriate parts of IS 228 or any other established Instrumental/Chemical method.) |
- |
2000 |
|
- |
| Cl. 5.1, 5.2 & Table1(Manganese- Appropriate parts of IS 228 or any other established Instrumental/Chemical method.) |
- |
1500 |
|
- |
| Cl. 5.1, 5.2 & Table1(Sulphur- Appropriate parts of IS 228 or any other established Instrumental/Chemical method.) |
- |
1500 |
|
- |
| Cl. 5.1, 5.2 & Table1(Phosphorus- Appropriate parts of IS 228 or any other established Instrumental/Chemical method.) |
- |
1500 |
|
- |
| Cl. 5.1, 5.2 & Table1(Nitrogen- Appropriate parts of IS 228 or any other established Instrumental/Chemical method.) |
- |
2000 |
|
- |
| Cl. 5.1, 5.2 & Table1(Aluminium- Appropriate parts of IS 228 or any other established Instrumental/Chemical method.) |
- |
1500 |
|
- |
| 6(Freedom from defects) |
- |
1000 |
|
- |
| 8(Dimensions and Tolerances) |
- |
500 |
|
- |
| Cl. 5.1, 5.2(chromium) |
- |
1500 |
|
- |
| Cl. 5.1, 5.2(silicon) |
- |
1500 |
|
- |
| Cl. 5.1, 5.2(copper) |
- |
1500 |
|
- |
| Cl. 5.1, 5.2(aluminium) |
- |
0 |
|
- |
| Cl. 5.1, 5.2(Nitrogen ) |
- |
0 |
|
- |
| Cl. 5.1, 5.2(Phosphorus) |
- |
0 |
|
- |
| Cl. 5.1, 5.2(Sulphur) |
- |
0 |
|
- |
| Cl. 5.1, 5.2(Manganese) |
- |
0 |
|
- |
| Cl. 5.1, 5.2(carbon) |
- |
0 |
|
- |
|
18 Dec, 2027 |
- Included w.e.f 10.10.2024 |
| 8225 |
Kailtech Test and Research Centre Pvt. Ltd., Indore
| 8125636
| IS 1029 (1970) |
Specification for hot-rolled steel strip (Baling) (First Revision) |
All |
15000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Cl.4(Sulphur -IS 228 or method specified in relevant ISO standard) |
- |
3000 |
|
- |
| Cl.4(Phosphorus -IS 228 or method specified in relevant ISO standard) |
- |
3000 |
|
- |
| 5.2(Tensile Test-1608:Part 1) |
- |
4000 |
|
- |
| 5.2(Tensile Strength, Mpa) |
- |
2000 |
|
Elongation |
| 5.2(Elongation, %) |
- |
2000 |
|
- |
| 5.3(Bend Test-1599) |
- |
1000 |
|
- |
| 7.1(Freedom from defects) |
- |
1000 |
|
- |
| 8.2(Width) |
- |
1000 |
|
- |
| 8.2(Thickness) |
- |
1000 |
|
- |
| 9.1(Finishing & Packing) |
- |
0 |
|
- |
| 10(Marking) |
- |
0 |
|
- |
| Cl.4(Sulphur -IS 228 or method specified in relevant ISO standard) |
- |
0 |
|
- |
| Cl.4(Phosphorus -IS 228 or method specified in relevant ISO standard) |
- |
0 |
|
- |
| 5.2(Tensile Test-1608:Part 1) |
- |
0 |
|
- |
| 5.2(Tensile Strength, Mpa) |
- |
0 |
|
- |
| 5.2(Elongation, %) |
- |
0 |
|
- |
| 5.3(Bend Test-1599) |
- |
0 |
|
- |
| 7.1(Freedom from defects) |
- |
0 |
|
- |
| 8.2(Width) |
- |
0 |
|
- |
| 8.2(Thickness) |
- |
0 |
|
- |
| 9.1(Finishing & Packing) |
- |
0 |
|
- |
| 10(Marking) |
- |
0 |
|
- |
|
18 Dec, 2027 |
- Included w.e.f 10.10.2024 |
| 8226 |
Sleen India Biz venture Private Limited, Agra
| 9139736
| IS 878 (2008) |
Laboratory glassware - Graduated measuring cylinders (Second Revision) |
Type 1 a,Type 1b,Type 2 |
14500 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Table-1(Nominal capacity) |
- |
1000 |
|
- |
| Table-1(Overall height) |
- |
500 |
|
- |
| Table-1(Distance from top of scale to top of cylinder) |
- |
500 |
|
- |
| Table-1(Internal height to highest graduation line) |
- |
500 |
|
- |
| Table-1(Sub-divisions) |
- |
500 |
|
- |
| Table-1(capacity at lowest graduation line) |
- |
500 |
|
- |
| Cl-9.1(Wall thickness) |
- |
500 |
|
- |
| Cl-9.2(Stability) |
- |
500 |
|
- |
| Cl-9.3(Base) |
- |
500 |
|
- |
| Cl-9.4(Rim and spout) |
- |
500 |
|
- |
| Cl-9.5(Neck and stopper) |
- |
500 |
|
- |
| Cl-9.6, Table-2(Nominal capacity) |
- |
1000 |
|
- |
| Cl-9.6, Table-2(Overall height) |
- |
500 |
|
- |
| Cl-9.6, Table-2(Distance from top of scale to top of cylinder) |
- |
500 |
|
- |
| Cl-9.6, Table-2(Internal height to highest graduation line) |
- |
500 |
|
- |
| Cl-9.6, Table-2(Sub divisions) |
- |
500 |
|
- |
| Cl-9.6, Table-2(capacity at lowest graduation line) |
- |
500 |
|
- |
| Cl-10.1(Graduation) |
- |
500 |
|
- |
| Cl-10.2(Figuring) |
- |
500 |
|
- |
| Cl-11(Accuracy testing) |
- |
1000 |
|
- |
| Cl-13(Visibility of graduation lines, figures and marking) |
- |
500 |
|
- |
| Clause. 8.0(Material) |
- |
4000 |
|
- |
| Table- 1(Max. Permissible Error (Class- a)) |
- |
500 |
|
- |
| Table- 1(Max. Permissible Error (Class- b)) |
- |
500 |
|
- |
| Table- 2(Max. Permissible Error (Type-2)) |
- |
500 |
|
- |
| Table-1(capacity at lowest graduation line) |
- |
0 |
|
Repeated Clause. |
| Cl-9.1(Wall thickness) |
- |
0 |
|
Repeated Clause. |
| Cl-9.2(Stability) |
- |
0 |
|
Repeated Clause. |
| Cl-9.3(Base) |
- |
0 |
|
Repeated Clause. |
| Cl-9.4(Rim and spout) |
- |
0 |
|
Repeated Clause. |
| Cl-9.5(Neck and stopper) |
- |
0 |
|
Repeated Clause. |
| Cl-9.6, Table-2(Nominal capacity) |
- |
0 |
|
Repeated Clause. |
| Cl-9.6, Table-2(Overall height) |
- |
0 |
|
Repeated Clause. |
| Cl-9.6, Table-2(Distance from top of scale to top of cylinder) |
- |
0 |
|
Repeated Clause. |
| Cl-9.6, Table-2(Internal height to highest graduation line) |
- |
0 |
|
Repeated Clause. |
| Cl-9.6, Table-2(Sub divisions) |
- |
0 |
|
Repeated Clause. |
| Cl-9.6, Table-2(capacity at lowest graduation line) |
- |
0 |
|
Repeated Clause. |
| Cl-10.1(Graduation) |
- |
0 |
|
Repeated Clause. |
| Cl-10.2(Figuring) |
- |
0 |
|
Repeated Clause. |
| Cl-11(Accuracy testing) |
- |
0 |
|
Repeated Clause. |
| Cl-13(Visibility of graduation lines, figures and marking) |
- |
0 |
|
Repeated Clause. |
| Clause. 8.0(Material) |
- |
0 |
|
Repeated Clause. |
| Table- 1(Max. Permissible Error (Class- a)) |
- |
0 |
|
Repeated Clause. |
| Table- 1(Max. Permissible Error (Class- b)) |
- |
0 |
|
Repeated Clause. |
| Table- 2(Max. Permissible Error (Type-2)) |
- |
0 |
|
Repeated Clause. |
| Table-1(capacity at lowest graduation line) |
- |
0 |
|
Repeated Clause. |
| Cl-9.1(Wall thickness) |
- |
0 |
|
Repeated Clause. |
| Cl-9.2(Stability) |
- |
0 |
|
Repeated Clause. |
| Cl-9.3(Base) |
- |
0 |
|
Repeated Clause. |
| Cl-9.4(Rim and spout) |
- |
0 |
|
Repeated Clause. |
| Cl-9.5(Neck and stopper) |
- |
0 |
|
Repeated Clause. |
| Cl-9.6, Table-2(Nominal capacity) |
- |
0 |
|
Repeated Clause. |
| Cl-9.6, Table-2(Overall height) |
- |
0 |
|
Repeated Clause. |
| Cl-9.6, Table-2(Distance from top of scale to top of cylinder) |
- |
0 |
|
Repeated Clause. |
| Cl-9.6, Table-2(Internal height to highest graduation line) |
- |
0 |
|
Repeated Clause. |
| Cl-9.6, Table-2(Sub divisions) |
- |
0 |
|
Repeated Clause. |
| Cl-9.6, Table-2(capacity at lowest graduation line) |
- |
0 |
|
Repeated Clause. |
| Cl-10.1(Graduation) |
- |
0 |
|
Repeated Clause. |
| Cl-10.2(Figuring) |
- |
0 |
|
Repeated Clause. |
| Cl-11(Accuracy testing) |
- |
0 |
|
Repeated Clause. |
| Cl-13(Visibility of graduation lines, figures and marking) |
- |
0 |
|
Repeated Clause. |
| Clause. 8.0(Material) |
- |
0 |
|
Repeated Clause. |
| Table- 1(Max. Permissible Error (Class- a)) |
- |
0 |
|
Repeated Clause. |
| Table- 1(Max. Permissible Error (Class- b)) |
- |
0 |
|
Repeated Clause. |
| Table- 2(Max. Permissible Error (Type-2)) |
- |
0 |
|
Repeated Clause. |
| Table-1(capacity at lowest graduation line) |
- |
0 |
|
Repeated Clause. |
| Cl-9.1(Wall thickness) |
- |
0 |
|
Repeated Clause. |
| Cl-9.2(Stability) |
- |
0 |
|
Repeated Clause. |
| Cl-9.3(Base) |
- |
0 |
|
Repeated Clause. |
| Cl-9.4(Rim and spout) |
- |
0 |
|
Repeated Clause. |
| Cl-9.5(Neck and stopper) |
- |
0 |
|
Repeated Clause. |
| Cl-9.6, Table-2(Nominal capacity) |
- |
0 |
|
Repeated Clause. |
| Cl-9.6, Table-2(Overall height) |
- |
0 |
|
Repeated Clause. |
| Cl-9.6, Table-2(Distance from top of scale to top of cylinder) |
- |
0 |
|
Repeated Clause. |
| Cl-9.6, Table-2(Internal height to highest graduation line) |
- |
0 |
|
Repeated Clause. |
| Cl-9.6, Table-2(Sub divisions) |
- |
0 |
|
Repeated Clause. |
| Cl-9.6, Table-2(capacity at lowest graduation line) |
- |
0 |
|
Repeated Clause. |
| Cl-10.1(Graduation) |
- |
0 |
|
Repeated Clause. |
| Cl-10.2(Figuring) |
- |
0 |
|
Repeated Clause. |
| Cl-11(Accuracy testing) |
- |
0 |
|
Repeated Clause. |
| Cl-13(Visibility of graduation lines, figures and marking) |
- |
0 |
|
Repeated Clause. |
| Clause. 8.0(Material) |
- |
0 |
|
Repeated Clause. |
| Table- 1(Max. Permissible Error (Class- a)) |
- |
0 |
|
Repeated Clause. |
| Table- 1(Max. Permissible Error (Class- b)) |
- |
0 |
|
Repeated Clause. |
| Table- 2(Max. Permissible Error (Type-2)) |
- |
0 |
|
Repeated Clause. |
|
- |
- Included w.e.f 28.07.2025 |
| 8227 |
Ahmedabad Textile Industry's Research Association (ATIRA), Ahmedabad
| 7173002
| IS 17355 (2020) |
Agro textiles – Propylene spun bonded non-woven mulch mat for agricultural and horticultural applications - Specification |
- |
18010 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Clause no. 6.1 & 8.3, Table-1 (i)(Lengthwise) |
- |
200 |
|
- |
| Clause no. 6.1 & 8.3, Table-1 (ii)(Width) |
- |
200 |
|
- |
| Clause no. 6.1 & 8.3, Table-1 (iii)(Mass) |
- |
450 |
|
- |
| Clause no. 6.1 & 8.3, Table-1 (iv)(Thickness) |
- |
450 |
|
- |
| Clause no. 6.1 & 8.3, Table-1 (v) a)(Tensile Strength, Machine Direction) |
- |
450 |
|
- |
| Clause no. 6.1 & 8.3, Table-1 (v) b)(Tensile Strength, Cross Direction) |
- |
450 |
|
- |
| Clause no. 6.1 & 8.3, Table-1 (vi) a)(Elongation, Machine Dir.) |
- |
0 |
|
- |
| Clause no. 6.1 & 8.3, Table-1 (vi) b)(Elongation, Cross Dir.) |
- |
0 |
|
- |
| Clause no. 6.1 & 8.3, Table-1 (vii) a)(UV stability, retained strength after UV exposure, Machine Dir.) |
- |
13860 |
|
- |
| Clause no. 6.1 & 8.3, Table-1 (vii) b)(UV stability, retained strength after UV exposure, Cross Dir.) |
- |
0 |
|
- |
| Clause no. 6.1 & 8.3, Table-1 (viii)(Colour) |
- |
200 |
|
- |
| Clause no. 6.1 & 8.3, Table-1 (ix)(Ash Content) |
- |
650 |
|
- |
| Clause no. 6.1 & 8.3, Table-1 (x) a)(Trapezoid Tear Strength, Machine Direction) |
- |
450 |
|
- |
| Clause no. 6.1 & 8.3, Table-1 (x) b)(Trapezoid Tear Strength, Cross Direction) |
- |
450 |
|
- |
| Clause No. 4-(a)(Mass) |
- |
200 |
|
- |
| Clause No. 4-(b)(Mass) |
- |
0 |
|
- |
| Clause No. 5(Conditioning and Testing) |
- |
0 |
|
- |
| Clause No. 6.1 (i)(Length, m) |
- |
0 |
|
- |
| Clause No. 6.1 (ii)(Width, m) |
- |
0 |
|
- |
| Clause No. 6.1 (iii)(Mass, g/m²) |
- |
0 |
|
- |
| Clause No. 6.1 (iv)(Thickness, mm) |
- |
0 |
|
- |
| Clause No. 6.1 (v)(Tensile strength, N/5 cm) |
- |
0 |
|
- |
| Clause No. 6.1 (vi)(Elongation, percent) |
- |
0 |
|
- |
| Clause No. 6.1 (vii)(UV stability, retained strength after 144 h exposure, percent, (machine direction and cross direction)) |
- |
0 |
|
- |
| Clause No. 6.1 (viii)(Colour) |
- |
0 |
|
- |
| Clause No. 6.1 (ix)(Ash content, percent) |
- |
0 |
|
- |
| Clause No. 6.1 (x)(Trapezoid tear strength) |
- |
0 |
|
- |
| 4("Mulch Mat Types - a) Type 1 . — Mulch mat of minimum 50 g/m²
b) Type 2 . — Mulch mat of minimum 70 g/m²") |
- |
0 |
|
- |
| 5(CONDITIONING AND TESTING) |
- |
0 |
|
- |
| 6.1-Table 1- i)(REQUIREMENTS - Length, m) |
- |
0 |
|
- |
| 6.1-Table 1- ii)(REQUIREMENTS - Width, m) |
- |
0 |
|
- |
| 6.1-Table 1- iii)(REQUIREMENTS - Mass, g/m²) |
- |
0 |
|
- |
| 6.1-Table 1- iv)(REQUIREMENTS - Thickness, mm) |
- |
0 |
|
- |
| 6.1-Table 1- v)(REQUIREMENTS - Tensile strength, N/5 cm a)Machine Direction b)Cross direction) |
- |
0 |
|
- |
| 6.1-Table 1- vi)(REQUIREMENTS - Elongation, percent a)Machine Direction b)Cross direction) |
- |
0 |
|
- |
| 6.1-Table 1- vii)(REQUIREMENTS - UV stability, retained strength after 144 h exposure, percent, Min (machine direction and cross direction)) |
- |
0 |
|
- |
| 6.1-Table 1- viii)(REQUIREMENTS - Colour) |
- |
0 |
|
- |
| 6.1-Table 1- ix)(REQUIREMENTS - Ash content, percent) |
- |
0 |
|
- |
| 6.1-Table 1- x)(REQUIREMENTS - Trapezoid tear strength a)Machine Direction b)Cross direction) |
- |
0 |
|
- |
|
- |
- Included w.e.f 12.03.2025
Exclusion: Clause No. 7.1 (Length and Thickness of Mulch Mat) |
| 8228 |
BIS, Northern Regional Laboratory (NRL)
| None
| IS 14650 (2023) |
UNALLOYED AND ALLOYED STEEL INGOT AND SEMI-FINISHED PRODUCTS FOR RE-ROLLING PURPOSES - SPECIFICATION (First Revision) |
- |
- View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Clause - 7.1 (CARBON) |
- |
|
|
|
| Clause - 7.1 (SULPHUR) |
- |
|
|
|
| Clause - 7.1 (PHOSPHURS) |
- |
|
|
|
| Clause - 7.1 (MANGANESE) |
- |
|
|
|
| Clause - 7.1 (NITROGEN) |
- |
|
|
|
| Clause.7.1 (Carbon Equbalant) |
- |
|
|
|
| Clause.7.1 (Silicon) |
- |
|
|
|
| Clause.7.1 (Microalloy element) |
- |
|
|
|
|
- |
- except optional tests |
| 8229 |
BIS, Northern Regional Laboratory (NRL)
| None
| IS 9537 : Part 8 (2003) |
Conduits for electrical installations - Specification: Part 8 rigid non - Threadable conduits of aluminium alloy |
- |
2550/- View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Clause No. 7 (Testing Dimensions) |
- |
|
|
|
| Clause No. 7 (Testing Dimensions) |
- |
|
|
|
| Clause No. 8 (construction) |
- |
|
|
|
| clause No. 9.3 (Compression Test) |
- |
|
|
|
|
- |
- Complete facility available |
| 8230 |
Sleen India Biz venture Private Limited, Agra
| 9139736
| IS 1381 : Part 2 (2019) |
Laboratory glassware - Boiling flasks: Part 2 boiling flasks with conical ground joints (Third Revision) |
Conical flask,Flat-bottom flask,Round-bottom flask |
16000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 3(Type) |
- |
1000 |
|
- |
| 4(Series of capacities) |
- |
2000 |
|
- |
| 5(Material) |
- |
4000 |
|
- |
| 5(Material) |
- |
4000 |
|
- |
| 6(Dimensions) |
- |
1500 |
|
- |
| 6(Dimensions) |
- |
1500 |
|
- |
| 6(Dimensions) |
- |
1500 |
|
- |
| 6(Dimensions) |
- |
1500 |
|
- |
| 7(Ground glass joints) |
- |
500 |
|
- |
| 8(Thermal shock endurance) |
- |
3000 |
|
- |
| 9(Marking) |
- |
500 |
|
- |
| 9(Marking) |
- |
500 |
|
- |
| 9(Marking) |
- |
500 |
|
- |
| 9(Marking) |
- |
500 |
|
- |
| 3(Type) |
- |
0 |
|
- |
| 4(Series of capacities) |
- |
0 |
|
- |
| 5(Material) |
- |
0 |
|
- |
| 5(Material) |
- |
0 |
|
- |
| 6(Dimensions) |
- |
0 |
|
- |
| 6(Dimensions) |
- |
0 |
|
- |
| 6(Dimensions) |
- |
0 |
|
- |
| 6(Dimensions) |
- |
0 |
|
- |
| 7(Ground glass joints) |
- |
0 |
|
- |
| 8(Thermal shock endurance) |
- |
0 |
|
- |
| 9(Marking) |
- |
0 |
|
- |
| 9(Marking) |
- |
0 |
|
- |
| 9(Marking) |
- |
0 |
|
- |
| 9(Marking) |
- |
0 |
|
- |
| 3(Type) |
- |
0 |
|
Repeated Clause. |
| 4(Series of capacities) |
- |
0 |
|
Repeated Clause. |
| 5(Material) |
- |
0 |
|
Repeated Clause. |
| 5(Material) |
- |
0 |
|
Repeated Clause. |
| 6(Dimensions) |
- |
0 |
|
Repeated Clause. |
| 6(Dimensions) |
- |
0 |
|
Repeated Clause. |
| 6(Dimensions) |
- |
0 |
|
Repeated Clause. |
| 6(Dimensions) |
- |
0 |
|
Repeated Clause. |
| 7(Ground glass joints) |
- |
0 |
|
Repeated Clause. |
| 8(Thermal shock endurance) |
- |
0 |
|
Repeated Clause. |
| 9(Marking) |
- |
0 |
|
Repeated Clause. |
| 9(Marking) |
- |
0 |
|
Repeated Clause. |
| 9(Marking) |
- |
0 |
|
Repeated Clause. |
| 9(Marking) |
- |
0 |
|
Repeated Clause. |
| 3(Type) |
- |
0 |
|
Repeated Clause. |
| 4(Series of capacities) |
- |
0 |
|
Repeated Clause. |
| 5(Material) |
- |
0 |
|
Repeated Clause. |
| 5(Material) |
- |
0 |
|
Repeated Clause. |
| 6(Dimensions) |
- |
0 |
|
Repeated Clause. |
| 6(Dimensions) |
- |
0 |
|
Repeated Clause. |
| 6(Dimensions) |
- |
0 |
|
Repeated Clause. |
| 6(Dimensions) |
- |
0 |
|
Repeated Clause. |
| 7(Ground glass joints) |
- |
0 |
|
Repeated Clause. |
| 8(Thermal shock endurance) |
- |
0 |
|
Repeated Clause. |
| 9(Marking) |
- |
0 |
|
Repeated Clause. |
| 9(Marking) |
- |
0 |
|
Repeated Clause. |
| 9(Marking) |
- |
0 |
|
Repeated Clause. |
| 9(Marking) |
- |
0 |
|
Repeated Clause. |
|
- |
- Included w.e.f 18.12.2024
Excluding : Cl 5 Material test |
| 8231 |
ACE TEST LAB PRIVATE LIMITED (8166826), DELHI
| 8166826
| IS 302 : Part 1 (2008) |
Safety of household and similar electrical appliances: Part 1 general requirements (Sixth Revision) |
- |
40000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 6(Classification- IS 302-1) |
- |
500 |
|
OK |
| 7(Marking and instructions) |
- |
500 |
|
OK |
| 8.1.1(Protection against live parts in all positions) |
- |
500 |
|
OK |
| 8.1.2(Protection against live parts in openings) |
- |
500 |
|
OK |
| 8.1.3(Protection against live parts in visible glowing heating elements) |
- |
500 |
|
OK |
| 8.1.4(Protection against live parts against protective impedance) |
- |
500 |
|
OK |
| 9(Starting of motor operation test requirements and tests) |
- |
2000 |
|
OK |
| 10.1(Power input) |
- |
2500 |
|
OK |
| 10.2(Current input) |
- |
2000 |
|
OK |
| 11.3(Heating) |
- |
4000 |
|
OK |
| 13.2(Leakage current at operating temperature) |
- |
1500 |
|
OK |
| 13.3(Electric Strength at operating temperature) |
- |
500 |
|
OK |
| 14(Transient Over Voltages) |
- |
500 |
|
OK |
| 15.1(Ingress Protection test other than IPX0 (IP test)) |
- |
5000 |
|
OK |
| 15.2(Spillage Test) |
- |
500 |
|
OK |
| 15.3(Humidity Test) |
- |
1000 |
|
OK |
| 16.2(Leakage Current (after Clause 15)) |
- |
5500 |
|
OK |
| 16.3(Electric Strength (after clause 15 and 16.2)) |
- |
500 |
|
OK |
| 17(Over Load Protection of Transformers and associated circuits) |
- |
500 |
|
OK |
| 19(Abnormal Operation) |
- |
500 |
|
OK |
| 20(Stability test) |
- |
500 |
|
OK |
| 21(Mechanical Strength Test) |
- |
500 |
|
OK |
| 22(Construction verification related test) |
- |
500 |
|
OK |
| 23(General) |
- |
500 |
|
OK |
| 25(Supply connection and external flexible cords) |
- |
500 |
|
OK |
| 26(Terminals for external conductors) |
- |
500 |
|
OK |
| 27(Provision for earthing) |
- |
500 |
|
OK |
| 28(Screw test and connections) |
- |
500 |
|
OK |
| 29(clearance, creepage distances and solid insulation) |
- |
500 |
|
OK |
| 30.1(Ball pressure test) |
- |
500 |
|
OK |
| 30.2(Glow Wire Test) |
- |
500 |
|
OK |
| 31(Resistance to Rusting) |
- |
500 |
|
OK |
| 11.1(General) |
- |
500 |
|
OK |
| 11.2(General) |
- |
500 |
|
OK |
| 11.4(Heating appliances) |
- |
1000 |
|
OK |
| 11.5(Motor-operated appliances) |
- |
500 |
|
OK |
| 11.6(Combined appliances) |
- |
500 |
|
OK |
| 11.7(Duration corresponding) |
- |
500 |
|
OK |
| 11.8(Temperature rise) |
- |
1000 |
|
OK |
|
- |
- 32 (Radiation Toxicity and Similar Hazards)
"(1)Cooking ranges, hobs, ovens and similar appliances, (2)Commercial Dispensing Appliances and Vending Machines, (3) spin extractors
(For testing charges please refer relevant Part 2 standard in LIMS)" |
| 8232 |
ACE TEST LAB PRIVATE LIMITED (8166826), DELHI
| 8166826
| IS 16333 : Part 3 (2022) |
Mobile phone handsets: Part 3 Indian language support for mobile phone handsets - Specific requirements(Second Revision) |
- |
15000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 5.1(Inputting of text) |
- |
8000 |
|
- |
| 5.2(Message Readability) |
- |
5000 |
|
- |
| 6(Marking) |
- |
2000 |
|
- |
| 5.1(Inputting of text) |
- |
8000 |
|
- |
| 5.2(Message Readability) |
- |
5000 |
|
- |
| 6(Marking) |
- |
2000 |
|
- |
|
- |
- - |
| 8233 |
ACE TEST LAB PRIVATE LIMITED (8166826), DELHI
| 8166826
| IS 16221 : Part 2 (2015) |
Safety of power converters for use in photovoltaic power systems: Part 2 particular requirements for inverters |
- |
150000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| Clause No. 4.3(Thermal testing) |
- |
4000 |
|
- |
| Clause No. 4.4(Testing in single fault condition) |
- |
4000 |
|
- |
| 4.5(Humidity preconditioning) |
- |
4000 |
|
- |
| 4.6(Backfeed voltage protection) |
- |
4000 |
|
- |
| 4.7(Electrical rating tests) |
- |
4000 |
|
- |
| 4.8(Additional tests for grid interactive inverters) |
- |
4000 |
|
- |
| 4(General Test Requirements) |
- |
4000 |
|
- |
| 5(Marking and documentation) |
- |
4000 |
|
- |
| 6(Environmental requirements and conditions) |
- |
4000 |
|
- |
| 7(Protection against electric shock and energy hazards) |
- |
4000 |
|
- |
| 8(Protection against Mechanical Hazards) |
- |
4000 |
|
- |
| 9(Protection against Fire Hazards) |
- |
4000 |
|
- |
| 10(Protection against Sonic Pressure Hazards) |
- |
4000 |
|
- |
| 11(Protection against Liquid Hazards) |
- |
4000 |
|
- |
| 12(Protection against Chemical Hazards) |
- |
4000 |
|
- |
| 13(Physical Requirements) |
- |
4000 |
|
- |
| 14(Components) |
- |
4000 |
|
- |
| 4.4.4.15.1(Fault-tolerance of residual current monitoring) |
- |
4000 |
|
- |
| 4.4.4.15.2(Fault-tolerance of automatic disconnecting means) |
- |
4000 |
|
- |
| 4.4.4.16(Stand-alone inverters – Load transfer test) |
- |
4000 |
|
- |
| 4.4.4.17(Cooling system failure – Blanketing test) |
- |
4000 |
|
- |
| 4.7.3(Measurement requirements for AC output ports for stand-alone inverters) |
- |
4000 |
|
- |
| 4.7.4(Stand-alone Inverter AC output voltage and frequency) |
- |
4000 |
|
- |
| 4.7.4.2(Steady state output voltage at nominal DC input) |
- |
4000 |
|
- |
| 4.7.4.3(Steady state output voltage across the DC input range) |
- |
4000 |
|
- |
| 4.7.4.4(Load step response of the output voltage at nominal DC input) |
- |
4000 |
|
- |
| 4.7.4.5(Steady state output frequency) |
- |
4000 |
|
- |
| 4.7.5(Stand-alone inverter output voltage waveform) |
- |
4000 |
|
- |
| 4.7.5.2(Sinusoidal output voltage waveform requirements) |
- |
4000 |
|
- |
| 4.7.5.3(Non-sinusoidal output waveform requirements) |
- |
4000 |
|
- |
| 4.7.5.5(Output voltage waveform requirements for inverters for dedicated loads) |
- |
3000 |
|
- |
| 4.8.2.1(Array insulation resistance detection for inverters for ungrounded arrays) |
- |
3000 |
|
- |
| 4.8.2.2(Array insulation resistance detection for inverters for functionally grounded arrays) |
- |
3000 |
|
- |
| 4.8.3.2(30 mA touch current type test for isolated inverters) |
- |
3000 |
|
- |
| 4,8.3.3(Fire hazard residual current type test for isolated inverters) |
- |
3000 |
|
- |
| 4.8.3.5(Protection by residual current monitoring) |
- |
3000 |
|
- |
| 7.3.10(Additional requirements for stand-alone inverters) |
- |
3000 |
|
- |
| 9.3.4(Inverter backfeed current onto the array) |
- |
3000 |
|
- |
| 13.9(Fault indication) |
- |
3000 |
|
- |
| 9.1.4.3(Hot flaming oil test) |
- |
3000 |
|
- |
|
- |
- - |
| 8234 |
ACE TEST LAB PRIVATE LIMITED (8166826), DELHI
| 8166826
| IS 10322 : Part 5 : Sec 1 (2012) |
Luminaires: Part 5 particular requirements: Sec 1 fixed general purpose luminaires (First Revision) |
- |
40000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 4(General Test Requireements) |
- |
3000 |
|
- |
| 5(Classification of Luminaires') |
- |
1500 |
|
- |
| 6.0(Marking) |
- |
1500 |
|
- |
| 7.0(Construction) |
- |
2000 |
|
- |
| 8.0(Creepage Distance and Clearances) |
- |
2000 |
|
- |
| 9.0(Provision for earthing) |
- |
2000 |
|
- |
| 10.0(Terminals) |
- |
2000 |
|
- |
| 11.0(External & Internal Wiring) |
- |
2000 |
|
- |
| 12.0(Protection against electric shock) |
- |
2000 |
|
- |
| 13.0(Endurance Tests and Thermal Tests) |
- |
2000 |
|
- |
| 14.0(Resistance to Dust & Moisture) |
- |
3000 |
|
- |
| 15.0(Insulation Resistance and Electric Strength) |
- |
2000 |
|
- |
| 16.0(Resistance to Heat , fire and tracking) |
- |
2000 |
|
- |
| 4(General Test Requireements) |
- |
1000 |
|
- |
| 5(Classification of Luminaires') |
- |
1000 |
|
- |
| 6.0(Marking) |
- |
1000 |
|
- |
| 7.0(Construction) |
- |
1000 |
|
- |
| 8.0(Creepage Distance and Clearances) |
- |
1000 |
|
- |
| 9.0(Provision for earthing) |
- |
1000 |
|
- |
| 10.0(Terminals) |
- |
1000 |
|
- |
| 11.0(External & Internal Wiring) |
- |
1000 |
|
- |
| 12.0(Protection against electric shock) |
- |
1000 |
|
- |
| 13.0(Endurance Tests and Thermal Tests) |
- |
1000 |
|
- |
| 14.0(Resistance to Dust & Moisture) |
- |
1000 |
|
- |
| 15.0(Insulation Resistance and Electric Strength) |
- |
1000 |
|
- |
| 16.0(Resistance to Heat , fire and tracking) |
- |
1000 |
|
- |
| 4(General Test Requireements) |
- |
- |
|
- |
| 5(Classification of Luminaires') |
- |
- |
|
- |
| 6.0(Marking) |
- |
- |
|
- |
| 7.0(Construction) |
- |
- |
|
- |
| 8.0(Creepage Distance and Clearances) |
- |
- |
|
- |
| 9.0(Provision for earthing) |
- |
- |
|
- |
| 10.0(Terminals) |
- |
- |
|
- |
| 11.0(External & Internal Wiring) |
- |
- |
|
- |
| 12.0(Protection against electric shock) |
- |
- |
|
- |
| 13.0(Endurance Tests and Thermal Tests) |
- |
- |
|
- |
| 14.0(Resistance to Dust & Moisture) |
- |
- |
|
- |
| 15.0(Insulation Resistance and Electric Strength) |
- |
- |
|
- |
| 16.0(Resistance to Heat , fire and tracking) |
- |
- |
|
- |
|
- |
- - |
| 8235 |
ACE TEST LAB PRIVATE LIMITED (8166826), DELHI
| 8166826
| IS 16221 : Part 1 (2016) |
Safety of Power Converters for use in Photovoltaic Power Systems Part 1 General Requirements |
- |
390000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 4.2(Thermal testing) |
- |
4000 |
|
- |
| 4.3, 4.3.2, 4.3.2.2, 4.3.2.3(Thermal Tests (Maximum temperatures, Touch temperature, temperature limits for mount surfaces)) |
- |
4000 |
|
- |
| 4.4.3.1(Protection against shock hazard) |
- |
4000 |
|
- |
| 6.3(Ingress protection) |
- |
4000 |
|
- |
| 7.3.2.3(Short-term limits of accessible voltages under fault conditions) |
- |
4000 |
|
- |
| 7.3.2.6(Working voltage and DVC) |
- |
4000 |
|
- |
| 7.3.4,7.3.4.2(protection against direct contact) |
- |
4000 |
|
- |
| 7.3.4.3(Protection by means of insulation of live parts) |
- |
4000 |
|
- |
| 7.3.5,7.3.5.2(Protection in case of direct contact) |
- |
4000 |
|
- |
| 7.3.5.3.1(Limitation of current through protective impedance) |
- |
4000 |
|
- |
| 7.3.5.3.2(Limitation of discharging energy through protective impedance) |
- |
4000 |
|
- |
| 7.3.5.4(Protection by means of limited voltages) |
- |
4000 |
|
- |
| 7.3.6.1,7.3.6.2(Protection against indirect contact(Creapage & clearance)) |
- |
4000 |
|
- |
| 7.3.6.3(Protective class I - Protective bonding and earthing) |
- |
4000 |
|
- |
| 7.3.6.3.3(Rating of protective bonding) |
- |
4000 |
|
- |
| 7.3.7.4(Clearance distances) |
- |
4000 |
|
- |
| 7.3.7.5(Creepage distances) |
- |
4000 |
|
- |
| 7.3.7.8.4.2(Use of coating materials (on PWBs)) |
- |
4000 |
|
- |
| 7.3.8(Residual current detection (RCD) or Monitoring (RCM) device compatibilty (DC components on AC side)) |
- |
4000 |
|
- |
| 7.3.9(Protection against shock hazard due to stored energy) |
- |
4000 |
|
- |
| 7.4(Protection against energy hazards) |
- |
4000 |
|
- |
| 7.5.1(Impulse voltage test (type test)) |
- |
4000 |
|
- |
| 7.5.2(Voltage test (dielectric strength test)) |
- |
4000 |
|
- |
| 7.5.2.3(Humidity preconditioning) |
- |
4000 |
|
- |
| 7.5.3(Partial discharge test (type test or sample test)) |
- |
4000 |
|
- |
| 7.5.4(Touch current measurement) |
- |
4000 |
|
- |
| 8.2(Moving parts) |
- |
4000 |
|
- |
| 8.3(Stability) |
- |
4000 |
|
- |
| 8.4(Provisions for lifting and carrying) |
- |
4000 |
|
- |
| 8.5(Wall mounting) |
- |
4000 |
|
- |
| 8.6(Expelled parts) |
- |
4000 |
|
- |
| 10.2(Sonic pressure and sound level) |
- |
5000 |
|
- |
| 11.1(Liquid containment, pressure and leakage) |
- |
5000 |
|
- |
| 11.2(Fluid pressure and leakage) |
- |
5000 |
|
- |
| 12(Chemical hazards) |
- |
5000 |
|
- |
| 13.1(Handles and manual controls) |
- |
5000 |
|
- |
| 13.1.1(Adjustable controls) |
- |
5000 |
|
- |
| 13.2(Securing of parts) |
- |
5000 |
|
- |
| 13.3(Provisions for external connections) |
- |
5000 |
|
- |
| 13.3.2.5(Cord anchorages and strain relief) |
- |
5000 |
|
- |
| 13.3.5(Wire bending space for wires 10mm2 and greater) |
- |
5000 |
|
- |
| 13.4(Internal wiring and connections) |
- |
5000 |
|
- |
| 13.6.2.1(Stress relief test) |
- |
5000 |
|
- |
| 4.4.3.2(Protection against spread of fire) |
- |
5000 |
|
- |
| 4.4.3.4(Protection Against parts expulsion hazards) |
- |
5000 |
|
- |
| 4.4.4.1(Component fault tests) |
- |
5000 |
|
- |
| 4.4.4.2(Equipment’s or parts for short-term or intermittent operation) |
- |
5000 |
|
- |
| 4.4.4.3(Motors(Lock rotor)) |
- |
5000 |
|
- |
| 4.4.4.4(Transformer short circuit tests) |
- |
5000 |
|
- |
| 4.4.4.5(Output short circuit) |
- |
5000 |
|
- |
| 4.4.4.6(Backfeed current test for equipment with more than one source of supply) |
- |
5000 |
|
- |
| 4.4.4.7(Output overload) |
- |
5000 |
|
- |
| 4.4.4.8(Cooling system failure) |
- |
5000 |
|
- |
| 4.4.4.9(Heating devices) |
- |
5000 |
|
- |
| 4.4.4.10(Safety interlock systems) |
- |
5000 |
|
- |
| 4.4.4.11(Reverse d.c. connections) |
- |
5000 |
|
- |
| 4.4.4.12(Voltage selector mismatch) |
- |
5000 |
|
- |
| 4.4.4.13(Mis-wiring with incorrect phase sequence or polarity) |
- |
5000 |
|
- |
| 4.4.4.14(Printed wiring board short-circuit test) |
- |
5000 |
|
- |
| 4.5(Humidity preconditioning) |
- |
5000 |
|
- |
| 4.6.1(Backfeed tests under normal conditions) |
- |
5000 |
|
- |
| 4.6.2(Backfeed tests under single-fault conditions) |
- |
5000 |
|
- |
| 4.7(Electrical rating tests) |
- |
5000 |
|
- |
| 5.1.2(Durability of markings) |
- |
5000 |
|
- |
| 5.2.1(Visibility and legibility requirements for warning markings) |
- |
5000 |
|
- |
| 9.1.1(Reducing the risk of ignition and spread of flame) |
- |
5000 |
|
- |
| 9.1.2(Conditions for a fire enclosure) |
- |
5000 |
|
- |
| 9.1.3(Material requirements for protection against fire hazard) |
- |
5000 |
|
- |
| 9.1.4(Openings in fire enclosures) |
- |
5000 |
|
- |
| 9.1.4.3(Hot flaming oil test) |
- |
5000 |
|
- |
| 9.1.4.6(Additional requirements for openings in transportable equipment) |
- |
5000 |
|
- |
| 9.2.2(Limited power source tests) |
- |
5000 |
|
- |
| 9.3(Short-circuit and overcurrent protection) |
- |
5000 |
|
- |
| 13.7(Mechanical resistance to deflection, impact, or drop) |
- |
5000 |
|
- |
| 13.8(Thickness requirements for metal enclosures) |
- |
5000 |
|
- |
| 4(General testing requirements) |
- |
5000 |
|
- |
| 5(Marking and documentation) |
- |
5000 |
|
- |
| 6(Environmental Requirements and conditions) |
- |
5000 |
|
- |
| 7(Protection against electric shock and energy hazards) |
- |
5000 |
|
- |
| 8(Protection Against mechanical Hazards) |
- |
5000 |
|
- |
| 9(Protection Against Fire Hazards) |
- |
5000 |
|
- |
| 10(Protection against Sonic Pressure hazards) |
- |
5000 |
|
- |
| 11(Protection against liquid hazards) |
- |
5000 |
|
- |
| 13(Physical requirements) |
- |
5000 |
|
- |
| Annex A(Measurement of clearances and creepage distances) |
- |
500 |
|
- |
| Annex B(Programmable equipment) |
- |
500 |
|
- |
| Annex C(Symbols to be used in equipment markings) |
- |
500 |
|
- |
| Annex D(Test probes for determining access) |
- |
500 |
|
- |
| Annex E(RCDs) |
- |
500 |
|
- |
| Annex F(Altitude correction for clearances) |
- |
500 |
|
- |
| Annex G(Clearance and creepage distance determination for frequencies greater than 30 kHz) |
- |
500 |
|
- |
| Annex H("Measuring instrument for touch current measurements
") |
- |
500 |
|
- |
| Annex I("Examples of protection, insulation, and overvoltage category requirements for PCE
") |
- |
500 |
|
- |
| 14(Components) |
- |
3500 |
|
- |
|
- |
- - |
| 8236 |
ACE TEST LAB PRIVATE LIMITED (8166826), DELHI
| 8166826
| IS 10322 : PART 5 : SEC 3 (2012) |
Luminaires: Part 5 particular requirements: Sec 3 luminaires for road and street lighting (First Revision) |
- |
50000 View breakup
(10% discount to BIS)
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 4(General Test Requireements) |
- |
0 |
|
- |
| 5(Classification of Luminaires') |
- |
0 |
|
- |
| 6.0(Marking) |
- |
0 |
|
- |
| 7.0(Construction) |
- |
5000 |
|
- |
| 8.0(Creepage Distance and Clearances) |
- |
5000 |
|
- |
| 9.0(Provision for earthing) |
- |
5000 |
|
- |
| 10.0(Terminals) |
- |
5000 |
|
- |
| 11.0(External & Internal Wiring) |
- |
5000 |
|
- |
| 12.0(Protection against electric shock) |
- |
5000 |
|
- |
| 13.0(Endurance Tests and Thermal Tests) |
- |
5000 |
|
- |
| 14.0(Resistance to Dust & Moisture) |
- |
5000 |
|
- |
| 15.0(Insulation Resistance and Electric Strength) |
- |
5000 |
|
- |
| 16.0(Resistance to Heat , fire and tracking) |
- |
5000 |
|
- |
|
- |
- Photometry test (Cl.1.7) |
| 8237 |
ACE TEST LAB PRIVATE LIMITED (8166826), DELHI
| 8166826
| IS 10322 : Part 5 : Sec 2 (2012) |
Luminaires: Part 5 particular requirements: Sec 2 recessed luminaires (First Revision) |
- |
45000 View breakup
(10% discount to BIS)
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 4(General Test Requireements) |
- |
0 |
|
- |
| 5(Classification of Luminaires') |
- |
0 |
|
- |
| 6(Marking) |
- |
0 |
|
- |
| 7(Construction) |
- |
4500 |
|
- |
| 8(Creepage Distance and Clearances) |
- |
4500 |
|
- |
| 9(Provision for earthing) |
- |
4500 |
|
- |
| 10(Terminals) |
- |
4500 |
|
- |
| 11(External & Internal Wiring) |
- |
4500 |
|
- |
| 12(Protection against electric shock) |
- |
4500 |
|
- |
| 13(Endurance Tests and Thermal Tests) |
- |
4500 |
|
- |
| 14(Resistance to Dust and Moisture) |
- |
4500 |
|
- |
| 15(Insulation Resistance and Electric Strength) |
- |
4500 |
|
- |
| 16(Resistance to Heat , fire and tracking) |
- |
4500 |
|
- |
|
- |
- Photometry test (Cl.1.7) |
| 8238 |
ACE TEST LAB PRIVATE LIMITED (8166826), DELHI
| 8166826
| IS 16270 (2014) |
Secondary cells and batteries for solar photovoltaic application - General requirements and methods of test |
Storage Batteries |
625500 View breakup
For Stationary Lead acid cell/battery (with tubular positive plates) in monobloc containers), Rs.6,25,500/- For Stationary acid cell and batteries (with tubular positive plates), Rs.6,25,500/- For Stationary Valve regulated lead acid batteries). (10% discount to BIS)
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 4(Condition of use) |
- |
5500 |
|
- |
| 5.1(Mechanical Endurance) |
- |
15000 |
|
- |
| 5.2(Charge efficiency) |
- |
10000 |
|
- |
| 5.3(Deep discharge protection) |
- |
10000 |
|
- |
| 5.4(Marking) |
- |
10000 |
|
- |
| 5.5(Dafety) |
- |
10000 |
|
- |
| 5.6(Documentation) |
- |
10000 |
|
- |
| 6(Finctional Characteristics) |
- |
10000 |
|
- |
| 7(General test conditions) |
- |
10000 |
|
- |
| 8.1(Capacity test) |
- |
40000 |
|
- |
| 8.2(Endurance test) |
- |
160000 |
|
- |
| 8.3(Charge retention test) |
- |
40000 |
|
- |
| 8.4(Cycle endurance in Photovoltaic application) |
- |
150000 |
|
- |
| 8.5(Sulphation Test) |
- |
80000 |
|
- |
| 8.6(Water loss test) |
- |
50000 |
|
- |
| 8.7(Non spillability) |
- |
15000 |
|
- |
|
- |
- • Capacity restricted to Batteries up to 160Ah, 15V (i) Stationary cells & Batteries, Lead acid type (with tubular positive plates) (ii) Stationary valve regulated lead acid batteries. |
| 8239 |
ACE TEST LAB PRIVATE LIMITED (8166826), DELHI
| 8166826
| IS 16046 : Part 1 (2018) |
Secondary Cells and Batteries Containing Alkaline or Other Non-Acid Electrolytes ” Safety Requirements for Portable Sealed Secondary Cells and for Batteries Made from Them for Use in Portable Applications Part 1 Nickel Systems ( Second Revision ) |
Nickel System Cells And Batteries |
132000 View breakup
or Nickel system cells, Rs.40,000/- for Nickel system batteries. (10% Discount for BIS).
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 4(Parameter Measurement Tolerances) |
- |
0 |
|
- |
| 5(General Safety Considerations) |
- |
0 |
|
- |
| 5.1(General) |
- |
0 |
|
- |
| 5.2(Insulation and Wiring) |
- |
2000 |
|
- |
| 5.3(Venting) |
- |
0 |
|
- |
| 5.4(Temperature, Voltage and Current Management) |
- |
0 |
|
- |
| 5.5(Terminal Contacts) |
- |
0 |
|
- |
| 5.6(Assembly of Cells into batteries) |
- |
0 |
|
- |
| 5.7(Quality Plan) |
- |
0 |
|
- |
| 6(Tyoe Test amd Sample Size) |
- |
0 |
|
- |
| 7(Specific requirements and tests) |
- |
0 |
|
- |
| 7.1(Charging procedure for test purposes) |
- |
10000 |
|
- |
| 7.2(Intended Use) |
- |
31000 |
|
- |
| 7.3(Reasonably foreseeable misuse) |
- |
24000 |
|
- |
| 8(Information for safety) |
- |
0 |
|
- |
| 8.1(General) |
- |
0 |
|
- |
| 8.2(Small Cell and battery safety information) |
- |
0 |
|
- |
| 9(Marking) |
- |
0 |
|
- |
| 9.1(Cell Marking) |
- |
0 |
|
- |
| 9.2(Battery Marking) |
- |
0 |
|
- |
| 9.3(Caution for ingestion of small cells and batteries) |
- |
0 |
|
- |
| 9.4(Other information) |
- |
0 |
|
- |
| 10(Packaging) |
- |
0 |
|
- |
|
- |
- Capacity restricted up to 17.5Ah, 50V.
Included w.e.f. 26-10-2021. |
| 8240 |
ACE TEST LAB PRIVATE LIMITED (8166826), DELHI
| 8166826
| IS 13252 : Part 1 (2010) |
Information technology equipment - Safety: Part 1 general requirements (Second Revision) |
INFORMATION TECHNOLOGY EQUIPMENT — SAFETY PART 1 |
70000 View breakup
for Set Top Box, Telephone answering machines, Wireless Keyboard,
Passport Reader, Point of sale terminal, Power bank for use in portable applications, Smart card reader, Mobile phones, USB driven Barcode readers, Barcode scanners, iris scanners, Optical Fingerprint Scanners, Smart watches, Keyboard, USB Type External Hard Disk Drive, USB type External Solid State Storage Devices (above 256 GB Capacity), Digital Camera.
Rs.35,000/- for Laptop/ Notebook/ Tablet, Cash Registers, Mail processing machine/ postage machine/ Franking machine, Power adaptor for IT equipments, CCTV Camera/ CCTV Recorders, Automatic Teller Cash Dispensing Machines
Rs.40,000/- for Printer, Plotter, Scanner (Industrial & Non industrial), Visual display unit, videos monitors of screen size above 32”, Copying machine/ duplicator, Visual display unit, videos monitors of screen size up to 32”, Standalone Switch Mode Power supplies (SMPS) with output Voltage 48 V (max.)
Rs.50,000/- for Automatic Data Processing Machine.
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 5.3(Abnormal operating and fault conditions) |
- |
5000 |
|
- |
| 4.5(Thermal requirements) |
- |
2000 |
|
- |
| 1.6(Power interface .) |
- |
3000 |
|
- |
| 2.2(SELV circuits) |
- |
2000 |
|
- |
| 1.7(Markings and instructions) |
- |
1000 |
|
- |
| 2.1(Protection from electric shock and energy hazards) |
- |
2000 |
|
- |
| 2.3(TNV circuits) |
- |
2000 |
|
- |
| 2.5(Limited power sources .) |
- |
2000 |
|
- |
| 2.6(Provisions for earthing and bonding) |
- |
2000 |
|
- |
| 2.7(Overcurrent and earth fault protection in primary circuits) |
- |
2000 |
|
- |
| 2.8(Safety interlocks) |
- |
2000 |
|
- |
| 2.9(Electrical insulation) |
- |
2000 |
|
- |
| 2.10(Clearances, creepage distances and distances through insulation) |
- |
4000 |
|
- |
| 3.1(General) |
- |
0 |
|
- |
| 3.2(Connection to a mains supply) |
- |
2000 |
|
- |
| 3.3(Wiring terminals for connection of external conductors) |
- |
2000 |
|
- |
| 3.4(Disconnection from the mains supply) |
- |
2000 |
|
- |
| 3.5(Interconnection of equipment) |
- |
2000 |
|
- |
| 4.1(Stability) |
- |
2000 |
|
- |
| 4.2(Mechanical strength) |
- |
2000 |
|
- |
| 4.3(Design and construction) |
- |
2000 |
|
- |
| 4.4(Protection against hazardous moving parts) |
- |
2000 |
|
- |
| 4.6(Openings in enclosures) |
- |
3000 |
|
- |
| 4.7(Resistance to fire) |
- |
2000 |
|
- |
| 5.1(Touch current and protective conductor curren) |
- |
2000 |
|
- |
| 5.2(Electric strength) |
- |
3000 |
|
- |
| 6.1(Protection of telecommunication network service persons, and users of other equipment connected to the network, from hazards in the equipment) |
- |
1000 |
|
- |
| 6.2(Protection of equipment users from overvoltages on networks telecommunication) |
- |
3000 |
|
- |
| 6.3(Protection of the telecommunication wiring system from overheating) |
- |
1000 |
|
- |
| 7.1(General) |
- |
0 |
|
- |
| 7.2(Protection of cable distribution system service persons, and users of other equipment connected to the system, from hazardous voltages in the equipment) |
- |
2000 |
|
- |
| 7.3(Protection of equipment users from overvoltages on the cable distribution system) |
- |
2000 |
|
- |
| 7.4(Insulation between primary circuits and cable distribution systems) |
- |
2000 |
|
- |
| 1.5(Components) |
- |
0 |
|
- |
| 2.4(Limited current circuits) |
- |
2000 |
|
- |
| 2.8.2/2.8.5(Interlock switches) |
- |
0 |
|
- |
| 2.8.7(Switches and Relay) |
- |
0 |
|
- |
| 2.10.4.2(Material Group and Comparative Tracking Index) |
- |
0 |
|
- |
| 2.10.5.3(Insulating Compound as Solid Insulation) |
- |
0 |
|
- |
| 2.10.5.4(Opto-coupler) |
- |
0 |
|
- |
| 2.10.5.6(Thin sheet materials) |
- |
0 |
|
- |
| 2.10.5.11(SMPS Transformer and Inductor) |
- |
0 |
|
- |
| 2.10.5.12(Wires in wound components) |
- |
0 |
|
- |
| 2.10.5.13(Winding wire) |
- |
0 |
|
- |
| 2.10.5.14(Additional insulation in wound components) |
- |
0 |
|
- |
| 2.10.6(PCB material) |
- |
0 |
|
- |
| 2.10.8.2(Thermal conditioning (thermal ageing)) |
- |
0 |
|
- |
| 2.10.8.4(Abrasion resistance test) |
- |
0 |
|
- |
| 2.10.9(Thermal Cycling) |
- |
0 |
|
- |
| 2.10.10(Test for Pollution Degree 1 environment and for insulating compound) |
- |
0 |
|
- |
| 2.10.11(Tests for semiconductor devices and for cemented joints) |
- |
0 |
|
- |
| 2.10.12(Enclosed and sealed parts) |
- |
0 |
|
- |
| 3.1.4(Internal wire) |
- |
0 |
|
- |
| 3.2.4(Appliance inlet /connector) |
- |
0 |
|
- |
| 3.2.5(Non re-wirable plug with PVC sheathed cable) |
- |
0 |
|
- |
| 4.2.8(Cathode Ray Tubes) |
- |
0 |
|
- |
| 4.3.8(Batteries) |
- |
0 |
|
- |
| 4.3.10(Dust, powders, liquids and gases) |
- |
0 |
|
- |
| 4.3.11(Containers for liquids or gases) |
- |
0 |
|
- |
| 4.3.12(Flammable liquids) |
- |
0 |
|
- |
| Annex A3(Hot flaming oil test) |
- |
0 |
|
- |
| Annex CC(Evaluation of integrated circuit (IC) current limiters) |
- |
0 |
|
- |
| Annex K(Thermal Control) |
- |
0 |
|
- |
| Annex Q(Voltage Dependent Resistors) |
- |
0 |
|
- |
| Annex B(Motor tests under abnormal conditions) |
- |
0 |
|
- |
| Annex C(Transformers) |
- |
0 |
|
- |
| Annex DD(Requirements for the mounting means of a rack mounted equipment) |
- |
0 |
|
- |
| Annex EE(Household and home/ office document/ media shredders) |
- |
0 |
|
- |
|
- |
- Components (Cl.1.5), Ionizing radiation (Cl.4.3.13), Insulated winding wires for use without interleaved insulation (Annex U). Included w.e.f. 26-10-2021. |
| 8241 |
ACE TEST LAB PRIVATE LIMITED (8166826), DELHI
| 8166826
| IS 16102 : Part 1 (2012) |
Self - Ballasted led lamps for general lighting services: Part 1 safety requirements |
SELF-BALLASTED LED LAMPS FOR GENERAL LIGHTING SERVICES |
30000 View breakup
(10% discount to BIS)
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 5(Marking) |
- |
0 |
|
- |
| 6(Interchangeability) |
- |
2500 |
|
- |
| 7(Protection against accidental contact with live parts) |
- |
4500 |
|
- |
| 8(Insulation Resistance and Electric Strength) |
- |
2500 |
|
- |
| 9(MECHANICAL STRENGTH) |
- |
3000 |
|
- |
| 10(cap temperature) |
- |
4000 |
|
- |
| 11(Resistance to Heat) |
- |
4000 |
|
- |
| 12(Resistance to Flame and Ignition) |
- |
4000 |
|
- |
| 13(Fault conditions) |
- |
4500 |
|
- |
| 14(Creepage distance and clearances) |
- |
1000 |
|
- |
|
- |
- - |
| 8242 |
ACE TEST LAB PRIVATE LIMITED (8166826), DELHI
| 8166826
| IS/IEC 61730 : PART 2 (2004) |
Photovoltaic (PV) Module Safety Qualification Part 2 Requirements for Testing |
PHOTOVOLTAIC (PV) MODULE SAFETY QUALIFICATION |
1000000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 10.1(Visual Inspection (MST 01)) |
- |
18518 |
|
- |
| 10.2(Accessibility test (MST 11)) |
- |
18518 |
|
- |
| 10.3(Cut susceptibility test (MST 12)) |
- |
18518 |
|
- |
| 10.4(Ground Continuity Test (MST 13)) |
- |
18518 |
|
- |
| 10.5(Impulse voltage test (MST 14)) |
- |
18518 |
|
- |
| 10.6(Dielectric withstand test (MST 16)) |
- |
18518 |
|
- |
| 10.7(Temperature test (MST 21)) |
- |
18518 |
|
- |
| 10.8(Fire test (MST 23)) |
- |
18518 |
|
- |
| 10.9(Reverse Current overload test (MST 26)) |
- |
18518 |
|
- |
| 10.10(Module breakage test (MST 32)) |
- |
18518 |
|
- |
| 11.1(Partial discharge-test (MST 15)) |
- |
18518 |
|
- |
| 11.2(Conduit Bending test (MST 33)) |
- |
18518 |
|
- |
| 11.3(Terminal box knockout tests (MST 44)) |
- |
18518 |
|
- |
| Cl.5, Table 7(Thermal cycling (T200) (MST 51)) |
- |
18518 |
|
- |
| Cl.5, Table 7(Thermal cycling (T50) (MST 51)) |
- |
18518 |
|
- |
| Cl.5, Table 7(Humidity freeze (10HF) (MST 52)) |
- |
18518 |
|
- |
| Cl.5, Table 7(Damp heat (DH1000) (MST 53)) |
- |
18518 |
|
- |
| Cl.5, Table 7(UV resistance (MST 54)) |
- |
18518 |
|
- |
| Cl.5, Table 7(Wet leakage current test (MST 17)) |
- |
18518 |
|
- |
| Cl.5, Table 7(Robustness of termination test (MST 42)) |
- |
18518 |
|
- |
| Cl.5, Table 7(Hot spot test (MST 22)) |
- |
18518 |
|
- |
| Cl.5, Table 7(Mechanical load test (MST 34)) |
- |
18518 |
|
- |
| 10.33 IS/IEC 61730-2(Dry heat conditioning MST 56) |
- |
18518 |
|
- |
| 10.32 IS/IEC 61730-2(Cold conditioning MST 55) |
- |
18518 |
|
- |
| 10.31 IS/IEC 61730-2(UV test MST 54) |
- |
18518 |
|
- |
| 10.30 IS/IEC 61730-2(Damp heat test MST 53) |
- |
18518 |
|
- |
| 10.29 IS/IEC 61730-2(Humidity-freeze test MST 52) |
- |
18518 |
|
- |
| 10.28 IS/IEC 61730-2(Thermal cycling test MST 51) |
- |
18518 |
|
- |
| 10.27 IS/IEC 61730-2(Robutness of terminations test MST 42) |
- |
18518 |
|
- |
| 10.26 IS/IEC 61730-2(Materials creep test MST 37) |
- |
18518 |
|
- |
| 10.25 IS/IEC 61730-2(Lap shear strength test MST 36) |
- |
18518 |
|
- |
| 10.24 IS/IEC 61730-2(Peel test MST 35) |
- |
18518 |
|
- |
| 10.23 IS/IEC 61730-2(Static Mechanical load test MST 34) |
- |
18518 |
|
- |
| 10.22 IS/IEC 61730-2(Screw connections test MST 33) |
- |
18518 |
|
- |
| 10.21 IS/IEC 61730-2(Module breakage test MST 32) |
- |
18518 |
|
- |
| 10.20 IS/IEC 61730-2(Reverse current overload test MST 25) |
- |
18518 |
|
- |
| 10.19 IS/IEC 61730-2(Bypass diode thermal test MST 25) |
- |
18518 |
|
- |
| 10.18 IS/IEC 61730-2(Ignitability test MST 24) |
- |
18518 |
|
- |
| 10.17 IS/IEC 61730-2(Fire test MST 23) |
- |
18518 |
|
- |
| 10.16 IS/IEC 61730-2(Hot-spot endurance test MST 22) |
- |
18518 |
|
- |
| 10.15 IS/IEC 61730-2(Temperature test MST 21) |
- |
18518 |
|
- |
| 10.14 IS/IEC 61730-2(Wet leakage current test MST 17) |
- |
18518 |
|
- |
| 10.13 IS/IEC 61730-2(Insulation test MST 16) |
- |
18518 |
|
- |
| 10.12 IS/IEC 61730-2(Impulse voltage test MST 14) |
- |
18518 |
|
- |
| 10.11 IS/IEC 61730-2(Continuity test of equipotential bonding MST 13) |
- |
18518 |
|
- |
| 10.10 IS/IEC 61730-2(Cut susceptibility test MST 12) |
- |
18518 |
|
- |
| 10.9 IS/IEC 61730-2(Accessibility test MST 11) |
- |
18518 |
|
- |
| 10.8 IS/IEC 61730-2(Bypass diode functionality test MST 07) |
- |
18518 |
|
- |
| 10.7 IS/IEC 61730-2(Sharp edge test MST 06) |
- |
18518 |
|
- |
| 10.6 IS/IEC 61730-2(Durability of marking MST 05) |
- |
18518 |
|
- |
| 10.5 IS/IEC 61730-2(Insulation thickness test MST 04) |
- |
18518 |
|
- |
| 10.4 IS/IEC 61730-2(Maximum power determination MST 03) |
- |
18518 |
|
- |
| 10.3 IS/IEC 61730-2(Performance at STC MST 02) |
- |
18518 |
|
- |
| 10.2 IS/IEC 61730-2(Visual inspection MST01) |
- |
18546 |
|
- |
|
- |
- - |
| 8243 |
ACE TEST LAB PRIVATE LIMITED (8166826), DELHI
| 8166826
| IS/IEC 61730 : PART 1 (2004) |
Photovoltaic (PV) Module Safety Qualification Part 1 Requirements for Construction |
PHOTOVOLTAIC (PV) MODULE SAFETY QUALIFICATION |
200000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 3(Application classes) |
- |
20000 |
|
- |
| 4(Construction requirements) |
- |
20000 |
|
- |
| 5(Polymeric materials) |
- |
20000 |
|
- |
| 6(Internal wiring and current-carrying parts) |
- |
20000 |
|
- |
| 7(Connections) |
- |
20000 |
|
- |
| 8(Bonding and grounding) |
- |
20000 |
|
- |
| 9(Creepage and clearance distances) |
- |
20000 |
|
- |
| 10(Field wiring compartments with covers) |
- |
20000 |
|
- |
| 11(Marking) |
- |
20000 |
|
- |
| 12() |
- |
20000 |
|
- |
|
- |
- - |
| 8244 |
ACE TEST LAB PRIVATE LIMITED (8166826), DELHI
| 8166826
| IS 15885 : Part 2 : Sec 13 (2012) |
Safety of lamp controlgear: Part 2 particular requirements: Sec 13 d.c. or a.c. supplied electronic controlgear for led modules |
SAFETY OF LAMP CONTROLGEAR |
30000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 7(Marking) |
- |
1500.02 |
|
ok |
| 8(Protection against accidental contact with live parts) |
- |
2666.66 |
|
ok |
| 9(Terminals) |
- |
3166.66 |
|
ok |
| 10(PROVISION FOR EARTHING) |
- |
1500 |
|
ok |
| 11(MOISTURE RESISTANCE) |
- |
2500 |
|
ok |
| 12(Electric Strength) |
- |
2500 |
|
ok |
| 13(Thermal endurance test for winding of ballasts) |
- |
1000 |
|
ok |
| 14(Fault conditions) |
- |
1000 |
|
ok |
| 15(Transformer heating) |
- |
2500 |
|
ok |
| 16(Construction) |
- |
3166.66 |
|
ok |
| 17(Creepage distance and clearances) |
- |
1000 |
|
ok |
| 18(Screws, current carrying parts and connections) |
- |
1500 |
|
ok |
| 19(Resistance to heat, fire and tracking) |
- |
4000 |
|
ok |
| 20(Resistance to corrosion) |
- |
2000 |
|
ok |
|
- |
- - |
| 8245 |
ACE TEST LAB PRIVATE LIMITED (8166826), DELHI
| 8166826
| IS 16242 : Part 1 (2014) |
Uninterruptible power systems (UPS): Part 1 general and safety requirements for UPS |
Uninterruptible Power Systems (UPS) |
50000 View breakup
Upto 10 KVA (10% discount to BIS)
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 4.5(Components) |
- |
0 |
|
- |
| 4.6(Power interface) |
- |
3000 |
|
- |
| 4.7(Marking & instructions) |
- |
1000 |
|
- |
| 5.1(Protection against shock and energy hazards) |
- |
1500 |
|
- |
| 5.2(Requirement of auxiliary circuits) |
- |
1000 |
|
- |
| 5.3(Protective earthing and bonding) |
- |
1500 |
|
- |
| 5.4(AC and DC power isolation) |
- |
2000 |
|
- |
| 5.5(Over current and earth fault condition) |
- |
2000 |
|
- |
| 5.6(Safety interlocks) |
- |
5000 |
|
- |
| 5.7(CLEARANCES, CREEPAGE DISTANCES AND SOLID INSULATION) |
- |
2000 |
|
- |
| 6.1(Wiring, connections and supply) |
- |
1000 |
|
- |
| 6.2(Connection to power) |
- |
2000 |
|
- |
| 6.3(Wiring terminals for external power conductors) |
- |
2000 |
|
- |
| 7.1(Enclosure) |
- |
2000 |
|
- |
| 7.2(STABILITY) |
- |
2500 |
|
- |
| 7.3(MECHANICAL STRENGTH) |
- |
2000 |
|
- |
| 7.4(Construction details) |
- |
2000 |
|
- |
| 7.5(Resistance to fire) |
- |
3000 |
|
- |
| 7.6(Battery location) |
- |
1500 |
|
- |
| 7.7(Temperature rise) |
- |
3000 |
|
- |
| 8.1(General procision for earth leakage) |
- |
2000 |
|
- |
| 8.2(Electric Strength) |
- |
2000 |
|
- |
| 8.3(Abnormal operating and fault conditions) |
- |
2000 |
|
- |
| 9.0(Connection to telecommunication networks) |
- |
2000 |
|
- |
| 4.3.8(Batteries) |
- |
2000 |
|
- |
|
- |
- • Exclusion: Components (Cl.1.5), SMPS?Mains Transformer (Cl.2.10.5.11), PCB Material (Cl.2.10.6), Non rewireble plug with PVC sheathed cable (Cl.3.2.5), Appliance inlet/connector (Cl.3.2.4), Internal wire (Cl.3.1.4), Semi-conductor devices (Cl.2.10.5.4), Switches & Relays (Cl.2.8.2, 2.8.5, 2.8.7), Winding wires (Cl.2.10.5.3), Batteries (cl.4.3.8) |
| 8246 |
ACE TEST LAB PRIVATE LIMITED (8166826), DELHI
| 8166826
| IS 14286 (2010) |
Crystalline silicon terrestrial photovoltaic (PV) modules - Design qualification and type approval (First Revision) |
- |
740000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 4(Marking) |
- |
39333.33 |
|
- |
| 10.1(Visual inspection) |
- |
39333.33 |
|
- |
| 10.2(Maximum power determination) |
- |
39333.33 |
|
- |
| 10.3(Insulation test) |
- |
39333.33 |
|
- |
| 10.4(Measurement of temperature coefficients) |
- |
39333.33 |
|
- |
| 10.5(Measurement of NOCT) |
- |
39333.33 |
|
- |
| 10.6(Performance at STC and NOCT) |
- |
39333.33 |
|
- |
| 10.7(Performance at low irradiance) |
- |
39333.33 |
|
- |
| 10.8(Outdoor exposure test) |
- |
39333.33 |
|
- |
| 10.9(Hot-spot endurance test) |
- |
39333.33 |
|
- |
| 10.10(UV preconditioning) |
- |
39333.33 |
|
- |
| 10.11(Thermal cycling test) |
- |
36888.90 |
|
- |
| 10.12(Humidity freeze test) |
- |
36888.90 |
|
- |
| 10.13(Damp heat test) |
- |
36888.92 |
|
- |
| 10.14(Robustness of termination test) |
- |
39333.33 |
|
- |
| 10.15(Wet leakage current test) |
- |
39333.33 |
|
- |
| 10.16(Mechanical load test) |
- |
39333.33 |
|
- |
| 10.17(Hail test) |
- |
39333.33 |
|
- |
| 10.18(Bypass diode thermal' test) |
- |
39333.33 |
|
- |
|
- |
- - |
| 8247 |
Bharti Automation Pvt. Ltd.(A Testing Division), Gurugram
| 8141726
| IS 16333 : Part 3 (2022) |
Mobile phone handsets: Part 3 Indian language support for mobile phone handsets - Specific requirements(Second Revision) |
- |
20000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 5(Tests) |
- |
2000 |
|
20% Discount to BIS |
| 4(Requirements) |
- |
2000 |
|
20% Discount to BIS |
| 5.1(Inputting of text) |
- |
2000 |
|
20% Discount to BIS |
| 5.2(Message Readability) |
- |
2000 |
|
20% Discount to BIS |
| 6(Marking) |
- |
2000 |
|
20% Discount to BIS |
| 6(Marking) |
- |
2000 |
|
20% Discount to BIS |
| "Cl.6.1 "(Marking) |
- |
2000 |
|
20% Discount to BIS |
| "Cl.6.2 "(BIS Certification Marking) |
- |
2000 |
|
20% Discount to BIS |
|
05 Aug, 2027 |
- - |
| 8248 |
Bharti Automation Pvt. Ltd.(A Testing Division), Gurugram
| 8141726
| IS 302 : Part 2 : Sec 8 (1994) |
Safety of household and similar electrical appliances : part 2 particular requirements, section 8 electrical shavers hair, clippers and similar appliances |
- |
30000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 5(Rating) |
- |
1000 |
|
20% discount to BIS |
| 6(Classification) |
- |
1000 |
|
20% discount to BIS |
| 7(Marking/ Marking & Instructions) |
- |
1000 |
|
20% discount to BIS |
| 8(Protection against Electric Shock/ Protection against Access to Live Parts) |
- |
1000 |
|
20% discount to BIS |
| 9(Starting Of Motor Operated Appliances) |
- |
1000 |
|
20% discount to BIS |
| 10(Power Input
& Current) |
- |
1000 |
|
20% discount to BIS |
| 11(Temperature Rise/Heating) |
- |
1000 |
|
20% discount to BIS |
| 13(Leakage Current and Electric Strength at Operating Temperature) |
- |
1000 |
|
20% discount to BIS |
| 14(Radio and Television Interference Suppression/ Transient Over Voltage) |
- |
1000 |
|
20% discount to BIS |
| 15(Moisture Resistance) |
- |
1000 |
|
20% discount to BIS |
| 16(Leakage Current and Electric Strength) |
- |
1000 |
|
20% discount to BIS |
| 17(Overload Protection/ Overload Protection of Transformers & Associated Circuits) |
- |
1000 |
|
20% discount to BIS |
| 18(Endurance) |
- |
1000 |
|
20% discount to BIS |
| 19(Abnormal Operation) |
- |
1000 |
|
20% discount to BIS |
| 20(Stability & Mechanical Hazards) |
- |
1000 |
|
20% discount to BIS |
| 21(Mechanical strength) |
- |
1000 |
|
20% discount to BIS |
| 22(Construction) |
- |
1000 |
|
20% discount to BIS |
| 23(Internal wiring) |
- |
1000 |
|
20% discount to BIS |
| 24(Component) |
- |
1000 |
|
20% discount to BIS |
| 25(Supply Connection & External Flexible Cables and Cords) |
- |
1000 |
|
20% discount to BIS |
| 26(Terminals For External Conductors) |
- |
1000 |
|
20% discount to BIS |
| 27(Provision For Earthing) |
- |
1000 |
|
20% discount to BIS |
| 28(Screws & Connection) |
- |
1000 |
|
20% discount to BIS |
| 29(Clearances, Creepage Distances & Solid Insulation) |
- |
1000 |
|
20% discount to BIS |
| 30(Resistance to Heat & Fire) |
- |
1000 |
|
20% discount to BIS |
| 31(Resistance to Rusting) |
- |
1000 |
|
20% discount to BIS |
| 19.11.4.1(Electrostatic discharges) |
- |
1000 |
|
20% discount to BIS |
| 19.11.4.2(Radiated fields) |
- |
1000 |
|
20% discount to BIS |
| 19.11.4.3(Fast transient bursts) |
- |
1000 |
|
20% discount to BIS |
| 19.11.4.4(Surge immunity test) |
- |
1000 |
|
20% discount to BIS |
| 19.11.4.5(Immunity to conducted discharges) |
- |
1000 |
|
20% discount to BIS |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
1000 |
|
20% discount to BIS |
| 19.11.4.7(Harmonics) |
- |
1000 |
|
20% discount to BIS |
|
05 Aug, 2027 |
- Cl.19.11.4.1 to Cl.19.11.4.7 (EMI/EMC) |
| 8249 |
Bharti Automation Pvt. Ltd.(A Testing Division), Gurugram
| 8141726
| IS 302 : Part 2 : Sec 76 (1999) |
Safety of household and similar electrical appliances: Part 2 particular requirements: Sec 76 electric fence energizers |
- |
45000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| CL. 1.1(VOLTAGE) |
- |
1000 |
|
20% discount to BIS |
| Cl.6.1 OF IS:302-1:2008(Classification) |
- |
1000 |
|
20% discount to BIS |
| Cl.6.2 OF IS:302-1:2008(Classification) |
- |
1000 |
|
20% discount to BIS |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7 & IS:302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.2(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.3(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.3(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.3(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.4(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.5(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.6 & IS:302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.8 of IS :302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.9 of IS :302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.10 of IS :302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.11 of IS :302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.12 & IS:302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.12.1 & IS:302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.12.2 OF IS:302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.12.3 & IS:302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.12.4 OF IS:302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.12.5 OF IS:302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.12.6 OF IS:302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.12.7 OF IS:302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.12.8 OF IS:302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.13 of IS 302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.14 of IS302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.15 of IS 302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.16 of IS 302-1:2008(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.101(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.7.102(Marking and Instructions) |
- |
1000 |
|
20% discount to BIS |
| Cl.8.1 OF IS:302-1:2008(Protection Against Access to Live Parts) |
- |
1000 |
|
20% discount to BIS |
| Cl.8.1.1 OF IS:302-1:2008(Protection Against Access to Live Parts) |
- |
1000 |
|
20% discount to BIS |
| Cl.8.1.2 OF IS:302-1:2008(Protection Against Access to Live Parts) |
- |
1000 |
|
20% discount to BIS |
| Cl.8.1.3 OF IS:302-1:2008(Protection Against Access to Live Parts) |
- |
1000 |
|
20% discount to BIS |
| Cl.8.1.4 OF IS:302-1:2008(Protection Against Access to Live Parts) |
- |
1000 |
|
20% discount to BIS |
| Cl.10.1 OF IS:302-1:2008(Power Input and Current) |
- |
1000 |
|
20% discount to BIS |
| Cl.11.2 OF IS:302-1:2008(Heating) |
- |
1000 |
|
20% discount to BIS |
| Cl.11.3 OF IS:302-1:2008(Heating) |
- |
1000 |
|
20% discount to BIS |
| Cl.11.4 OF IS:302-1:2008(Heating) |
- |
1000 |
|
20% discount to BIS |
| Cl.11.5 OF IS:302-1:2008(Heating) |
- |
1000 |
|
20% discount to BIS |
| Cl.11.6 OF IS:302-1:2008(Heating) |
- |
1000 |
|
20% discount to BIS |
| Cl.11.7 OF IS:302-1:2008(Heating) |
- |
1000 |
|
20% discount to BIS |
| Cl.11.8 OF IS:302-1:2008(Heating) |
- |
1000 |
|
20% discount to BIS |
| Cl.13.1 OF IS:302-1:2008(Leakage Current & Electric Strength at operating temp.) |
- |
1000 |
|
20% discount to BIS |
| Cl.13.2 OF IS:302-1:2008(Leakage Current & Electric Strength at operating temp.) |
- |
1000 |
|
20% discount to BIS |
| Cl.13.3 OF IS:302-1:2008(Leakage Current & Electric Strength at operating temp.) |
- |
1000 |
|
20% discount to BIS |
| Cl.14.101 OF IS:302-1:2008(TRANSIENT OVERVOLTAGE) |
- |
1000 |
|
20% discount to BIS |
| Cl.15 OF IS: 302-1:2008(Moisture Resistance) |
- |
1000 |
|
20% discount to BIS |
| Cl.15.3 of IS 302-1:200(Moisture Resistance) |
- |
1000 |
|
20% discount to BIS |
| Cl.16.2 OF IS:302-1:2008(Leakage Current & Electric Strength) |
- |
1000 |
|
20% discount to BIS |
| Cl.16.3 OF IS:302-1:2008(Leakage Current & Electric Strength) |
- |
1000 |
|
20% discount to BIS |
| Cl.16.1 OF IS:302-1:2008(Leakage Current & Electric Strength) |
- |
1000 |
|
20% discount to BIS |
| Cl.16.101 OF IS:302-1:2008(Leakage Current & Electric Strength) |
- |
1000 |
|
20% discount to BIS |
| Cl.16.102 OF IS:302-1:2008(Leakage Current & Electric Strength) |
- |
1000 |
|
20% discount to BIS |
| Cl.18(Endurance.) |
- |
1000 |
|
20% discount to BIS |
| Cl.19 OF IS:302-1:2008(Abnormal Operation.) |
- |
1000 |
|
20% discount to BIS |
| Cl.19.1 OF IS:302-1:2008(Abnormal Operation.) |
- |
1000 |
|
20% discount to BIS |
| Cl.19 OF IS:302-1:2008(Abnormal Operation.) |
- |
1000 |
|
20% discount to BIS |
| Cl.19.11 OF IS:302-1:2008(Abnormal Operation.) |
- |
1000 |
|
20% discount to BIS |
| Cl.19.101(Abnormal Operation.) |
- |
1000 |
|
20% discount to BIS |
| Cl.19.102(Abnormal Operation.) |
- |
1000 |
|
20% discount to BIS |
| Cl.19.103(Abnormal Operation.) |
- |
1000 |
|
20% discount to BIS |
| Cl.19.104(Abnormal Operation.) |
- |
1000 |
|
20% discount to BIS |
| Cl.19.105(Abnormal Operation.) |
- |
1000 |
|
20% discount to BIS |
| Cl.19.106(Abnormal Operation.) |
- |
1000 |
|
20% discount to BIS |
| Cl.21 & IS:302-1:2008)(Mechanical Strength.) |
- |
1000 |
|
20% discount to BIS |
| Cl.21.2 of IS 302-1:2008(Mechanical Strength.) |
- |
1000 |
|
20% discount to BIS |
| Cl.21.101(Mechanical Strength.) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.1 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.2 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.3 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.4 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.5 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.6 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.7 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.8 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.9 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.10 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.11(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.12 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.13 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.14 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.15 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.16 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.17of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.18 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.19 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.20 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.21 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.22 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.23 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.24 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.25 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.26 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.27 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.28 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.29 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.31 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.32 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.33 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.34 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.35 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.36 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.37 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.38 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.39 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.40 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.41 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.42 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.43 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.44 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.45 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.46 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.47 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl. 22.101(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl. 22.102(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl. 22.103(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl. 22.104(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl. 22.105(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl. 22.106(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl. 22.107(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl. 22.108(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl. 22.109(Construction) |
- |
1000 |
|
20% discount to BIS |
| Cl.23.1 of IS:302-1:2008(Internal Wiring) |
- |
1000 |
|
20% discount to BIS |
| Cl.23.2 of IS:302-1:2008(Internal Wiring) |
- |
1000 |
|
20% discount to BIS |
| Cl.23.3 of IS:302-1:2008(Internal Wiring) |
- |
1000 |
|
20% discount to BIS |
| Cl.23.4 of IS:302-1:2008(Internal Wiring) |
- |
1000 |
|
20% discount to BIS |
| Cl.23.5 of IS:302-1:2008(Internal Wiring) |
- |
1000 |
|
20% discount to BIS |
| Cl.23.6 of IS:302-1:2008(Internal Wiring) |
- |
1000 |
|
20% discount to BIS |
| Cl.23.7 of IS:302-1:2008(Internal Wiring) |
- |
1000 |
|
20% discount to BIS |
| Cl.23.8 of IS:302-1:2008(Internal Wiring) |
- |
1000 |
|
20% discount to BIS |
| Cl.23.9 of IS:302-1:2008(Internal Wiring) |
- |
1000 |
|
20% discount to BIS |
| Cl.23.10 of IS:302-1:2008(Internal Wiring) |
- |
1000 |
|
20% discount to BIS |
| Cl.24.1 of IS 302-1:2008(Components) |
- |
1000 |
|
20% discount to BIS |
| Cl.24.1.1 of IS 302-1:2008(Components) |
- |
1000 |
|
20% discount to BIS |
| Cl.24.1.2 of IS 302-1:2008(Components) |
- |
1000 |
|
20% discount to BIS |
| Cl.24.1.3 of IS 302-1:2008(Components) |
- |
1000 |
|
20% discount to BIS |
| Cl.24.1.4 of IS 302-1:2008(Components) |
- |
1000 |
|
20% discount to BIS |
| Cl.24.1.5 of IS 302-1:2008(Components) |
- |
1000 |
|
20% discount to BIS |
| Cl.24.1.6 of IS 302-1:2008(Components) |
- |
1000 |
|
20% discount to BIS |
| Cl.24.2 of IS 302-1:2008(Components) |
- |
1000 |
|
20% discount to BIS |
| Cl.24.3 of IS 302-1:2008(Components) |
- |
1000 |
|
20% discount to BIS |
| Cl.24.4 of IS 302-1:2008(Components) |
- |
1000 |
|
20% discount to BIS |
| Cl.24.5 of IS 302-1:2008(Components) |
- |
1000 |
|
20% discount to BIS |
| Cl.24.6 of IS 302-1:2008(Components) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.1 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.1 -ADDITION(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.2 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.3 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.4 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.5 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.6 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.7 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.8 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.9 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.10 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.11 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.12 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.13 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.14 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.15 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.16 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.17 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.18 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.19 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.20 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.21 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.22 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.23 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.24 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.25.25 of IS 302-1:2008(Supply Connection And External Flexible Cords) |
- |
1000 |
|
20% discount to BIS |
| Cl.26.1 of IS 302-1:2008(Terminals for external conductors) |
- |
1000 |
|
20% discount to BIS |
| Cl.26.2 of IS 302-1:2008(Terminals for external conductors) |
- |
1000 |
|
20% discount to BIS |
| Cl.26.3 of IS 302-1:2008(Terminals for external conductors) |
- |
1000 |
|
20% discount to BIS |
| Cl.26.4 of IS 302-1:2008(Terminals for external conductors) |
- |
1000 |
|
20% discount to BIS |
| Cl.26.5 of IS 302-1:2008(Terminals for external conductors) |
- |
1000 |
|
20% discount to BIS |
| Cl.26.6 of IS 302-1:2008(Terminals for external conductors) |
- |
1000 |
|
20% discount to BIS |
| Cl.26.7 of IS 302-1:2008(Terminals for external conductors) |
- |
1000 |
|
20% discount to BIS |
| Cl.26.8 of IS 302-1:2008(Terminals for external conductors) |
- |
1000 |
|
20% discount to BIS |
| Cl.26.9 of IS 302-1:2008(Terminals for external conductors) |
- |
1000 |
|
20% discount to BIS |
| Cl.26.10 of IS 302-1:2008(Terminals for external conductors) |
- |
1000 |
|
20% discount to BIS |
| Cl.26.11 of IS 302-1:2008(Terminals for external conductors) |
- |
1000 |
|
20% discount to BIS |
| Cl.26.101(Terminals for external conductors) |
- |
1000 |
|
20% discount to BIS |
| Cl.26.102(Terminals for external conductors) |
- |
1000 |
|
20% discount to BIS |
| Cl.26.103(Terminals for external conductors) |
- |
1000 |
|
20% discount to BIS |
| Cl.27.1 of IS 302-1:2008(Provision For Earthing) |
- |
1000 |
|
20% discount to BIS |
| Cl.27.2 of IS 302-1:2008(Provision For Earthing) |
- |
1000 |
|
20% discount to BIS |
| Cl.27.3 of IS 302-1:2008(Provision For Earthing) |
- |
1000 |
|
20% discount to BIS |
| Cl.27.4 of IS 302-1:2008(Provision For Earthing) |
- |
1000 |
|
20% discount to BIS |
| Cl.27.5 of IS 302-1:2008(Provision For Earthing) |
- |
1000 |
|
20% discount to BIS |
| Cl.27.6 of IS 302-1:2008(Provision For Earthing) |
- |
1000 |
|
20% discount to BIS |
| Cl.28.1 of IS 302-1:2008(Screws and connections) |
- |
1000 |
|
20% discount to BIS |
| Cl.28.2 of IS 302-1:2008(Screws and connections) |
- |
1000 |
|
20% discount to BIS |
| Cl.28.3 of IS 302-1:2008(Screws and connections) |
- |
1000 |
|
20% discount to BIS |
| Cl.28.4 of IS 302-1:2008(Screws and connections) |
- |
1000 |
|
20% discount to BIS |
| CL.29.1 of IS 302-1:2008("Clearances, Creepage distances and solid
insulation") |
- |
1000 |
|
20% discount to BIS |
| CL.29 of IS 302-1:2008("Clearances, Creepage distances and solid
insulation") |
- |
1000 |
|
20% discount to BIS |
| CL.29.2 of IS 302-1:2008("Clearances, Creepage distances and solid
insulation") |
- |
1000 |
|
20% discount to BIS |
| CL.29.3 of IS 302-1:2008("Clearances, Creepage distances and solid
insulation") |
- |
1000 |
|
20% discount to BIS |
| CL.30.1 of IS 302-1:2008(Resistance to heat and fire) |
- |
1000 |
|
20% discount to BIS |
| CL.30.2 of IS 302-1:2008(Resistance to heat and fire) |
- |
1000 |
|
20% discount to BIS |
| CL.30.2.1 of IS 302-1:2008(Resistance to heat and fire) |
- |
1000 |
|
20% discount to BIS |
| CL.30.2.2 of IS 302-1:2008(Resistance to heat and fire) |
- |
1000 |
|
20% discount to BIS |
| CL.30.2.3 of IS 302-1:2008(Resistance to heat and fire) |
- |
1000 |
|
20% discount to BIS |
| CL.30.2.4 of IS 302-1:2008(Resistance to heat and fire) |
- |
1000 |
|
20% discount to BIS |
| CL.31 of IS 302-1:2008(Resistance to Rusting) |
- |
1000 |
|
20% discount to BIS |
| Cl.8.1.5 OF IS:302-1:2008(Protection Against Access to Live Parts) |
- |
1000 |
|
20% discount to BIS |
| Cl.8.2 OF IS:302-1:2008(Protection Against Access to Live Parts) |
- |
1000 |
|
20% discount to BIS |
| Cl.11.5 OF IS:302-1:2008(Heating) |
- |
1000 |
|
20% discount to BIS |
| Cl.22.48 of IS 302-1:2008(Construction) |
- |
1000 |
|
20% discount to BIS |
|
05 Aug, 2027 |
- CL.32 of IS 302-1:2008 (Radiation, toxicity and similar hazards) |
| 8250 |
Bharti Automation Pvt. Ltd.(A Testing Division), Gurugram
| 8141726
| IS 302 : Part 1 (2008) |
Safety of household and similar electrical appliances: Part 1 general requirements (Sixth Revision) |
- |
40000 View breakup
-
| Clause No. |
Exclusion |
Testing Charges (Excl. Of Taxes) |
Effective Date |
Remark |
| 4(General Requirement) |
- |
1000 |
|
20% Discount to BIS |
| 5(General conditions for tests) |
- |
1000 |
|
20% Discount to BIS |
| 6(Classification- IS 302-1) |
- |
1000 |
|
20% Discount to BIS |
| 7(Marking and instructions) |
- |
1000 |
|
20% Discount to BIS |
| 8.1.1(Protection against live parts in all positions) |
- |
1000 |
|
20% Discount to BIS |
| 8.1.2(Protection against live parts in openings) |
- |
1000 |
|
20% Discount to BIS |
| 8.1.3(Protection against live parts in visible glowing heating elements) |
- |
1000 |
|
20% Discount to BIS |
| 8.1.4(Protection against live parts against protective impedance) |
- |
1000 |
|
20% Discount to BIS |
| 10.1(Power input) |
- |
1000 |
|
20% Discount to BIS |
| 10.2(Current input) |
- |
1000 |
|
20% Discount to BIS |
| 11.1(General) |
- |
1000 |
|
20% Discount to BIS |
| 11.2(General) |
- |
1000 |
|
20% Discount to BIS |
| 11.3(Heating) |
- |
1000 |
|
20% Discount to BIS |
| 11.4(Heating appliances) |
- |
1000 |
|
20% Discount to BIS |
| 11.5(Motor-operated appliances) |
- |
1000 |
|
20% Discount to BIS |
| 11.6(Combined appliances) |
- |
1000 |
|
20% Discount to BIS |
| 11.7(Duration corresponding) |
- |
1000 |
|
20% Discount to BIS |
| 11.8(Temperature rise) |
- |
1000 |
|
20% Discount to BIS |
| 4(General requirement) |
- |
1000 |
|
20% Discount to BIS |
| 13.1(General) |
- |
1000 |
|
20% Discount to BIS |
| 13.2(Leakage current at operating temperature) |
- |
1000 |
|
20% Discount to BIS |
| 13.3(Electric Strength at operating temperature) |
- |
1000 |
|
20% Discount to BIS |
| 14(Transient Over Voltages) |
- |
1000 |
|
20% Discount to BIS |
| 15.0(General) |
- |
1000 |
|
20% Discount to BIS |
| 15.1(Ingress Protection test other than IPX0 (IP test)) |
- |
1000 |
|
20% Discount to BIS |
| 15.2(Spillage Test) |
- |
1000 |
|
20% Discount to BIS |
| 15.3(Humidity Test) |
- |
1000 |
|
20% Discount to BIS |
| 16.0(General) |
- |
1000 |
|
20% Discount to BIS |
| 16.1(General) |
- |
1000 |
|
20% Discount to BIS |
| 16.2(Leakage Current (after Clause 15)) |
- |
1000 |
|
20% Discount to BIS |
| 16.3(Electric Strength (after clause 15 and 16.2)) |
- |
1000 |
|
20% Discount to BIS |
| 17(Over Load Protection of Transformers and associated circuits) |
- |
1000 |
|
20% Discount to BIS |
| 17(Overload protection of transformers and associated circuits) |
- |
1000 |
|
20% Discount to BIS |
| 8.1.5(Live parts of built-in appliances) |
- |
1000 |
|
20% Discount to BIS |
| 19(Abnormal Operation) |
- |
1000 |
|
20% Discount to BIS |
| 19.11.4.1(Electrostatic discharges) |
- |
200 |
|
20% Discount to BIS |
| 19.11.4.2(Radiated fields) |
- |
200 |
|
20% Discount to BIS |
| 19.11.4.3(Fast transient bursts) |
- |
200 |
|
20% Discount to BIS |
| 19.11.4.4(Surge immunity test) |
- |
200 |
|
20% Discount to BIS |
| 19.11.4.6(Class 3 Voltage dips and interruptions) |
- |
200 |
|
20% Discount to BIS |
| 19.11.4.7(Harmonics) |
- |
200 |
|
20% Discount to BIS |
| 20(Stability test) |
- |
1000 |
|
20% Discount to BIS |
| 21(Mechanical Strength Test) |
- |
1000 |
|
20% Discount to BIS |
| 22(Construction verification related test) |
- |
1000 |
|
20% Discount to BIS |
| 23(General) |
- |
1000 |
|
20% Discount to BIS |
| 24(Components) |
- |
1000 |
|
20% Discount to BIS |
| 25(Supply connection and external flexible cords) |
- |
1000 |
|
20% Discount to BIS |
| 26(Terminals for external conductors) |
- |
1000 |
|
20% Discount to BIS |
| 27(Provision for earthing) |
- |
1000 |
|
20% Discount to BIS |
| 28(Screw test and connections) |
- |
1000 |
|
20% Discount to BIS |
| 29(clearance, creepage distances and solid insulation) |
- |
1000 |
|
20% Discount to BIS |
| 30.1(Ball pressure test) |
- |
1000 |
|
20% Discount to BIS |
| 30.2(Glow Wire Test) |
- |
1000 |
|
20% Discount to BIS |
| 30.2(Needle Flame Test) |
- |
1000 |
|
20% Discount to BIS |
| 31(Resistance to Rusting) |
- |
1000 |
|
20% Discount to BIS |
| 19.11.4.5(Immunity to conducted discharges) |
- |
200 |
|
20% Discount to BIS |
| 16(Leakage current and electric strength) |
- |
1000 |
|
20% Discount to BIS |
|
05 Aug, 2027 |
- 32 (Radiation Toxicity and Similar Hazards)
9 (Starting of motor operation test requirements and tests)
18 (Endurance Test requirements and tests)
18 (Endurance)
"(1)Cooking ranges, hobs, ovens and similar appliances, (2)Commercial Dispensing Appliances and Vending Machines, (3) spin extractors
(For testing charges please refer relevant Part 2 standard in LIMS)" |